* Patch by Stefan Roese, 5 Jul 2005:

Update uc100 board PHY setup
* Patch by Detlev Zundel, 30 Jun 2005:
2005-07-05 11:35:27 +00:00 · 2005-07-04 00:03:16 +00:00 · 2005-07-01 15:53:57 +00:00 · 2005-06-30 13:06:07 +00:00 · 2005-06-27 13:30:03 +00:00 · 2005-06-20 10:28:38 +00:00
1221 changed files with 178209 additions and 21567 deletions
--- a/1193
+++ b/1193
--- a/11
+++ b/11
@@ -1,3 +1,14 @@
+  NOTE! This copyright does *not* cover the so-called "standalone"
+applications that use U-Boot services by means of the jump table
+provided by U-Boot exactly for this purpose - this is merely
+considered normal use of U-Boot, and does *not* fall under the
+heading of "derived work". Also note that the GPL below is
+copyrighted by the Free Software Foundation, but the instance of code
+that it refers to (the U-Boot source code) is copyrighted by me and
+others who actually wrote it. -- Wolfgang Denk
+
+=======================================================================
+
 		    GNU GENERAL PUBLIC LICENSE
 		       Version 2, June 1991

--- a/96
+++ b/96
@@ -38,6 +38,9 @@ N: Yuli Barcohen
 E: yuli@arabellasw.com
 D: Unified support for Motorola MPC826xADS/MPC8272ADS/PQ2FADS boards.
 D: Support for Zephyr Engineering ZPC.1900 board.
+D: Support for Interphase iSPAN boards.
+D: Support for Analogue&Micro Adder boards.
+D: Support for Analogue&Micro Rattler boards.
 W: http://www.arabellasw.com

 N: Jerry van Baren
@@ -73,6 +76,12 @@ N: Oliver Brown
 E: obrown@adventnetworks.com
 D: Port to the gw8260 board

+N: Curt Brune
+E: curt@cucy.com
+D: Added support for Samsung S3C4510B CPU (ARM7tdmi based SoC)
+D: Added support for ESPD-Inc. EVB4510 Board
+W: http://www.cucy.com
+
 N: Jonathan De Bruyne
 E: jonathan.debruyne@siemens.atea.be
 D: Port to Siemens IAD210 board
@@ -198,6 +207,15 @@ N: Yoo. Jonghoon
 E: yooth@ipone.co.kr
 D: Added port to the RPXlite board

+N: Mark Jonas
+E: mark.jonas@freescale.com
+D: Support for Freescale Total5200 platform
+W: http://www.mobilegt.com/
+
+N: Sam Song
+E: samsongshu@yahoo.com.cn
+D: Port to the RPXlite_DW board
+
 N: Brad Kemp
 E: Brad.Kemp@seranoa.com
 D: Port to Windriver ppmc8260 board
@@ -206,6 +224,10 @@ N: Sangmoon Kim
 E: dogoil@etinsys.com
 D: Support for debris board

+N: Frederick W. Klatt
+E: fred.klatt@windriver.com
+D: Support for Wind River SBC8540/SBC8560 boards
+
 N: Thomas Koeller
 E: tkoeller@gmx.net
 D: Port to Motorola Sandpoint 3 (MPC8240)
@@ -219,6 +241,10 @@ N: Bernhard Kuhn
 E: bkuhn@metrowerks.com
 D Support for Coldfire CPU; Support for Motorola M5272C3 and M5282EVB boards

+N: Prakash Kumar
+E: prakash@embedx.com
+D  Support for Intrinsyc CERF PXA250 board.
+
 N: Thomas Lange
 E: thomas@corelatus.se
 D: Support for GTH and dbau1x00 boards; lots of PCMCIA fixes
@@ -228,6 +254,10 @@ E: team@leox.org
 D: Support for LEOX boards, DS164x RTC
 W: http://www.leox.org

+N: Leif Lindholm
+E: leif.lindholm@i3micro.com
+D: Support for AMD dbau1550 board.
+
 N: Stephan Linz
 E: linz@li-pro.net
 D: Support for Nios Stratix Development Kit (DK-1S10)
@@ -242,6 +272,11 @@ N: Dan Malek
 E: dan@netx4.com
 D: FADSROM, the grandfather of all of this

+N: Andrea "llandre" Marson
+E: andrea.marson@dave-tech.it
+D: Port to PPChameleonEVB board
+W: www.dave-tech.it
+
 N: Reinhard Meyer
 E: r.meyer@emk-elektronik.de
 D: Port to EMK TOP860 Module
@@ -260,7 +295,10 @@ D: Support for Samsung ARM920T SMDK2410 eval board

 N: Scott McNutt
 E: smcnutt@psyent.com
-D: Support for Altera Nios-32 CPU, for Nios Cyclone Development Kit (DK-1C20)
+D: Support for Altera Nios-32 CPU
+D: Support for Altera Nios-II CPU
+D: Support for Nios Cyclone Development Kit (DK-1C20)
+W: http://www.psyent.com

 N: Rolf Offermanns
 E: rof@sysgo.de
@@ -269,7 +307,7 @@ W: www.elinos.com

 N: Tolunay Orkun
 E: torkun@nextio.com
-D: Support for Cogent CSB272 board
+D: Support for Cogent CSB272 & CSB472 boards

 N: Keith Outwater
 E: keith_outwater@mvis.com
@@ -285,10 +323,20 @@ D: Support for 4xx SCSI, floppy, CDROM, CT69000 video, ...
 D: Support for PIP405 board
 D: Support for MIP405 board

+N: Dave Peverley
+E: dpeverley@mpc-data.co.uk
+W: http://www.mpc-data.co.uk
+D: OMAP730 P2 board support
+
 N: Bill Pitts
 E: wlp@mindspring.com
 D: BedBug embedded debugger code

+N: Daniel Poirot
+E: dan.poirot@windriver.com
+D: Support for the Wind River sbc405, sbc8240 board
+W: http://www.windriver.com
+
 N: Stefan Roese
 E: stefan.roese@esd-electronics.com
 D: IBM PPC401/403/405GP Support; Windows environment support
@@ -297,6 +345,10 @@ N: Erwin Rol
 E: erwin@muffin.org
 D: boot support for RTEMS

+N: Paul Ruhland
+E: pruhland@rochester.rr.com
+D: Port to Logic Zoom LH7A40x SDK board(s)
+
 N: Neil Russell
 E: caret@c-side.com
 D: Author of LiMon-1.4.2, which contributed some ideas
@@ -313,6 +365,19 @@ N: Robert Schwebel
 E: r.schwebel@pengutronix.de
 D: Support for csb226, logodl and innokom boards (PXA2xx)

+N: Yasushi Shoji
+E: yashi@atmark-techno.com
+D: Support for Xilinx MicroBlaze, for Atmark Techno SUZAKU FPGA board
+
+N: Kurt Stremerch
+E: kurt@exys.be
+D: Support for Exys XSEngine board
+
+N: Andrea Scian
+E: andrea.scian@dave-tech.it
+D: Port to B2 board
+W: www.dave-tech.it
+
 N: Rob Taylor
 E: robt@flyingpig.com
 D: Port to MBX860T and Sandpoint8240
@@ -329,17 +394,34 @@ N: Rune Torgersen
 E: <runet@innovsys.com>
 D: Support for Motorola MPC8266ADS board

+N: Greg Ungerer
+E: greg.ungerer@opengear.com
+D: Support for ks8695 CPU, and OpenGear cmXXXX boards
+
 N: David Updegraff
 E: dave@cray.com
 D: Port to Cray L1 board; DHCP vendor extensions

+N: Christian Vejlbo
+E: christian.vejlbo@tellabs.com
+D: FADS860T ethernet support
+
+N: Robert Whaley
+E: rwhaley@applieddata.net
+D: Port to ARM PXA27x adsvix SBC
+
 N: Martin Winistoerfer
 E: martinwinistoerfer@gmx.ch
 D: Port to MPC555/556 microcontrollers and support for cmi board

-N: Christian Vejlbo
-E: christian.vejlbo@tellabs.com
-D: FADS860T ethernet support
+N: Ming-Len Wu
+E: minglen_wu@techware.com.tw
+D: Motorola MX1ADS board support
+W: http://www.techware.com.tw/
+
+N: Xianghua Xiao
+E: x.xiao@motorola.com
+D: Support for Motorola 85xx(PowerQUICC III) chip, MPC8540ADS and MPC8560ADS boards.

 N: John Zhan
 E: zhanz@sinovee.com
@@ -349,7 +431,3 @@ N: Alex Zuepke
 E: azu@sysgo.de
 D: Overall improvements on StrongARM, ARM720TDMI; Support for Tuxscreen; initial PCMCIA support for ARM
 W: www.elinos.com
-
-N: Xianghua Xiao
-E: x.xiao@motorola.com
-D: Support for Motorola 85xx(PowerQUICC III) chip, MPC8540ADS and MPC8560ADS boards.
--- a/116
+++ b/116
@@ -25,9 +25,16 @@ Pantelis Antoniou <panto@intracom.gr>

 	NETVIA			MPC8xx

+Reinhard Arlt <reinhard.arlt@esd-electronics.com>
+
+	CPCI750			PPC750FX/GX
+
 Yuli Barcohen <yuli@arabellasw.com>

+	Adder			MPC87x/MPC852T
+	ISPAN			MPC8260
 	MPC8260ADS		MPC826x/MPC827x/MPC8280
+	Rattler			MPC8248
 	ZPC1900			MPC8265

 Jerry Van Baren <gerald.vanbaren@smiths-aerospace.com>
@@ -56,13 +63,14 @@ Torsten Demke <torsten.demke@fci.com>

 Wolfgang Denk <wd@denx.de>

+	IceCube_5100		MGT5100
+	IceCube_5200		MPC5200
+
 	AMX860			MPC860
 	ETX094			MPC850
 	FPS850L			MPC850
 	FPS860L			MPC860
 	ICU862			MPC862
-	IceCube_5100		MGT5100
-	IceCube_5200		MPC5200
 	IP860			MPC860
 	IVML24			MPC860
 	IVML24_128		MPC860
@@ -72,6 +80,7 @@ Wolfgang Denk <wd@denx.de>
 	IVMS8_256		MPC860
 	LANTEC			MPC850
 	LWMON			MPC823
+	NC650			MPC852
 	R360MPI			MPC823
 	RMU			MPC850
 	RRvision		MPC823
@@ -98,7 +107,6 @@ Wolfgang Denk <wd@denx.de>
 	TQM8255			MPC8255

 	CPU86			MPC8260
-	PM825			MPC8250
 	PM826			MPC8260
 	TQM8260			MPC8260

@@ -164,10 +172,6 @@ Sangmoon Kim <dogoil@etinsys.com>

 	debris			MPC8245

-Raghu Krishnaprasad <raghu.krishnaprasad@fci.com>
-
-	ADDERII			MPC852T
-
 Nye Liu <nyet@zumanetworks.com>

 	ZUMA			MPC7xx_74xx
@@ -184,6 +188,10 @@ Eran Man <eran@nbase.co.il>

 	EVB64260_750CX		MPC750CX

+Andrea "llandre" Marson <andrea.marson@dave-tech.it>
+
+	PPChameleonEVB	PPC405EP
+
 Reinhard Meyer <r.meyer@emk-elektronik.de>

 	TOP860			MPC860T
@@ -194,7 +202,8 @@ Scott McNutt <smcnutt@artesyncp.com>
 	EBONY			PPC440GP

 Tolunay Orkun <torkun@nextio.com>
-	csb272			PPC4xx
+	csb272			PPC405GP
+	csb472			PPC405GP

 Keith Outwater <Keith_Outwater@mvis.com>

@@ -205,25 +214,40 @@ Frank Panno <fpanno@delphintech.com>

 	ep8260			MPC8260

+Peter Pearse <peter.pearse@arm.com>
+
+	Integrator/AP		CM 926EJ-S, CM7x0T, CM9x0T
+	Integrator/CP		CM 926EJ-S  CM920T, CM940T, CM922T-XA10
+	Versatile/AB		ARM926EJ-S
+	Versatile/PB		ARM926EJ-S
+
 Denis Peter <d.peter@mpl.ch>

 	MIP405			PPC4xx
 	PIP405			PPC4xx

-Stefan Roese <stefan.roese@esd-electronics.com>
+Daniel Poirot <dan.poirot@windriver.com>
+	sbc8240			MPC8240
+	sbc405			PPC405GP
+
+Matthias Fuchs <matthias.fuchs@esd-electronics.com>

 	ADCIOP			IOP480 (PPC401)
+	APC405			PPC405GP
 	AR405			PPC405GP
 	ASH405			PPC405EP
 	CANBT			PPC405CR
 	CPCI405			PPC405GP
 	CPCI4052		PPC405GP
 	CPCI405AB		PPC405GP
+	CPCI405DT		PPC405GP
 	CPCI440			PPC440GP
 	CPCIISER4		PPC405GP
 	DASA_SIM		IOP480 (PPC401)
 	DP405			PPC405EP
 	DU405			PPC405GP
+	G2000			PPC405EP
+	HH405			PPC405EP
 	HUB405			PPC405EP
 	OCRTC			PPC405GP
 	ORSG			PPC405GP
@@ -231,6 +255,8 @@ Stefan Roese <stefan.roese@esd-electronics.com>
 	PLU405			PPC405EP
 	PMC405			PPC405GP
 	VOH405			PPC405EP
+	VOM405			PPC405EP
+	WUH405			PPC405EP

 Travis Sawyer (travis.sawyer@sandburst.com>

@@ -255,6 +281,11 @@ Rune Torgersen <runet@innovsys.com>

 	MPC8266ADS		MPC8266

+Josef Wagner <Wagner@Microsys.de>
+
+	CPC45			MPC8245
+	PM520			MPC5200
+
 Stephen Williams <steve@icarus.com>

 	JSE			PPC405GPr
@@ -263,15 +294,21 @@ John Zhan <zhanz@sinovee.com>

 	svm_sc8xx		MPC8xx

-Xianghua Xiao <x.xiao@motorola.com>
+Jon Loeliger <jdl@freescale.com>

 	MPC8540ADS		MPC8540
 	MPC8560ADS		MPC8560
+	MPC8541CDS		MPC8541
+	MPC8555CDS		MPC8555

 Dan Malek <dan@embeddededge.com>

 	STxGP3			MPC85xx

+Yusdi Santoso <yusdi_santoso@adaptec.com>
+
+	HIDDEN_DRAGON	MPC8241/MPC8245
+
 -------------------------------------------------------------------------

 Unknown / orphaned boards:
@@ -336,15 +373,30 @@ Gary Jennejohn <gj@denx.de>
 	smdk2400		ARM920T
 	trab			ARM920T

+Prakash Kumar <prakash@embedx.com>
+
+	cerf250			xscale
+
 Kshitij Gupta <kshitij@ti.com>

 	omap1510inn		ARM925T
 	omap1610inn		ARM926EJS

+Dave Peverley <dpeverley@mpc-data.co.uk>
+	omap730p2		ARM926EJS
+
 Nishant Kamat <nskamat@ti.com>

 	omap1610h2		ARM926EJS

+Rishi Bhattacharya <rishi@ti.com>
+
+	omap5912osk		ARM926EJS
+
+Richard Woodruff <r-woodruff2@ti.com>
+
+	omap2420h4		ARM1136EJS
+
 David M<>ller <d.mueller@elsoft.ch>

 	smdk2410		ARM920T
@@ -359,6 +411,16 @@ Robert Schwebel <r.schwebel@pengutronix.de>
 	csb226			xscale
 	innokom			xscale

+Andrea Scian <andrea.scian@dave-tech.it>
+
+	B2				ARM7TDMI (S3C44B0X)
+
+Greg Ungerer <greg.ungerer@opengear.com>
+
+	cm4008			ks8695p
+	cm4116			ks8695p
+	cm4148			ks8695p
+
 Alex Z<>pke <azu@sysgo.de>

 	lart			SA1100
@@ -406,6 +468,40 @@ Scott McNutt <smcnutt@psyent.com>

 	DK1C20			Nios-32

+#########################################################################
+# Nios-II Systems:							#
+#									#
+# Maintainer Name, Email Address					#
+#	Board			CPU					#
+#########################################################################
+
+Scott McNutt <smcnutt@psyent.com>
+
+	PCI5441			Nios-II
+	PK1C20			Nios-II
+
+#########################################################################
+# MicroBlaze Systems:							#
+#									#
+# Maintainer Name, Email Address					#
+#	Board			CPU					#
+#########################################################################
+
+Yasushi Shoji <yashi@atmark-techno.com>
+
+	SUZAKU			MicroBlaze
+
+#########################################################################
+# Coldfire Systems:							#
+#									#
+# Maintainer Name, Email Address					#
+#	Board			CPU					#
+#########################################################################
+
+Matthias Fuchs <matthias.fuchs@esd-electronics.com>
+
+	TASREG			MCF5249
+
 #########################################################################
 # End of MAINTAINERS list						#
 #########################################################################
--- a/137
+++ b/137
@@ -26,6 +26,7 @@ LIST_5xx="	\

 LIST_5xxx="	\
 	icecube_5100	icecube_5200	EVAL5200	PM520		\
+	Total5100	Total5200	Total5200_Rev2	TQM5200_auto	\
 "

 #########################################################################
@@ -33,22 +34,25 @@ LIST_5xxx="	\
 #########################################################################

 LIST_8xx="	\
-	AdderII		ADS860		AMX860		c2mon		\
-	CCM		cogent_mpc8xx	DUET_ADS	ESTEEM192E	\
-	ETX094		ELPT860		FADS823		FADS850SAR	\
-	FADS860T	FLAGADM		FPS850L		GEN860T		\
-	GEN860T_SC	GENIETV		GTH		hermes		\
-	IAD210		ICU862_100MHz	IP860		IVML24		\
-	IVML24_128	IVML24_256	IVMS8		IVMS8_128	\
-	IVMS8_256	KUP4K		KUP4X		LANTEC		\
-	lwmon		MBX		MBX860T		MHPC		\
-	MPC86xADS	MVS1		NETVIA		NETVIA_V2	\
-	NX823		pcu_e		QS823		QS850		\
-	QS860T		R360MPI		RBC823		rmu		\
-	RPXClassic	RPXlite		RRvision	SM850		\
-	SPD823TS	svm_sc8xx	SXNI855T	TOP860		\
-	TQM823L		TQM823L_LCD	TQM850L		TQM855L		\
-	TQM860L		v37		NETTA		NETPHONE	\
+	Adder87x	GENIETV		MBX860T		R360MPI		\
+	AdderII		GTH		MHPC		RBC823		\
+	ADS860		hermes		MPC86xADS	rmu		\
+	AMX860		IAD210		MPC885ADS	RPXClassic	\
+	c2mon		ICU862_100MHz	MVS1		RPXlite		\
+	CCM		IP860		NETPHONE	RPXlite_DW	\
+	cogent_mpc8xx	IVML24		NETTA		RRvision	\
+	ELPT860		IVML24_128	NETTA2		SM850		\
+	ESTEEM192E	IVML24_256	NETTA_ISDN	SPD823TS	\
+	ETX094		IVMS8		NETVIA		svm_sc8xx	\
+	FADS823		IVMS8_128	NETVIA_V2	SXNI855T	\
+	FADS850SAR	IVMS8_256	NX823		TOP860		\
+	FADS860T	KUP4K		pcu_e		TQM823L		\
+	FLAGADM		KUP4X		QS823		TQM823L_LCD	\
+	FPS850L		LANTEC		QS850		TQM850L		\
+	GEN860T		lwmon		QS860T		TQM855L		\
+	GEN860T_SC	MBX		quantum		TQM860L		\
+							uc100		\
+							v37		\
 "

 #########################################################################
@@ -59,13 +63,21 @@ LIST_4xx="	\
 	ADCIOP		AR405		ASH405		BUBINGA405EP	\
 	CANBT		CPCI405		CPCI4052	CPCI405AB	\
 	CPCI440		CPCIISER4	CRAYL1		csb272		\
-	DASA_SIM	DP405		DU405		EBONY		\
-	ERIC		EXBITGEN	HUB405		JSE		\
-	MIP405		MIP405T		ML2		ml300		\
-	OCOTEA		OCRTC		ORSG		PCI405		\
-	PIP405		PLU405		PMC405		PPChameleonEVB	\
-	VOH405		W7OLMC		W7OLMG		WALNUT405	\
-	XPEDITE1K							\
+	csb472		DASA_SIM	DP405		DU405		\
+	EBONY		ERIC		EXBITGEN	HUB405		\
+	JSE		MIP405		MIP405T		ML2		\
+	ml300		OCOTEA		OCRTC		ORSG		\
+	PCI405		PIP405		PLU405		PMC405		\
+	PPChameleonEVB	VOH405		W7OLMC		W7OLMG		\
+	WALNUT405	WUH405          XPEDITE1K			\
+"
+
+#########################################################################
+## MPC8220 Systems
+#########################################################################
+
+LIST_8220="	\
+	Alaska8220	Yukon8220					\
 "

 #########################################################################
@@ -74,9 +86,10 @@ LIST_4xx="	\

 LIST_824x="	\
 	A3000		BMW		CPC45		CU824		\
-	debris		eXalion		MOUSSE		MUSENKI		\
-	MVBLUE		OXC		PN62		Sandpoint8240	\
-	Sandpoint8245	SL8245		utx8245				\
+	debris		eXalion		HIDDEN_DRAGON	MOUSSE		\
+	MUSENKI		MVBLUE		OXC		PN62		\
+	Sandpoint8240	Sandpoint8245	SL8245		utx8245		\
+	sbc8240	\
 "

 #########################################################################
@@ -84,12 +97,13 @@ LIST_824x="	\
 #########################################################################

 LIST_8260="	\
-	atc		cogent_mpc8260	CPU86		ep8260		\
-	gw8260		hymod		IPHASE4539	MPC8260ADS	\
-	MPC8266ADS	MPC8272ADS	PM826		PM828		\
-	ppmc8260	PQ2FADS		RPXsuper	rsdproto	\
-	sacsng		sbc8260		SCM		TQM8260_AC	\
-	TQM8260_AD	TQM8260_AE	ZPC1900				\
+	atc		cogent_mpc8260	CPU86		CPU87		\
+	ep8260		gw8260		hymod		IPHASE4539	\
+	ISPAN		MPC8260ADS	MPC8266ADS	MPC8272ADS	\
+	PM826		PM828		ppmc8260	Rattler8248	\
+	RPXsuper	rsdproto	sacsng		sbc8260		\
+	SCM		TQM8260_AC	TQM8260_AD	TQM8260_AE	\
+	ZPC1900								\
 "

 #########################################################################
@@ -97,7 +111,9 @@ LIST_8260="	\
 #########################################################################

 LIST_85xx="	\
-	MPC8540ADS	MPC8560ADS	stxgp3				\
+	MPC8540ADS	MPC8541CDS	MPC8555CDS	MPC8560ADS	\
+	PM854		sbc8540		sbc8560		stxgp3		\
+	TQM8540								\
 "

 #########################################################################
@@ -110,12 +126,12 @@ LIST_74xx="	\
 "

 LIST_7xx="	\
-	BAB7xx		ELPPC						\
+	BAB7xx		CPCI750		ELPPC				\
 "

 LIST_ppc="${LIST_5xx}  ${LIST_5xxx}		\
 	  ${LIST_8xx}				\
-	  ${LIST_824x} ${LIST_8260} \
+	  ${LIST_8220} ${LIST_824x} ${LIST_8260} \
 	  ${LIST_85xx}				\
 	  ${LIST_4xx}				\
 	  ${LIST_74xx} ${LIST_7xx}"
@@ -130,29 +146,43 @@ LIST_SA="assabet dnp1110 gcplus lart shannon"
 ## ARM7 Systems
 #########################################################################

-LIST_ARM7="B2 ep7312 impa7"
+LIST_ARM7="B2 ep7312 evb4510 impa7 modnet50"

 #########################################################################
 ## ARM9 Systems
 #########################################################################

 LIST_ARM9="	\
-	at91rm9200dk	integratorcp	integratorap			\
-	omap1510inn	omap1610h2	omap1610inn			\
-	smdk2400	smdk2410	trab				\
-	VCMA9		versatile					\
+	at91rm9200dk	cmc_pu2		integratorcp	integratorap 	\
+	lpd7a400	mx1ads		mx1fs2		omap1510inn	\
+	omap1610h2	omap1610inn	omap730p2	scb9328		\
+	smdk2400	smdk2410	trab		VCMA9		\
+	versatile	voiceblue					\
 "

+#########################################################################
+## ARM11 Systems
+#########################################################################
+LIST_ARM11="omap2420h4"
+
 #########################################################################
 ## Xscale Systems
 #########################################################################

-LIST_pxa="cradle csb226 innokom lubbock wepep250 xm250"
+LIST_pxa="	\
+	adsvix		cerf250		cradle		csb226		\
+	innokom		lubbock		wepep250	xaeniax		\
+	xm250		xsengine							\
+"

 LIST_ixp="ixdp425"


-LIST_arm="${LIST_SA} ${LIST_ARM7} ${LIST_ARM9} ${LIST_pxa} ${LIST_ixp}"
+LIST_arm="	\
+	${LIST_SA}							\
+	${LIST_ARM7} ${LIST_ARM9} ${LIST_ARM11}				\
+	${LIST_pxa} ${LIST_ixp}						\
+"

 #########################################################################
 ## MIPS Systems
@@ -162,9 +192,9 @@ LIST_mips4kc="incaip"

 LIST_mips5kc="purple"

-LIST_au1x00="dbau1000 dbau1100 dbau1500"
+LIST_au1xx0="dbau1000 dbau1100 dbau1500 dbau1550 dbau1550_el"

-LIST_mips="${LIST_mips4kc} ${LIST_mips5kc} ${LIST_au1x00}"
+LIST_mips="${LIST_mips4kc} ${LIST_mips5kc} ${LIST_au1xx0}"

 #########################################################################
 ## i386 Systems
@@ -185,6 +215,18 @@ LIST_nios="	\
 	DK1S10 DK1S10_standard_32 DK1S10_mtx_ldk_20			\
 "

+#########################################################################
+## Nios-II Systems
+#########################################################################
+
+LIST_nios2="PCI5441 PK1C20"
+
+#########################################################################
+## MicroBlaze Systems
+#########################################################################
+
+LIST_microblaze="suzaku"
+
 #-----------------------------------------------------------------------

 #----- for now, just run PPC by default -----
@@ -207,10 +249,11 @@ build_target() {
 for arg in $@
 do
 	case "$arg" in
-	ppc|5xx|5xxx|8xx|824x|8260|85xx|4xx|7xx|74xx| \
-	arm|SA|ARM7|ARM9|pxa|ixp| \
+	ppc|5xx|5xxx|8xx|8220|824x|8260|85xx|4xx|7xx|74xx| \
+	arm|SA|ARM7|ARM9|ARM11|pxa|ixp| \
+	microblaze| \
 	mips| \
-	nios| \
+	nios|nios2| \
 	x86|I486)
 			for target in `eval echo '$LIST_'${arg}`
 			do
--- a/555
+++ b/555
@@ -1,5 +1,5 @@
 #
-# (C) Copyright 2000-2004
+# (C) Copyright 2000-2005
 # Wolfgang Denk, DENX Software Engineering, wd@denx.de.
 #
 # See file CREDITS for list of people who contributed to this
@@ -45,7 +45,7 @@ export	TOPDIR
 ifeq (include/config.mk,$(wildcard include/config.mk))
 # load ARCH, BOARD, and CPU configuration
 include include/config.mk
-export	ARCH CPU BOARD VENDOR
+export	ARCH CPU BOARD VENDOR SOC
 # load other configuration
 include $(TOPDIR)/config.mk

@@ -72,6 +72,9 @@ endif
 ifeq ($(ARCH),nios)
 CROSS_COMPILE = nios-elf-
 endif
+ifeq ($(ARCH),nios2)
+CROSS_COMPILE = nios2-elf-
+endif
 ifeq ($(ARCH),m68k)
 CROSS_COMPILE = m68k-elf-
 endif
@@ -101,9 +104,12 @@ endif
 LIBS  = lib_generic/libgeneric.a
 LIBS += board/$(BOARDDIR)/lib$(BOARD).a
 LIBS += cpu/$(CPU)/lib$(CPU).a
+ifdef SOC
+LIBS += cpu/$(CPU)/$(SOC)/lib$(SOC).a
+endif
 LIBS += lib_$(ARCH)/lib$(ARCH).a
 LIBS += fs/cramfs/libcramfs.a fs/fat/libfat.a fs/fdos/libfdos.a fs/jffs2/libjffs2.a \
-	fs/reiserfs/libreiserfs.a
+	fs/reiserfs/libreiserfs.a fs/ext2/libext2fs.a
 LIBS += net/libnet.a
 LIBS += disk/libdisk.a
 LIBS += rtc/librtc.a
@@ -115,7 +121,7 @@ LIBS += common/libcommon.a
 .PHONY : $(LIBS)

 # Add GCC lib
-PLATFORM_LIBS += --no-warn-mismatch -L $(shell dirname `$(CC) $(CFLAGS) -print-libgcc-file-name`) -lgcc
+PLATFORM_LIBS += -L $(shell dirname `$(CC) $(CFLAGS) -print-libgcc-file-name`) -lgcc


 # The "tools" are needed early, so put this first
@@ -133,6 +139,9 @@ ALL = u-boot.srec u-boot.bin System.map

 all:		$(ALL)

+u-boot.hex:	u-boot
+		$(OBJCOPY) ${OBJCFLAGS} -O ihex $< $@
+
 u-boot.srec:	u-boot
 		$(OBJCOPY) ${OBJCFLAGS} -O srec $< $@

@@ -152,7 +161,7 @@ u-boot.dis:	u-boot
 u-boot:		depend $(SUBDIRS) $(OBJS) $(LIBS) $(LDSCRIPT)
 		UNDEF_SYM=`$(OBJDUMP) -x $(LIBS) |sed  -n -e 's/.*\(__u_boot_cmd_.*\)/-u\1/p'|sort|uniq`;\
 		$(LD) $(LDFLAGS) $$UNDEF_SYM $(OBJS) \
-			--start-group $(LIBS) $(PLATFORM_LIBS) --end-group \
+			--start-group $(LIBS) --end-group $(PLATFORM_LIBS) \
 			-Map u-boot.map -o u-boot

 $(LIBS):
@@ -176,6 +185,9 @@ tags:

 etags:
 		etags -a `find $(SUBDIRS) include \
+				lib_generic board/$(BOARDDIR) cpu/$(CPU) lib_$(ARCH) \
+				fs/cramfs fs/fat fs/fdos fs/jffs2 \
+				net disk rtc dtt drivers drivers/sk98lin common \
 			\( -name CVS -prune \) -o \( -name '*.[ch]' -print \)`

 System.map:	u-boot
@@ -203,6 +215,9 @@ unconfig:
 ## MPC5xx Systems
 #########################################################################

+canmb_config:	unconfig
+	@./mkconfig -a canmb ppc mpc5xxx canmb
+
 cmi_mpc5xx_config:	unconfig
 	@./mkconfig $(@:_config=) ppc mpc5xx cmi

@@ -212,6 +227,10 @@ PATI_config:		unconfig
 #########################################################################
 ## MPC5xxx Systems
 #########################################################################
+
+hmi1001_config:         unconfig
+	@./mkconfig hmi1001 ppc mpc5xxx hmi1001
+
 Lite5200_config				\
 Lite5200_LOWBOOT_config			\
 Lite5200_LOWBOOT08_config		\
@@ -249,27 +268,106 @@ icecube_5100_config:			unconfig
 		}
 	@./mkconfig -a IceCube ppc mpc5xxx icecube

+inka4x0_config:		unconfig
+	@./mkconfig inka4x0 ppc mpc5xxx inka4x0
+
+PM520_config \
+PM520_DDR_config \
+PM520_ROMBOOT_config \
+PM520_ROMBOOT_DDR_config:	unconfig
+	@ >include/config.h
+	@[ -z "$(findstring DDR,$@)" ] || \
+		{ echo "#define CONFIG_MPC5200_DDR"	>>include/config.h ; \
+		  echo "... DDR memory revision" ; \
+		}
+	@[ -z "$(findstring ROMBOOT,$@)" ] || \
+		{ echo "#define CONFIG_BOOT_ROM" >>include/config.h ; \
+		  echo "... booting from 8-bit flash" ; \
+		}
+	@./mkconfig -a PM520 ppc mpc5xxx pm520
+
 MINI5200_config	\
 EVAL5200_config	\
 TOP5200_config:	unconfig
 	@ echo "#define CONFIG_$(@:_config=) 1"	>include/config.h
 	@./mkconfig -a TOP5200 ppc mpc5xxx top5200 emk

-PM520_config:	unconfig
-	@./mkconfig $(@:_config=) ppc mpc5xxx pm520
+Total5100_config		\
+Total5200_config		\
+Total5200_lowboot_config	\
+Total5200_Rev2_config		\
+Total5200_Rev2_lowboot_config:	unconfig
+	@ >include/config.h
+	@[ -z "$(findstring 5100,$@)" ] || \
+		{ echo "#define CONFIG_MGT5100"		>>include/config.h ; \
+		  echo "... with MGT5100 processor" ; \
+		}
+	@[ -z "$(findstring 5200,$@)" ] || \
+		{ echo "#define CONFIG_MPC5200"		>>include/config.h ; \
+		  echo "... with MPC5200 processor" ; \
+		}
+	@[ -n "$(findstring Rev,$@)" ] || \
+		{ echo "#define CONFIG_TOTAL5200_REV 1"	>>include/config.h ; \
+		  echo "... revision 1 board" ; \
+		}
+	@[ -z "$(findstring Rev2_,$@)" ] || \
+		{ echo "#define CONFIG_TOTAL5200_REV 2"	>>include/config.h ; \
+		  echo "... revision 2 board" ; \
+		}
+	@[ -z "$(findstring lowboot_,$@)" ] || \
+		{ echo "TEXT_BASE = 0xFE000000" >board/total5200/config.tmp ; \
+		  echo "... with lowboot configuration" ; \
+		}
+	@./mkconfig -a Total5200 ppc mpc5xxx total5200
+
+TQM5200_auto_config		\
+TQM5200_AA_config	\
+TQM5200_AB_config	\
+TQM5200_AC_config	\
+MiniFAP_config:	unconfig
+	@ >include/config.h
+	@[ -z "$(findstring MiniFAP,$@)" ] || \
+		{ echo "#define CONFIG_MINIFAP"	>>include/config.h ; \
+		  echo "#define CONFIG_TQM5200_AC"	>>include/config.h ; \
+		  echo "... TQM5200_AC on MiniFAP" ; \
+		}
+	@[ -z "$(findstring AA,$@)" ] || \
+		{ echo "#define CONFIG_TQM5200_AA"	>>include/config.h ; \
+		  echo "... with 4 MB Flash, 16 MB SDRAM, 32 kB EEPROM" ; \
+		}
+	@[ -z "$(findstring AB,$@)" ] || \
+		{ echo "#define CONFIG_TQM5200_AB"	>>include/config.h ; \
+		  echo "... with 64 MB Flash, 64 MB SDRAM, 32 kB EEPROM, 512 kB SRAM" ; \
+		  echo "... with Graphics Controller"; \
+		}
+	@[ -z "$(findstring AC,$@)" ] || \
+		{ echo "#define CONFIG_TQM5200_AC"	>>include/config.h ; \
+		  echo "... with 4 MB Flash, 128 MB SDRAM" ; \
+		  echo "... with Graphics Controller"; \
+		}
+	@[ -z "$(findstring auto,$@)" ] || \
+		{ echo "#define CONFIG_CS_AUTOCONF"	>>include/config.h ; \
+		  echo "... with automatic CS configuration" ; \
+		}
+	@./mkconfig -a TQM5200 ppc mpc5xxx tqm5200

 #########################################################################
 ## MPC8xx Systems
 #########################################################################

-AdderII_config:	unconfig
-	@./mkconfig $(@:_config=) ppc mpc8xx adderII
+Adder_config    \
+Adder87x_config \
+AdderII_config  \
+	:		unconfig
+	$(if $(findstring AdderII,$@), \
+	@echo "#define CONFIG_MPC852T" > include/config.h)
+	@./mkconfig -a Adder ppc mpc8xx adder

 ADS860_config     \
-DUET_ADS_config   \
 FADS823_config    \
 FADS850SAR_config \
 MPC86xADS_config  \
+MPC885ADS_config  \
 FADS860T_config:	unconfig
 	@./mkconfig $(@:_config=) ppc mpc8xx fads

@@ -417,19 +515,53 @@ NETPHONE_config:	unconfig
 		 }
 	@./mkconfig -a $(call xtract_NETPHONE,$@) ppc mpc8xx netphone

-xtract_NETTA = $(subst _ISDN,,$(subst _config,,$1))
+xtract_NETTA = $(subst _SWAPHOOK,,$(subst _6412,,$(subst _ISDN,,$(subst _config,,$1))))

+NETTA_ISDN_6412_SWAPHOOK_config \
+NETTA_ISDN_SWAPHOOK_config \
+NETTA_6412_SWAPHOOK_config \
+NETTA_SWAPHOOK_config \
+NETTA_ISDN_6412_config \
 NETTA_ISDN_config \
+NETTA_6412_config \
 NETTA_config:		unconfig
 	@ >include/config.h
-	@[ -z "$(findstring NETTA_config,$@)" ] || \
-		 { echo "#undef CONFIG_NETTA_ISDN" >>include/config.h ; \
-		 }
-	@[ -z "$(findstring NETTA_ISDN_config,$@)" ] || \
+	@[ -z "$(findstring ISDN_,$@)" ] || \
 		 { echo "#define CONFIG_NETTA_ISDN 1" >>include/config.h ; \
 		 }
+	@[ -n "$(findstring ISDN_,$@)" ] || \
+		 { echo "#undef CONFIG_NETTA_ISDN" >>include/config.h ; \
+		 }
+	@[ -z "$(findstring 6412_,$@)" ] || \
+		 { echo "#define CONFIG_NETTA_6412 1" >>include/config.h ; \
+		 }
+	@[ -n "$(findstring 6412_,$@)" ] || \
+		 { echo "#undef CONFIG_NETTA_6412" >>include/config.h ; \
+		 }
+	@[ -z "$(findstring SWAPHOOK_,$@)" ] || \
+		 { echo "#define CONFIG_NETTA_SWAPHOOK 1" >>include/config.h ; \
+		 }
+	@[ -n "$(findstring SWAPHOOK_,$@)" ] || \
+		 { echo "#undef CONFIG_NETTA_SWAPHOOK" >>include/config.h ; \
+		 }
 	@./mkconfig -a $(call xtract_NETTA,$@) ppc mpc8xx netta

+xtract_NETTA2 = $(subst _V2,,$(subst _config,,$1))
+
+NETTA2_V2_config \
+NETTA2_config:		unconfig
+	@ >include/config.h
+	@[ -z "$(findstring NETTA2_config,$@)" ] || \
+		 { echo "#define CONFIG_NETTA2_VERSION 1" >>include/config.h ; \
+		 }
+	@[ -z "$(findstring NETTA2_V2_config,$@)" ] || \
+		 { echo "#define CONFIG_NETTA2_VERSION 2" >>include/config.h ; \
+		 }
+	@./mkconfig -a $(call xtract_NETTA2,$@) ppc mpc8xx netta2
+
+NC650_config:	unconfig
+	@./mkconfig $(@:_config=) ppc mpc8xx nc650
+
 NX823_config:		unconfig
 	@./mkconfig $(@:_config=) ppc mpc8xx nx823

@@ -445,6 +577,9 @@ QS823_config:	unconfig
 QS860T_config:	unconfig
 	@./mkconfig $(@:_config=) ppc mpc8xx qs860t snmc

+quantum_config:	unconfig
+	@./mkconfig $(@:_config=) ppc mpc8xx quantum
+
 R360MPI_config:	unconfig
 	@./mkconfig $(@:_config=) ppc mpc8xx r360mpi

@@ -457,6 +592,30 @@ RPXClassic_config:	unconfig
 RPXlite_config:		unconfig
 	@./mkconfig $(@:_config=) ppc mpc8xx RPXlite

+RPXlite_DW_64_config  		\
+RPXlite_DW_LCD_config 		\
+RPXlite_DW_64_LCD_config 	\
+RPXlite_DW_NVRAM_config		\
+RPXlite_DW_NVRAM_64_config      \
+RPXlite_DW_NVRAM_LCD_config	\
+RPXlite_DW_NVRAM_64_LCD_config  \
+RPXlite_DW_config:         unconfig
+	@ >include/config.h
+	@[ -z "$(findstring _64,$@)" ] || \
+		{ echo "#define RPXlite_64MHz"		>>include/config.h ; \
+		  echo "... with 64MHz system clock ..."; \
+		}
+	@[ -z "$(findstring _LCD,$@)" ] || \
+		{ echo "#define CONFIG_LCD"          	>>include/config.h ; \
+		  echo "#define CONFIG_NEC_NL6448BC20"	>>include/config.h ; \
+		  echo "... with LCD display ..."; \
+		}
+	@[ -z "$(findstring _NVRAM,$@)" ] || \
+		{ echo "#define  CFG_ENV_IS_IN_NVRAM" 	>>include/config.h ; \
+		  echo "... with ENV in NVRAM ..."; \
+		}
+	@./mkconfig -a RPXlite_DW ppc mpc8xx RPXlite_dw
+
 rmu_config:	unconfig
 	@./mkconfig $(@:_config=) ppc mpc8xx rmu

@@ -518,6 +677,9 @@ TTTech_config:	unconfig
 	@echo "#define CONFIG_SHARP_LQ104V7DS01" >>include/config.h
 	@./mkconfig -a TQM823L ppc mpc8xx tqm8xx

+uc100_config	:	unconfig
+	@./mkconfig $(@:_config=) ppc mpc8xx uc100
+
 v37_config:	unconfig
 	@echo "#define CONFIG_LCD" >include/config.h
 	@echo "#define CONFIG_SHARP_LQ084V1DG21" >>include/config.h
@@ -531,11 +693,14 @@ wtk_config:	unconfig
 #########################################################################
 ## PPC4xx Systems
 #########################################################################
-xtract_4xx = $(subst _MODEL_BA,,$(subst _MODEL_ME,,$(subst _MODEL_HI,,$(subst _config,,$1))))
+xtract_4xx = $(subst _25,,$(subst _33,,$(subst _BA,,$(subst _ME,,$(subst _HI,,$(subst _config,,$1))))))

 ADCIOP_config:	unconfig
 	@./mkconfig $(@:_config=) ppc ppc4xx adciop esd

+APC405_config:	unconfig
+	@./mkconfig $(@:_config=) ppc ppc4xx apc405 esd
+
 AR405_config:	unconfig
 	@./mkconfig $(@:_config=) ppc ppc4xx ar405 esd

@@ -548,8 +713,24 @@ BUBINGA405EP_config:	unconfig
 CANBT_config:	unconfig
 	@./mkconfig $(@:_config=) ppc ppc4xx canbt esd

+CATcenter_config	\
+CATcenter_25_config	\
+CATcenter_33_config:	unconfig
+	@ echo "/* CATcenter uses PPChameleon Model ME */"  > include/config.h
+	@ echo "#define CONFIG_PPCHAMELEON_MODULE_MODEL 1" >> include/config.h
+	@[ -z "$(findstring _25,$@)" ] || \
+		{ echo "#define CONFIG_PPCHAMELEON_CLK_25" >>include/config.h ; \
+		  echo "SysClk = 25MHz" ; \
+		}
+	@[ -z "$(findstring _33,$@)" ] || \
+		{ echo "#define CONFIG_PPCHAMELEON_CLK_33" >>include/config.h ; \
+		  echo "SysClk = 33MHz" ; \
+		}
+	@./mkconfig -a $(call xtract_4xx,$@) ppc ppc4xx PPChameleonEVB dave
+
 CPCI405_config	\
 CPCI4052_config	\
+CPCI405DT_config	\
 CPCI405AB_config:	unconfig
 	@./mkconfig $(@:_config=) ppc ppc4xx cpci405 esd
 	@echo "BOARD_REVISION = $(@:_config=)"	>>include/config.mk
@@ -566,6 +747,9 @@ CRAYL1_config:	unconfig
 csb272_config:	unconfig
 	@./mkconfig $(@:_config=) ppc ppc4xx csb272

+csb472_config:	unconfig
+	@./mkconfig $(@:_config=) ppc ppc4xx csb472
+
 DASA_SIM_config: unconfig
 	@./mkconfig $(@:_config=) ppc ppc4xx dasa_sim esd

@@ -584,6 +768,12 @@ ERIC_config:	unconfig
 EXBITGEN_config:	unconfig
 	@./mkconfig $(@:_config=) ppc ppc4xx exbitgen

+G2000_config:	unconfig
+	@./mkconfig $(@:_config=) ppc ppc4xx g2000
+
+HH405_config:	unconfig
+	@./mkconfig $(@:_config=) ppc ppc4xx hh405 esd
+
 HUB405_config:	unconfig
 	@./mkconfig $(@:_config=) ppc ppc4xx hub405 esd

@@ -623,28 +813,45 @@ PLU405_config:	unconfig
 PMC405_config:	unconfig
 	@./mkconfig $(@:_config=) ppc ppc4xx pmc405 esd

-PPChameleonEVB_MODEL_BA_config	\
-PPChameleonEVB_MODEL_ME_config	\
-PPChameleonEVB_MODEL_HI_config	\
-PPChameleonEVB_config:	unconfig
+PPChameleonEVB_config		\
+PPChameleonEVB_BA_25_config	\
+PPChameleonEVB_ME_25_config	\
+PPChameleonEVB_HI_25_config	\
+PPChameleonEVB_BA_33_config	\
+PPChameleonEVB_ME_33_config	\
+PPChameleonEVB_HI_33_config:	unconfig
 	@ >include/config.h
-	@[ -z "$(findstring _MODEL_BA,$@)" ] || \
+	@[ -z "$(findstring EVB_BA,$@)" ] || \
 		{ echo "#define CONFIG_PPCHAMELEON_MODULE_MODEL 0" >>include/config.h ; \
 		  echo "... BASIC model" ; \
 		}
-	@[ -z "$(findstring _MODEL_ME,$@)" ] || \
+	@[ -z "$(findstring EVB_ME,$@)" ] || \
 		{ echo "#define CONFIG_PPCHAMELEON_MODULE_MODEL 1" >>include/config.h ; \
 		  echo "... MEDIUM model" ; \
 		}
-	@[ -z "$(findstring _MODEL_HI,$@)" ] || \
+	@[ -z "$(findstring EVB_HI,$@)" ] || \
 		{ echo "#define CONFIG_PPCHAMELEON_MODULE_MODEL 2" >>include/config.h ; \
 		  echo "... HIGH-END model" ; \
 		}
+	@[ -z "$(findstring _25,$@)" ] || \
+		{ echo "#define CONFIG_PPCHAMELEON_CLK_25" >>include/config.h ; \
+		  echo "SysClk = 25MHz" ; \
+		}
+	@[ -z "$(findstring _33,$@)" ] || \
+		{ echo "#define CONFIG_PPCHAMELEON_CLK_33" >>include/config.h ; \
+		  echo "SysClk = 33MHz" ; \
+		}
 	@./mkconfig -a $(call xtract_4xx,$@) ppc ppc4xx PPChameleonEVB dave

+sbc405_config:	unconfig
+	@./mkconfig $(@:_config=) ppc ppc4xx sbc405
+
 VOH405_config:	unconfig
 	@./mkconfig $(@:_config=) ppc ppc4xx voh405 esd

+VOM405_config:	unconfig
+	@./mkconfig $(@:_config=) ppc ppc4xx vom405 esd
+
 W7OLMC_config	\
 W7OLMG_config: unconfig
 	@./mkconfig $(@:_config=) ppc ppc4xx w7o
@@ -652,9 +859,24 @@ W7OLMG_config: unconfig
 WALNUT405_config:	unconfig
 	@./mkconfig $(@:_config=) ppc ppc4xx walnut405

+WUH405_config:	unconfig
+	@./mkconfig $(@:_config=) ppc ppc4xx wuh405 esd
+
 XPEDITE1K_config:	unconfig
 	@./mkconfig $(@:_config=) ppc ppc4xx xpedite1k

+#########################################################################
+## MPC8220 Systems
+#########################################################################
+Alaska8220_config:	unconfig
+	@./mkconfig $(@:_config=) ppc mpc8220 alaska
+
+sorcery_config:		unconfig
+	@./mkconfig $(@:_config=) ppc mpc8220 sorcery
+
+Yukon8220_config:	unconfig
+	@./mkconfig $(@:_config=) ppc mpc8220 yukon
+
 #########################################################################
 ## MPC824x Systems
 #########################################################################
@@ -688,6 +910,9 @@ debris_config: unconfig
 eXalion_config: unconfig
 	@./mkconfig $(@:_config=) ppc mpc824x eXalion

+HIDDEN_DRAGON_config: unconfig
+	@./mkconfig $(@:_config=) ppc mpc824x hidden_dragon
+
 MOUSSE_config: unconfig
 	@./mkconfig $(@:_config=) ppc mpc824x mousse

@@ -709,12 +934,18 @@ Sandpoint8240_config: unconfig
 Sandpoint8245_config: unconfig
 	@./mkconfig $(@:_config=) ppc mpc824x sandpoint

+sbc8240_config: unconfig
+	@./mkconfig $(@:_config=) ppc mpc824x sbc8240
+
 SL8245_config: unconfig
 	@./mkconfig $(@:_config=) ppc mpc824x sl8245

 utx8245_config: unconfig
 	@./mkconfig $(@:_config=) ppc mpc824x utx8245

+cobra5272_config :		unconfig
+	@./mkconfig $(@:_config=) m68k mcf52x2 cobra5272
+
 #########################################################################
 ## MPC8260 Systems
 #########################################################################
@@ -738,6 +969,19 @@ CPU86_ROMBOOT_config: unconfig
 	fi; \
 	echo "export CONFIG_BOOT_ROM" >> config.mk;

+CPU87_config	\
+CPU87_ROMBOOT_config: unconfig
+	@./mkconfig $(call xtract_82xx,$@) ppc mpc8260 cpu87
+	@cd ./include ;				\
+	if [ "$(findstring _ROMBOOT_,$@)" ] ; then \
+		echo "CONFIG_BOOT_ROM = y" >> config.mk ; \
+		echo "... booting from 8-bit flash" ; \
+	else \
+		echo "CONFIG_BOOT_ROM = n" >> config.mk ; \
+		echo "... booting from 64-bit flash" ; \
+	fi; \
+	echo "export CONFIG_BOOT_ROM" >> config.mk;
+
 ep8260_config:	unconfig
 	@./mkconfig $(@:_config=) ppc mpc8260 ep8260

@@ -747,17 +991,35 @@ gw8260_config:	unconfig
 hymod_config:	unconfig
 	@./mkconfig $(@:_config=) ppc mpc8260 hymod

+IDS8247_config:	unconfig
+	@./mkconfig $(@:_config=) ppc mpc8260 ids8247
+
 IPHASE4539_config:	unconfig
 	@./mkconfig $(@:_config=) ppc mpc8260 iphase4539

+ISPAN_config		\
+ISPAN_REVB_config:	unconfig
+	@if [ "$(findstring _REVB_,$@)" ] ; then \
+		echo "#define CFG_REV_B" > include/config.h ; \
+	fi
+	@./mkconfig -a ISPAN ppc mpc8260 ispan
+
 MPC8260ADS_config	\
+MPC8260ADS_lowboot_config	\
 MPC8260ADS_33MHz_config	\
+MPC8260ADS_33MHz_lowboot_config	\
 MPC8260ADS_40MHz_config	\
+MPC8260ADS_40MHz_lowboot_config	\
 MPC8272ADS_config	\
+MPC8272ADS_lowboot_config	\
 PQ2FADS_config		\
+PQ2FADS_lowboot_config		\
 PQ2FADS-VR_config	\
+PQ2FADS-VR_lowboot_config	\
 PQ2FADS-ZU_config	\
+PQ2FADS-ZU_lowboot_config	\
 PQ2FADS-ZU_66MHz_config	\
+PQ2FADS-ZU_66MHz_lowboot_config	\
 	:		unconfig
 	$(if $(findstring PQ2FADS,$@), \
 	@echo "#define CONFIG_ADSTYPE CFG_PQ2FADS" > include/config.h, \
@@ -766,6 +1028,10 @@ PQ2FADS-ZU_66MHz_config	\
 	@echo "#define CONFIG_8260_CLKIN" $(subst MHz,,$(word 2,$(subst _, ,$@)))"000000" >> include/config.h, \
 	$(if $(findstring VR,$@), \
 	@echo "#define CONFIG_8260_CLKIN 66000000" >> include/config.h))
+	@[ -z "$(findstring lowboot_,$@)" ] || \
+		{ echo "TEXT_BASE = 0xFF800000" >board/mpc8260ads/config.tmp ; \
+		  echo "... with lowboot configuration" ; \
+		}
 	@./mkconfig -a MPC8260ADS ppc mpc8260 mpc8260ads

 MPC8266ADS_config:	unconfig
@@ -825,6 +1091,12 @@ PM828_ROMBOOT_PCI_config:	unconfig
 ppmc8260_config:	unconfig
 	@./mkconfig $(@:_config=) ppc mpc8260 ppmc8260

+Rattler8248_config	\
+Rattler_config:		unconfig
+	$(if $(findstring 8248,$@), \
+	@echo "#define CONFIG_MPC8248" > include/config.h)
+	@./mkconfig -a Rattler ppc mpc8260 rattler
+
 RPXsuper_config:	unconfig
 	@./mkconfig $(@:_config=) ppc mpc8260 rpxsuper

@@ -884,6 +1156,11 @@ TQM8265_AA_config:  unconfig
 	fi
 	@./mkconfig -a TQM8260 ppc mpc8260 tqm8260

+VoVPN-GW_66MHz_config	\
+VoVPN-GW_100MHz_config:		unconfig
+	@echo "#define CONFIG_CLKIN_$(word 2,$(subst _, ,$@))" > include/config.h
+	@./mkconfig -a VoVPN-GW ppc mpc8260 vovpn-gw funkwerk
+
 ZPC1900_config: unconfig
 	@./mkconfig $(@:_config=) ppc mpc8260 zpc1900

@@ -900,6 +1177,9 @@ M5272C3_config :		unconfig
 M5282EVB_config :		unconfig
 	@./mkconfig $(@:_config=) m68k mcf52x2 m5282evb

+TASREG_config :		unconfig
+	@./mkconfig $(@:_config=) m68k mcf52x2 tasreg esd
+
 #########################################################################
 ## MPC85xx Systems
 #########################################################################
@@ -910,9 +1190,48 @@ MPC8540ADS_config:      unconfig
 MPC8560ADS_config:	unconfig
 	@./mkconfig $(@:_config=) ppc mpc85xx mpc8560ads

+MPC8541CDS_config:	unconfig
+	@./mkconfig $(@:_config=) ppc mpc85xx mpc8541cds cds
+
+MPC8555CDS_config:	unconfig
+	@./mkconfig $(@:_config=) ppc mpc85xx mpc8555cds cds
+
+PM854_config:	unconfig
+	@./mkconfig $(@:_config=) ppc mpc85xx pm854
+
+sbc8540_config \
+sbc8540_33_config \
+sbc8540_66_config:	unconfig
+	@if [ "$(findstring _66_,$@)" ] ; then \
+		echo "#define CONFIG_PCI_66"	>>include/config.h ; \
+		echo "... 66 MHz PCI" ; \
+	else \
+		>include/config.h ; \
+		echo "... 33 MHz PCI" ; \
+	fi
+	@./mkconfig -a SBC8540 ppc mpc85xx sbc8560
+
+sbc8560_config \
+sbc8560_33_config \
+sbc8560_66_config:      unconfig
+	@if [ "$(findstring _66_,$@)" ] ; then \
+		echo "#define CONFIG_PCI_66"	>>include/config.h ; \
+		echo "... 66 MHz PCI" ; \
+	else \
+		>include/config.h ; \
+		echo "... 33 MHz PCI" ; \
+	fi
+	@./mkconfig -a sbc8560 ppc mpc85xx sbc8560
+
 stxgp3_config:		unconfig
 	@./mkconfig $(@:_config=) ppc mpc85xx stxgp3

+TQM8540_config:      unconfig
+	@./mkconfig $(@:_config=) ppc mpc85xx tqm8540
+
+TQM8560_config:      unconfig
+	@./mkconfig $(@:_config=) ppc mpc85xx tqm8560
+
 #########################################################################
 ## 74xx/7xx Systems
 #########################################################################
@@ -923,6 +1242,9 @@ AmigaOneG3SE_config:	unconfig
 BAB7xx_config: unconfig
 	@./mkconfig $(@:_config=) ppc 74xx_7xx bab7xx eltec

+CPCI750_config:        unconfig
+	@./mkconfig CPCI750 ppc 74xx_7xx cpci750 esd
+
 DB64360_config:  unconfig
 	@./mkconfig DB64360 ppc 74xx_7xx db64360 Marvell

@@ -974,29 +1296,61 @@ shannon_config	:	unconfig

 xtract_trab = $(subst _bigram,,$(subst _bigflash,,$(subst _old,,$(subst _config,,$1))))

-xtract_omap1610xxx = $(subst _cs0boot,,$(subst _cs3boot,, $(subst _config,,$1)))
+xtract_omap1610xxx = $(subst _cs0boot,,$(subst _cs3boot,,$(subst _cs_autoboot,,$(subst _config,,$1))))

-SX1_config :		unconfig
-	@./mkconfig $(@:_config=) arm arm925t sx1
+xtract_omap730p2 = $(subst _cs0boot,,$(subst _cs3boot,, $(subst _config,,$1)))

-integratorcp_config :	unconfig
-	@./mkconfig $(@:_config=) arm arm926ejs integratorcp
+at91rm9200dk_config	:	unconfig
+	@./mkconfig $(@:_config=) arm arm920t at91rm9200dk NULL at91rm9200
+
+cmc_pu2_config	:	unconfig
+	@./mkconfig $(@:_config=) arm arm920t cmc_pu2 NULL at91rm9200

 integratorap_config :	unconfig
 	@./mkconfig $(@:_config=) arm arm926ejs integratorap

-versatile_config :	unconfig
-	@./mkconfig $(@:_config=) arm arm926ejs versatile
+integratorcp_config :	unconfig
+	@./mkconfig $(@:_config=) arm arm926ejs integratorcp
+
+lpd7a400_config \
+lpd7a404_config:	unconfig
+	@./mkconfig $(@:_config=) arm lh7a40x lpd7a40x
+
+mx1ads_config	:	unconfig
+	@./mkconfig $(@:_config=) arm arm920t mx1ads NULL imx
+
+mx1fs2_config	:	unconfig
+	@./mkconfig $(@:_config=) arm arm920t mx1fs2 NULL imx

 omap1510inn_config :	unconfig
 	@./mkconfig $(@:_config=) arm arm925t omap1510inn

+omap5912osk_config :	unconfig
+	@./mkconfig $(@:_config=) arm arm926ejs omap5912osk
+
 omap1610inn_config \
 omap1610inn_cs0boot_config \
 omap1610inn_cs3boot_config \
+omap1610inn_cs_autoboot_config \
 omap1610h2_config \
 omap1610h2_cs0boot_config \
-omap1610h2_cs3boot_config :	unconfig
+omap1610h2_cs3boot_config \
+omap1610h2_cs_autoboot_config:	unconfig
+	@if [ "$(findstring _cs0boot_, $@)" ] ; then \
+		echo "#define CONFIG_CS0_BOOT" >> ./include/config.h ; \
+		echo "... configured for CS0 boot"; \
+	elif [ "$(findstring _cs_autoboot_, $@)" ] ; then \
+		echo "#define CONFIG_CS_AUTOBOOT" >> ./include/config.h ; \
+		echo "... configured for CS_AUTO boot"; \
+	else \
+		echo "#define CONFIG_CS3_BOOT" >> ./include/config.h ; \
+		echo "... configured for CS3 boot"; \
+	fi;
+	@./mkconfig -a $(call xtract_omap1610xxx,$@) arm arm926ejs omap1610inn
+
+omap730p2_config \
+omap730p2_cs0boot_config \
+omap730p2_cs3boot_config :	unconfig
 	@if [ "$(findstring _cs0boot_, $@)" ] ; then \
 		echo "#define CONFIG_CS0_BOOT" >> ./include/config.h ; \
 		echo "... configured for CS0 boot"; \
@@ -1004,13 +1358,19 @@ omap1610h2_cs3boot_config :	unconfig
 		echo "#define CONFIG_CS3_BOOT" >> ./include/config.h ; \
 		echo "... configured for CS3 boot"; \
 	fi;
-	@./mkconfig -a $(call xtract_omap1610xxx,$@) arm arm926ejs omap1610inn
+	@./mkconfig -a $(call xtract_omap730p2,$@) arm arm926ejs omap730p2
+
+scb9328_config	:	unconfig
+	@./mkconfig $(@:_config=) arm arm920t scb9328 NULL imx

 smdk2400_config	:	unconfig
-	@./mkconfig $(@:_config=) arm arm920t smdk2400
+	@./mkconfig $(@:_config=) arm arm920t smdk2400 NULL s3c24x0

 smdk2410_config	:	unconfig
-	@./mkconfig $(@:_config=) arm arm920t smdk2410
+	@./mkconfig $(@:_config=) arm arm920t smdk2410 NULL s3c24x0
+
+SX1_config :		unconfig
+	@./mkconfig $(@:_config=) arm arm925t sx1

 # TRAB default configuration:	8 MB Flash, 32 MB RAM
 trab_config \
@@ -1035,11 +1395,32 @@ trab_old_config:	unconfig
 		  echo "... with 8 MB Flash, 16 MB RAM" ; \
 		  echo "TEXT_BASE = 0x0CF40000" >board/trab/config.tmp ; \
 		}
-	@./mkconfig -a $(call xtract_trab,$@) arm arm920t trab
+	@./mkconfig -a $(call xtract_trab,$@) arm arm920t trab NULL s3c24x0

 VCMA9_config	:	unconfig
-	@./mkconfig $(@:_config=) arm arm920t vcma9 mpl
+	@./mkconfig $(@:_config=) arm arm920t vcma9 mpl s3c24x0

+versatile_config :	unconfig
+	@./mkconfig $(@:_config=) arm arm926ejs versatile
+
+voiceblue_smallflash_config	\
+voiceblue_config:	unconfig
+	@if [ "$(findstring _smallflash_,$@)" ] ; then \
+		echo "... boot from lower flash bank" ; \
+		echo "#define VOICEBLUE_SMALL_FLASH" >>include/config.h ; \
+		echo "VOICEBLUE_SMALL_FLASH=y" >board/voiceblue/config.tmp ; \
+	else \
+		echo "... boot from upper flash bank" ; \
+		>include/config.h ; \
+		echo "VOICEBLUE_SMALL_FLASH=n" >board/voiceblue/config.tmp ; \
+	fi
+	@./mkconfig -a voiceblue arm arm925t voiceblue
+
+cm4008_config	:	unconfig
+	@./mkconfig $(@:_config=) arm arm920t cm4008 NULL ks8695
+
+cm41xx_config	:	unconfig
+	@./mkconfig $(@:_config=) arm arm920t cm41xx NULL ks8695

 #########################################################################
 ## S3C44B0 Systems
@@ -1052,26 +1433,28 @@ B2_config	:	unconfig
 ## ARM720T Systems
 #########################################################################

-impa7_config	:	unconfig
-	@./mkconfig $(@:_config=) arm arm720t impa7
-
 ep7312_config	:	unconfig
 	@./mkconfig $(@:_config=) arm arm720t ep7312

+impa7_config	:	unconfig
+	@./mkconfig $(@:_config=) arm arm720t impa7
+
 modnet50_config :	unconfig
 	@./mkconfig $(@:_config=) arm arm720t modnet50

-#########################################################################
-## AT91RM9200 Systems
-#########################################################################
-
-at91rm9200dk_config	:	unconfig
-	@./mkconfig $(@:_config=) arm at91rm9200 at91rm9200dk
+evb4510_config :	unconfig
+	@./mkconfig $(@:_config=) arm arm720t evb4510

 #########################################################################
 ## XScale Systems
 #########################################################################

+adsvix_config	:	unconfig
+	@./mkconfig $(@:_config=) arm pxa adsvix
+
+cerf250_config :	unconfig
+	@./mkconfig $(@:_config=) arm pxa cerf250
+
 cradle_config	:	unconfig
 	@./mkconfig $(@:_config=) arm pxa cradle

@@ -1093,9 +1476,21 @@ logodl_config	:	unconfig
 wepep250_config	:	unconfig
 	@./mkconfig $(@:_config=) arm pxa wepep250

+xaeniax_config	:	unconfig
+	@./mkconfig $(@:_config=) arm pxa xaeniax
+
 xm250_config	:	unconfig
 	@./mkconfig $(@:_config=) arm pxa xm250

+xsengine_config :	unconfig
+	@./mkconfig $(@:_config=) arm pxa xsengine
+
+#########################################################################
+## ARM1136 Systems
+#########################################################################
+omap2420h4_config :    unconfig
+	@./mkconfig $(@:_config=) arm arm1136 omap2420h4
+
 #========================================================================
 # i386
 #========================================================================
@@ -1142,6 +1537,34 @@ incaip_config: unconfig
 tb0229_config: unconfig
 	@./mkconfig $(@:_config=) mips mips tb0229

+#########################################################################
+## MIPS32 AU1X00
+#########################################################################
+dbau1000_config		: 	unconfig
+	@ >include/config.h
+	@echo "#define CONFIG_DBAU1000 1" >>include/config.h
+	@./mkconfig -a dbau1x00 mips mips dbau1x00
+
+dbau1100_config		: 	unconfig
+	@ >include/config.h
+	@echo "#define CONFIG_DBAU1100 1" >>include/config.h
+	@./mkconfig -a dbau1x00 mips mips dbau1x00
+
+dbau1500_config		: 	unconfig
+	@ >include/config.h
+	@echo "#define CONFIG_DBAU1500 1" >>include/config.h
+	@./mkconfig -a dbau1x00 mips mips dbau1x00
+
+dbau1550_config		:	unconfig
+	@ >include/config.h
+	@echo "#define CONFIG_DBAU1550 1" >>include/config.h
+	@./mkconfig -a dbau1x00 mips mips dbau1x00
+
+dbau1550_el_config	:	unconfig
+	@ >include/config.h
+	@echo "#define CONFIG_DBAU1550 1" >>include/config.h
+	@./mkconfig -a dbau1x00 mips mips dbau1x00 "" little
+
 #########################################################################
 ## MIPS64 5Kc
 #########################################################################
@@ -1215,6 +1638,15 @@ ADNPESC1_config: unconfig
 		}
 	@./mkconfig -a ADNPESC1 nios nios adnpesc1 ssv

+#########################################################################
+## Nios-II
+#########################################################################
+
+PK1C20_config : unconfig
+	@./mkconfig  PK1C20 nios2 nios2 pk1c20 psyent
+
+PCI5441_config : unconfig
+	@./mkconfig  PCI5441 nios2 nios2 pci5441 psyent

 #========================================================================
 # MicroBlaze
@@ -1227,24 +1659,6 @@ suzaku_config:	unconfig
 	@echo "#define CONFIG_SUZAKU 1" >> include/config.h
 	@./mkconfig -a $(@:_config=) microblaze microblaze suzaku AtmarkTechno

-#########################################################################
-## MIPS32 AU1X00
-#########################################################################
-dbau1000_config		: 	unconfig
-	@ >include/config.h
-	@echo "#define CONFIG_DBAU1000 1" >>include/config.h
-	@./mkconfig -a dbau1x00 mips mips dbau1x00
-
-dbau1100_config		: 	unconfig
-	@ >include/config.h
-	@echo "#define CONFIG_DBAU1100 1" >>include/config.h
-	@./mkconfig -a dbau1x00 mips mips dbau1x00
-
-dbau1500_config		: 	unconfig
-	@ >include/config.h
-	@echo "#define CONFIG_DBAU1500 1" >>include/config.h
-	@./mkconfig -a dbau1x00 mips mips dbau1x00
-
 #########################################################################
 #########################################################################

@@ -1255,9 +1669,10 @@ clean:
 		| xargs rm -f
 	rm -f examples/hello_world examples/timer \
 	      examples/eepro100_eeprom examples/sched \
-	      examples/mem_to_mem_idma2intr examples/82559_eeprom
+	      examples/mem_to_mem_idma2intr examples/82559_eeprom \
+	      examples/test_burst
 	rm -f tools/img2srec tools/mkimage tools/envcrc tools/gen_eth_addr
-	rm -f tools/mpc86x_clk
+	rm -f tools/mpc86x_clk tools/ncb
 	rm -f tools/easylogo/easylogo tools/bmp_logo
 	rm -f tools/gdb/astest tools/gdb/gdbcont tools/gdb/gdbsend
 	rm -f tools/env/fw_printenv tools/env/fw_setenv
@@ -1265,13 +1680,13 @@ clean:
 	rm -f board/trab/trab_fkt

 clobber:	clean
-	find . -type f \
-		\( -name .depend -o -name '*.srec' -o -name '*.bin' \) \
-		-print \
-		| xargs rm -f
+	find . -type f \( -name .depend \
+		-o -name '*.srec' -o -name '*.bin' -o -name u-boot.img \) \
+		-print0 \
+		| xargs -0 rm -f
 	rm -f $(OBJS) *.bak tags TAGS
 	rm -fr *.*~
-	rm -f u-boot u-boot.map $(ALL)
+	rm -f u-boot u-boot.map u-boot.hex $(ALL)
 	rm -f tools/crc32.c tools/environment.c tools/env/crc32.c
 	rm -f tools/inca-swap-bytes cpu/mpc824x/bedbug_603e.c
 	rm -f include/asm/proc include/asm/arch include/asm
--- a/400
+++ b/400
@@ -1,5 +1,5 @@
 #
-# (C) Copyright 2000 - 2004
+# (C) Copyright 2000 - 2005
 # Wolfgang Denk, DENX Software Engineering, wd@denx.de.
 #
 # See file CREDITS for list of people who contributed to this
@@ -25,9 +25,10 @@ Summary:
 ========

 This directory contains the source code for U-Boot, a boot loader for
-Embedded boards based on PowerPC and ARM processors, which can be
-installed in a boot ROM and used to initialize and test the hardware
-or to download and run application code.
+Embedded boards based on PowerPC, ARM, MIPS and several other
+processors, which can be installed in a boot ROM and used to
+initialize and test the hardware or to download and run application
+code.

 The development of U-Boot is closely related to Linux: some parts of
 the source code originate in the Linux source tree, we have some
@@ -122,23 +123,28 @@ Directory Hierarchy:
 - board		Board dependent files
 - common	Misc architecture independent functions
 - cpu		CPU specific files
-  - 74xx_7xx	Files specific to Motorola MPC74xx and 7xx CPUs
+  - 74xx_7xx	Files specific to Freescale MPC74xx and 7xx CPUs
  - arm720t	Files specific to ARM 720 CPUs
  - arm920t	Files specific to ARM 920 CPUs
+    - at91rm9200 Files specific to Atmel AT91RM9200 CPU
+    - imx	Files specific to Freescale MC9328 i.MX CPUs
+    - s3c24x0	Files specific to Samsung S3C24X0 CPUs
  - arm925t	Files specific to ARM 925 CPUs
  - arm926ejs	Files specific to ARM 926 CPUs
-  - at91rm9200	Files specific to Atmel AT91RM9200 CPUs
+  - arm1136	Files specific to ARM 1136 CPUs
  - i386	Files specific to i386 CPUs
  - ixp		Files specific to Intel XScale IXP CPUs
-  - mcf52x2	Files specific to Motorola ColdFire MCF52x2 CPUs
+  - mcf52x2	Files specific to Freescale ColdFire MCF52x2 CPUs
  - mips	Files specific to MIPS CPUs
-  - mpc5xx	Files specific to Motorola MPC5xx  CPUs
-  - mpc5xxx	Files specific to Motorola MPC5xxx CPUs
-  - mpc8xx	Files specific to Motorola MPC8xx  CPUs
-  - mpc824x	Files specific to Motorola MPC824x CPUs
-  - mpc8260	Files specific to Motorola MPC8260 CPUs
-  - mpc85xx	Files specific to Motorola MPC85xx CPUs
+  - mpc5xx	Files specific to Freescale MPC5xx  CPUs
+  - mpc5xxx	Files specific to Freescale MPC5xxx CPUs
+  - mpc8xx	Files specific to Freescale MPC8xx  CPUs
+  - mpc8220	Files specific to Freescale MPC8220 CPUs
+  - mpc824x	Files specific to Freescale MPC824x CPUs
+  - mpc8260	Files specific to Freescale MPC8260 CPUs
+  - mpc85xx	Files specific to Freescale MPC85xx CPUs
  - nios	Files specific to Altera NIOS CPUs
+  - nios2	Files specific to Altera Nios-II CPUs
  - ppc4xx	Files specific to IBM PowerPC 4xx CPUs
  - pxa		Files specific to Intel XScale PXA CPUs
  - s3c44b0	Files specific to Samsung S3C44B0 CPUs
@@ -225,6 +231,7 @@ The following options need to be configured:
 		-------------------
 		CONFIG_MPC823,	CONFIG_MPC850,	CONFIG_MPC855,	CONFIG_MPC860
 	or	CONFIG_MPC5xx
+	or	CONFIG_MPC8220
 	or	CONFIG_MPC824X, CONFIG_MPC8260
 	or	CONFIG_MPC85xx
 	or	CONFIG_IOP480
@@ -242,7 +249,11 @@ The following options need to be configured:

 		MicroBlaze based CPUs:
 		----------------------
-		CONFIG_MICROBLZE
+		CONFIG_MICROBLAZE
+
+		Nios-2 based CPUs:
+		----------------------
+		CONFIG_NIOS2


 - Board Type:	Define exactly one of
@@ -250,57 +261,65 @@ The following options need to be configured:
 		PowerPC based boards:
 		---------------------

-		CONFIG_ADCIOP,		CONFIG_ADS860,		CONFIG_AMX860,
-		CONFIG_AR405,		CONFIG_BAB7xx,		CONFIG_c2mon,
-		CONFIG_CANBT,		CONFIG_CCM,		CONFIG_CMI,
-		CONFIG_cogent_mpc8260,	CONFIG_cogent_mpc8xx,	CONFIG_CPCI405,
-		CONFIG_CPCI4052,	CONFIG_CPCIISER4,	CONFIG_CPU86,
-		CONFIG_CRAYL1,		CONFIG_CU824,		CONFIG_DASA_SIM,
-		CONFIG_DB64360,		CONFIG_DB64460,		CONFIG_DU405,
-		CONFIG_DUET_ADS,	CONFIG_EBONY,		CONFIG_ELPPC,
-		CONFIG_ELPT860,		CONFIG_ep8260,		CONFIG_ERIC,
-		CONFIG_ESTEEM192E,	CONFIG_ETX094,		CONFIG_EVB64260,
-		CONFIG_FADS823,		CONFIG_FADS850SAR,	CONFIG_FADS860T,
-		CONFIG_FLAGADM,		CONFIG_FPS850L,		CONFIG_FPS860L,
-		CONFIG_GEN860T,		CONFIG_GENIETV,		CONFIG_GTH,
-		CONFIG_gw8260,		CONFIG_hermes,		CONFIG_hymod,
-		CONFIG_IAD210,		CONFIG_ICU862,		CONFIG_IP860,
-		CONFIG_IPHASE4539,	CONFIG_IVML24,		CONFIG_IVML24_128,
-		CONFIG_IVML24_256,	CONFIG_IVMS8,		CONFIG_IVMS8_128,
-		CONFIG_IVMS8_256,	CONFIG_JSE,		CONFIG_LANTEC,
-		CONFIG_lwmon,		CONFIG_MBX,		CONFIG_MBX860T,
-		CONFIG_MHPC,		CONFIG_MIP405,		CONFIG_MOUSSE,
-		CONFIG_MPC8260ADS,	CONFIG_MPC8540ADS,	CONFIG_MPC8560ADS,
-		CONFIG_MUSENKI,		CONFIG_MVS1,		CONFIG_NETPHONE,
-		CONFIG_NETTA,		CONFIG_NETVIA,		CONFIG_NX823,
-		CONFIG_OCRTC,		CONFIG_ORSG,		CONFIG_OXC,
-		CONFIG_PCI405,		CONFIG_PCIPPC2,		CONFIG_PCIPPC6,
-		CONFIG_pcu_e,		CONFIG_PIP405,		CONFIG_PM826,
-		CONFIG_ppmc8260,	CONFIG_QS823,		CONFIG_QS850,
-		CONFIG_QS860T,		CONFIG_RBC823,		CONFIG_RPXClassic,
-		CONFIG_RPXlite,		CONFIG_RPXsuper,	CONFIG_rsdproto,
-		CONFIG_sacsng,		CONFIG_Sandpoint8240,	CONFIG_Sandpoint8245,
-		CONFIG_sbc8260,		CONFIG_SM850,		CONFIG_SPD823TS,
-		CONFIG_STXGP3,		CONFIG_SXNI855T,	CONFIG_TQM823L,
-		CONFIG_TQM8260,		CONFIG_TQM850L,		CONFIG_TQM855L,
-		CONFIG_TQM860L,		CONFIG_TTTech,		CONFIG_UTX8245,
-		CONFIG_V37,		CONFIG_W7OLMC,		CONFIG_W7OLMG,
-		CONFIG_WALNUT405,	CONFIG_ZPC1900,		CONFIG_ZUMA,
+		CONFIG_ADCIOP		CONFIG_GEN860T		CONFIG_PCI405
+		CONFIG_ADS860		CONFIG_GENIETV		CONFIG_PCIPPC2
+		CONFIG_AMX860		CONFIG_GTH		CONFIG_PCIPPC6
+		CONFIG_AR405		CONFIG_gw8260		CONFIG_pcu_e
+		CONFIG_BAB7xx		CONFIG_hermes		CONFIG_PIP405
+		CONFIG_c2mon		CONFIG_hymod		CONFIG_PM826
+		CONFIG_CANBT		CONFIG_IAD210		CONFIG_ppmc8260
+		CONFIG_CCM		CONFIG_ICU862		CONFIG_QS823
+		CONFIG_CMI		CONFIG_IP860		CONFIG_QS850
+		CONFIG_cogent_mpc8260	CONFIG_IPHASE4539	CONFIG_QS860T
+		CONFIG_cogent_mpc8xx	CONFIG_IVML24		CONFIG_RBC823
+		CONFIG_CPCI405		CONFIG_IVML24_128	CONFIG_RPXClassic
+		CONFIG_CPCI4052		CONFIG_IVML24_256	CONFIG_RPXlite
+		CONFIG_CPCIISER4	CONFIG_IVMS8		CONFIG_RPXsuper
+		CONFIG_CPU86		CONFIG_IVMS8_128	CONFIG_rsdproto
+		CONFIG_CRAYL1		CONFIG_IVMS8_256	CONFIG_sacsng
+		CONFIG_CSB272		CONFIG_JSE		CONFIG_Sandpoint8240
+		CONFIG_CU824		CONFIG_LANTEC		CONFIG_Sandpoint8245
+		CONFIG_DASA_SIM		CONFIG_lwmon		CONFIG_sbc8260
+		CONFIG_DB64360		CONFIG_MBX		CONFIG_sbc8560
+		CONFIG_DB64460		CONFIG_MBX860T		CONFIG_SM850
+		CONFIG_DU405		CONFIG_MHPC		CONFIG_SPD823TS
+		CONFIG_DUET_ADS		CONFIG_MIP405		CONFIG_STXGP3
+		CONFIG_EBONY		CONFIG_MOUSSE		CONFIG_SXNI855T
+		CONFIG_ELPPC		CONFIG_MPC8260ADS	CONFIG_TQM823L
+		CONFIG_ELPT860		CONFIG_MPC8540ADS	CONFIG_TQM8260
+		CONFIG_ep8260		CONFIG_MPC8560ADS	CONFIG_TQM850L
+		CONFIG_ERIC		CONFIG_MUSENKI		CONFIG_TQM855L
+		CONFIG_ESTEEM192E	CONFIG_MVS1		CONFIG_TQM860L
+		CONFIG_ETX094		CONFIG_NETPHONE		CONFIG_TTTech
+		CONFIG_EVB64260		CONFIG_NETTA		CONFIG_UTX8245
+		CONFIG_FADS823		CONFIG_NETVIA		CONFIG_V37
+		CONFIG_FADS850SAR	CONFIG_NX823		CONFIG_W7OLMC
+		CONFIG_FADS860T		CONFIG_OCRTC		CONFIG_W7OLMG
+		CONFIG_FLAGADM		CONFIG_ORSG		CONFIG_WALNUT405
+		CONFIG_FPS850L		CONFIG_OXC		CONFIG_ZPC1900
+		CONFIG_FPS860L					CONFIG_ZUMA

 		ARM based boards:
 		-----------------

-		CONFIG_AT91RM9200DK,		CONFIG_DNP1110,		CONFIG_EP7312,
-		CONFIG_H2_OMAP1610,		CONFIG_HHP_CRADLE,	CONFIG_IMPA7,
-		CONFIG_INNOVATOROMAP1510,   CONFIG_INNOVATOROMAP1610,	CONFIG_LART,
-		CONFIG_LUBBOCK,			CONFIG_SHANNON,		CONFIG_SMDK2400,
-		CONFIG_SMDK2410,		CONFIG_TRAB,		CONFIG_VCMA9,
+		CONFIG_AT91RM9200DK,	CONFIG_CERF250,		CONFIG_DNP1110,
+		CONFIG_EP7312,		CONFIG_H2_OMAP1610,	CONFIG_HHP_CRADLE,
+		CONFIG_IMPA7,		CONFIG_INNOVATOROMAP1510, CONFIG_INNOVATOROMAP1610,
+		CONFIG_LART,		CONFIG_LPD7A400		CONFIG_LUBBOCK,
+		CONFIG_OSK_OMAP5912,	CONFIG_OMAP2420H4,	CONFIG_SHANNON,
+		CONFIG_P2_OMAP730,	CONFIG_SMDK2400,	CONFIG_SMDK2410,
+		CONFIG_TRAB,		CONFIG_VCMA9

 		MicroBlaze based boards:
 		------------------------

 		CONFIG_SUZAKU

+		Nios-2 based boards:
+		------------------------
+
+		CONFIG_PCI5441 CONFIG_PK1C20
+

 - CPU Module Type: (if CONFIG_COGENT is defined)
 		Define exactly one of
@@ -336,16 +355,17 @@ The following options need to be configured:
 		CONFIG_MPC8240, CONFIG_MPC8245

 - 8xx CPU Options: (if using an MPC8xx cpu)
-		Define one or more of
-		CONFIG_8xx_GCLK_FREQ	- if get_gclk_freq() cannot work
+		CONFIG_8xx_GCLK_FREQ	- deprecated: CPU clock if
+					  get_gclk_freq() cannot work
 					  e.g. if there is no 32KHz
 					  reference PIT/RTC clock
+		CONFIG_8xx_OSCLK	- PLL input clock (either EXTCLK
+					  or XTAL/EXTAL)

- 859/866 CPU options: (if using a MPC859 or MPC866 CPU):
-		CFG_866_OSCCLK
-		CFG_866_CPUCLK_MIN
-		CFG_866_CPUCLK_MAX
-		CFG_866_CPUCLK_DEFAULT
+- 859/866/885 CPU options: (if using a MPC859 or MPC866 or MPC885 CPU):
+		CFG_8xx_CPUCLK_MIN
+		CFG_8xx_CPUCLK_MAX
+		CONFIG_8xx_CPUCLK_DEFAULT
 			See doc/README.MPC866

 		CFG_MEASURE_CPUCLK
@@ -355,7 +375,7 @@ The following options need to be configured:
 		values. Mostly useful for board bringup to make sure
 		the PLL is locked at the intended frequency. Note
 		that this requires a (stable) reference clock (32 kHz
-		RTC clock),
+		RTC clock or CFG_8XX_XIN)

 - Linux Kernel Interface:
 		CONFIG_CLOCKS_IN_MHZ
@@ -377,6 +397,27 @@ The following options need to be configured:
 		expect it to be in bytes, others in MB.
 		Define CONFIG_MEMSIZE_IN_BYTES to make it in bytes.

+- Serial Ports:
+		CFG_PL010_SERIAL
+
+		Define this if you want support for Amba PrimeCell PL010 UARTs.
+
+		CFG_PL011_SERIAL
+
+		Define this if you want support for Amba PrimeCell PL011 UARTs.
+
+		CONFIG_PL011_CLOCK
+
+		If you have Amba PrimeCell PL011 UARTs, set this variable to
+		the clock speed of the UARTs.
+
+		CONFIG_PL01x_PORTS
+
+		If you have Amba PrimeCell PL010 or PL011 UARTs on your board,
+		define this to a list of base addresses for each (supported)
+		port. See e.g. include/configs/versatile.h
+
+
 - Console Interface:
 		Depending on board, define exactly one serial port
 		(like CONFIG_8xx_CONS_SMC1, CONFIG_8xx_CONS_SMC2,
@@ -538,22 +579,23 @@ The following options need to be configured:
 		CFG_CMD_ASKENV	* ask for env variable
 		CFG_CMD_AUTOSCRIPT Autoscript Support
 		CFG_CMD_BDI	  bdinfo
-		CFG_CMD_BEDBUG	  Include BedBug Debugger
+		CFG_CMD_BEDBUG	* Include BedBug Debugger
 		CFG_CMD_BMP	* BMP support
+		CFG_CMD_BSP	* Board specific commands
 		CFG_CMD_BOOTD	  bootd
-		CFG_CMD_CACHE	  icache, dcache
+		CFG_CMD_CACHE	* icache, dcache
 		CFG_CMD_CONSOLE	  coninfo
 		CFG_CMD_DATE	* support for RTC, date/time...
-		CFG_CMD_DHCP	  DHCP support
+		CFG_CMD_DHCP	* DHCP support
 		CFG_CMD_DIAG	* Diagnostics
 		CFG_CMD_DOC	* Disk-On-Chip Support
-		CFG_CMD_DTT	  Digital Therm and Thermostat
+		CFG_CMD_DTT	* Digital Therm and Thermostat
 		CFG_CMD_ECHO	* echo arguments
 		CFG_CMD_EEPROM	* EEPROM read/write support
-		CFG_CMD_ELF	  bootelf, bootvx
+		CFG_CMD_ELF	* bootelf, bootvx
 		CFG_CMD_ENV	  saveenv
 		CFG_CMD_FDC	* Floppy Disk Support
-		CFG_CMD_FAT	  FAT partition support
+		CFG_CMD_FAT	* FAT partition support
 		CFG_CMD_FDOS	* Dos diskette Support
 		CFG_CMD_FLASH	  flinfo, erase, protect
 		CFG_CMD_FPGA	  FPGA device initialization support
@@ -564,16 +606,16 @@ The following options need to be configured:
 		CFG_CMD_IMLS	  List all found images
 		CFG_CMD_IMMAP	* IMMR dump support
 		CFG_CMD_IRQ	* irqinfo
-		CFG_CMD_ITEST	* Integer/string test of 2 values
+		CFG_CMD_ITEST	  Integer/string test of 2 values
 		CFG_CMD_JFFS2	* JFFS2 Support
 		CFG_CMD_KGDB	* kgdb
 		CFG_CMD_LOADB	  loadb
 		CFG_CMD_LOADS	  loads
 		CFG_CMD_MEMORY	  md, mm, nm, mw, cp, cmp, crc, base,
-				  loop, mtest
+				  loop, loopw, mtest
 		CFG_CMD_MISC	  Misc functions like sleep etc
-		CFG_CMD_MMC	  MMC memory mapped support
-		CFG_CMD_MII	  MII utility commands
+		CFG_CMD_MMC	* MMC memory mapped support
+		CFG_CMD_MII	* MII utility commands
 		CFG_CMD_NAND	* NAND support
 		CFG_CMD_NET	  bootp, tftpboot, rarpboot
 		CFG_CMD_PCI	* pciinfo
@@ -582,9 +624,10 @@ The following options need to be configured:
 		CFG_CMD_PORTIO	* Port I/O
 		CFG_CMD_REGINFO * Register dump
 		CFG_CMD_RUN	  run command in env variable
-		CFG_CMD_SAVES	  save S record dump
+		CFG_CMD_SAVES	* save S record dump
 		CFG_CMD_SCSI	* SCSI Support
 		CFG_CMD_SDRAM	* print SDRAM configuration information
+				  (requires CFG_CMD_I2C)
 		CFG_CMD_SETGETDCR Support for DCR Register access (4xx only)
 		CFG_CMD_SPI	* SPI serial bus support
 		CFG_CMD_USB	* USB support
@@ -594,13 +637,13 @@ The following options need to be configured:
 		-----------------------------------------------
 		CFG_CMD_ALL	all

-		CFG_CMD_DFL	Default configuration; at the moment
+		CONFIG_CMD_DFL	Default configuration; at the moment
 				this is includes all commands, except
 				the ones marked with "*" in the list
 				above.

 		If you don't define CONFIG_COMMANDS it defaults to
-		CFG_CMD_DFL in include/cmd_confdefs.h. A board can
+		CONFIG_CMD_DFL in include/cmd_confdefs.h. A board can
 		override the default settings in the respective
 		include file.

@@ -650,6 +693,7 @@ The following options need to be configured:
 		CONFIG_RTC_DS1337	- use Maxim, Inc. DS1337 RTC
 		CONFIG_RTC_DS1338	- use Maxim, Inc. DS1338 RTC
 		CONFIG_RTC_DS164x	- use Dallas DS164x RTC
+		CONFIG_RTC_MAX6900	- use Maxim, Inc. MAX6900 RTC

 		Note that if the RTC uses I2C, then the I2C interface
 		must also be configured. See I2C Support, below.
@@ -739,12 +783,26 @@ The following options need to be configured:
 			CONFIG_LAN91C96_USE_32_BIT
 			Define this to enable 32 bit addressing

+		CONFIG_DRIVER_SMC91111
+		Support for SMSC's LAN91C111 chip
+
+			CONFIG_SMC91111_BASE
+			Define this to hold the physical address
+			of the device (I/O space)
+
+			CONFIG_SMC_USE_32_BIT
+			Define this if data bus is 32 bits
+
+			CONFIG_SMC_USE_IOFUNCS
+			Define this to use i/o functions instead of macros
+			(some hardware wont work with macros)
+
 - USB Support:
 		At the moment only the UHCI host controller is
 		supported (PIP405, MIP405, MPC5200); define
 		CONFIG_USB_UHCI to enable it.
 		define CONFIG_USB_KEYBOARD to enable the USB Keyboard
-		end define CONFIG_USB_STORAGE to enable the USB
+		and define CONFIG_USB_STORAGE to enable the USB
 		storage devices.
 		Note:
 		Supported are USB Keyboards and USB Floppy drives
@@ -765,6 +823,24 @@ The following options need to be configured:
 		enabled with CFG_CMD_MMC. The MMC driver also works with
 		the FAT fs. This is enabled with CFG_CMD_FAT.

+- Journaling Flash filesystem support:
+		CONFIG_JFFS2_NAND, CONFIG_JFFS2_NAND_OFF, CONFIG_JFFS2_NAND_SIZE,
+		CONFIG_JFFS2_NAND_DEV
+		Define these for a default partition on a NAND device
+
+		CFG_JFFS2_FIRST_SECTOR,
+		CFG_JFFS2_FIRST_BANK, CFG_JFFS2_NUM_BANKS
+		Define these for a default partition on a NOR device
+
+		CFG_JFFS_CUSTOM_PART
+		Define this to create an own partition. You have to provide a
+		function struct part_info* jffs2_part_info(int part_num)
+
+		If you define only one JFFS2 partition you may also want to
+		#define CFG_JFFS_SINGLE_PART	1
+		to disable the command chpart. This is the default when you
+		have not defined a custom partition
+
 - Keyboard Support:
 		CONFIG_ISA_KEYBOARD

@@ -878,7 +954,7 @@ The following options need to be configured:
 		If this option is set, the environment is checked for
 		a variable "splashimage". If found, the usual display
 		of logo, copyright and system information on the LCD
-		is supressed and the BMP image at the address
+		is suppressed and the BMP image at the address
 		specified in "splashimage" is loaded instead. The
 		console is redirected to the "nulldev", too. This
 		allows for a "silent" boot where a splash screen is
@@ -895,6 +971,32 @@ The following options need to be configured:
 		the malloc area (as defined by CFG_MALLOC_LEN) should
 		be at least 4MB.

+- MII/PHY support:
+		CONFIG_PHY_ADDR
+
+		The address of PHY on MII bus.
+
+		CONFIG_PHY_CLOCK_FREQ (ppc4xx)
+
+		The clock frequency of the MII bus
+
+		CONFIG_PHY_GIGE
+
+		If this option is set, support for speed/duplex
+		detection of Gigabit PHY is included.
+
+		CONFIG_PHY_RESET_DELAY
+
+		Some PHY like Intel LXT971A need extra delay after
+		reset before any MII register access is possible.
+		For such PHY, set this option to the usec delay
+		required. (minimum 300usec for LXT971A)
+
+		CONFIG_PHY_CMD_DELAY (ppc4xx)
+
+		Some PHY like Intel LXT971A need extra delay after
+		command issued before MII status register can be read
+
 - Ethernet address:
 		CONFIG_ETHADDR
 		CONFIG_ETH2ADDR
@@ -1129,6 +1231,12 @@ The following options need to be configured:
 		custom i2c_init_board() routine in boards/xxx/board.c
 		is run early in the boot sequence.

+		CONFIG_I2CFAST (PPC405GP|PPC405EP only)
+
+		This option enables configuration of bi_iic_fast[] flags
+		in u-boot bd_info structure based on u-boot environment
+		variable "i2cfast". (see also i2cfast)
+
 - SPI Support:	CONFIG_SPI

 		Enables SPI driver (so far only tested with
@@ -1779,6 +1887,16 @@ to save the current settings.
 	  environment area within the total memory of your DataFlash placed
 	  at the specified address.

+- CFG_ENV_IS_IN_NAND:
+
+	Define this if you have a NAND device which you want to use
+	for the environment.
+
+	- CFG_ENV_OFFSET:
+	- CFG_ENV_SIZE:
+
+	  These two #defines specify the offset and size of the environment
+	  area within the first NAND device.

 - CFG_SPI_INIT_OFFSET

@@ -1861,9 +1979,9 @@ Low Level (hardware related) configuration options:
 		source code. It is used to make hardware dependant
 		initializations.

- CFG_IMMR:	Physical address of the Internal Memory Mapped
-		Register; DO NOT CHANGE! (11-4)
-		[MPC8xx systems only]
+- CFG_IMMR:	Physical address of the Internal Memory.
+		DO NOT CHANGE unless you know exactly what you're
+		doing! (11-4) [MPC8xx/82xx systems only]

 - CFG_INIT_RAM_ADDR:

@@ -1993,6 +2111,37 @@ Low Level (hardware related) configuration options:
 		and crc32 is the correct crc32 which the
 		area should have.

+- CONFIG_LOOPW
+		Add the "loopw" memory command. This only takes effect if
+		the memory commands are activated globally (CFG_CMD_MEM).
+
+- CONFIG_MX_CYCLIC
+		Add the "mdc" and "mwc" memory commands. These are cyclic
+		"md/mw" commands.
+		Examples:
+
+		=> mdc.b 10 4 500
+		This command will print 4 bytes (10,11,12,13) each 500 ms.
+
+		=> mwc.l 100 12345678 10
+		This command will write 12345678 to address 100 all 10 ms.
+
+		This only takes effect if the memory commands are activated
+		globally (CFG_CMD_MEM).
+
+- CONFIG_SKIP_LOWLEVEL_INIT
+- CONFIG_SKIP_RELOCATE_UBOOT
+
+		[ARM only] If these variables are defined, then
+		certain low level initializations (like setting up
+		the memory controller) are omitted and/or U-Boot does
+		not relocate itself into RAM.
+		Normally these variables MUST NOT be defined. The
+		only exception is when U-Boot is loaded (to RAM) by
+		some other boot loader or by a debugger which
+		performs these intializations itself.
+
+
 Building the Software:
 ======================

@@ -2020,55 +2169,45 @@ is done by typing:
 where "NAME_config" is the name of one of the existing
 configurations; the following names are supported:

-	ADCIOP_config		ADS860_config		AR405_config
-	at91rm9200dk_config	CANBT_config		cmi_mpc5xx_config
-	cogent_common_config	cogent_mpc8260_config	cogent_mpc8xx_config
-	CPCI405_config		CPCIISER4_config	CU824_config
-	DUET_ADS_config		EBONY_config		ELPT860_config
-	ESTEEM192E_config	ETX094_config		FADS823_config
-	FADS850SAR_config	FADS860T_config		FPS850L_config
-	FPS860L_config		GEN860T_config		GENIETV_config
-	GTH_config		hermes_config		hymod_config
-	IP860_config		IVML24_config		IVMS8_config
-	JSE_config		LANTEC_config		lwmon_config
-	MBX860T_config		MBX_config		MPC8260ADS_config
-	MPC8540ADS_config	MPC8560ADS_config	NETVIA_config
-	omap1510inn_config	omap1610h2_config	omap1610inn_config
-	pcu_e_config		PIP405_config		QS823_config
-	QS850_config		QS860T_config		RPXlite_config
-	RPXsuper_config		rsdproto_config		Sandpoint8240_config
-	sbc8260_config		SM850_config		SPD823TS_config
-	stxgp3_config		SXNI855T_config		TQM823L_config
-	TQM850L_config		TQM855L_config		TQM860L_config
-	WALNUT405_config	ZPC1900_config
+	ADCIOP_config		FPS860L_config		omap730p2_config
+	ADS860_config		GEN860T_config		pcu_e_config
+	Alaska8220_config
+	AR405_config		GENIETV_config		PIP405_config
+	at91rm9200dk_config	GTH_config		QS823_config
+	CANBT_config		hermes_config		QS850_config
+	cmi_mpc5xx_config	hymod_config		QS860T_config
+	cogent_common_config	IP860_config		RPXlite_config
+	cogent_mpc8260_config	IVML24_config		RPXlite_DW_config
+	cogent_mpc8xx_config	IVMS8_config		RPXsuper_config
+	CPCI405_config		JSE_config		rsdproto_config
+	CPCIISER4_config	LANTEC_config		Sandpoint8240_config
+	csb272_config		lwmon_config		sbc8260_config
+	CU824_config		MBX860T_config		sbc8560_33_config
+	DUET_ADS_config		MBX_config		sbc8560_66_config
+	EBONY_config		MPC8260ADS_config	SM850_config
+	ELPT860_config		MPC8540ADS_config	SPD823TS_config
+	ESTEEM192E_config	MPC8560ADS_config	stxgp3_config
+	ETX094_config		NETVIA_config		SXNI855T_config
+	FADS823_config		omap1510inn_config	TQM823L_config
+	FADS850SAR_config	omap1610h2_config	TQM850L_config
+	FADS860T_config		omap1610inn_config	TQM855L_config
+	FPS850L_config		omap5912osk_config	TQM860L_config
+				omap2420h4_config	WALNUT405_config
+							Yukon8220_config
+							ZPC1900_config

 Note: for some board special configuration names may exist; check if
      additional information is available from the board vendor; for
-	      instance, the TQM8xxL systems run normally at 50 MHz and use  a
-	      SCC  for	10baseT	 ethernet; there are also systems with 80 MHz
-	      CPU clock, and an optional Fast Ethernet	module	is  available
-	      for  CPU's  with FEC. You can select such additional "features"
+      instance, the TQM823L systems are available without (standard)
+      or with LCD support. You can select such additional "features"
      when chosing the configuration, i. e.

-	      make TQM860L_config
-		- will configure for a plain TQM860L, i. e. 50MHz, no FEC
-
-	      make TQM860L_FEC_config
-		- will configure for a TQM860L at 50MHz with FEC for ethernet
-
-	      make TQM860L_80MHz_config
-		- will configure for a TQM860L at 80 MHz, with normal 10baseT
-		  interface
-
-	      make TQM860L_FEC_80MHz_config
-		- will configure for a TQM860L at 80 MHz with FEC for ethernet
+      make TQM823L_config
+	- will configure for a plain TQM823L, i. e. no LCD support

      make TQM823L_LCD_config
 	- will configure for a TQM823L with U-Boot console on LCD

-	      make TQM823L_LCD_80MHz_config
-		- will configure for a TQM823L at 80 MHz with U-Boot console on LCD
-
      etc.


@@ -2177,6 +2316,7 @@ configurations; the following names are supported:
 coninfo - print console devices and informations
 ide	- IDE sub-system
 loop	- infinite loop on address range
+loopw	- infinite write loop on address range
 mtest	- simple RAM test
 icache	- enable or disable instruction cache
 dcache	- enable or disable data cache
@@ -2236,6 +2376,12 @@ configurations; the following names are supported:
 		  This can be used to load and uncompress arbitrary
 		  data.

+  i2cfast	- (PPC405GP|PPC405EP only)
+		  if set to 'y' configures Linux I2C driver for fast
+		  mode (400kHZ). This environment variable is used in
+		  initialization code. So, for changes to be effective
+		  it must be saved and board must be reset.
+
  initrd_high	- restrict positioning of initrd images:
 		  If this variable is not set, initrd images will be
 		  copied to the highest possible address in RAM; this
@@ -2569,8 +2715,9 @@ configurations; the following names are supported:
 	  -n ==> set image name to 'name'
 	  -d ==> use image data from 'datafile'

-	Right now, all Linux kernels use the same load address	(0x00000000),
-	but the entry point address depends on the kernel version:
+Right now, all Linux kernels for PowerPC systems use the same load
+address (0x00000000), but the entry point address depends on the
+kernel version:

 - 2.2.x kernels have the entry point at 0x0000000C,
 - 2.3.x and later kernels have the entry point at 0x00000000.
@@ -2934,8 +3081,7 @@ configurations; the following names are supported:
 stage-2 loader which in turn loads and then invokes the kernel
 proper. Loader sources will eventually appear in the NetBSD source
 tree (probably in sys/arc/mpc8xx/stand/u-boot_stage2/); in the
-	meantime, send mail to bruno@exet-ag.de and/or wd@denx.de for
-	details.
+meantime, see ftp://ftp.denx.de/pub/u-boot/ppcboot_stage2.tar.gz


 Implementation Internals:
@@ -3235,6 +3381,7 @@ configurations; the following names are supported:
 establish some rules. Submissions which do not conform to these rules
 may be rejected, even when they contain important and valuable stuff.

+Patches shall be sent to the u-boot-users mailing list.

 When you send a patch, please include the following information with
 it:
@@ -3292,3 +3439,6 @@ configurations; the following names are supported:
  (using #ifdef), and the resulting code with the new feature
  disabled must not need more memory than the old code without your
  modification.
+
+* Remember that there is a size limit of 40 kB per message on the
+  u-boot-users mailing list. Compression may help.
--- a/board/AtmarkTechno/suzaku/suzaku.c
+++ b/board/AtmarkTechno/suzaku/suzaku.c
@@ -22,8 +22,11 @@
 * MA 02111-1307 USA
 */

-#include <common.h>
+/* This is a board specific file.  It's OK to include board specific
+ * header files */
+#include <asm/suzaku.h>

 void do_reset(void)
 {
+	*((unsigned long *)(MICROBLAZE_SYSREG_BASE_ADDR)) = MICROBLAZE_SYSREG_RECONFIGURE;
 }
--- a/board/Marvell/common/ecctest.c
+++ b/board/Marvell/common/ecctest.c
@@ -1,5 +1,3 @@
-indent: Standard input:49: Warning:old style assignment ambiguity in "=*".  Assuming "= *"
-
 /*
 * (C) Copyright 2001
 *
--- a/board/Marvell/db64360/db64360.c
+++ b/board/Marvell/db64360/db64360.c
@@ -549,18 +549,18 @@ static void move64 (unsigned long long *src, unsigned long long *dest)
 #if defined (CFG_DRAM_TEST_DATA)

 unsigned long long pattern[] = {
-	0xaaaaaaaaaaaaaaaa,
-	0xcccccccccccccccc,
-	0xf0f0f0f0f0f0f0f0,
-	0xff00ff00ff00ff00,
-	0xffff0000ffff0000,
-	0xffffffff00000000,
-	0x00000000ffffffff,
-	0x0000ffff0000ffff,
-	0x00ff00ff00ff00ff,
-	0x0f0f0f0f0f0f0f0f,
-	0x3333333333333333,
-	0x5555555555555555
+	0xaaaaaaaaaaaaaaaaULL,
+	0xccccccccccccccccULL,
+	0xf0f0f0f0f0f0f0f0ULL,
+	0xff00ff00ff00ff00ULL,
+	0xffff0000ffff0000ULL,
+	0xffffffff00000000ULL,
+	0x00000000ffffffffULL,
+	0x0000ffff0000ffffULL,
+	0x00ff00ff00ff00ffULL,
+	0x0f0f0f0f0f0f0f0fULL,
+	0x3333333333333333ULL,
+	0x5555555555555555ULL,
 };

 /*********************************************************************/
--- a/board/Marvell/db64460/db64460.c
+++ b/board/Marvell/db64460/db64460.c
@@ -549,18 +549,18 @@ static void move64 (unsigned long long *src, unsigned long long *dest)
 #if defined (CFG_DRAM_TEST_DATA)

 unsigned long long pattern[] = {
-	0xaaaaaaaaaaaaaaaa,
-	0xcccccccccccccccc,
-	0xf0f0f0f0f0f0f0f0,
-	0xff00ff00ff00ff00,
-	0xffff0000ffff0000,
-	0xffffffff00000000,
-	0x00000000ffffffff,
-	0x0000ffff0000ffff,
-	0x00ff00ff00ff00ff,
-	0x0f0f0f0f0f0f0f0f,
-	0x3333333333333333,
-	0x5555555555555555
+	0xaaaaaaaaaaaaaaaaULL,
+	0xccccccccccccccccULL,
+	0xf0f0f0f0f0f0f0f0ULL,
+	0xff00ff00ff00ff00ULL,
+	0xffff0000ffff0000ULL,
+	0xffffffff00000000ULL,
+	0x00000000ffffffffULL,
+	0x0000ffff0000ffffULL,
+	0x00ff00ff00ff00ffULL,
+	0x0f0f0f0f0f0f0f0fULL,
+	0x3333333333333333ULL,
+	0x5555555555555555ULL,
 };

 /*********************************************************************/
--- a/board/RPXlite_dw/Makefile
+++ b/board/RPXlite_dw/Makefile
@@ -0,0 +1,40 @@
+#
+# (C) Copyright 2000-2004
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+include $(TOPDIR)/config.mk
+
+LIB	= lib$(BOARD).a
+
+OBJS	= $(BOARD).o flash.o
+
+$(LIB):	.depend $(OBJS)
+	$(AR) crv $@ $(OBJS)
+
+#########################################################################
+
+.depend:	Makefile $(SOBJS:.o=.S) $(OBJS:.o=.c)
+		$(CC) -M $(CFLAGS) $(SOBJS:.o=.S) $(OBJS:.o=.c) > $@
+
+sinclude .depend
+
+#########################################################################
--- a/board/RPXlite_dw/README
+++ b/board/RPXlite_dw/README
@@ -0,0 +1,161 @@
+
+After following the step of Yoo. Jonghoon and Wolfgang Denk,
+I ported u-boot on RPXlite DW version board: RPXlite_DW or LITE_DW.
+
+There are at least three differences between the Yoo-ported RPXlite and the RPXlite_DW.
+
+Board(in U-Boot)	version(in EmbeddedPlanet)	CPU	SDRAM	FLASH
+RPXlite				RPXlite CW		850	16MB	4MB
+RPXlite_DW		RPXlite DW(EP 823 H1 DW)	823e	64MB	16MB
+
+This fireware is specially coded for EmbeddedPlanet Co. Software Development
+Platform(RPXlite DW),which has a NEC NL6448BC20-08 LCD panel.
+
+It has the following three features:
+
+1. 64MHz/48MHz system frequence setting options.
+The default setting is 48MHz.To get a 64MHz u-boot,just add
+'64' in make command,like
+
+make distclean
+make RPXlite_DW_64_config
+make all
+
+2. CFG_ENV_IS_IN_FLASH/CFG_ENV_IS_IN_NVRAM
+
+The default environment parameter is stored in FLASH because it is a common choice for
+environment parameter.So I make NVRAM as backup parameter storeage.The reason why I
+didn't use EEPROM for ENV is that PlanetCore V2.0 use EEPROM as environment parameter
+home.Because of the possibility of using two firewares on this board,I didn't
+'disturb' EEPROM.To get NVRAM support,you may use the following build command:
+
+make distclean
+make RPXlite_DW_NVRAM_config
+make all
+
+3. LCD panel support
+
+To support the Platform better,I added LCD panel(NL6448BC20-08) function.
+For the convenience of debug, CONFIG_PERBOOT was supported. So you just
+perss ENTER if you want to get a serial console in boot downcounting.
+Then you can switch to LCD and serial console freely just typing
+'run lcd' or 'run ser'. They are only vaild when CONFIG_LCD was enabled.
+
+To get a LCD support u-boot,you can do the following:
+
+make distclean
+make RPXlite_DW_LCD_config
+make all
+
+~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+The basic make commands could be:
+
+make RPXlite_DW_config
+make RPXlite_DW_64_config
+make RPXlite_DW_LCD_config
+make RPXlite_DW_NVRAM_config
+
+BTW,you can combine the above features together and get a workable u-boot to meet your need.
+For example,to get a 64MHZ && ENV_IS_IN_FLASH && LCD panel support u-boot,you can type:
+
+make RPXlite_DW_NVRAM_64_LCD_config
+make all
+
+So other combining make commands could be:
+
+make RPXlite_DW_NVRAM_64_config
+make RPXlite_DW_NVRAM_LCD_config
+make RPXlite_DW_64_LCD_config
+
+~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+The boot process by "make RPXlite_DW_config" could be:
+
+U-Boot 1.1.2 (Aug 29 2004 - 15:11:27)
+
+CPU:   PPC823EZTnnB2 at 48 MHz: 16 kB I-Cache 8 kB D-Cache
+Board: RPXlite_DW
+DRAM:  64 MB
+FLASH: 16 MB
+*** Warning - bad CRC, using default environment
+
+In:    serial
+Out:   serial
+Err:   serial
+Net:   SCC ETHERNET
+u-boot>
+
+~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+A word on the U-Boot enviroment variable setting and usage :
+
+In the beginning, you could just need very simple defult environment variable setting,
+like[include/configs/RPXlite.h] :
+
+#define CONFIG_BOOTCOMMAND                                                      \
+	"bootp; "                                                               \
+	"setenv bootargs root=/dev/nfs rw nfsroot=$(serverip):$(rootpath) "     \
+	"ip=$(ipaddr):$(serverip):$(gatewayip):$(netmask):$(hostname)::off; "   \
+	"bootm"
+
+This is enough for kernel NFS test. But as debug process goes on, you would expect
+to save some time on environment variable setting and u-boot/kernel updating.
+So the default environment variable setting would become more complicated. Just like
+the one I did in include/configs/RPXlite_DW.h.
+
+Two u-boot commands, ku and uu, should be careful to use. They were designed to update
+kernel and u-boot image file respectively. You must tftp your image to default address
+'100000' and then use them correctly. Yeah, you can create your own command to do this
+job. :-) The example u-boot image updating process could be :
+
+u-boot>t 100000 RPXlite_DW_LCD.bin
+Using SCC ETHERNET device
+TFTP from server 172.16.115.6; our IP address is 172.16.115.7
+Filename 'RPXlite_DW_LCD.bin'.
+Load address: 0x100000
+Loading: #############################
+done
+Bytes transferred = 144700 (2353c hex)
+u-boot>run uu
+Un-Protect Flash Sectors 0-4 in Bank # 1
+Erase Flash Sectors 0-4 in Bank # 1
+.... done
+Copy to Flash... done
+ff000000: 27051956 552d426f 6f742031 2e312e32    '..VU-Boot 1.1.2
+ff000010: 20284175 67203239 20323030 34202d20     (Aug 29 2004 -
+ff000020: 31353a32 303a3238 29000000 00000000    15:20:28).......
+ff000030: 00000000 00000000 00000000 00000000    ................
+ff000040: 00000000 00000000 00000000 00000000    ................
+ff000050: 00000000 00000000 00000000 00000000    ................
+ff000060: 00000000 00000000 00000000 00000000    ................
+ff000070: 00000000 00000000 00000000 00000000    ................
+ff000080: 00000000 00000000 00000000 00000000    ................
+ff000090: 00000000 00000000 00000000 00000000    ................
+ff0000a0: 00000000 00000000 00000000 00000000    ................
+ff0000b0: 00000000 00000000 00000000 00000000    ................
+ff0000c0: 00000000 00000000 00000000 00000000    ................
+ff0000d0: 00000000 00000000 00000000 00000000    ................
+ff0000e0: 00000000 00000000 00000000 00000000    ................
+ff0000f0: 00000000 00000000 00000000 00000000    ................
+u-boot updating finished
+u-boot>
+
+Also for environment updating, 'run eu' could let you erase OLD default environment variable
+and then use the working u-boot environment setting.
+
+~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~~
+
+Finally, if you want to keep the serial port to possible debug on spot for deployment, you
+just need to enable 'DEPLOYMENT' in RPXlite_DW.h as 'DEBUG' does. Only the special string
+defined by CONFIG_AUTOBOOT_STOP_STR like 'st' can stop the autoboot.
+
+I'd like to extend my heartfelt gratitute to kind people for helping me work it out.
+I would particually thank Wolfgang Denk for his nice help.
+
+Enjoy,
+
+Sam Song, samsongshu@yahoo.com.cn
+Institute of Electrical Machinery and Controls
+Shanghai University
+
+Oct. 11, 2004
--- a/board/RPXlite_dw/RPXlite_dw.c
+++ b/board/RPXlite_dw/RPXlite_dw.c
@@ -0,0 +1,180 @@
+/*
+ * (C) Copyright 2004
+ * Sam Song, IEMC. SHU, samsongshu@yahoo.com.cn
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+/*
+ * Sam Song
+ * U-Boot port on RPXlite DW board : RPXlite_DW or LITE_DW
+ * Tested on working at 64MHz(CPU)/32MHz(BUS),48MHz/24MHz
+ * with 64MB, 2 SDRAM Micron chips,MT48LC16M16A2-75.
+ */
+
+#include <common.h>
+#include <mpc8xx.h>
+
+/* ------------------------------------------------------------------------- */
+static long int dram_size (long int, long int *, long int);
+/* ------------------------------------------------------------------------- */
+
+#define	_NOT_USED_	0xFFFFCC25
+
+const uint sdram_table[] =
+{
+	/*
+	 * Single Read. (Offset 00h in UPMA RAM)
+	 */
+	0x0F03CC04, 0x00ACCC24, 0x1FF74C20, /* last */
+	_NOT_USED_, _NOT_USED_, _NOT_USED_, _NOT_USED_,
+	_NOT_USED_,
+
+	/*
+	 * Burst Read. (Offset 08h in UPMA RAM)
+	 */
+	0x0F03CC04, 0x00ACCC24, 0x00FFCC20, 0x00FFCC20,
+	0x01FFCC20, 0x1FF74C20, /* last */
+	_NOT_USED_, _NOT_USED_, _NOT_USED_, _NOT_USED_,
+	_NOT_USED_, _NOT_USED_, _NOT_USED_, _NOT_USED_,
+	_NOT_USED_, _NOT_USED_,
+
+	/*
+	 * Single Write. (Offset 18h in UPMA RAM)
+	 */
+	0x0F03CC02, 0x00AC0C24, 0x1FF74C25, /* last */
+	_NOT_USED_, _NOT_USED_, 0x0FA00C34,0x0FFFCC35,
+	_NOT_USED_,
+
+	/*
+	 * Burst Write. (Offset 20h in UPMA RAM)
+	 */
+	0x0F03CC00, 0x00AC0C20, 0x00FFFC20, 0x00FFFC22,
+	0x01FFFC24, 0x1FF74C25, /* last */
+	_NOT_USED_, _NOT_USED_, _NOT_USED_, _NOT_USED_,
+	_NOT_USED_, _NOT_USED_, _NOT_USED_, _NOT_USED_,
+	_NOT_USED_, _NOT_USED_,
+
+	/*
+	 * Refresh. (Offset 30h in UPMA RAM)
+	 */
+	0x0FF0CC24, 0xFFFFCC24, _NOT_USED_, _NOT_USED_,
+	_NOT_USED_, _NOT_USED_, 0xEFFB8C34, 0x0FF74C34,
+	0x0FFACCB4, 0x0FF5CC34, 0x0FFFCC34, 0x0FFFCCB4,
+	/* INIT sequence RAM WORDS
+	 * SDRAM Initialization (offset 0x36 in UPMA RAM)
+	 * The above definition uses the remaining space
+	 * to establish an initialization sequence,
+	 * which is executed by a RUN command.
+	 * The sequence is COMMAND INHIBIT(NOP),Precharge,
+	 * Load Mode Register,NOP,Auto Refresh.
+	 */
+
+	/*
+	 * Exception. (Offset 3Ch in UPMA RAM)
+	 */
+	0x0FEA8C34, 0x1FB54C34, 0xFFFFCC34, _NOT_USED_
+};
+
+/*
+ * Check Board Identity:
+ */
+
+int checkboard (void)
+{
+	puts ("Board: RPXlite_DW\n") ;
+	return (0) ;
+}
+
+/* ------------------------------------------------------------------------- */
+
+long int initdram (int board_type)
+{
+	volatile immap_t     *immap  = (immap_t *)CFG_IMMR;
+	volatile memctl8xx_t *memctl = &immap->im_memctl;
+	long int size9;
+
+	upmconfig(UPMA, (uint *)sdram_table, sizeof(sdram_table)/sizeof(uint));
+
+	/* Refresh clock prescalar */
+	memctl->memc_mptpr = CFG_MPTPR ;
+
+	memctl->memc_mar  = 0x00000088;
+
+	/* Map controller banks 1 to the SDRAM bank */
+	memctl->memc_or1 = CFG_OR1_PRELIM;
+	memctl->memc_br1 = CFG_BR1_PRELIM;
+
+	memctl->memc_mamr = CFG_MAMR_9COL & (~(MAMR_PTAE)); /* no refresh yet */
+	/*Disable Periodic timer A. */
+
+ 	udelay(200);
+
+	/* perform SDRAM initializsation sequence */
+
+	memctl->memc_mcr  = 0x80002236; /* SDRAM bank 0 - refresh twice */
+
+	udelay(1);
+
+	memctl->memc_mamr |= MAMR_PTAE;	/* enable refresh */
+
+	/*Enable Periodic timer A */
+
+	udelay (1000);
+
+	 /* Check Bank 0 Memory Size
+	  * try 9 column mode
+	  */
+
+	size9 = dram_size (CFG_MAMR_9COL, (ulong *)SDRAM_BASE_PRELIM, SDRAM_MAX_SIZE);
+
+	/*
+	 * Final mapping:
+	 */
+
+	memctl->memc_or1 = ((-size9) & 0xFFFF0000) | CFG_OR_TIMING_SDRAM;
+
+	udelay (1000);
+
+	return (size9);
+}
+
+void rpxlite_init (void)
+{
+	/* Enable NVRAM */
+	*((uchar *) BCSR0) |= BCSR0_ENNVRAM;
+}
+
+/*
+ * Check memory range for valid RAM. A simple memory test determines
+ * the actually available RAM size between addresses `base' and
+ * `base + maxsize'. Some (not all) hardware errors are detected:
+ * - short between address lines
+ * - short between data lines
+ */
+static long int dram_size (long int mamr_value, long int *base,
+			   long int maxsize)
+{
+	volatile immap_t *immap = (immap_t *) CFG_IMMR;
+	volatile memctl8xx_t *memctl = &immap->im_memctl;
+
+	memctl->memc_mamr = mamr_value;
+
+	return (get_ram_size (base, maxsize));
+}
--- a/board/RPXlite_dw/config.mk
+++ b/board/RPXlite_dw/config.mk
@@ -0,0 +1,29 @@
+#
+# (C) Copyright 2004
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+# Sam Song, IEMC. SHU, samsongshu@yahoo.com.cn
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+#
+# RPXlite dw boards : lite_dw
+#
+
+TEXT_BASE = 0xff000000
--- a/board/RPXlite_dw/flash.c
+++ b/board/RPXlite_dw/flash.c
@@ -0,0 +1,490 @@
+/*
+ * (C) Copyright 2004
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+/*
+ * Yoo. Jonghoon, IPone, yooth@ipone.co.kr
+ * U-Boot port on RPXlite board
+ *
+ * Some of flash control words are modified. (from 2x16bit device
+ * to 4x8bit device)
+ * RPXLite board I tested has only 4 AM29LV800BB devices. Other devices
+ * are not tested.
+ *
+ * (?) Does an RPXLite board which
+ * 	does not use AM29LV800 flash memory exist ?
+ *	I don't know...
+ */
+
+/* Yes,Yoo.They do use other FLASH for the board.
+ *
+ * Sam Song, IEMC. SHU, samsongshu@yahoo.com.cn
+ * U-Boot port on RPXlite DW version board
+ *
+ * By now,it uses 4 AM29DL323DB90VI devices(4x8bit).
+ * The total FLASH has 16MB(4x4MB).
+ * I just made some necessary changes on the basis of Wolfgang and Yoo's job.
+ *
+ * June 8, 2004 */
+
+#include <common.h>
+#include <mpc8xx.h>
+
+flash_info_t	flash_info[CFG_MAX_FLASH_BANKS]; /* info for FLASH chips	*/
+
+/*-----------------------------------------------------------------------
+ * Functions   vu_long : volatile unsigned long IN include/common.h
+ */
+static ulong flash_get_size (vu_long *addr, flash_info_t *info);
+static int write_word (flash_info_t *info, ulong dest, ulong data);
+static void flash_get_offsets (ulong base, flash_info_t *info);
+
+unsigned long flash_init (void)
+{
+	unsigned long size_b0 ;
+	int i;
+
+	/* Init: no FLASHes known */
+	for (i=0; i<CFG_MAX_FLASH_BANKS; ++i) {
+		flash_info[i].flash_id = FLASH_UNKNOWN;
+	}
+
+	size_b0 = flash_get_size((vu_long *)CFG_FLASH_BASE, &flash_info[0]);
+	flash_get_offsets (CFG_FLASH_BASE, &flash_info[0]);
+
+#if CFG_MONITOR_BASE >= CFG_FLASH_BASE
+	/* If Monitor is in the cope of FLASH,then
+	 * protect this area by default in case for
+	 * other occupation. [SAM] */
+
+	/* monitor protection ON by default */
+	flash_protect(FLAG_PROTECT_SET,
+		      CFG_MONITOR_BASE,
+		      CFG_MONITOR_BASE+CFG_MONITOR_LEN-1,
+		      &flash_info[0]);
+#endif
+	flash_info[0].size = size_b0;
+	return (size_b0);
+}
+
+static void flash_get_offsets (ulong base, flash_info_t *info)
+{
+	int i;
+
+	/* set up sector start address table */
+	if (info->flash_id & FLASH_BTYPE) {
+		info->start[0] = base + 0x00000000;
+		info->start[1] = base + 0x00008000;
+		info->start[2] = base + 0x00010000;
+		info->start[3] = base + 0x00018000;
+		info->start[4] = base + 0x00020000;
+		info->start[5] = base + 0x00028000;
+		info->start[6] = base + 0x00030000;
+		info->start[7] = base + 0x00038000;
+
+		for (i = 8; i < info->sector_count; i++) {
+			info->start[i] = base + ((i-7) * 0x00040000);
+		}
+	} else {
+		i = info->sector_count - 1;
+		info->start[i--] = base + info->size - 0x00010000;
+		info->start[i--] = base + info->size - 0x00018000;
+		info->start[i--] = base + info->size - 0x00020000;
+		for (; i >= 0; i--) {
+			info->start[i] = base + i * 0x00040000;
+		}
+	}
+
+}
+
+void flash_print_info  (flash_info_t *info)
+{
+	int i;
+
+	if (info->flash_id == FLASH_UNKNOWN) {
+		printf ("missing or unknown FLASH type\n");
+		return;
+	}
+
+	switch (info->flash_id & FLASH_VENDMASK) {
+	case FLASH_MAN_AMD:	printf ("AMD ");		break;
+	case FLASH_MAN_FUJ:	printf ("FUJITSU ");		break;
+	default:		printf ("Unknown Vendor ");	break;
+	}
+
+	switch (info->flash_id & FLASH_TYPEMASK) {
+	case FLASH_AM400B:	printf ("AM29LV400B (4 Mbit, bottom boot sect)\n");
+				break;
+	case FLASH_AM400T:	printf ("AM29LV400T (4 Mbit, top boot sector)\n");
+				break;
+	case FLASH_AM800B:	printf ("AM29LV800B (8 Mbit, bottom boot sect)\n");
+				break;
+	case FLASH_AM800T:	printf ("AM29LV800T (8 Mbit, top boot sector)\n");
+				break;
+	case FLASH_AM160B:	printf ("AM29LV160B (16 Mbit, bottom boot sect)\n");
+				break;
+	case FLASH_AM160T:	printf ("AM29LV160T (16 Mbit, top boot sector)\n");
+				break;
+	case FLASH_AM320B:	printf ("AM29LV320B (32 Mbit, bottom boot sect)\n");
+				break;
+	case FLASH_AM320T:	printf ("AM29LV320T (32 Mbit, top boot sector)\n");
+				break;
+	case FLASH_AMDL323B:    printf ("AM29DL323B (32 Mbit, bottom boot sector)\n");
+				break;
+	/* I just add the FLASH_AMDL323B for RPXlite_DW BOARD. [SAM]  */
+	default:		printf ("Unknown Chip Type\n");
+				break;
+	}
+	printf ("  Size: %ld MB in %d Sectors\n",info->size >> 20, info->sector_count);
+	printf ("  Sector Start Addresses:");
+	for (i=0; i<info->sector_count; ++i) {
+		if ((i % 5) == 0)
+			printf ("\n   ");
+		printf (" %08lX%s",info->start[i],info->protect[i] ? " (RO)" : "     ");
+	}
+	printf ("\n");
+	return;
+}
+
+static ulong flash_get_size (vu_long *addr, flash_info_t *info)
+{
+	short i;
+	ulong value;
+	ulong base = (ulong)addr;
+
+	/* Write auto select command: read Manufacturer ID */
+	addr[0xAAA] = 0x00AA00AA ;
+	addr[0x555] = 0x00550055 ;
+	addr[0xAAA] = 0x00900090 ;
+
+	value = addr[0] ;
+	switch (value & 0x00FF00FF) {
+	case AMD_MANUFACT:             		/* AMD_MANUFACT=0x00010001 in flash.h. */
+		info->flash_id = FLASH_MAN_AMD; /* FLASH_MAN_AMD=0x00000000 in flash.h.*/
+		break;
+	case FUJ_MANUFACT:
+		info->flash_id = FLASH_MAN_FUJ;
+		break;
+	default:
+		info->flash_id = FLASH_UNKNOWN;
+		info->sector_count = 0;
+		info->size = 0;
+		return (0);			/* no or unknown flash	*/
+	}
+
+	value = addr[2] ;			/* device ID		*/
+	switch (value & 0x00FF00FF) {
+	case (AMD_ID_LV400T & 0x00FF00FF):
+		info->flash_id += FLASH_AM400T;
+		info->sector_count = 11;
+		info->size = 0x00100000;
+		break;				/* => 1 MB		*/
+	case (AMD_ID_LV400B & 0x00FF00FF):
+		info->flash_id += FLASH_AM400B;
+		info->sector_count = 11;
+		info->size = 0x00100000;
+		break;				/* => 1 MB		*/
+	case (AMD_ID_LV800T & 0x00FF00FF):
+		info->flash_id += FLASH_AM800T;
+		info->sector_count = 19;
+		info->size = 0x00200000;
+		break;				/* => 2 MB		*/
+	case (AMD_ID_LV800B & 0x00FF00FF):
+		info->flash_id += FLASH_AM800B;
+		info->sector_count = 19;
+		info->size = 0x00400000;	/* Size doubled by yooth */
+		break;				/* => 4 MB		 */
+	case (AMD_ID_LV160T & 0x00FF00FF):
+		info->flash_id += FLASH_AM160T;
+		info->sector_count = 35;
+		info->size = 0x00400000;
+		break;				/* => 4 MB		*/
+	case (AMD_ID_LV160B & 0x00FF00FF):
+		info->flash_id += FLASH_AM160B;
+		info->sector_count = 35;
+		info->size = 0x00400000;
+		break;				/* => 4 MB		*/
+	case (AMD_ID_DL323B & 0x00FF00FF):
+		info->flash_id += FLASH_AMDL323B;
+		info->sector_count = 71;
+		info->size = 0x01000000;
+		break;                          /* => 16 MB(4x4MB)  */
+	/* AMD_ID_DL323B= 0x22532253  FLASH_AMDL323B= 0x0013
+	 * AMD_ID_DL323B could be found in <flash.h>.[SAM]
+	 * So we could get : flash_id = 0x00000013.
+	 * The first four-bit represents VEDOR ID,leaving others for FLASH ID. */
+	default:
+		info->flash_id = FLASH_UNKNOWN;
+		return (0);			/* => no or unknown flash */
+
+	}
+	/* set up sector start address table */
+	if (info->flash_id & FLASH_BTYPE) {
+	/* FLASH_BTYPE=0x0001 mask for bottom boot sector type.If the last bit equals 1,
+	 * it means bottom boot flash. GOOD IDEA! [SAM]
+	 */
+
+	/* set sector offsets for bottom boot block type        */
+		info->start[0] = base + 0x00000000;
+		info->start[1] = base + 0x00008000;
+		info->start[2] = base + 0x00010000;
+		info->start[3] = base + 0x00018000;
+		info->start[4] = base + 0x00020000;
+		info->start[5] = base + 0x00028000;
+		info->start[6] = base + 0x00030000;
+		info->start[7] = base + 0x00038000;
+
+		for (i = 8; i < info->sector_count; i++) {
+			info->start[i] = base + ((i-7) * 0x00040000) ;
+		}
+	} else {
+		/* set sector offsets for top boot block type		*/
+		i = info->sector_count - 1;
+		info->start[i--] = base + info->size - 0x00010000;
+		info->start[i--] = base + info->size - 0x00018000;
+		info->start[i--] = base + info->size - 0x00020000;
+		for (; i >= 0; i--) {
+			info->start[i] = base + i * 0x00040000;
+		}
+	}
+
+	/* check for protected sectors */
+	for (i = 0; i < info->sector_count; i++) {
+		/* read sector protection at sector address, (A7 .. A0) = 0x02 */
+		/* D0 = 1 if protected */
+		addr = (volatile unsigned long *)(info->start[i]);
+		/* info->protect[i] = addr[4] & 1 ; */
+		/* Mask it for disorder FLASH protection **[Sam]** */
+	}
+
+	/*
+	 * Prevent writes to uninitialized FLASH.
+	 */
+	if (info->flash_id != FLASH_UNKNOWN) {
+		addr = (volatile unsigned long *)info->start[0];
+
+		*addr = 0xF0F0F0F0;	/* reset bank */
+	}
+	return (info->size);
+}
+
+int	flash_erase (flash_info_t *info, int s_first, int s_last)
+{
+	vu_long *addr = (vu_long*)(info->start[0]);
+	int flag, prot, sect, l_sect;
+	ulong start, now, last;
+
+	if ((s_first < 0) || (s_first > s_last)) {
+		if (info->flash_id == FLASH_UNKNOWN) {
+			printf ("- missing\n");
+		} else {
+			printf ("- no sectors to erase\n");
+		}
+		return 1;
+	}
+
+	if ((info->flash_id == FLASH_UNKNOWN) ||
+	    (info->flash_id > FLASH_AMD_COMP)) {
+		printf ("Can't erase unknown flash type %08lx - aborted\n",
+			info->flash_id);
+		return 1;
+	}
+
+	prot = 0;
+	for (sect=s_first; sect<=s_last; ++sect) {
+		if (info->protect[sect]) {
+			prot++;
+		}
+	}
+
+	if (prot) {
+		printf ("- Warning: %d protected sectors will not be erased!\n",
+			prot);
+	} else {
+		printf ("\n");
+	}
+
+	l_sect = -1;
+
+	/* Disable interrupts which might cause a timeout here */
+	flag = disable_interrupts();
+
+	addr[0xAAA] = 0xAAAAAAAA;
+	addr[0x555] = 0x55555555;
+	addr[0xAAA] = 0x80808080;
+	addr[0xAAA] = 0xAAAAAAAA;
+	addr[0x555] = 0x55555555;
+
+	/* Start erase on unprotected sectors */
+	for (sect = s_first; sect<=s_last; sect++) {
+		if (info->protect[sect] == 0) {	/* not protected */
+			addr = (vu_long *)(info->start[sect]) ;
+			addr[0] = 0x30303030 ;
+			l_sect = sect;
+		}
+	}
+
+	/* re-enable interrupts if necessary */
+	if (flag)
+		enable_interrupts();
+
+	/* wait at least 80us - let's wait 1 ms */
+	udelay (1000);
+
+	/*
+	 * We wait for the last triggered sector
+	 */
+	if (l_sect < 0)
+		goto DONE;
+
+	start = get_timer (0);
+	last  = start;
+	addr = (vu_long *)(info->start[l_sect]);
+	while ((addr[0] & 0x80808080) != 0x80808080) {
+		if ((now = get_timer(start)) > CFG_FLASH_ERASE_TOUT) {
+			printf ("Timeout\n");
+			return 1;
+		}
+		/* show that we're waiting */
+		if ((now - last) > 1000) {	/* every second */
+			putc ('.');
+			last = now;
+		}
+	}
+
+DONE:
+	/* reset to read mode */
+	addr = (vu_long *)info->start[0];
+	addr[0] = 0xF0F0F0F0;	/* reset bank */
+
+	printf (" done\n");
+	return 0;
+}
+
+/*-----------------------------------------------------------------------
+ * Copy memory to flash, returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ */
+
+int write_buff (flash_info_t *info, uchar *src, ulong addr, ulong cnt)
+{
+	ulong cp, wp, data;
+	int i, l, rc;
+
+	wp = (addr & ~3);	/* get lower word aligned address */
+
+	/*
+	 * handle unaligned start bytes
+	 */
+	if ((l = addr - wp) != 0) {
+		data = 0;
+		for (i=0, cp=wp; i<l; ++i, ++cp) {
+			data = (data << 8) | (*(uchar *)cp);
+		}
+		for (; i<4 && cnt>0; ++i) {
+			data = (data << 8) | *src++;
+			--cnt;
+			++cp;
+		}
+		for (; cnt==0 && i<4; ++i, ++cp) {
+			data = (data << 8) | (*(uchar *)cp);
+		}
+
+		if ((rc = write_word(info, wp, data)) != 0) {
+			return (rc);
+		}
+		wp += 4;
+	}
+
+	/*
+	 * handle word aligned part
+	 */
+	while (cnt >= 4) {
+		data = 0;
+		for (i=0; i<4; ++i) {
+			data = (data << 8) | *src++;
+		}
+		if ((rc = write_word(info, wp, data)) != 0) {
+			return (rc);
+		}
+		wp  += 4;
+		cnt -= 4;
+	}
+
+	if (cnt == 0) {
+		return (0);
+	}
+
+	/*
+	 * handle unaligned tail bytes
+	 */
+	data = 0;
+	for (i=0, cp=wp; i<4 && cnt>0; ++i, ++cp) {
+		data = (data << 8) | *src++;
+		--cnt;
+	}
+	for (; i<4; ++i, ++cp) {
+		data = (data << 8) | (*(uchar *)cp);
+	}
+	return (write_word(info, wp, data));
+}
+
+/*-----------------------------------------------------------------------
+ * Write a word to Flash, returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ */
+static int write_word (flash_info_t *info, ulong dest, ulong data)
+{
+	vu_long *addr = (vu_long *)(info->start[0]);
+	ulong start;
+	int flag;
+
+	/* Check if Flash is (sufficiently) erased */
+	if ((*((vu_long *)dest) & data) != data) {
+		return (2);
+	}
+	/* Disable interrupts which might cause a timeout here */
+	flag = disable_interrupts();
+
+	addr[0xAAA] = 0xAAAAAAAA;
+	addr[0x555] = 0x55555555;
+	addr[0xAAA] = 0xA0A0A0A0;
+
+	*((vu_long *)dest) = data;
+
+	/* re-enable interrupts if necessary */
+	if (flag)
+		enable_interrupts();
+
+	/* data polling for D7 */
+	start = get_timer (0);
+	while ((*((vu_long *)dest) & 0x80808080) != (data & 0x80808080)) {
+		if (get_timer(start) > CFG_FLASH_WRITE_TOUT) {
+			return (1);
+		}
+	}
+	return (0);
+}
--- a/board/RPXlite_dw/u-boot.lds
+++ b/board/RPXlite_dw/u-boot.lds
@@ -0,0 +1,139 @@
+/*
+ * (C) Copyright 2000-2004
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+OUTPUT_ARCH(powerpc)
+SEARCH_DIR(/lib); SEARCH_DIR(/usr/lib); SEARCH_DIR(/usr/local/lib); SEARCH_DIR(/usr/local/powerpc-any-elf/lib);
+/* Do we need any of these for elf?
+   __DYNAMIC = 0;    */
+SECTIONS
+{
+  /* Read-only sections, merged into text segment: */
+  . = + SIZEOF_HEADERS;
+  .interp : { *(.interp) }
+  .hash          : { *(.hash)		}
+  .dynsym        : { *(.dynsym)		}
+  .dynstr        : { *(.dynstr)		}
+  .rel.text      : { *(.rel.text)		}
+  .rela.text     : { *(.rela.text) 	}
+  .rel.data      : { *(.rel.data)		}
+  .rela.data     : { *(.rela.data) 	}
+  .rel.rodata    : { *(.rel.rodata) 	}
+  .rela.rodata   : { *(.rela.rodata) 	}
+  .rel.got       : { *(.rel.got)		}
+  .rela.got      : { *(.rela.got)		}
+  .rel.ctors     : { *(.rel.ctors)	}
+  .rela.ctors    : { *(.rela.ctors)	}
+  .rel.dtors     : { *(.rel.dtors)	}
+  .rela.dtors    : { *(.rela.dtors)	}
+  .rel.bss       : { *(.rel.bss)		}
+  .rela.bss      : { *(.rela.bss)		}
+  .rel.plt       : { *(.rel.plt)		}
+  .rela.plt      : { *(.rela.plt)		}
+  .init          : { *(.init)	}
+  .plt : { *(.plt) }
+  .text      :
+  {
+    /* WARNING - the following is hand-optimized to fit within	*/
+    /* the sector layout of our flash chips!	XXX FIXME XXX	*/
+
+    cpu/mpc8xx/start.o	(.text)
+    common/dlmalloc.o	(.text)
+    lib_ppc/ppcstring.o	(.text)
+    lib_generic/vsprintf.o	(.text)
+    lib_generic/crc32.o		(.text)
+    lib_generic/zlib.o		(.text)
+/* XXX ?
+    . = env_offset;
+*/
+    common/environment.o(.text)
+
+    *(.text)
+    *(.fixup)
+    *(.got1)
+  }
+  _etext = .;
+  PROVIDE (etext = .);
+  .rodata    :
+  {
+    *(.rodata)
+    *(.rodata1)
+    *(.rodata.str1.4)
+  }
+  .fini      : { *(.fini)    } =0
+  .ctors     : { *(.ctors)   }
+  .dtors     : { *(.dtors)   }
+
+  /* Read-write section, merged into data segment: */
+  . = (. + 0x00FF) & 0xFFFFFF00;
+  _erotext = .;
+  PROVIDE (erotext = .);
+  .reloc   :
+  {
+    *(.got)
+    _GOT2_TABLE_ = .;
+    *(.got2)
+    _FIXUP_TABLE_ = .;
+    *(.fixup)
+  }
+  __got2_entries = (_FIXUP_TABLE_ - _GOT2_TABLE_) >>2;
+  __fixup_entries = (. - _FIXUP_TABLE_)>>2;
+
+  .data    :
+  {
+    *(.data)
+    *(.data1)
+    *(.sdata)
+    *(.sdata2)
+    *(.dynamic)
+    CONSTRUCTORS
+  }
+  _edata  =  .;
+  PROVIDE (edata = .);
+
+  __u_boot_cmd_start = .;
+  .u_boot_cmd : { *(.u_boot_cmd) }
+  __u_boot_cmd_end = .;
+
+
+  __start___ex_table = .;
+  __ex_table : { *(__ex_table) }
+  __stop___ex_table = .;
+
+  . = ALIGN(256);
+  __init_begin = .;
+  .text.init : { *(.text.init) }
+  .data.init : { *(.data.init) }
+  . = ALIGN(256);
+  __init_end = .;
+
+  __bss_start = .;
+  .bss       :
+  {
+   *(.sbss) *(.scommon)
+   *(.dynbss)
+   *(.bss)
+   *(COMMON)
+  }
+  _end = . ;
+  PROVIDE (end = .);
+}
--- a/board/RPXlite_dw/u-boot.lds.debug
+++ b/board/RPXlite_dw/u-boot.lds.debug
@@ -0,0 +1,135 @@
+/*
+ * (C) Copyright 2000-2004
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+OUTPUT_ARCH(powerpc)
+SEARCH_DIR(/lib); SEARCH_DIR(/usr/lib); SEARCH_DIR(/usr/local/lib); SEARCH_DIR(/usr/local/powerpc-any-elf/lib);
+/* Do we need any of these for elf?
+   __DYNAMIC = 0;    */
+SECTIONS
+{
+  /* Read-only sections, merged into text segment: */
+  . = + SIZEOF_HEADERS;
+  .interp : { *(.interp) }
+  .hash          : { *(.hash)		}
+  .dynsym        : { *(.dynsym)		}
+  .dynstr        : { *(.dynstr)		}
+  .rel.text      : { *(.rel.text)		}
+  .rela.text     : { *(.rela.text) 	}
+  .rel.data      : { *(.rel.data)		}
+  .rela.data     : { *(.rela.data) 	}
+  .rel.rodata    : { *(.rel.rodata) 	}
+  .rela.rodata   : { *(.rela.rodata) 	}
+  .rel.got       : { *(.rel.got)		}
+  .rela.got      : { *(.rela.got)		}
+  .rel.ctors     : { *(.rel.ctors)	}
+  .rela.ctors    : { *(.rela.ctors)	}
+  .rel.dtors     : { *(.rel.dtors)	}
+  .rela.dtors    : { *(.rela.dtors)	}
+  .rel.bss       : { *(.rel.bss)		}
+  .rela.bss      : { *(.rela.bss)		}
+  .rel.plt       : { *(.rel.plt)		}
+  .rela.plt      : { *(.rela.plt)		}
+  .init          : { *(.init)	}
+  .plt : { *(.plt) }
+  .text      :
+  {
+    /* WARNING - the following is hand-optimized to fit within	*/
+    /* the sector layout of our flash chips!	XXX FIXME XXX	*/
+
+    cpu/mpc8xx/start.o	(.text)
+    common/dlmalloc.o	(.text)
+    lib_generic/vsprintf.o	(.text)
+    lib_generic/crc32.o		(.text)
+
+    . = env_offset;
+    common/environment.o(.text)
+
+    *(.text)
+    *(.fixup)
+    *(.got1)
+  }
+  _etext = .;
+  PROVIDE (etext = .);
+  .rodata    :
+  {
+    *(.rodata)
+    *(.rodata1)
+  }
+  .fini      : { *(.fini)    } =0
+  .ctors     : { *(.ctors)   }
+  .dtors     : { *(.dtors)   }
+
+  /* Read-write section, merged into data segment: */
+  . = (. + 0x0FFF) & 0xFFFFF000;
+  _erotext = .;
+  PROVIDE (erotext = .);
+  .reloc   :
+  {
+    *(.got)
+    _GOT2_TABLE_ = .;
+    *(.got2)
+    _FIXUP_TABLE_ = .;
+    *(.fixup)
+  }
+  __got2_entries = (_FIXUP_TABLE_ - _GOT2_TABLE_) >>2;
+  __fixup_entries = (. - _FIXUP_TABLE_)>>2;
+
+  .data    :
+  {
+    *(.data)
+    *(.data1)
+    *(.sdata)
+    *(.sdata2)
+    *(.dynamic)
+    CONSTRUCTORS
+  }
+  _edata  =  .;
+  PROVIDE (edata = .);
+
+  __u_boot_cmd_start = .;
+  .u_boot_cmd : { *(.u_boot_cmd) }
+  __u_boot_cmd_end = .;
+
+
+  __start___ex_table = .;
+  __ex_table : { *(__ex_table) }
+  __stop___ex_table = .;
+
+  . = ALIGN(4096);
+  __init_begin = .;
+  .text.init : { *(.text.init) }
+  .data.init : { *(.data.init) }
+  . = ALIGN(4096);
+  __init_end = .;
+
+  __bss_start = .;
+  .bss       :
+  {
+   *(.sbss) *(.scommon)
+   *(.dynbss)
+   *(.bss)
+   *(COMMON)
+  }
+  _end = . ;
+  PROVIDE (end = .);
+}
--- a/board/adder/Makefile
+++ b/board/adder/Makefile
@@ -0,0 +1,46 @@
+#
+# Copyright (C) 2004 Arabella Software Ltd.
+# Yuli Barcohen <yuli@arabellasw.com>
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+include $(TOPDIR)/config.mk
+
+LIB	= lib$(BOARD).a
+
+OBJS	:= $(BOARD).o
+
+$(LIB):	$(OBJS) $(SOBJS)
+	$(AR) crv $@ $(OBJS)
+
+clean:
+	rm -f $(SOBJS) $(OBJS)
+
+distclean:	clean
+	rm -f $(LIB) core *.bak .depend
+
+#########################################################################
+
+.depend:	Makefile $(SOBJS:.o=.S) $(OBJS:.o=.c)
+		$(CC) -M $(CPPFLAGS) $(SOBJS:.o=.S) $(OBJS:.o=.c) > $@
+
+-include .depend
+
+#########################################################################
--- a/board/adder/adder.c
+++ b/board/adder/adder.c
@@ -0,0 +1,107 @@
+/*
+ * Copyright (C) 2004 Arabella Software Ltd.
+ * Yuli Barcohen <yuli@arabellasw.com>
+ *
+ * Support for Analogue&Micro Adder boards family.
+ * Tested on AdderII and Adder87x.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <mpc8xx.h>
+
+/*
+ * SDRAM is single Samsung K4S643232F-T70 chip.
+ * Minimal CPU frequency is 40MHz.
+ */
+static uint sdram_table[] = {
+	/* Single read	(offset 0x00 in UPM RAM) */
+	0x1f07fc24, 0xe0aefc04, 0x10adfc04, 0xe0bbbc00,
+	0x10f77c44, 0xf3fffc07, 0xfffffc04, 0xfffffc04,
+
+	/* Burst read	(offset 0x08 in UPM RAM) */
+	0x1f07fc24, 0xe0aefc04, 0x10adfc04, 0xf0affc00,
+	0xf0affc00, 0xf0affc00, 0xf0affc00, 0x10a77c44,
+	0xf7bffc47, 0xfffffc35, 0xfffffc34, 0xfffffc35,
+	0xfffffc35, 0x1ff77c35, 0xfffffc34, 0x1fb57c35,
+
+	/* Single write (offset 0x18 in UPM RAM) */
+	0x1f27fc24, 0xe0aebc04, 0x00b93c00, 0x13f77c47,
+	0xfffdfc04, 0xfffffc04, 0xfffffc04, 0xfffffc04,
+
+	/* Burst write	(offset 0x20 in UPM RAM) */
+	0x1f07fc24, 0xeeaebc00, 0x10ad7c00, 0xf0affc00,
+	0xf0affc00, 0xe0abbc00, 0x1fb77c47, 0xfffffc04,
+	0xfffffc04, 0xfffffc04, 0xfffffc04, 0xfffffc04,
+	0xfffffc04, 0xfffffc04, 0xfffffc04, 0xfffffc04,
+
+	/* Refresh	(offset 0x30 in UPM RAM) */
+	0x1ff5fca4, 0xfffffc04, 0xfffffc04, 0xfffffc04,
+	0xfffffc84, 0xfffffc07, 0xfffffc04, 0xfffffc04,
+	0xfffffc04, 0xfffffc04, 0xfffffc04, 0xfffffc04,
+
+	/* Exception	(offset 0x3C in UPM RAM) */
+	0xfffffc27, 0xfffffc04, 0xfffffc04, 0xfffffc04
+};
+
+long int initdram (int board_type)
+{
+	long int msize = CFG_SDRAM_SIZE;
+	volatile immap_t     *immap  = (volatile immap_t *)CFG_IMMR;
+	volatile memctl8xx_t *memctl = &immap->im_memctl;
+
+	upmconfig(UPMA, sdram_table, sizeof(sdram_table) / sizeof(uint));
+
+	/* Configure SDRAM refresh */
+	memctl->memc_mptpr = MPTPR_PTP_DIV32; /* BRGCLK/32 */
+
+	memctl->memc_mamr = (94 << 24) | CFG_MAMR;
+	memctl->memc_mar  = 0x0;
+	udelay(200);
+
+	/* Run precharge from location 0x15 */
+	memctl->memc_mcr = 0x80002115;
+	udelay(200);
+
+	/* Run 8 refresh cycles */
+	memctl->memc_mcr = 0x80002830;
+	udelay(200);
+
+	memctl->memc_mar = 0x88;
+	udelay(200);
+
+	/* Run MRS pattern from location 0x16 */
+	memctl->memc_mcr = 0x80002116;
+	udelay(200);
+
+	return msize;
+}
+
+int checkboard( void )
+{
+	puts("Board: Adder");
+#if defined(CONFIG_MPC885_FAMILY)
+	puts("87x\n");
+#elif defined(CONFIG_MPC866_FAMILY)
+	puts("II\n");
+#endif
+
+	return 0;
+}
--- a/board/adder/config.mk
+++ b/board/adder/config.mk
@@ -0,0 +1,27 @@
+#
+# Copyright (C) 2004 Arabella Software Ltd.
+# Yuli Barcohen <yuli@arabellasw.com>
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+#
+# Analogue&Micro Adder boards family
+#
+TEXT_BASE = 0xFE000000
--- a/board/adder/u-boot.lds
+++ b/board/adder/u-boot.lds
@@ -0,0 +1,122 @@
+/*
+ * (C) Copyright 2001-2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * Modified by Yuli Barcohen <yuli@arabellasw.com>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+OUTPUT_ARCH(powerpc)
+SECTIONS
+{
+  /* Read-only sections, merged into text segment: */
+  . = + SIZEOF_HEADERS;
+  .interp        : { *(.interp)		}
+  .hash          : { *(.hash)		}
+  .dynsym        : { *(.dynsym)		}
+  .dynstr        : { *(.dynstr)		}
+  .rel.text      : { *(.rel.text)	}
+  .rela.text     : { *(.rela.text) 	}
+  .rel.data      : { *(.rel.data)	}
+  .rela.data     : { *(.rela.data) 	}
+  .rel.rodata    : { *(.rel.rodata) 	}
+  .rela.rodata   : { *(.rela.rodata) 	}
+  .rel.got       : { *(.rel.got)	}
+  .rela.got      : { *(.rela.got)	}
+  .rel.ctors     : { *(.rel.ctors)	}
+  .rela.ctors    : { *(.rela.ctors)	}
+  .rel.dtors     : { *(.rel.dtors)	}
+  .rela.dtors    : { *(.rela.dtors)	}
+  .rel.bss       : { *(.rel.bss)	}
+  .rela.bss      : { *(.rela.bss)	}
+  .rel.plt       : { *(.rel.plt)	}
+  .rela.plt      : { *(.rela.plt)	}
+  .init          : { *(.init)		}
+  .plt           : { *(.plt)		}
+  .text          :
+  {
+    cpu/mpc8xx/start.o	(.text)
+    *(.text)
+    *(.fixup)
+    *(.got1)
+    . = ALIGN(16);
+    *(.rodata)
+    *(.rodata1)
+    *(.rodata.str1.4)
+  }
+  .fini      : { *(.fini)    } =0
+  .ctors     : { *(.ctors)   }
+  .dtors     : { *(.dtors)   }
+
+  /* Read-write section, merged into data segment: */
+  . = (. + 0x0FFF) & 0xFFFFF000;
+  _erotext = .;
+  PROVIDE (erotext = .);
+  .reloc   :
+  {
+    *(.got)
+    _GOT2_TABLE_ = .;
+    *(.got2)
+    _FIXUP_TABLE_ = .;
+    *(.fixup)
+  }
+  __got2_entries = (_FIXUP_TABLE_ - _GOT2_TABLE_) >> 2;
+  __fixup_entries = (. - _FIXUP_TABLE_) >> 2;
+
+  .data    :
+  {
+    *(.data)
+    *(.data1)
+    *(.sdata)
+    *(.sdata2)
+    *(.dynamic)
+    CONSTRUCTORS
+  }
+  _edata  =  .;
+  PROVIDE (edata = .);
+
+  __u_boot_cmd_start = .;
+  .u_boot_cmd : { *(.u_boot_cmd) }
+  __u_boot_cmd_end = .;
+
+
+  __start___ex_table = .;
+  __ex_table : { *(__ex_table) }
+  __stop___ex_table = .;
+
+  . = ALIGN(4096);
+  __init_begin = .;
+  .text.init : { *(.text.init) }
+  .data.init : { *(.data.init) }
+  . = ALIGN(4096);
+  __init_end = .;
+
+  __bss_start = .;
+  .bss       :
+  {
+   *(.sbss) *(.scommon)
+   *(.dynbss)
+   *(.bss)
+   *(COMMON)
+  }
+  _end = . ;
+  PROVIDE (end = .);
+}
+ENTRY(_start)
--- a/board/adderII/adderII.c
+++ b/board/adderII/adderII.c
@@ -1,189 +0,0 @@
-/*
- * (C) Copyright 2000-2003
- * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
- *
- * See file CREDITS for list of people who contributed to this
- * project.
- *
- * This program is free software; you can redistribute it and/or
- * modify it under the terms of the GNU General Public License as
- * published by the Free Software Foundation; either version 2 of
- * the License, or (at your option) any later version.
- *
- * This program is distributed in the hope that it will be useful,
- * but WITHOUT ANY WARRANTY; without even the implied warranty of
- * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
- * GNU General Public License for more details.
- *
- * You should have received a copy of the GNU General Public License
- * along with this program; if not, write to the Free Software
- * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
- * MA 02111-1307 USA
- */
-
-#include <common.h>
-#include <config.h>
-#include <mpc8xx.h>
-
-/*
- * Check Board Identity:
- */
-
-int checkboard( void )
-{
-	puts("Board: ");
-	puts("AdderII(MPC852T)\n" );
-
-  	return 0;
-}
-
-#if defined( CONFIG_SDRAM_50MHZ )
-
-/******************************************************************************
-** for chip Samsung K4S643232F - T70
-** this table is for 32-50MHz operation
-*******************************************************************************/
-
-#define SDRAM_MPTPRVALUE 	0x0200
-
-#define SDRAM_MAMRVALUE0 	0x00802114   /* refresh at 32MHz */
-#define SDRAM_MAMRVALUE1 	0x00802118
-
-#define SDRAM_OR1VALUE   	0xff800e00
-#define SDRAM_BR1VALUE   	0x00000081
-
-#define SDRAM_MARVALUE		94
-
-#define SDRAM_MCRVALUE0  	0x80808105
-#define SDRAM_MCRVALUE1  	0x80808130
-
-const uint sdram_table[] = {
-
-	/* single read   (offset 0x00 in upm ram) */
-       	0x1f07fc24, 0xe0aefc04, 0x10adfc04, 0xe0bbbc00,
-       	0x10f77c44, 0xf3fffc07, 0xfffffc04, 0xfffffc04,
-
-	/* burst read    (offset 0x08 in upm ram) */
-       	0x1f07fc24, 0xe0aefc04, 0x10adfc04, 0xf0affc00,
-       	0xf0affc00, 0xf0affc00, 0xf0affc00, 0x10a77c44,
-       	0xf7bffc47, 0xfffffc35, 0xfffffc34, 0xfffffc35,
-       	0xfffffc35, 0x1ff77c35, 0xfffffc34, 0x1fb57c35,
-
-	/* single write  (offset 0x18 in upm ram) */
-       	0x1f27fc24, 0xe0aebc04, 0x00b93c00, 0x13f77c47,
-       	0xfffdfc04, 0xfffffc04, 0xfffffc04, 0xfffffc04,
-
-	/* burst write   (offset 0x20 in upm ram) */
-       	0x1f07fc24, 0xeeaebc00, 0x10ad7c00, 0xf0affc00,
-       	0xf0affc00, 0xe0abbc00, 0x1fb77c47, 0xfffffc04,
-       	0xfffffc04, 0xfffffc04, 0xfffffc04, 0xfffffc04,
-       	0xfffffc04, 0xfffffc04, 0xfffffc04, 0xfffffc04,
-
-	/* refresh       (offset 0x30 in upm ram) */
-       	0x1ff5fca4, 0xfffffc04, 0xfffffc04, 0xfffffc04,
-       	0xfffffc84, 0xfffffc07, 0xfffffc04, 0xfffffc04,
-       	0xfffffc04, 0xfffffc04, 0xfffffc04, 0xfffffc04,
-
-	/* exception     (offset 0x3C in upm ram) */
-       	0xfffffc27, 0xfffffc04, 0xfffffc04, 0xfffffc04,
-};
-
-#else
-#error SDRAM not correctly configured
-#endif
-
-int _initsdram (uint base, uint noMbytes)
-{
-	volatile immap_t *immap = (immap_t *) CFG_IMMR;
-	volatile memctl8xx_t *memctl = &immap->im_memctl;
-
-	if (noMbytes != 8) {
-		return -1;
-	}
-
-	upmconfig (UPMA, (uint *) sdram_table,
-		   sizeof (sdram_table) / sizeof (uint));
-
-	memctl->memc_mptpr = SDRAM_MPTPRVALUE;
-
-	/* Configure the refresh (mostly).  This needs to be
-	 * based upon processor clock speed and optimized to provide
-	 * the highest level of performance.  For multiple banks,
-	 * this time has to be divided by the number of banks.
-	 * Although it is not clear anywhere, it appears the
-	 * refresh steps through the chip selects for this UPM
-	 * on each refresh cycle.
-	 * We have to be careful changing
-	 * UPM registers after we ask it to run these commands.
-	 */
-
-	memctl->memc_mamr = (SDRAM_MAMRVALUE0 | (SDRAM_MARVALUE << 24));
-	memctl->memc_mar = 0x0;
-	udelay (200);
-
-	/* Now run the precharge/nop/mrs commands.
-	 */
-	memctl->memc_mcr = 0x80002115;
-	udelay (200);
-
-	/* Run 8 refresh cycles */
-	memctl->memc_mcr = 0x80002380;
-	udelay (200);
-
-	memctl->memc_mar = 0x88;
-	udelay (200);
-
-	memctl->memc_mcr = 0x80002116;
-	udelay (200);
-
-	memctl->memc_or1 = SDRAM_OR1VALUE;
-	memctl->memc_br1 = SDRAM_BR1VALUE | base;
-
-	return 0;
-}
-
-void _sdramdisable( void )
-{
-	volatile immap_t     *immap = (immap_t *)CFG_IMMR;
-	volatile memctl8xx_t *memctl = &immap->im_memctl;
-
-	memctl->memc_br1 = 0x00000000;
-
-	/* maybe we should turn off upma here or something */
-}
-
-int initsdram (uint base, uint * noMbytes)
-{
-	uint m = 8;
-
-	*noMbytes = m;
-
-	if (!_initsdram (base, m)) {
-		return 0;
-	} else {
-		_sdramdisable ();
-		return -1;
-	}
-}
-
-long int initdram (int board_type)
-{
-	/* AdderII: has 8MB SDRAM */
-	uint sdramsz;
-	uint m = 0;
-
-	if (!initsdram (0x00000000, &sdramsz)) {
-		m += sdramsz;
-	} else {
-		return -1;
-	}
-	return (m << 20);
-}
-
-int testdram (void)
-{
-	/* TODO: XXX XXX XXX not an actual SDRAM test */
-	printf ("Test: 8MB SDRAM\n");
-
-	return (0);
-}
--- a/board/adderII/flash.c
+++ b/board/adderII/flash.c
@@ -1,501 +0,0 @@
-/*
- * (C) Copyright 2000-2003
- * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
- *
- * See file CREDITS for list of people who contributed to this
- * project.
- *
- * This program is free software; you can redistribute it and/or
- * modify it under the terms of the GNU General Public License as
- * published by the Free Software Foundation; either version 2 of
- * the License, or (at your option) any later version.
- *
- * This program is distributed in the hope that it will be useful,
- * but WITHOUT ANY WARRANTY; without even the implied warranty of
- * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
- * GNU General Public License for more details.
- *
- * You should have received a copy of the GNU General Public License
- * along with this program; if not, write to the Free Software
- * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
- * MA 02111-1307 USA
- */
-/******************************************************************************
-** Notes: AM29LV320DB - 90EI ( 32 Mbit device )
-** Sectors - Eight 8 Kb sector
-** 	   - Sixty three 64 Kb sector
-** Bottom boot sector
-******************************************************************************/
-#include <common.h>
-#include <mpc8xx.h>
-
-
-/******************************************************************************
-**	Defines
-******************************************************************************/
-#ifdef CONFIG_ADDERII
-
-#define ADDR0	0x0555
-#define ADDR1	0x02AA
-#define FLASH_WORD_SIZE unsigned short
-
-#endif
-
-#if defined( CFG_ENV_IS_IN_FLASH )
-# ifndef  CFG_ENV_ADDR
-#  define CFG_ENV_ADDR  ( CFG_FLASH_BASE + CFG_ENV_OFFSET )
-# endif
-# ifndef  CFG_ENV_SIZE
-#  define CFG_ENV_SIZE  CFG_ENV_SECT_SIZE
-# endif
-# ifndef  CFG_ENV_SECT_SIZE
-#  define CFG_ENV_SECT_SIZE  CFG_ENV_SIZE
-# endif
-#endif
-
-/******************************************************************************
-**	Global Parameters
-******************************************************************************/
-flash_info_t flash_info[CFG_MAX_FLASH_BANKS];
-
-/******************************************************************************
-**	Function Prototypes
-******************************************************************************/
-static ulong flash_get_size( vu_long *addr, flash_info_t *info );
-
-static int write_word( flash_info_t *info, ulong dest, ulong data );
-
-static void flash_get_offsets( ulong base, flash_info_t *info );
-
-int wait_for_DQ7( flash_info_t *info, int sect );
-
-/******************************************************************************
-** Function :	flash_init
-** Param    :   void
-** Notes    :   Initializes the Flash Chip
-******************************************************************************/
-ulong flash_init (void)
-{
-	ulong size_b0 = -1;
-	int i;
-	volatile immap_t *immap = (immap_t *) CFG_IMMR;
-	volatile memctl8xx_t *memctl = &immap->im_memctl;
-
-	/* Set Flash to unknown */
-	for (i = 0; i < CFG_MAX_FLASH_BANKS; i++) {
-		flash_info[i].flash_id = FLASH_UNKNOWN;
-	}
-
-	/* Get the Flash Bank Size */
-
-	size_b0 = flash_get_size ((vu_long *) (CFG_FLASH_BASE),
-				  &flash_info[0]);
-
-	if (flash_info[0].flash_id == FLASH_UNKNOWN) {
-		printf ("## UNKNOWN Flash on Bank 0 - Size = 0x%08lx = %ldMB\n",
-			size_b0, size_b0 >> 20);
-	}
-
-	/* Remap Flash according to size detected  */
-	memctl->memc_or0 = 0xFF800774;
-	memctl->memc_br0 = CFG_BR0_PRELIM;
-
-	/* Setup Flash Sector Offsets */
-
-	flash_get_offsets (CFG_FLASH_BASE, &flash_info[0]);
-
-	/* Monitor Protection ON - default */
-
-#if ( CFG_MONITOR_BASE >= CFG_FLASH_BASE  )
-	flash_protect (FLAG_PROTECT_SET, CFG_MONITOR_BASE,
-		       (CFG_MONITOR_BASE + monitor_flash_len - 1),
-		       &flash_info[0]);
-#endif
-
-	/* Protect Environment Variables */
-#ifdef CFG_ENV_IS_IN_FLASH
-	flash_protect (FLAG_PROTECT_SET, CFG_ENV_ADDR,
-		       (CFG_ENV_ADDR + CFG_ENV_SIZE - 1), &flash_info[0]);
-#endif
-
-	return size_b0;
-}
-
-/******************************************************************************
-** Function : flash_get_offsets
-** Param    : ulong base, flash_into_t *info
-** Notes    :
-******************************************************************************/
-static void flash_get_offsets (ulong base, flash_info_t * info)
-{
-	return;
-}
-
-
-/******************************************************************************
-** Function : flash_print_info
-** Param    : flash_info_t
-** Notes    :
-******************************************************************************/
-void flash_print_info (flash_info_t * info)
-{
-	int i;
-
-	if (info->flash_id == FLASH_UNKNOWN) {
-		printf ("Missing or unknown flash type\n");
-		return;
-	}
-
-	switch (info->flash_id & FLASH_VENDMASK) {
-	case FLASH_MAN_AMD:
-		printf ("AMD ");
-		break;
-	case FLASH_MAN_FUJ:
-		printf ("FUJITSU ");
-		break;
-	case FLASH_MAN_BM:
-		printf ("BRIGHT MICRO ");
-		break;
-	default:
-		printf ("Unknown Vendor ");
-		break;
-	}
-
-	switch (info->flash_id & FLASH_TYPEMASK) {
-	case FLASH_AM320B:
-		printf ("AM29LV320B (32 Mbit, bottom boot sect)\n");
-		break;
-	case FLASH_AM320T:
-		printf ("AM29LV320T (32 Mbit, top boot sector)\n");
-		break;
-	default:
-		printf ("Unknown Chip Type\n");
-		break;
-
-	}
-
-	printf ("  Size: %ld MB in %d Sectors\n", info->size >> 20,
-		info->sector_count);
-	printf ("  Sector Start Addresses:");
-
-	for (i = 0; i < info->sector_count; ++i) {
-		if ((i % 5) == 0) {
-			printf ("\n   ");
-		}
-		printf (" %08lX%s",
-			info->start[i],
-			info->protect[i] ? " (RO)" : "     ");
-	}
-	printf ("\n");
-	return;
-}
-
-/******************************************************************************
-** Function : flash_get_size
-** Param    : vu_long *addr, flash_info_t *info
-** Notes    :
-******************************************************************************/
-static ulong flash_get_size (vu_long * addr, flash_info_t * info)
-{
-	short i;
-	FLASH_WORD_SIZE manu_id, dev_id;
-	ulong base = (ulong) addr;
-	volatile FLASH_WORD_SIZE *addr2 = (FLASH_WORD_SIZE *) addr;
-
-	/* Write Auto Select Command and read Manufacturer's ID and Dev ID */
-
-	addr2[ADDR0] = (FLASH_WORD_SIZE) 0xAAAAAAAA;
-	addr2[ADDR1] = (FLASH_WORD_SIZE) 0x55555555;
-	addr2[ADDR0] = (FLASH_WORD_SIZE) 0x90909090;
-
-	manu_id = addr2[0];
-
-	switch (manu_id) {
-	case (FLASH_WORD_SIZE) AMD_MANUFACT:
-		info->flash_id = FLASH_MAN_AMD;
-		break;
-
-	default:
-		info->flash_id = FLASH_UNKNOWN;
-		info->sector_count = 0;
-		info->size = 0;
-		break;
-	}
-
-	/* Read Device Id */
-	dev_id = addr2[1];
-
-	switch (dev_id) {
-	case (FLASH_WORD_SIZE) AMD_ID_LV320B:
-		info->flash_id += FLASH_AM320B;
-		info->sector_count = 71;	/* 8 - boot sec + 63 normal */
-		info->size = 0x400000;	/* 4MByte */
-		break;
-
-	default:
-		info->flash_id = FLASH_UNKNOWN;
-		break;
-	}
-
-	/* Set up sector start Addresses */
-
-	if (info->flash_id & FLASH_BTYPE) {
-		/* set sector offsets for bottom boot block
-		 ** Eight 8 Kb Boot sectors
-		 ** Sixty Three 64Kb sectors
-		 */
-		for (i = 0; i < 8; i++) {
-			info->start[i] = base + (i * 0x00002000);
-		}
-		for (i = 8; i < info->sector_count; i++) {
-			info->start[i] = base + (i * 0x00010000) - 0x00070000;
-		}
-	}
-
-	/* Reset To read mode */
-
-	if (info->flash_id != FLASH_UNKNOWN) {
-		addr = (ulong *) info->start[0];
-		*addr = 0xF0F0F0F0;
-	}
-	return (info->size);
-}
-
-/*******************************************************************************
-** Function : flash_erase
-** Param    : flash_info_t *info, int s_first, int s_last
-** Notes    :
-******************************************************************************/
-int flash_erase (flash_info_t * info, int s_first, int s_last)
-{
-	volatile FLASH_WORD_SIZE *addr = (FLASH_WORD_SIZE *) (info->start[0]);
-	volatile FLASH_WORD_SIZE *addr2;
-	int flag, prot, sect, l_sect;
-	int i;
-
-	if ((s_first < 0) || (s_first > s_last)) {
-		if (info->flash_id == FLASH_UNKNOWN) {
-			printf ("- missing\n");
-		} else {
-			printf ("- no sectors to erase\n");
-		}
-		return 1;
-	}
-
-	if (info->flash_id == FLASH_UNKNOWN) {
-		printf ("Can't erase unknown flash type - aborted\n");
-		return 1;
-	}
-
-	prot = 0;
-	for (sect = s_first; sect <= s_last; ++sect) {
-		if (info->protect[sect]) {
-			prot++;
-		}
-	}
-
-	if (prot) {
-		printf ("Warning: %d protected sectors will not be erased!\n",
-			prot);
-	} else {
-		printf ("\n");
-	}
-
-	l_sect = -1;
-
-	/* Disable interrupts which might cause a timeout here */
-	flag = disable_interrupts ();
-
-	/* Start erase on unprotected sectors */
-	for (sect = s_first; sect <= s_last; sect++) {
-
-		if (info->protect[sect] == 0) {	/* not protected */
-			addr2 = (FLASH_WORD_SIZE *) (info->start[sect]);
-
-			if ((info->flash_id & FLASH_VENDMASK) ==
-			    FLASH_MAN_SST) {
-				addr[ADDR0] = (FLASH_WORD_SIZE) 0x00AA00AA;
-				addr[ADDR1] = (FLASH_WORD_SIZE) 0x00550055;
-				addr[ADDR0] = (FLASH_WORD_SIZE) 0x00800080;
-				addr[ADDR0] = (FLASH_WORD_SIZE) 0x00AA00AA;
-				addr[ADDR1] = (FLASH_WORD_SIZE) 0x00550055;
-				addr2[0] = (FLASH_WORD_SIZE) 0x00500050;	/* block erase */
-				for (i = 0; i < 50; i++)
-					udelay (1000);	/* wait 1 ms */
-			} else {
-				addr[ADDR0] = (FLASH_WORD_SIZE) 0x00AA00AA;
-				addr[ADDR1] = (FLASH_WORD_SIZE) 0x00550055;
-				addr[ADDR0] = (FLASH_WORD_SIZE) 0x00800080;
-				addr[ADDR0] = (FLASH_WORD_SIZE) 0x00AA00AA;
-				addr[ADDR1] = (FLASH_WORD_SIZE) 0x00550055;
-				addr2[0] = (FLASH_WORD_SIZE) 0x00300030;	/* sector erase */
-			}
-			l_sect = sect;
-			/*
-			 * Wait for each sector to complete, it's more
-			 * reliable.  According to AMD Spec, you must
-			 * issue all erase commands within a specified
-			 * timeout.  This has been seen to fail, especially
-			 * if printf()s are included (for debug)!!
-			 */
-			wait_for_DQ7 (info, sect);
-		}
-	}
-	/* re-enable interrupts if necessary */
-	if (flag)
-		enable_interrupts ();
-
-	/* wait at least 80us - let's wait 1 ms */
-	udelay (1000);
-
-	/* reset to read mode */
-	addr = (FLASH_WORD_SIZE *) info->start[0];
-	addr[0] = (FLASH_WORD_SIZE) 0x00F000F0;	/* reset bank */
-
-	printf (" done\n");
-	return 0;
-}
-
-int wait_for_DQ7 (flash_info_t * info, int sect)
-{
-	ulong start, now, last;
-	volatile FLASH_WORD_SIZE *addr =
-		(FLASH_WORD_SIZE *) (info->start[sect]);
-
-	start = get_timer (0);
-	last = start;
-	while ((addr[0] & (FLASH_WORD_SIZE) 0x00800080) !=
-	       (FLASH_WORD_SIZE) 0x00800080) {
-		if ((now = get_timer (start)) > CFG_FLASH_ERASE_TOUT) {
-			printf ("Timeout\n");
-			return -1;
-		}
-		/* show that we're waiting */
-		if ((now - last) > 1000) {
-			putc ('.');
-			last = now;
-		}
-	}
-	return 0;
-}
-
-
-/******************************************************************************
-** Function : write_buff
-** Param    : flash_info_t *info, uchar *src, ulong addr, ulong cnt
-** Notes    :
-******************************************************************************/
-int write_buff (flash_info_t * info, uchar * src, ulong addr, ulong cnt)
-{
-	ulong cp, wp, data;
-	int i, l, rc;
-
-	/* get lower word aligned address */
-	wp = (addr & ~3);
-
-	/*
-	 * handle unaligned start bytes
-	 */
-	if ((l = addr - wp) != 0) {
-		data = 0;
-		for (i = 0, cp = wp; i < l; ++i, ++cp) {
-			data = (data << 8) | (*(uchar *) cp);
-		}
-		for (; i < 4 && cnt > 0; ++i) {
-			data = (data << 8) | *src++;
-			--cnt;
-			++cp;
-		}
-		for (; cnt == 0 && i < 4; ++i, ++cp) {
-			data = (data << 8) | (*(uchar *) cp);
-		}
-
-		if ((rc = write_word (info, wp, data)) != 0) {
-			return (rc);
-		}
-		wp += 4;
-	}
-
-	/*
-	 * handle word aligned part
-	 */
-	while (cnt >= 4) {
-		data = 0;
-		for (i = 0; i < 4; ++i) {
-			data = (data << 8) | *src++;
-		}
-		if ((rc = write_word (info, wp, data)) != 0) {
-			return (rc);
-		}
-		wp += 4;
-		cnt -= 4;
-	}
-
-	if (cnt == 0) {
-		return (0);
-	}
-
-	/*
-	 * handle unaligned tail bytes
-	 */
-	data = 0;
-	for (i = 0, cp = wp; i < 4 && cnt > 0; ++i, ++cp) {
-		data = (data << 8) | *src++;
-		--cnt;
-	}
-	for (; i < 4; ++i, ++cp) {
-		data = (data << 8) | (*(uchar *) cp);
-	}
-
-	return (write_word (info, wp, data));
-}
-
-
-/******************************************************************************
-** Function : write_word
-** Param    : flash_info_t *info, ulong dest, ulong data
-** Notes    :
-******************************************************************************/
-static int write_word (flash_info_t * info, ulong dest, ulong data)
-{
-	volatile FLASH_WORD_SIZE *addr2 =
-		(FLASH_WORD_SIZE *) (info->start[0]);
-	volatile FLASH_WORD_SIZE *dest2 = (FLASH_WORD_SIZE *) dest;
-	volatile FLASH_WORD_SIZE *data2 = (FLASH_WORD_SIZE *) & data;
-	ulong start;
-	int i;
-
-	/* Check if Flash is (sufficiently) erased */
-	if ((*((volatile FLASH_WORD_SIZE *) dest) &
-	     (FLASH_WORD_SIZE) data) != (FLASH_WORD_SIZE) data) {
-		return (2);
-	}
-
-	for (i = 0; i < 4 / sizeof (FLASH_WORD_SIZE); i++) {
-		int flag;
-
-		/* Disable interrupts which might cause a timeout here */
-		flag = disable_interrupts ();
-
-		addr2[ADDR0] = (FLASH_WORD_SIZE) 0x00AA00AA;
-		addr2[ADDR1] = (FLASH_WORD_SIZE) 0x00550055;
-		addr2[ADDR0] = (FLASH_WORD_SIZE) 0x00A000A0;
-
-		dest2[i] = data2[i];
-
-		/* re-enable interrupts if necessary */
-		if (flag)
-			enable_interrupts ();
-
-		/* data polling for D7 */
-		start = get_timer (0);
-		while ((dest2[i] & (FLASH_WORD_SIZE) 0x00800080) !=
-		       (data2[i] & (FLASH_WORD_SIZE) 0x00800080)) {
-			if (get_timer (start) > CFG_FLASH_WRITE_TOUT) {
-				return (1);
-			}
-		}
-	}
-
-	return (0);
-}
--- a/board/adsvix/Makefile
+++ b/board/adsvix/Makefile
@@ -0,0 +1,48 @@
+
+#
+# (C) Copyright 2000
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+include $(TOPDIR)/config.mk
+
+LIB	= lib$(BOARD).a
+
+OBJS	:= adsvix.o pcmcia.o
+SOBJS	:= lowlevel_init.o pxavoltage.o
+
+$(LIB):	$(OBJS) $(SOBJS)
+	$(AR) crv $@ $(OBJS) $(SOBJS)
+
+clean:
+	rm -f $(SOBJS) $(OBJS)
+
+distclean:	clean
+	rm -f $(LIB) core *.bak .depend
+
+#########################################################################
+
+.depend:	Makefile $(SOBJS:.o=.S) $(OBJS:.o=.c)
+		$(CC) -M $(CPPFLAGS) $(SOBJS:.o=.S) $(OBJS:.o=.c) > $@
+
+-include .depend
+
+#########################################################################
--- a/board/adsvix/adsvix.c
+++ b/board/adsvix/adsvix.c
@@ -0,0 +1,77 @@
+/*
+ * (C) Copyright 2004
+ * Robert Whaley, Applied Data Systems, Inc. rwhaley@applieddata.net
+ *
+ * (C) Copyright 2002
+ * Kyle Harris, Nexus Technologies, Inc. kharris@nexus-tech.net
+ *
+ * (C) Copyright 2002
+ * Sysgo Real-Time Solutions, GmbH <www.elinos.com>
+ * Marius Groeger <mgroeger@sysgo.de>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+
+/* ------------------------------------------------------------------------- */
+
+/*
+ * Miscelaneous platform dependent initialisations
+ */
+
+int board_init (void)
+{
+	DECLARE_GLOBAL_DATA_PTR;
+
+	/* memory and cpu-speed are setup before relocation */
+	/* so we do _nothing_ here */
+
+	/* arch number of ADSVIX-Board */
+	gd->bd->bi_arch_number = 620;
+
+	/* adress of boot parameters */
+	gd->bd->bi_boot_params = 0xa000003c;
+
+	return 0;
+}
+
+int board_late_init(void)
+{
+	setenv("stdout", "serial");
+	setenv("stderr", "serial");
+	return 0;
+}
+
+
+int dram_init (void)
+{
+	DECLARE_GLOBAL_DATA_PTR;
+
+	gd->bd->bi_dram[0].start = PHYS_SDRAM_1;
+	gd->bd->bi_dram[0].size = PHYS_SDRAM_1_SIZE;
+	gd->bd->bi_dram[1].start = PHYS_SDRAM_2;
+	gd->bd->bi_dram[1].size = PHYS_SDRAM_2_SIZE;
+	gd->bd->bi_dram[2].start = PHYS_SDRAM_3;
+	gd->bd->bi_dram[2].size = PHYS_SDRAM_3_SIZE;
+	gd->bd->bi_dram[3].start = PHYS_SDRAM_4;
+	gd->bd->bi_dram[3].size = PHYS_SDRAM_4_SIZE;
+
+	return 0;
+}
--- a/board/adsvix/config.mk
+++ b/board/adsvix/config.mk
@@ -0,0 +1 @@
+TEXT_BASE = 0xa1700000
--- a/board/adsvix/lowlevel_init.S
+++ b/board/adsvix/lowlevel_init.S
@@ -0,0 +1,466 @@
+/*
+ * This was originally from the Lubbock u-boot port.
+ *
+ * Most of this taken from Redboot hal_platform_setup.h with cleanup
+ *
+ * NOTE: I haven't clean this up considerably, just enough to get it
+ * running. See hal_platform_setup.h for the source. See
+ * board/cradle/lowlevel_init.S for another PXA250 setup that is
+ * much cleaner.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <config.h>
+#include <version.h>
+#include <asm/arch/pxa-regs.h>
+
+/* wait for coprocessor write complete */
+   .macro CPWAIT reg
+   mrc	p15,0,\reg,c2,c0,0
+   mov	\reg,\reg
+   sub	pc,pc,#4
+   .endm
+
+
+/*
+ *	Memory setup
+ */
+
+.globl lowlevel_init
+lowlevel_init:
+
+	/* Set up GPIO pins first ----------------------------------------- */
+
+	ldr		r0,	=GPSR0
+	ldr		r1,	=CFG_GPSR0_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GPSR1
+	ldr		r1,	=CFG_GPSR1_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GPSR2
+	ldr		r1,	=CFG_GPSR2_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GPSR3
+	ldr		r1,	=CFG_GPSR3_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GPCR0
+	ldr		r1,	=CFG_GPCR0_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GPCR1
+	ldr		r1,	=CFG_GPCR1_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GPCR2
+	ldr		r1,	=CFG_GPCR2_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GPCR3
+	ldr		r1,	=CFG_GPCR3_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GPDR0
+	ldr		r1,	=CFG_GPDR0_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GPDR1
+	ldr		r1,	=CFG_GPDR1_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GPDR2
+	ldr		r1,	=CFG_GPDR2_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GPDR3
+	ldr		r1,	=CFG_GPDR3_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GAFR0_L
+	ldr		r1,	=CFG_GAFR0_L_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GAFR0_U
+	ldr		r1,	=CFG_GAFR0_U_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GAFR1_L
+	ldr		r1,	=CFG_GAFR1_L_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GAFR1_U
+	ldr		r1,	=CFG_GAFR1_U_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GAFR2_L
+	ldr		r1,	=CFG_GAFR2_L_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GAFR2_U
+	ldr		r1,	=CFG_GAFR2_U_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GAFR3_L
+	ldr		r1,	=CFG_GAFR3_L_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=GAFR3_U
+	ldr		r1,	=CFG_GAFR3_U_VAL
+	str		r1,   [r0]
+
+	ldr		r0,	=PSSR		/* enable GPIO pins */
+	ldr		r1,	=CFG_PSSR_VAL
+	str		r1,   [r0]
+
+	/* ---------------------------------------------------------------- */
+	/* Enable memory interface					    */
+	/*								    */
+	/* The sequence below is based on the recommended init steps	    */
+	/* detailed in the Intel PXA250 Operating Systems Developers Guide, */
+	/* Chapter 10.							    */
+	/* ---------------------------------------------------------------- */
+
+	/* ---------------------------------------------------------------- */
+	/* Step 1: Wait for at least 200 microsedonds to allow internal	    */
+	/*	   clocks to settle. Only necessary after hard reset...	    */
+	/*	   FIXME: can be optimized later			    */
+	/* ---------------------------------------------------------------- */
+
+	ldr r3, =OSCR			/* reset the OS Timer Count to zero */
+	mov r2, #0
+	str r2, [r3]
+	ldr r4, =0x300			/* really 0x2E1 is about 200usec,   */
+					/* so 0x300 should be plenty	    */
+1:
+	ldr r2, [r3]
+	cmp r4, r2
+	bgt 1b
+
+mem_init:
+
+	ldr	r1,  =MEMC_BASE		/* get memory controller base addr. */
+
+	/* ---------------------------------------------------------------- */
+	/* Step 2a: Initialize Asynchronous static memory controller	    */
+	/* ---------------------------------------------------------------- */
+
+	/* MSC registers: timing, bus width, mem type			    */
+
+	/* MSC0: nCS(0,1)						    */
+	ldr	r2,   =CFG_MSC0_VAL
+	str	r2,   [r1, #MSC0_OFFSET]
+	ldr	r2,   [r1, #MSC0_OFFSET]	/* read back to ensure	    */
+						/* that data latches	    */
+	/* MSC1: nCS(2,3)						    */
+	ldr	r2,  =CFG_MSC1_VAL
+	str	r2,  [r1, #MSC1_OFFSET]
+	ldr	r2,  [r1, #MSC1_OFFSET]
+
+	/* MSC2: nCS(4,5)						    */
+	ldr	r2,  =CFG_MSC2_VAL
+	str	r2,  [r1, #MSC2_OFFSET]
+	ldr	r2,  [r1, #MSC2_OFFSET]
+
+	/* ---------------------------------------------------------------- */
+	/* Step 2b: Initialize Card Interface				    */
+	/* ---------------------------------------------------------------- */
+
+	/* MECR: Memory Expansion Card Register				    */
+	ldr	r2,  =CFG_MECR_VAL
+	str	r2,  [r1, #MECR_OFFSET]
+	ldr	r2,	[r1, #MECR_OFFSET]
+
+	/* MCMEM0: Card Interface slot 0 timing				    */
+	ldr	r2,  =CFG_MCMEM0_VAL
+	str	r2,  [r1, #MCMEM0_OFFSET]
+	ldr	r2,	[r1, #MCMEM0_OFFSET]
+
+	/* MCMEM1: Card Interface slot 1 timing				    */
+	ldr	r2,  =CFG_MCMEM1_VAL
+	str	r2,  [r1, #MCMEM1_OFFSET]
+	ldr	r2,	[r1, #MCMEM1_OFFSET]
+
+	/* MCATT0: Card Interface Attribute Space Timing, slot 0	    */
+	ldr	r2,  =CFG_MCATT0_VAL
+	str	r2,  [r1, #MCATT0_OFFSET]
+	ldr	r2,	[r1, #MCATT0_OFFSET]
+
+	/* MCATT1: Card Interface Attribute Space Timing, slot 1	    */
+	ldr	r2,  =CFG_MCATT1_VAL
+	str	r2,  [r1, #MCATT1_OFFSET]
+	ldr	r2,	[r1, #MCATT1_OFFSET]
+
+	/* MCIO0: Card Interface I/O Space Timing, slot 0		    */
+	ldr	r2,  =CFG_MCIO0_VAL
+	str	r2,  [r1, #MCIO0_OFFSET]
+	ldr	r2,	[r1, #MCIO0_OFFSET]
+
+	/* MCIO1: Card Interface I/O Space Timing, slot 1		    */
+	ldr	r2,  =CFG_MCIO1_VAL
+	str	r2,  [r1, #MCIO1_OFFSET]
+	ldr	r2,	[r1, #MCIO1_OFFSET]
+
+	/* ---------------------------------------------------------------- */
+	/* Step 2c: Write FLYCNFG  FIXME: what's that???		    */
+	/* ---------------------------------------------------------------- */
+	ldr	r2,  =CFG_FLYCNFG_VAL
+	str	r2,  [r1, #FLYCNFG_OFFSET]
+	str	r2,	[r1, #FLYCNFG_OFFSET]
+
+	/* ---------------------------------------------------------------- */
+	/* Step 2d: Initialize Timing for Sync Memory (SDCLK0)		    */
+	/* ---------------------------------------------------------------- */
+
+	/* Before accessing MDREFR we need a valid DRI field, so we set	    */
+	/* this to power on defaults + DRI field.			    */
+
+	ldr	r4,	[r1, #MDREFR_OFFSET]
+	ldr	r2,	=0xFFF
+	bic	r4,	r4, r2
+
+	ldr	r3,	=CFG_MDREFR_VAL
+	and	r3,	r3,  r2
+
+	orr	r4,	r4, r3
+	str	r4,	[r1, #MDREFR_OFFSET]	/* write back MDREFR	    */
+
+	orr	r4,  r4, #MDREFR_K0RUN
+	orr	r4,  r4, #MDREFR_K0DB4
+	orr	r4,  r4, #MDREFR_K0FREE
+	orr	r4,  r4, #MDREFR_K0DB2
+	orr	r4,  r4, #MDREFR_K1DB2
+	bic	r4,  r4, #MDREFR_K1FREE
+	bic	r4,  r4, #MDREFR_K2FREE
+
+	str	r4,	[r1, #MDREFR_OFFSET]	/* write back MDREFR	    */
+	ldr	r4,  [r1, #MDREFR_OFFSET]
+
+	/* Note: preserve the mdrefr value in r4			    */
+
+
+	/* ---------------------------------------------------------------- */
+	/* Step 3: Initialize Synchronous Static Memory (Flash/Peripherals) */
+	/* ---------------------------------------------------------------- */
+
+	/* Initialize SXCNFG register. Assert the enable bits		    */
+
+	/* Write SXMRS to cause an MRS command to all enabled banks of	    */
+	/* synchronous static memory. Note that SXLCR need not be written   */
+	/* at this time.						    */
+
+	ldr	r2,  =CFG_SXCNFG_VAL
+	str	r2,  [r1, #SXCNFG_OFFSET]
+
+	/* ---------------------------------------------------------------- */
+	/* Step 4: Initialize SDRAM					    */
+	/* ---------------------------------------------------------------- */
+
+	bic	r4, r4, #(MDREFR_K2FREE |MDREFR_K1FREE | MDREFR_K0FREE)
+
+	orr	r4, r4, #MDREFR_K1RUN
+	bic	r4, r4, #MDREFR_K2DB2
+	str	r4, [r1, #MDREFR_OFFSET]
+	ldr	r4, [r1, #MDREFR_OFFSET]
+
+	bic	r4, r4, #MDREFR_SLFRSH
+	str	r4, [r1, #MDREFR_OFFSET]
+	ldr	r4, [r1, #MDREFR_OFFSET]
+
+	orr	r4, r4, #MDREFR_E1PIN
+	str	r4, [r1, #MDREFR_OFFSET]
+	ldr	r4, [r1, #MDREFR_OFFSET]
+
+	nop
+	nop
+
+
+	/* Step 4d: write MDCNFG with MDCNFG:DEx deasserted (set to 0), to  */
+	/*	    configure but not enable each SDRAM partition pair.	    */
+
+	ldr	r4,	=CFG_MDCNFG_VAL
+	bic	r4,	r4,	#(MDCNFG_DE0|MDCNFG_DE1)
+	bic	r4,	r4,	#(MDCNFG_DE2|MDCNFG_DE3)
+
+	str	r4,	[r1, #MDCNFG_OFFSET]	/* write back MDCNFG	    */
+	ldr	r4,	[r1, #MDCNFG_OFFSET]
+
+
+	/* Step 4e: Wait for the clock to the SDRAMs to stabilize,	    */
+	/*	    100..200 <20>sec.					    */
+
+	ldr r3, =OSCR			/* reset the OS Timer Count to zero */
+	mov r2, #0
+	str r2, [r3]
+	ldr r4, =0x300			/* really 0x2E1 is about 200usec,   */
+					/* so 0x300 should be plenty	    */
+1:
+	    ldr r2, [r3]
+	    cmp r4, r2
+	    bgt 1b
+
+
+	/* Step 4f: Trigger a number (usually 8) refresh cycles by	    */
+	/*	    attempting non-burst read or write accesses to disabled */
+	/*	    SDRAM, as commonly specified in the power up sequence   */
+	/*	    documented in SDRAM data sheets. The address(es) used   */
+	/*	    for this purpose must not be cacheable.		    */
+
+	ldr	r3,	=CFG_DRAM_BASE
+	str	r2,	[r3]
+	str	r2,	[r3]
+	str	r2,	[r3]
+	str	r2,	[r3]
+	str	r2,	[r3]
+	str	r2,	[r3]
+	str	r2,	[r3]
+	str	r2,	[r3]
+
+
+	/* Step 4g: Write MDCNFG with enable bits asserted		    */
+	/*	    (MDCNFG:DEx set to 1).				    */
+
+	ldr	r3,	[r1, #MDCNFG_OFFSET]
+	mov	r4, r3
+	orr	r3,	r3,	#MDCNFG_DE0
+	str	r3,	[r1, #MDCNFG_OFFSET]
+	mov	r0, r3
+
+	/* Step 4h: Write MDMRS.					    */
+
+	ldr	r2,  =CFG_MDMRS_VAL
+	str	r2,  [r1, #MDMRS_OFFSET]
+
+	/* enable APD */
+	ldr	r3,  [r1, #MDREFR_OFFSET]
+	orr	r3,  r3,  #MDREFR_APD
+	str	r3,  [r1, #MDREFR_OFFSET]
+
+	/* We are finished with Intel's memory controller initialisation    */
+
+setvoltage:
+
+	mov	r10,	lr
+	bl	initPXAvoltage	/* In case the board is rebooting with a    */
+	mov	lr,	r10	/* low voltage raise it up to a good one.   */
+
+wakeup:
+	/* Are we waking from sleep? */
+	ldr	r0,	=RCSR
+	ldr	r1,	[r0]
+	and	r1,	r1, #(RCSR_GPR | RCSR_SMR | RCSR_WDR | RCSR_HWR)
+	str	r1,	[r0]
+	teq	r1,	#RCSR_SMR
+
+	bne	initirqs
+
+	ldr	r0,	=PSSR
+	mov	r1,	#PSSR_PH
+	str	r1,	[r0]
+
+	/* if so, resume at PSPR */
+	ldr	r0,	=PSPR
+	ldr	r1,	[r0]
+	mov	pc,	r1
+
+	/* ---------------------------------------------------------------- */
+	/* Disable (mask) all interrupts at interrupt controller	    */
+	/* ---------------------------------------------------------------- */
+
+initirqs:
+
+	mov	r1,  #0		/* clear int. level register (IRQ, not FIQ) */
+	ldr	r2,  =ICLR
+	str	r1,  [r2]
+
+	ldr	r2,  =ICMR	/* mask all interrupts at the controller    */
+	str	r1,  [r2]
+
+	/* ---------------------------------------------------------------- */
+	/* Clock initialisation						    */
+	/* ---------------------------------------------------------------- */
+
+initclks:
+
+	/* Disable the peripheral clocks, and set the core clock frequency  */
+
+	/* Turn Off on-chip peripheral clocks (except for memory)	    */
+	/* for re-configuration.					    */
+	ldr	r1,  =CKEN
+	ldr	r2,  =CFG_CKEN
+	str	r2,  [r1]
+
+	/* ... and write the core clock config register			    */
+	ldr	r2,  =CFG_CCCR
+	ldr	r1,  =CCCR
+	str	r2,  [r1]
+
+	/* Turn on turbo mode */
+	mrc	p14, 0, r2, c6, c0, 0
+	orr	r2, r2, #0xB		/* Turbo, Fast-Bus, Freq change**/
+	mcr	p14, 0, r2, c6, c0, 0
+
+	/* Re-write MDREFR */
+	ldr	r1, =MEMC_BASE
+	ldr	r2, [r1, #MDREFR_OFFSET]
+	str	r2, [r1, #MDREFR_OFFSET]
+#ifdef RTC
+	/* enable the 32Khz oscillator for RTC and PowerManager		    */
+	ldr	r1,  =OSCC
+	mov	r2,  #OSCC_OON
+	str	r2,  [r1]
+
+	/* NOTE:  spin here until OSCC.OOK get set, meaning the PLL	    */
+	/* has settled.							    */
+60:
+	ldr	r2, [r1]
+	ands	r2, r2, #1
+	beq	60b
+#else
+#error "RTC not defined"
+#endif
+
+	/* Interrupt init: Mask all interrupts				    */
+    ldr r0, =ICMR /* enable no sources */
+	mov r1, #0
+    str r1, [r0]
+	/* FIXME */
+
+#ifdef NODEBUG
+	/*Disable software and data breakpoints */
+	mov	r0,#0
+	mcr	p15,0,r0,c14,c8,0  /* ibcr0 */
+	mcr	p15,0,r0,c14,c9,0  /* ibcr1 */
+	mcr	p15,0,r0,c14,c4,0  /* dbcon */
+
+	/*Enable all debug functionality */
+	mov	r0,#0x80000000
+	mcr	p14,0,r0,c10,c0,0  /* dcsr */
+#endif
+
+	/* ---------------------------------------------------------------- */
+	/* End lowlevel_init							    */
+	/* ---------------------------------------------------------------- */
+
+endlowlevel_init:
+
+	mov	pc, lr
--- a/board/adsvix/pcmcia.c
+++ b/board/adsvix/pcmcia.c
@@ -0,0 +1,67 @@
+/*
+ * (C) Copyright 2004
+ * Robert Whaley, Applied Data Systems, Inc. rwhaley@applieddata.net
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <asm/arch/pxa-regs.h>
+
+void pcmcia_power_on(void)
+{
+#if 0
+	if (!(GPLR(20) & GPIO_bit(20))) { /* 3.3V */
+		GPCR(81) = GPIO_bit(81);
+		GPSR(82) = GPIO_bit(82);
+	}
+	else if (!(GPLR(21) & GPIO_bit(21))) { /* 5.0V */
+		GPCR(81) = GPIO_bit(81);
+		GPCR(82) = GPIO_bit(82);
+	}
+#else
+#warning "Board will only supply 5V, wait for next HW spin for selectable power"
+	/* 5.0V */
+	GPCR(81) = GPIO_bit(81);
+	GPCR(82) = GPIO_bit(82);
+#endif
+
+	udelay(300000);
+
+	/* reset the card */
+	GPSR(52) = GPIO_bit(52);
+
+	/* enable PCMCIA */
+	GPCR(83) = GPIO_bit(83);
+
+	/* clear reset */
+	udelay(10);
+	GPCR(52) = GPIO_bit(52);
+
+	udelay(20000);
+}
+
+void pcmcia_power_off(void)
+{
+	/* 0V */
+	GPSR(81) = GPIO_bit(81);
+	GPSR(82) = GPIO_bit(82);
+	/* disable PCMCIA */
+	GPSR(83) = GPIO_bit(83);
+}
--- a/board/adsvix/pxavoltage.S
+++ b/board/adsvix/pxavoltage.S
@@ -0,0 +1,230 @@
+/*
+ * (C) Copyright 2004
+ * Robert Whaley, Applied Data Systems, Inc. rwhaley@applieddata.net
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <asm/arch/pxa-regs.h>
+
+#define LTC1663_ADDR    0x20
+
+#define LTC1663_SY	0x01	/* Sync ACK */
+#define LTC1663_SD	0x04	/* shutdown */
+#define LTC1663_BG	0x04	/* Internal Voltage Ref */
+
+#define VOLT_1_55         18    /* DAC value for 1.55V */
+
+		.global	initPXAvoltage
+
+@ Set the voltage to 1.55V early in the boot process so we can run
+@ at a high clock speed and boot quickly.  Note that this is necessary
+@ because the reset button does not reset the CPU voltage, so if the
+@ voltage was low (say 0.85V) then the CPU would crash without this
+@ routine
+
+@ This routine clobbers r0-r4
+
+initializei2c:
+
+		ldr	r2, =CKEN
+		ldr	r3, [r2]
+		orr	r3, r3, #CKEN15_PWRI2C
+		str	r3, [r2]
+
+		ldr	r2, =PCFR
+		ldr	r3, [r2]
+		orr	r3, r3, #PCFR_PI2C_EN
+		str	r3, [r2]
+
+		/* delay for about 250msec
+		 */
+		ldr	r3, =OSCR
+		mov	r2, #0
+		str	r2, [r3]
+		ldr	r1, =0xC0000
+
+1:
+		ldr	r2, [r3]
+		cmp	r1, r2
+		bgt	1b
+		ldr	r0, =PWRICR
+		ldr	r1, [r0]
+		bic	r1, r1, #(ICR_MA | ICR_START | ICR_STOP)
+		str	r1, [r0]
+
+		orr	r1, r1, #ICR_UR
+		str	r1, [r0]
+
+		ldr	r2, =PWRISR
+		ldr	r3, =0x7ff
+		str	r3, [r2]
+
+		bic	r1, r1, #ICR_UR
+		str	r1, [r0]
+
+		mov	r1, #(ICR_GCD | ICR_SCLE)
+		str	r1, [r0]
+
+		orr	r1, r1, #ICR_IUE
+		str	r1, [r0]
+
+		orr	r1, r1, #ICR_FM
+		str	r1, [r0]
+
+		/* delay for about 1msec
+		 */
+		ldr	r3, =OSCR
+		mov	r2, #0
+		str	r2, [r3]
+		ldr	r1, =0xC00
+
+1:
+		ldr	r2, [r3]
+		cmp	r1, r2
+		bgt	1b
+		mov	pc, lr
+
+sendbytei2c:
+		ldr	r3, =PWRIDBR
+		str	r0, [r3]
+		ldr	r3, =PWRICR
+		ldr	r0, [r3]
+		orr	r0, r0, r1
+		bic	r0, r0, r2
+		str	r0, [r3]
+		orr	r0, r0, #ICR_TB
+		str	r0, [r3]
+
+		mov	r2, #0x100000
+
+waitfortxemptyi2c:
+
+		ldr	r0, =PWRISR
+		ldr	r1, [r0]
+
+		/* take it from the top if we don't get empty after a while */
+		subs	r2, r2, #1
+		moveq	lr, r4
+		beq	initPXAvoltage
+
+		tst	r1, #ISR_ITE
+
+		beq	waitfortxemptyi2c
+
+		orr	r1, r1, #ISR_ITE
+		str	r1, [r0]
+
+		mov	pc, lr
+
+initPXAvoltage:
+
+		mov	r4, lr
+
+		bl	setleds
+
+		bl	initializei2c
+
+		bl	setleds
+
+		/* now send the real message to set the correct voltage */
+		ldr	r0, =LTC1663_ADDR
+		mov	r0, r0, LSL #1
+		mov	r1, #ICR_START
+		ldr	r2, =(ICR_STOP | ICR_ALDIE | ICR_ACKNAK)
+		bl	sendbytei2c
+
+		bl	setleds
+
+		mov	r0, #LTC1663_BG
+		mov	r1, #0
+		mov	r2, #(ICR_STOP | ICR_START)
+		bl	sendbytei2c
+
+		bl	setleds
+
+		ldr	r0, =VOLT_1_55
+		and	r0, r0, #0xff
+		mov	r1, #0
+		mov	r2, #(ICR_STOP | ICR_START)
+		bl	sendbytei2c
+
+		bl	setleds
+
+		ldr	r0, =VOLT_1_55
+		mov	r0, r0, ASR #8
+		and	r0, r0, #0xff
+		mov	r1, #ICR_STOP
+		mov	r2, #ICR_START
+		bl	sendbytei2c
+
+		bl	setleds
+
+		@ delay a little for the volatage to stablize
+		ldr	r3, =OSCR
+		mov	r2, #0
+		str	r2, [r3]
+		ldr	r1, =0xC0
+
+1:
+		ldr	r2, [r3]
+		cmp	r1, r2
+		bgt	1b
+		mov	pc, r4
+
+setleds:
+	mov		pc, lr
+
+	ldr		r5, =0x40e00058
+	ldr		r3, [r5]
+	bic		r3, r3, #0x3
+	str		r3, [r5]
+	ldr		r5, =0x40e0000c
+	ldr		r3, [r5]
+	orr		r3, r3, #0x00010000
+	str		r3, [r5]
+
+	@ inner loop
+	mov		r0, #0x2
+1:
+
+	ldr		r5, =0x40e00018
+	mov		r3, #0x00010000
+	str		r3, [r5]
+
+	@ outer loop
+	mov		r3, #0x00F00000
+2:
+	subs		r3, r3, #1
+	bne		2b
+
+	ldr		r5, =0x40e00024
+	mov		r3, #0x00010000
+	str		r3, [r5]
+
+	@ outer loop
+	mov		r3, #0x00F00000
+3:
+	subs		r3, r3, #1
+	bne		3b
+
+	subs		r0, r0, #1
+	bne		1b
+
+	mov		pc, lr
--- a/board/adsvix/u-boot.lds
+++ b/board/adsvix/u-boot.lds
@@ -0,0 +1,55 @@
+/*
+ * (C) Copyright 2000
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+OUTPUT_FORMAT("elf32-littlearm", "elf32-littlearm", "elf32-littlearm")
+OUTPUT_ARCH(arm)
+ENTRY(_start)
+SECTIONS
+{
+	. = 0x00000000;
+
+	. = ALIGN(4);
+	.text      :
+	{
+	  cpu/pxa/start.o	(.text)
+	  *(.text)
+	}
+
+	. = ALIGN(4);
+	.rodata : { *(.rodata) }
+
+	. = ALIGN(4);
+	.data : { *(.data) }
+
+	. = ALIGN(4);
+	.got : { *(.got) }
+
+	__u_boot_cmd_start = .;
+	.u_boot_cmd : { *(.u_boot_cmd) }
+	__u_boot_cmd_end = .;
+
+	. = ALIGN(4);
+	__bss_start = .;
+	.bss : { *(.bss) }
+	_end = .;
+}
--- a/board/alaska/Makefile
+++ b/board/alaska/Makefile
@@ -0,0 +1,45 @@
+# (C) Copyright 2003-2005
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+include $(TOPDIR)/config.mk
+
+LIB	= lib$(BOARD).a
+
+OBJS	:= $(BOARD).o flash.o
+
+$(LIB):	$(OBJS) $(SOBJS)
+	$(AR) crv $@ $(OBJS)
+
+clean:
+	rm -f $(SOBJS) $(OBJS)
+
+distclean:	clean
+	rm -f $(LIB) core *.bak .depend
+
+#########################################################################
+
+.depend:	Makefile $(SOBJS:.o=.S) $(OBJS:.o=.c)
+		$(CC) -M $(CPPFLAGS) $(SOBJS:.o=.S) $(OBJS:.o=.c) > $@
+
+-include .depend
+
+#########################################################################
--- a/board/alaska/alaska.c
+++ b/board/alaska/alaska.c
@@ -0,0 +1,153 @@
+/*
+ * (C) Copyright 2004, Freescale Inc.
+ * TsiChung Liew, Tsi-Chung.Liew@freescale.com
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <mpc8220.h>
+#include <asm/processor.h>
+#include <asm/mmu.h>
+
+void setupBat (ulong size)
+{
+	ulong batu, batl;
+	int blocksize = 0;
+
+	/* Flash 0 */
+#if defined (CFG_AMD_BOOT)
+	batu = CFG_FLASH0_BASE | (BL_512K << 2) | BPP_RW | BPP_RX;
+#else
+	batu = CFG_FLASH0_BASE | (BL_16M << 2) | BPP_RW | BPP_RX;
+#endif
+	batl = CFG_FLASH0_BASE | 0x22;
+	write_bat (IBAT0, batu, batl);
+	write_bat (DBAT0, batu, batl);
+
+	/* Flash 1 */
+#if defined (CFG_AMD_BOOT)
+	batu = CFG_FLASH1_BASE | (BL_16M << 2) | BPP_RW | BPP_RX;
+#else
+	batu = CFG_FLASH1_BASE | (BL_512K << 2) | BPP_RW | BPP_RX;
+#endif
+	batl = CFG_FLASH1_BASE | 0x22;
+	write_bat (IBAT1, batu, batl);
+	write_bat (DBAT1, batu, batl);
+
+	/* CPLD */
+	batu = CFG_CPLD_BASE | (BL_512K << 2) | BPP_RW | BPP_RX;
+	batl = CFG_CPLD_BASE | 0x22;
+	write_bat (IBAT2, 0, 0);
+	write_bat (DBAT2, batu, batl);
+
+	/* FPGA */
+	batu = CFG_FPGA_BASE | (BL_512K << 2) | BPP_RW | BPP_RX;
+	batl = CFG_FPGA_BASE | 0x22;
+	write_bat (IBAT3, 0, 0);
+	write_bat (DBAT3, batu, batl);
+
+	/* MBAR - Data only */
+	batu = CFG_MBAR | BPP_RW | BPP_RX;
+	batl = CFG_MBAR | 0x22;
+	mtspr (IBAT4L, 0);
+	mtspr (IBAT4U, 0);
+	mtspr (DBAT4L, batl);
+	mtspr (DBAT4U, batu);
+
+	/* MBAR - SRAM */
+	batu = CFG_SRAM_BASE | BPP_RW | BPP_RX;
+	batl = CFG_SRAM_BASE | 0x42;
+	mtspr (IBAT5L, batl);
+	mtspr (IBAT5U, batu);
+	mtspr (DBAT5L, batl);
+	mtspr (DBAT5U, batu);
+
+	if (size <= 0x800000)	/* 8MB */
+		blocksize = BL_8M << 2;
+	else if (size <= 0x1000000)	/* 16MB */
+		blocksize = BL_16M << 2;
+	else if (size <= 0x2000000)	/* 32MB */
+		blocksize = BL_32M << 2;
+	else if (size <= 0x4000000)	/* 64MB */
+		blocksize = BL_64M << 2;
+	else if (size <= 0x8000000)	/* 128MB */
+		blocksize = BL_128M << 2;
+	else if (size <= 0x10000000)	/* 256MB */
+		blocksize = BL_256M << 2;
+
+	/* Memory */
+	batu = CFG_SDRAM_BASE | blocksize | BPP_RW | BPP_RX;
+	batl = CFG_SDRAM_BASE | 0x42;
+	mtspr (IBAT6L, batl);
+	mtspr (IBAT6U, batu);
+	mtspr (DBAT6L, batl);
+	mtspr (DBAT6U, batu);
+
+	/* memory size is less than 256MB */
+	if (size <= 0x10000000) {
+		/* Nothing */
+		batu = 0;
+		batl = 0;
+	} else {
+		size -= 0x10000000;
+		if (size <= 0x800000)	/* 8MB */
+			blocksize = BL_8M << 2;
+		else if (size <= 0x1000000)	/* 16MB */
+			blocksize = BL_16M << 2;
+		else if (size <= 0x2000000)	/* 32MB */
+			blocksize = BL_32M << 2;
+		else if (size <= 0x4000000)	/* 64MB */
+			blocksize = BL_64M << 2;
+		else if (size <= 0x8000000)	/* 128MB */
+			blocksize = BL_128M << 2;
+		else if (size <= 0x10000000)	/* 256MB */
+			blocksize = BL_256M << 2;
+
+		batu = (CFG_SDRAM_BASE +
+			0x10000000) | blocksize | BPP_RW | BPP_RX;
+		batl = (CFG_SDRAM_BASE + 0x10000000) | 0x42;
+	}
+
+	mtspr (IBAT7L, batl);
+	mtspr (IBAT7U, batu);
+	mtspr (DBAT7L, batl);
+	mtspr (DBAT7U, batu);
+}
+
+long int initdram (int board_type)
+{
+	ulong size;
+
+	size = dramSetup ();
+
+/* if iCache ad dCache is defined */
+#if (CONFIG_COMMANDS & CFG_CMD_CACHE)
+/*    setupBat(size);*/
+#endif
+
+	return size;
+}
+
+int checkboard (void)
+{
+	puts ("Board: Alaska MPC8220 Evaluation Board\n");
+
+	return 0;
+}
--- a/board/alaska/config.mk
+++ b/board/alaska/config.mk
@@ -0,0 +1,31 @@
+#
+# (C) Copyright 2003-2004
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+#
+# alaska board
+#
+
+TEXT_BASE = 0xfff00000
+# TEXT_BASE = 0x00100000
+
+PLATFORM_CPPFLAGS += -DTEXT_BASE=$(TEXT_BASE) -I$(TOPDIR)/board
--- a/board/alaska/flash.c
+++ b/board/alaska/flash.c
@@ -0,0 +1,807 @@
+/*
+ * (C) Copyright 2001
+ * Kyle Harris, Nexus Technologies, Inc. kharris@nexus-tech.net
+ *
+ * (C) Copyright 2001-2004
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <linux/byteorder/swab.h>
+
+
+flash_info_t flash_info[CFG_MAX_FLASH_BANKS];	/* info for FLASH chips    */
+
+/* Board support for 1 or 2 flash devices */
+#define FLASH_PORT_WIDTH8
+
+typedef unsigned char FLASH_PORT_WIDTH;
+typedef volatile unsigned char FLASH_PORT_WIDTHV;
+
+#define SWAP(x)         (x)
+
+/* Intel-compatible flash ID */
+#define INTEL_COMPAT    0x89
+#define INTEL_ALT       0xB0
+
+/* Intel-compatible flash commands */
+#define INTEL_PROGRAM   0x10
+#define INTEL_ERASE     0x20
+#define INTEL_CLEAR     0x50
+#define INTEL_LOCKBIT   0x60
+#define INTEL_PROTECT   0x01
+#define INTEL_STATUS    0x70
+#define INTEL_READID    0x90
+#define INTEL_CONFIRM   0xD0
+#define INTEL_RESET     0xFF
+
+/* Intel-compatible flash status bits */
+#define INTEL_FINISHED  0x80
+#define INTEL_OK        0x80
+
+#define FPW             FLASH_PORT_WIDTH
+#define FPWV            FLASH_PORT_WIDTHV
+
+#define FLASH_CYCLE1    0x0555
+#define FLASH_CYCLE2    0x02aa
+
+#define WR_BLOCK        0x20
+
+/*-----------------------------------------------------------------------
+ * Functions
+ */
+static ulong flash_get_size (FPW * addr, flash_info_t * info);
+static int write_data (flash_info_t * info, ulong dest, FPW data);
+static int write_data_block (flash_info_t * info, ulong src, ulong dest);
+static int write_word_amd (flash_info_t * info, FPWV * dest, FPW data);
+static void flash_get_offsets (ulong base, flash_info_t * info);
+void inline spin_wheel (void);
+
+/*-----------------------------------------------------------------------
+ */
+
+unsigned long flash_init (void)
+{
+	int i;
+	ulong size = 0;
+	ulong fsize = 0;
+
+	for (i = 0; i < CFG_MAX_FLASH_BANKS; i++) {
+		memset (&flash_info[i], 0, sizeof (flash_info_t));
+
+		switch (i) {
+		case 0:
+			flash_get_size ((FPW *) CFG_FLASH1_BASE,
+					&flash_info[i]);
+			flash_get_offsets (CFG_FLASH1_BASE, &flash_info[i]);
+			break;
+		case 1:
+			flash_get_size ((FPW *) CFG_FLASH1_BASE,
+					&flash_info[i]);
+			fsize = CFG_FLASH1_BASE + flash_info[i - 1].size;
+			flash_get_offsets (fsize, &flash_info[i]);
+			break;
+		case 2:
+			flash_get_size ((FPW *) CFG_FLASH0_BASE,
+					&flash_info[i]);
+			flash_get_offsets (CFG_FLASH0_BASE, &flash_info[i]);
+			break;
+		case 3:
+			flash_get_size ((FPW *) CFG_FLASH0_BASE,
+					&flash_info[i]);
+			fsize = CFG_FLASH0_BASE + flash_info[i - 1].size;
+			flash_get_offsets (fsize, &flash_info[i]);
+			break;
+		default:
+			panic ("configured to many flash banks!\n");
+			break;
+		}
+		size += flash_info[i].size;
+	}
+
+	/* Protect monitor and environment sectors
+	 */
+#if defined (CFG_AMD_BOOT)
+	flash_protect (FLAG_PROTECT_SET,
+		       CFG_MONITOR_BASE,
+		       CFG_MONITOR_BASE + monitor_flash_len - 1,
+		       &flash_info[2]);
+	flash_protect (FLAG_PROTECT_SET,
+		       CFG_INTEL_BASE,
+		       CFG_INTEL_BASE + monitor_flash_len - 1,
+		       &flash_info[1]);
+#else
+	flash_protect (FLAG_PROTECT_SET,
+		       CFG_MONITOR_BASE,
+		       CFG_MONITOR_BASE + monitor_flash_len - 1,
+		       &flash_info[3]);
+	flash_protect (FLAG_PROTECT_SET,
+		       CFG_AMD_BASE,
+		       CFG_AMD_BASE + monitor_flash_len - 1, &flash_info[0]);
+#endif
+
+	flash_protect (FLAG_PROTECT_SET,
+		       CFG_ENV1_ADDR,
+		       CFG_ENV1_ADDR + CFG_ENV1_SIZE - 1, &flash_info[1]);
+	flash_protect (FLAG_PROTECT_SET,
+		       CFG_ENV_ADDR,
+		       CFG_ENV_ADDR + CFG_ENV_SIZE - 1, &flash_info[3]);
+
+	return size;
+}
+
+/*-----------------------------------------------------------------------
+ */
+static void flash_get_offsets (ulong base, flash_info_t * info)
+{
+	int i;
+
+	if (info->flash_id == FLASH_UNKNOWN)
+		return;
+
+	if ((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_AMD) {
+		for (i = 0; i < info->sector_count; i++) {
+			info->start[i] = base + (i * PHYS_AMD_SECT_SIZE);
+			info->protect[i] = 0;
+		}
+	}
+
+	if ((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_INTEL) {
+		for (i = 0; i < info->sector_count; i++) {
+			info->start[i] = base + (i * PHYS_INTEL_SECT_SIZE);
+			info->protect[i] = 0;
+		}
+	}
+}
+
+/*-----------------------------------------------------------------------
+ */
+void flash_print_info (flash_info_t * info)
+{
+	int i;
+
+	if (info->flash_id == FLASH_UNKNOWN) {
+		printf ("missing or unknown FLASH type\n");
+		return;
+	}
+
+	switch (info->flash_id & FLASH_VENDMASK) {
+	case FLASH_MAN_INTEL:
+		printf ("INTEL ");
+		break;
+	case FLASH_MAN_AMD:
+		printf ("AMD ");
+		break;
+	default:
+		printf ("Unknown Vendor ");
+		break;
+	}
+
+	switch (info->flash_id & FLASH_TYPEMASK) {
+	case FLASH_28F128J3A:
+		printf ("28F128J3A\n");
+		break;
+
+	case FLASH_AM040:
+		printf ("AMD29F040B\n");
+		break;
+
+	default:
+		printf ("Unknown Chip Type\n");
+		break;
+	}
+
+	printf ("  Size: %ld MB in %d Sectors\n",
+		info->size >> 20, info->sector_count);
+
+	printf ("  Sector Start Addresses:");
+	for (i = 0; i < info->sector_count; ++i) {
+		if ((i % 5) == 0)
+			printf ("\n   ");
+		printf (" %08lX%s",
+			info->start[i], info->protect[i] ? " (RO)" : "     ");
+	}
+	printf ("\n");
+	return;
+}
+
+/*
+ * The following code cannot be run from FLASH!
+ */
+static ulong flash_get_size (FPW * addr, flash_info_t * info)
+{
+	FPWV value;
+	static int amd = 0;
+
+	/* Write auto select command: read Manufacturer ID */
+	/* Write auto select command sequence and test FLASH answer */
+	addr[FLASH_CYCLE1] = (FPW) 0x00AA00AA;	/* for AMD, Intel ignores this */
+	__asm__ ("sync");
+	addr[FLASH_CYCLE2] = (FPW) 0x00550055;	/* for AMD, Intel ignores this */
+	__asm__ ("sync");
+	addr[FLASH_CYCLE1] = (FPW) 0x00900090;	/* selects Intel or AMD */
+	__asm__ ("sync");
+
+	udelay (100);
+
+	switch (addr[0] & 0xff) {
+
+	case (uchar) AMD_MANUFACT:
+		info->flash_id = FLASH_MAN_AMD;
+		value = addr[1];
+		break;
+
+	case (uchar) INTEL_MANUFACT:
+		info->flash_id = FLASH_MAN_INTEL;
+		value = addr[2];
+		break;
+
+	default:
+		printf ("unknown\n");
+		info->flash_id = FLASH_UNKNOWN;
+		info->sector_count = 0;
+		info->size = 0;
+		addr[0] = (FPW) 0x00FF00FF;	/* restore read mode */
+		return (0);	/* no or unknown flash  */
+	}
+
+	switch (value) {
+
+	case (FPW) INTEL_ID_28F128J3A:
+		info->flash_id += FLASH_28F128J3A;
+		info->sector_count = 64;
+		info->size = 0x00800000;	/* => 16 MB     */
+		break;
+
+	case (FPW) AMD_ID_LV040B:
+		info->flash_id += FLASH_AM040;
+		if (amd == 0) {
+			info->sector_count = 7;
+			info->size = 0x00070000;	/* => 448 KB     */
+			amd = 1;
+		} else {
+			/* for Environment settings */
+			info->sector_count = 1;
+			info->size = PHYS_AMD_SECT_SIZE;	/* => 64 KB     */
+			amd = 0;
+		}
+		break;
+
+	default:
+		info->flash_id = FLASH_UNKNOWN;
+		break;
+	}
+
+	if (info->sector_count > CFG_MAX_FLASH_SECT) {
+		printf ("** ERROR: sector count %d > max (%d) **\n",
+			info->sector_count, CFG_MAX_FLASH_SECT);
+		info->sector_count = CFG_MAX_FLASH_SECT;
+	}
+
+	if (value == (FPW) INTEL_ID_28F128J3A)
+		addr[0] = (FPW) 0x00FF00FF;	/* restore read mode */
+	else
+		addr[0] = (FPW) 0x00F000F0;	/* restore read mode */
+
+	return (info->size);
+}
+
+
+/*-----------------------------------------------------------------------
+ */
+int flash_erase (flash_info_t * info, int s_first, int s_last)
+{
+	int flag, prot, sect;
+	ulong type, start, last;
+	int rcode = 0, intel = 0;
+
+	if ((s_first < 0) || (s_first > s_last)) {
+		if (info->flash_id == FLASH_UNKNOWN)
+			printf ("- missing\n");
+		else
+			printf ("- no sectors to erase\n");
+		return 1;
+	}
+
+	type = (info->flash_id & FLASH_VENDMASK);
+	if ((type != FLASH_MAN_INTEL)) {
+		type = (info->flash_id & FLASH_VENDMASK);
+		if ((type != FLASH_MAN_AMD)) {
+			printf ("Can't erase unknown flash type %08lx - aborted\n",
+				info->flash_id);
+			return 1;
+		}
+	}
+
+	if (type == FLASH_MAN_INTEL)
+		intel = 1;
+
+	prot = 0;
+	for (sect = s_first; sect <= s_last; ++sect) {
+		if (info->protect[sect]) {
+			prot++;
+		}
+	}
+
+	if (prot) {
+		printf ("- Warning: %d protected sectors will not be erased!\n", prot);
+	} else {
+		printf ("\n");
+	}
+
+	start = get_timer (0);
+	last = start;
+
+	/* Disable interrupts which might cause a timeout here */
+	flag = disable_interrupts ();
+
+	/* Start erase on unprotected sectors */
+	for (sect = s_first; sect <= s_last; sect++) {
+		if (info->protect[sect] == 0) {	/* not protected */
+			FPWV *addr = (FPWV *) (info->start[sect]);
+			FPW status;
+
+			printf ("Erasing sector %2d ... ", sect);
+
+			/* arm simple, non interrupt dependent timer */
+			start = get_timer (0);
+
+			if (intel) {
+				*addr = (FPW) 0x00500050;	/* clear status register */
+				*addr = (FPW) 0x00200020;	/* erase setup */
+				*addr = (FPW) 0x00D000D0;	/* erase confirm */
+			} else {
+				FPWV *base;	/* first address in bank */
+
+				base = (FPWV *) (CFG_AMD_BASE);
+				base[FLASH_CYCLE1] = (FPW) 0x00AA00AA;	/* unlock */
+				base[FLASH_CYCLE2] = (FPW) 0x00550055;	/* unlock */
+				base[FLASH_CYCLE1] = (FPW) 0x00800080;	/* erase mode */
+				base[FLASH_CYCLE1] = (FPW) 0x00AA00AA;	/* unlock */
+				base[FLASH_CYCLE2] = (FPW) 0x00550055;	/* unlock */
+				*addr = (FPW) 0x00300030;	/* erase sector */
+			}
+
+			while (((status =
+				 *addr) & (FPW) 0x00800080) !=
+			       (FPW) 0x00800080) {
+				if (get_timer (start) > CFG_FLASH_ERASE_TOUT) {
+					printf ("Timeout\n");
+					if (intel) {
+						*addr = (FPW) 0x00B000B0;	/* suspend erase     */
+						*addr = (FPW) 0x00FF00FF;	/* reset to read mode */
+					} else
+						*addr = (FPW) 0x00F000F0;	/* reset to read mode */
+
+					rcode = 1;
+					break;
+				}
+			}
+
+			if (intel) {
+				*addr = (FPW) 0x00500050;	/* clear status register cmd.   */
+				*addr = (FPW) 0x00FF00FF;	/* resest to read mode          */
+			} else
+				*addr = (FPW) 0x00F000F0;	/* reset to read mode */
+
+			printf (" done\n");
+		}
+	}
+	return rcode;
+}
+
+/*-----------------------------------------------------------------------
+ * Copy memory to flash, returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ * 4 - Flash not identified
+ */
+
+int write_buff (flash_info_t * info, uchar * src, ulong addr, ulong cnt)
+{
+	if (info->flash_id == FLASH_UNKNOWN) {
+		return 4;
+	}
+
+	switch (info->flash_id & FLASH_VENDMASK) {
+	case FLASH_MAN_AMD:
+	    {
+		FPW data = 0;	/* 16 or 32 bit word, matches flash bus width */
+		int bytes;	/* number of bytes to program in current word */
+		int left;	/* number of bytes left to program */
+		int i, res;
+
+		for (left = cnt, res = 0;
+		     left > 0 && res == 0;
+		     addr += sizeof (data), left -=
+		     sizeof (data) - bytes) {
+
+			bytes = addr & (sizeof (data) - 1);
+			addr &= ~(sizeof (data) - 1);
+
+			/* combine source and destination data so can program
+			 * an entire word of 16 or 32 bits
+			 */
+			for (i = 0; i < sizeof (data); i++) {
+				data <<= 8;
+				if (i < bytes || i - bytes >= left)
+					data += *((uchar *) addr + i);
+				else
+					data += *src++;
+			}
+
+			res = write_word_amd (info, (FPWV *) addr,
+					      data);
+		}
+		return res;
+	    }		/* case FLASH_MAN_AMD */
+
+	case FLASH_MAN_INTEL:
+	    {
+		ulong cp, wp;
+		FPW data;
+		int count, i, l, rc, port_width;
+
+		/* get lower word aligned address */
+		wp = addr;
+		port_width = 1;
+
+		/*
+		 * handle unaligned start bytes
+		 */
+		if ((l = addr - wp) != 0) {
+			data = 0;
+			for (i = 0, cp = wp; i < l; ++i, ++cp) {
+				data = (data << 8) | (*(uchar *) cp);
+			}
+
+			for (; i < port_width && cnt > 0; ++i) {
+				data = (data << 8) | *src++;
+				--cnt;
+				++cp;
+			}
+
+			for (; cnt == 0 && i < port_width; ++i, ++cp)
+				data = (data << 8) | (*(uchar *) cp);
+
+			if ((rc =
+			     write_data (info, wp, SWAP (data))) != 0)
+				return (rc);
+			wp += port_width;
+		}
+
+		if (cnt > WR_BLOCK) {
+			/*
+			 * handle word aligned part
+			 */
+			count = 0;
+			while (cnt >= WR_BLOCK) {
+
+				if ((rc =
+				     write_data_block (info,
+						       (ulong) src,
+						       wp)) != 0)
+					return (rc);
+
+				wp += WR_BLOCK;
+				src += WR_BLOCK;
+				cnt -= WR_BLOCK;
+
+				if (count++ > 0x800) {
+					spin_wheel ();
+					count = 0;
+				}
+			}
+		}
+
+		if (cnt < WR_BLOCK) {
+			/*
+			 * handle word aligned part
+			 */
+			count = 0;
+			while (cnt >= port_width) {
+				data = 0;
+				for (i = 0; i < port_width; ++i)
+					data = (data << 8) | *src++;
+
+				if ((rc =
+				     write_data (info, wp,
+						 SWAP (data))) != 0)
+					return (rc);
+
+				wp += port_width;
+				cnt -= port_width;
+				if (count++ > 0x800) {
+					spin_wheel ();
+					count = 0;
+				}
+			}
+		}
+
+		if (cnt == 0)
+			return (0);
+
+		/*
+		 * handle unaligned tail bytes
+		 */
+		data = 0;
+		for (i = 0, cp = wp; i < port_width && cnt > 0;
+		     ++i, ++cp) {
+			data = (data << 8) | *src++;
+			--cnt;
+		}
+
+		for (; i < port_width; ++i, ++cp)
+			data = (data << 8) | (*(uchar *) cp);
+
+		return (write_data (info, wp, SWAP (data)));
+	    }		/* case FLASH_MAN_INTEL */
+
+	}			/* switch */
+	return (0);
+}
+
+/*-----------------------------------------------------------------------
+ * Write a word or halfword to Flash, returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ */
+static int write_data (flash_info_t * info, ulong dest, FPW data)
+{
+	FPWV *addr = (FPWV *) dest;
+	ulong start;
+	int flag;
+
+	/* Check if Flash is (sufficiently) erased */
+	if ((*addr & data) != data) {
+		printf ("not erased at %08lx (%lx)\n", (ulong) addr, *addr);
+		return (2);
+	}
+	/* Disable interrupts which might cause a timeout here */
+	flag = disable_interrupts ();
+
+	*addr = (FPW) 0x00400040;	/* write setup */
+	*addr = data;
+
+	/* arm simple, non interrupt dependent timer */
+	start = get_timer (0);
+
+	/* wait while polling the status register */
+	while ((*addr & (FPW) 0x00800080) != (FPW) 0x00800080) {
+		if (get_timer (start) > CFG_FLASH_WRITE_TOUT) {
+			*addr = (FPW) 0x00FF00FF;	/* restore read mode */
+			return (1);
+		}
+	}
+
+	*addr = (FPW) 0x00FF00FF;	/* restore read mode */
+
+	return (0);
+}
+
+/*-----------------------------------------------------------------------
+ * Write a word or halfword to Flash, returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ */
+static int write_data_block (flash_info_t * info, ulong src, ulong dest)
+{
+	FPWV *srcaddr = (FPWV *) src;
+	FPWV *dstaddr = (FPWV *) dest;
+	ulong start;
+	int flag, i;
+
+	/* Check if Flash is (sufficiently) erased */
+	for (i = 0; i < WR_BLOCK; i++)
+		if ((*dstaddr++ & 0xff) != 0xff) {
+			printf ("not erased at %08lx (%lx)\n",
+				(ulong) dstaddr, *dstaddr);
+			return (2);
+		}
+
+	dstaddr = (FPWV *) dest;
+
+	/* Disable interrupts which might cause a timeout here */
+	flag = disable_interrupts ();
+
+	*dstaddr = (FPW) 0x00e800e8;	/* write block setup */
+
+	/* arm simple, non interrupt dependent timer */
+	start = get_timer (0);
+
+	/* wait while polling the status register */
+	while ((*dstaddr & (FPW) 0x00800080) != (FPW) 0x00800080) {
+		if (get_timer (start) > CFG_FLASH_WRITE_TOUT) {
+			*dstaddr = (FPW) 0x00FF00FF;	/* restore read mode */
+			return (1);
+		}
+	}
+
+	*dstaddr = (FPW) 0x001f001f;	/* write 32 to buffer */
+	for (i = 0; i < WR_BLOCK; i++)
+		*dstaddr++ = *srcaddr++;
+
+	dstaddr -= 1;
+	*dstaddr = (FPW) 0x00d000d0;	/* write 32 to buffer */
+
+	/* arm simple, non interrupt dependent timer */
+	start = get_timer (0);
+
+	/* wait while polling the status register */
+	while ((*dstaddr & (FPW) 0x00800080) != (FPW) 0x00800080) {
+		if (get_timer (start) > CFG_FLASH_WRITE_TOUT) {
+			*dstaddr = (FPW) 0x00FF00FF;	/* restore read mode */
+			return (1);
+		}
+	}
+
+	*dstaddr = (FPW) 0x00FF00FF;	/* restore read mode */
+
+	return (0);
+}
+
+/*-----------------------------------------------------------------------
+ * Write a word to Flash for AMD FLASH
+ * A word is 16 or 32 bits, whichever the bus width of the flash bank
+ * (not an individual chip) is.
+ *
+ * returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ */
+static int write_word_amd (flash_info_t * info, FPWV * dest, FPW data)
+{
+	ulong start;
+	int flag;
+	int res = 0;		/* result, assume success */
+	FPWV *base;		/* first address in flash bank */
+
+	/* Check if Flash is (sufficiently) erased */
+	if ((*dest & data) != data) {
+		return (2);
+	}
+
+	base = (FPWV *) (CFG_AMD_BASE);
+
+	/* Disable interrupts which might cause a timeout here */
+	flag = disable_interrupts ();
+
+	base[FLASH_CYCLE1] = (FPW) 0x00AA00AA;	/* unlock */
+	base[FLASH_CYCLE2] = (FPW) 0x00550055;	/* unlock */
+	base[FLASH_CYCLE1] = (FPW) 0x00A000A0;	/* selects program mode */
+
+	*dest = data;		/* start programming the data */
+
+	/* re-enable interrupts if necessary */
+	if (flag)
+		enable_interrupts ();
+
+	start = get_timer (0);
+
+	/* data polling for D7 */
+	while (res == 0
+	       && (*dest & (FPW) 0x00800080) != (data & (FPW) 0x00800080)) {
+		if (get_timer (start) > CFG_FLASH_WRITE_TOUT) {
+			*dest = (FPW) 0x00F000F0;	/* reset bank */
+			res = 1;
+		}
+	}
+
+	return (res);
+}
+
+void inline spin_wheel (void)
+{
+	static int p = 0;
+	static char w[] = "\\/-";
+
+	printf ("\010%c", w[p]);
+	(++p == 3) ? (p = 0) : 0;
+}
+
+/*-----------------------------------------------------------------------
+ * Set/Clear sector's lock bit, returns:
+ * 0 - OK
+ * 1 - Error (timeout, voltage problems, etc.)
+ */
+int flash_real_protect (flash_info_t * info, long sector, int prot)
+{
+	ulong start;
+	int i;
+	int rc = 0;
+	FPWV *addr = (FPWV *) (info->start[sector]);
+	int flag = disable_interrupts ();
+
+	/*
+	 * 29F040B AMD flash does not support software protection/unprotection,
+	 * the only way to protect the AMD flash is marked it as prot bit.
+	 * This flash only support hardware protection, by supply or not supply
+	 * 12vpp to the flash
+	 */
+	if ((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_AMD) {
+		info->protect[sector] = prot;
+
+		return 0;
+	}
+
+	*addr = INTEL_CLEAR;	/* Clear status register    */
+	if (prot) {		/* Set sector lock bit      */
+		*addr = INTEL_LOCKBIT;	/* Sector lock bit          */
+		*addr = INTEL_PROTECT;	/* set                      */
+	} else {		/* Clear sector lock bit    */
+		*addr = INTEL_LOCKBIT;	/* All sectors lock bits    */
+		*addr = INTEL_CONFIRM;	/* clear                    */
+	}
+
+	start = get_timer (0);
+
+	while ((*addr & INTEL_FINISHED) != INTEL_FINISHED) {
+		if (get_timer (start) > CFG_FLASH_UNLOCK_TOUT) {
+			printf ("Flash lock bit operation timed out\n");
+			rc = 1;
+			break;
+		}
+	}
+
+	if (*addr != INTEL_OK) {
+		printf ("Flash lock bit operation failed at %08X, CSR=%08X\n",
+			(uint) addr, (uint) * addr);
+		rc = 1;
+	}
+
+	if (!rc)
+		info->protect[sector] = prot;
+
+	/*
+	 * Clear lock bit command clears all sectors lock bits, so
+	 * we have to restore lock bits of protected sectors.
+	 */
+	if (!prot) {
+		for (i = 0; i < info->sector_count; i++) {
+			if (info->protect[i]) {
+				start = get_timer (0);
+				addr = (FPWV *) (info->start[i]);
+				*addr = INTEL_LOCKBIT;	/* Sector lock bit  */
+				*addr = INTEL_PROTECT;	/* set              */
+				while ((*addr & INTEL_FINISHED) !=
+				       INTEL_FINISHED) {
+					if (get_timer (start) >
+					    CFG_FLASH_UNLOCK_TOUT) {
+						printf ("Flash lock bit operation timed out\n");
+						rc = 1;
+						break;
+					}
+				}
+			}
+		}
+	}
+
+	if (flag)
+		enable_interrupts ();
+
+	*addr = INTEL_RESET;	/* Reset to read array mode */
+
+	return rc;
+}
--- a/board/alaska/u-boot.lds
+++ b/board/alaska/u-boot.lds
@@ -0,0 +1,122 @@
+/*
+ * (C) Copyright 2003-2004
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+OUTPUT_ARCH(powerpc)
+SEARCH_DIR(/lib); SEARCH_DIR(/usr/lib); SEARCH_DIR(/usr/local/lib); SEARCH_DIR(/usr/local/powerpc-any-elf/lib);
+/* Do we need any of these for elf?
+   __DYNAMIC = 0;    */
+SECTIONS
+{
+  /* Read-only sections, merged into text segment: */
+  . = + SIZEOF_HEADERS;
+  .interp : { *(.interp) }
+  .hash          : { *(.hash)		}
+  .dynsym        : { *(.dynsym)		}
+  .dynstr        : { *(.dynstr)		}
+  .rel.text      : { *(.rel.text)		}
+  .rela.text     : { *(.rela.text) 	}
+  .rel.data      : { *(.rel.data)		}
+  .rela.data     : { *(.rela.data) 	}
+  .rel.rodata    : { *(.rel.rodata) 	}
+  .rela.rodata   : { *(.rela.rodata) 	}
+  .rel.got       : { *(.rel.got)		}
+  .rela.got      : { *(.rela.got)		}
+  .rel.ctors     : { *(.rel.ctors)	}
+  .rela.ctors    : { *(.rela.ctors)	}
+  .rel.dtors     : { *(.rel.dtors)	}
+  .rela.dtors    : { *(.rela.dtors)	}
+  .rel.bss       : { *(.rel.bss)		}
+  .rela.bss      : { *(.rela.bss)		}
+  .rel.plt       : { *(.rel.plt)		}
+  .rela.plt      : { *(.rela.plt)		}
+  .init          : { *(.init)	}
+  .plt : { *(.plt) }
+  .text      :
+  {
+    cpu/mpc8220/start.o	(.text)
+    *(.text)
+    *(.fixup)
+    *(.got1)
+    . = ALIGN(16);
+    *(.rodata)
+    *(.rodata1)
+    *(.rodata.str1.4)
+  }
+  .fini      : { *(.fini)    } =0
+  .ctors     : { *(.ctors)   }
+  .dtors     : { *(.dtors)   }
+
+  /* Read-write section, merged into data segment: */
+  . = (. + 0x0FFF) & 0xFFFFF000;
+  _erotext = .;
+  PROVIDE (erotext = .);
+  .reloc   :
+  {
+    *(.got)
+    _GOT2_TABLE_ = .;
+    *(.got2)
+    _FIXUP_TABLE_ = .;
+    *(.fixup)
+  }
+  __got2_entries = (_FIXUP_TABLE_ - _GOT2_TABLE_) >> 2;
+  __fixup_entries = (. - _FIXUP_TABLE_) >> 2;
+
+  .data    :
+  {
+    *(.data)
+    *(.data1)
+    *(.sdata)
+    *(.sdata2)
+    *(.dynamic)
+    CONSTRUCTORS
+  }
+  _edata  =  .;
+  PROVIDE (edata = .);
+
+  __u_boot_cmd_start = .;
+  .u_boot_cmd : { *(.u_boot_cmd) }
+  __u_boot_cmd_end = .;
+
+
+  __start___ex_table = .;
+  __ex_table : { *(__ex_table) }
+  __stop___ex_table = .;
+
+  . = ALIGN(4096);
+  __init_begin = .;
+  .text.init : { *(.text.init) }
+  .data.init : { *(.data.init) }
+  . = ALIGN(4096);
+  __init_end = .;
+
+  __bss_start = .;
+  .bss       :
+  {
+   *(.sbss) *(.scommon)
+   *(.dynbss)
+   *(.bss)
+   *(COMMON)
+  }
+  _end = . ;
+  PROVIDE (end = .);
+}
--- a/board/altera/dk1c20/vectors.S
+++ b/board/altera/dk1c20/vectors.S
@@ -38,6 +38,8 @@
 *	_cwp_lolimit	-Handles register window underflows.
 *	_cwp_hilimit	-Handles register window overflows.
 *	_timebase_int	-Increments the timebase.
+ *	_brkpt_hw_int	-Hardware breakpoint handler.
+ *	_brkpt_sw_int	-Software breakpoint handler.
 *	_def_xhandler	-Default exception handler.
 *
 * _timebase_int handles a Nios Timer interrupt and increments the
@@ -58,9 +60,8 @@ _vectors:
 	.long	_def_xhandler@h		/* Vector 0  - NMI */
 	.long	_cwp_lolimit@h		/* Vector 1  -  underflow */
 	.long	_cwp_hilimit@h		/* Vector 2  - overflow	*/
-
-	.long	_def_xhandler@h		/* Vector 3 - GNUPro debug */
-	.long	_def_xhandler@h		/* Vector 4 - GNUPro debug */
+	.long	_brkpt_hw_int@h		/* Vector 3 - Breakpoint */
+	.long	_brkpt_sw_int@h		/* Vector 4 - Single step*/
 	.long	_def_xhandler@h		/* Vector 5 - GNUPro debug */
 	.long	_def_xhandler@h		/* Vector 6 - future reserved */
 	.long	_def_xhandler@h		/* Vector 7 - future reserved */
--- a/board/assabet/assabet.c
+++ b/board/assabet/assabet.c
@@ -101,7 +101,7 @@ board_init(void)
 {
 	DECLARE_GLOBAL_DATA_PTR;

-	gd->bd->bi_arch_number = 25;	/* Intel Assabet Board */
+	gd->bd->bi_arch_number = MACH_TYPE_ASSABET;
 	gd->bd->bi_boot_params = 0xc0000100;

 	neponset_init();
--- a/board/assabet/setup.S
+++ b/board/assabet/setup.S
@@ -80,8 +80,8 @@ BCR_DB1110:	.long	ASSABET_BCR_DB1110
 LEDS:		.long	NEPONSET_LEDS


-	.globl memsetup
-memsetup:
+	.globl lowlevel_init
+lowlevel_init:

 	/* Setting up the memory and stuff */

--- a/board/at91rm9200dk/Makefile
+++ b/board/at91rm9200dk/Makefile
@@ -25,8 +25,7 @@ include $(TOPDIR)/config.mk

 LIB	= lib$(BOARD).a

-OBJS	:= at91rm9200dk.o flash.o
-SOBJS	:=
+OBJS	:= at91rm9200dk.o at45.o dm9161.o flash.o

 $(LIB):	$(OBJS) $(SOBJS)
 	$(AR) crv $@ $(OBJS) $(SOBJS)
--- a/board/at91rm9200dk/at45.c
+++ b/board/at91rm9200dk/at45.c
@@ -25,7 +25,14 @@
 #ifdef CONFIG_HAS_DATAFLASH
 #include <dataflash.h>

-#define SPI_CLK 5000000
+#define AT91C_SPI_CLK	10000000	/* Max Value = 10MHz to be compliant to
+the Continuous Array Read function */
+
+/* AC Characteristics */
+/* DLYBS = tCSS = 250ns min and DLYBCT = tCSH = 250ns */
+#define DATAFLASH_TCSS	(0xC << 16)
+#define DATAFLASH_TCHS	(0x1 << 24)
+
 #define AT91C_TIMEOUT_WRDY			200000
 #define AT91C_SPI_PCS0_SERIAL_DATAFLASH		0xE     /* Chip Select 0 : NPCS0 %1110 */
 #define AT91C_SPI_PCS3_DATAFLASH_CARD		0x7     /* Chip Select 3 : NPCS3 %0111 */
@@ -50,9 +57,11 @@ void AT91F_SpiInit(void) {
 	AT91C_BASE_SPI->SPI_MR = AT91C_SPI_MSTR | AT91C_SPI_MODFDIS | AT91C_SPI_PCS;

 	/* Configure CS0 and CS3 */
-	*(AT91C_SPI_CSR + 0) = AT91C_SPI_CPOL | (AT91C_SPI_DLYBS & 0x100000) | ((AT91C_MASTER_CLOCK / (2*SPI_CLK)) << 8);
+	*(AT91C_SPI_CSR + 0) = AT91C_SPI_CPOL | (AT91C_SPI_DLYBS & DATAFLASH_TCSS) | (AT91C_SPI_DLYBCT &
+	DATAFLASH_TCHS) | ((AT91C_MASTER_CLOCK / (2*AT91C_SPI_CLK)) << 8);

-	*(AT91C_SPI_CSR + 3) = AT91C_SPI_CPOL | (AT91C_SPI_DLYBS & 0x100000) | ((AT91C_MASTER_CLOCK / (2*SPI_CLK)) << 8);
+	*(AT91C_SPI_CSR + 3) = AT91C_SPI_CPOL | (AT91C_SPI_DLYBS & DATAFLASH_TCSS) | (AT91C_SPI_DLYBCT &
+	DATAFLASH_TCHS) | ((AT91C_MASTER_CLOCK / (2*AT91C_SPI_CLK)) << 8);

 }

--- a/board/at91rm9200dk/at91rm9200dk.c
+++ b/board/at91rm9200dk/at91rm9200dk.c
@@ -45,7 +45,7 @@ int board_init (void)
 	/* so we do _nothing_ here */

 	/* arch number of AT91RM9200DK-Board */
-	gd->bd->bi_arch_number = 251;
+	gd->bd->bi_arch_number = MACH_TYPE_AT91RM9200;
 	/* adress of boot parameters */
 	gd->bd->bi_boot_params = PHYS_SDRAM + 0x100;

@@ -102,6 +102,10 @@ void nand_init (void)
 	*AT91C_PIOB_PER = AT91C_PIO_PB1;	/* enable direct output enable */
 	*AT91C_PIOB_ODR = AT91C_PIO_PB1;	/* disable output */

+	/* PIOB and PIOC clock enabling */
+	*AT91C_PMC_PCER = 1 << AT91C_ID_PIOB;
+	*AT91C_PMC_PCER = 1 << AT91C_ID_PIOC;
+
 	if (*AT91C_PIOB_PDSR & AT91C_PIO_PB1)
 		printf ("  No SmartMedia card inserted\n");
 #ifdef DEBUG
--- a/board/at91rm9200dk/config.mk
+++ b/board/at91rm9200dk/config.mk
@@ -1 +1 @@
-TEXT_BASE = 0x21f80000
+TEXT_BASE = 0x21f00000
--- a/board/at91rm9200dk/dm9161.c
+++ b/board/at91rm9200dk/dm9161.c
@@ -0,0 +1,243 @@
+/*
+ * (C) Copyright 2003
+ * Author : Hamid Ikdoumi (Atmel)
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <at91rm9200_net.h>
+#include <net.h>
+#include <dm9161.h>
+
+#ifdef CONFIG_DRIVER_ETHER
+
+#if (CONFIG_COMMANDS & CFG_CMD_NET)
+
+/*
+ * Name:
+ *	dm9161_IsPhyConnected
+ * Description:
+ *	Reads the 2 PHY ID registers
+ * Arguments:
+ *	p_mac - pointer to AT91S_EMAC struct
+ * Return value:
+ *	TRUE - if id read successfully
+ *	FALSE- if error
+ */
+static unsigned int dm9161_IsPhyConnected (AT91PS_EMAC p_mac)
+{
+	unsigned short Id1, Id2;
+
+	at91rm9200_EmacEnableMDIO (p_mac);
+	at91rm9200_EmacReadPhy (p_mac, DM9161_PHYID1, &Id1);
+	at91rm9200_EmacReadPhy (p_mac, DM9161_PHYID2, &Id2);
+	at91rm9200_EmacDisableMDIO (p_mac);
+
+	if ((Id1 == (DM9161_PHYID1_OUI >> 6)) &&
+		((Id2 >> 10) == (DM9161_PHYID1_OUI & DM9161_LSB_MASK)))
+		return TRUE;
+
+	return FALSE;
+}
+
+/*
+ * Name:
+ *	dm9161_GetLinkSpeed
+ * Description:
+ *	Link parallel detection status of MAC is checked and set in the
+ *	MAC configuration registers
+ * Arguments:
+ *	p_mac - pointer to MAC
+ * Return value:
+ *	TRUE - if link status set succesfully
+ *	FALSE - if link status not set
+ */
+static UCHAR dm9161_GetLinkSpeed (AT91PS_EMAC p_mac)
+{
+	unsigned short stat1, stat2;
+
+	if (!at91rm9200_EmacReadPhy (p_mac, DM9161_BMSR, &stat1))
+		return FALSE;
+
+	if (!(stat1 & DM9161_LINK_STATUS))	/* link status up? */
+		return FALSE;
+
+	if (!at91rm9200_EmacReadPhy (p_mac, DM9161_DSCSR, &stat2))
+		return FALSE;
+
+	if ((stat1 & DM9161_100BASE_TX_FD) && (stat2 & DM9161_100FDX)) {
+		/*set Emac for 100BaseTX and Full Duplex  */
+		p_mac->EMAC_CFG |= AT91C_EMAC_SPD | AT91C_EMAC_FD;
+		return TRUE;
+	}
+
+	if ((stat1 & DM9161_10BASE_T_FD) && (stat2 & DM9161_10FDX)) {
+		/*set MII for 10BaseT and Full Duplex  */
+		p_mac->EMAC_CFG = (p_mac->EMAC_CFG &
+				~(AT91C_EMAC_SPD | AT91C_EMAC_FD))
+				| AT91C_EMAC_FD;
+		return TRUE;
+	}
+
+	if ((stat1 & DM9161_100BASE_T4_HD) && (stat2 & DM9161_100HDX)) {
+		/*set MII for 100BaseTX and Half Duplex  */
+		p_mac->EMAC_CFG = (p_mac->EMAC_CFG &
+				~(AT91C_EMAC_SPD | AT91C_EMAC_FD))
+				| AT91C_EMAC_SPD;
+		return TRUE;
+	}
+
+	if ((stat1 & DM9161_10BASE_T_HD) && (stat2 & DM9161_10HDX)) {
+		/*set MII for 10BaseT and Half Duplex  */
+		p_mac->EMAC_CFG &= ~(AT91C_EMAC_SPD | AT91C_EMAC_FD);
+		return TRUE;
+	}
+	return FALSE;
+}
+
+
+/*
+ * Name:
+ *	dm9161_InitPhy
+ * Description:
+ *	MAC starts checking its link by using parallel detection and
+ *	Autonegotiation and the same is set in the MAC configuration registers
+ * Arguments:
+ *	p_mac - pointer to struct AT91S_EMAC
+ * Return value:
+ *	TRUE - if link status set succesfully
+ *	FALSE - if link status not set
+ */
+static UCHAR dm9161_InitPhy (AT91PS_EMAC p_mac)
+{
+	UCHAR ret = TRUE;
+	unsigned short IntValue;
+
+	at91rm9200_EmacEnableMDIO (p_mac);
+
+	if (!dm9161_GetLinkSpeed (p_mac)) {
+		/* Try another time */
+		ret = dm9161_GetLinkSpeed (p_mac);
+	}
+
+	/* Disable PHY Interrupts */
+	at91rm9200_EmacReadPhy (p_mac, DM9161_MDINTR, &IntValue);
+	/* clear FDX, SPD, Link, INTR masks */
+	IntValue &= ~(DM9161_FDX_MASK | DM9161_SPD_MASK |
+		      DM9161_LINK_MASK | DM9161_INTR_MASK);
+	at91rm9200_EmacWritePhy (p_mac, DM9161_MDINTR, &IntValue);
+	at91rm9200_EmacDisableMDIO (p_mac);
+
+	return (ret);
+}
+
+
+/*
+ * Name:
+ *	dm9161_AutoNegotiate
+ * Description:
+ *	MAC Autonegotiates with the partner status of same is set in the
+ *	MAC configuration registers
+ * Arguments:
+ *	dev - pointer to struct net_device
+ * Return value:
+ *	TRUE - if link status set successfully
+ *	FALSE - if link status not set
+ */
+static UCHAR dm9161_AutoNegotiate (AT91PS_EMAC p_mac, int *status)
+{
+	unsigned short value;
+	unsigned short PhyAnar;
+	unsigned short PhyAnalpar;
+
+	/* Set dm9161 control register */
+	if (!at91rm9200_EmacReadPhy (p_mac, DM9161_BMCR, &value))
+		return FALSE;
+	value &= ~DM9161_AUTONEG;	/* remove autonegotiation enable */
+	value |= DM9161_ISOLATE;	/* Electrically isolate PHY */
+	if (!at91rm9200_EmacWritePhy (p_mac, DM9161_BMCR, &value))
+		return FALSE;
+
+	/* Set the Auto_negotiation Advertisement Register */
+	/* MII advertising for Next page, 100BaseTxFD and HD, 10BaseTFD and HD, IEEE 802.3 */
+	PhyAnar = DM9161_NP | DM9161_TX_FDX | DM9161_TX_HDX |
+		  DM9161_10_FDX | DM9161_10_HDX | DM9161_AN_IEEE_802_3;
+	if (!at91rm9200_EmacWritePhy (p_mac, DM9161_ANAR, &PhyAnar))
+		return FALSE;
+
+	/* Read the Control Register     */
+	if (!at91rm9200_EmacReadPhy (p_mac, DM9161_BMCR, &value))
+		return FALSE;
+
+	value |= DM9161_SPEED_SELECT | DM9161_AUTONEG | DM9161_DUPLEX_MODE;
+	if (!at91rm9200_EmacWritePhy (p_mac, DM9161_BMCR, &value))
+		return FALSE;
+	/* Restart Auto_negotiation  */
+	value |= DM9161_RESTART_AUTONEG;
+	if (!at91rm9200_EmacWritePhy (p_mac, DM9161_BMCR, &value))
+		return FALSE;
+
+	/*check AutoNegotiate complete */
+	udelay (10000);
+	at91rm9200_EmacReadPhy (p_mac, DM9161_BMSR, &value);
+	if (!(value & DM9161_AUTONEG_COMP))
+		return FALSE;
+
+	/* Get the AutoNeg Link partner base page */
+	if (!at91rm9200_EmacReadPhy (p_mac, DM9161_ANLPAR, &PhyAnalpar))
+		return FALSE;
+
+	if ((PhyAnar & DM9161_TX_FDX) && (PhyAnalpar & DM9161_TX_FDX)) {
+		/*set MII for 100BaseTX and Full Duplex  */
+		p_mac->EMAC_CFG |= AT91C_EMAC_SPD | AT91C_EMAC_FD;
+		return TRUE;
+	}
+
+	if ((PhyAnar & DM9161_10_FDX) && (PhyAnalpar & DM9161_10_FDX)) {
+		/*set MII for 10BaseT and Full Duplex  */
+		p_mac->EMAC_CFG = (p_mac->EMAC_CFG &
+				~(AT91C_EMAC_SPD | AT91C_EMAC_FD))
+				| AT91C_EMAC_FD;
+		return TRUE;
+	}
+	return FALSE;
+}
+
+
+/*
+ * Name:
+ *	at91rm92000_GetPhyInterface
+ * Description:
+ *	Initialise the interface functions to the PHY
+ * Arguments:
+ *	None
+ * Return value:
+ *	None
+ */
+void at91rm92000_GetPhyInterface(AT91PS_PhyOps p_phyops)
+{
+	p_phyops->Init = dm9161_InitPhy;
+	p_phyops->IsPhyConnected = dm9161_IsPhyConnected;
+	p_phyops->GetLinkSpeed = dm9161_GetLinkSpeed;
+	p_phyops->AutoNegotiate = dm9161_AutoNegotiate;
+}
+
+#endif	/* CONFIG_COMMANDS & CFG_CMD_NET */
+
+#endif	/* CONFIG_DRIVER_ETHER */
--- a/board/at91rm9200dk/flash.c
+++ b/board/at91rm9200dk/flash.c
@@ -44,18 +44,20 @@ OrgDef OrgAT49BV16x4[] =
 {
 	{  8,  8*1024 },	/*   8 *  8 kBytes sectors */
 	{  2, 32*1024 },	/*   2 * 32 kBytes sectors */
-	{ 30, 64*1024 } /* 30 * 64kBytes sectors */
+	{ 30, 64*1024 },	/*  30 * 64 kBytes sectors */
 };

 OrgDef OrgAT49BV16x4A[] =
 {
 	{  8,  8*1024 },	/*   8 *  8 kBytes sectors */
-	{ 31, 64*1024 } /* 31 * 64kBytes sectors */
+	{ 31, 64*1024 },	/*  31 * 64 kBytes sectors */
 };

-
-#define FLASH_BANK_SIZE 0x200000	/* 2 MB */
-#define MAIN_SECT_SIZE  0x10000		/* 64 KB */
+OrgDef OrgAT49BV6416[] =
+{
+	{   8,  8*1024 },	/*   8 *  8 kBytes sectors */
+	{ 127, 64*1024 },	/* 127 * 64 kBytes sectors */
+};

 flash_info_t    flash_info[CFG_MAX_FLASH_BANKS];

@@ -73,13 +75,11 @@ flash_info_t    flash_info[CFG_MAX_FLASH_BANKS];
 #define CMD_ERASE_CONFIRM	0x0030
 #define CMD_PROGRAM		0x00A0
 #define CMD_UNLOCK_BYPASS	0x0020
+#define CMD_SECTOR_UNLOCK	0x0070

 #define MEM_FLASH_ADDR1		(*(volatile u16 *)(CFG_FLASH_BASE + (0x00005555<<1)))
 #define MEM_FLASH_ADDR2		(*(volatile u16 *)(CFG_FLASH_BASE + (0x00002AAA<<1)))

-#define IDENT_FLASH_ADDR1	(*(volatile u16 *)(CFG_FLASH_BASE + (0x0000555<<1)))
-#define IDENT_FLASH_ADDR2	(*(volatile u16 *)(CFG_FLASH_BASE + (0x0000AAA<<1)))
-
 #define BIT_ERASE_DONE		0x0080
 #define BIT_RDY_MASK		0x0080
 #define BIT_PROGRAM_ERROR	0x0020
@@ -95,17 +95,17 @@ void flash_identification (flash_info_t * info)
 {
 	volatile u16 manuf_code, device_code, add_device_code;

-	IDENT_FLASH_ADDR1 = FLASH_CODE1;
-	IDENT_FLASH_ADDR2 = FLASH_CODE2;
-	IDENT_FLASH_ADDR1 = ID_IN_CODE;
+	MEM_FLASH_ADDR1 = FLASH_CODE1;
+	MEM_FLASH_ADDR2 = FLASH_CODE2;
+	MEM_FLASH_ADDR1 = ID_IN_CODE;

 	manuf_code = *(volatile u16 *) CFG_FLASH_BASE;
 	device_code = *(volatile u16 *) (CFG_FLASH_BASE + 2);
 	add_device_code = *(volatile u16 *) (CFG_FLASH_BASE + (3 << 1));

-	IDENT_FLASH_ADDR1 = FLASH_CODE1;
-	IDENT_FLASH_ADDR2 = FLASH_CODE2;
-	IDENT_FLASH_ADDR1 = ID_OUT_CODE;
+	MEM_FLASH_ADDR1 = FLASH_CODE1;
+	MEM_FLASH_ADDR2 = FLASH_CODE2;
+	MEM_FLASH_ADDR1 = ID_OUT_CODE;

 	/* Vendor type */
 	info->flash_id = ATM_MANUFACT & FLASH_VENDMASK;
@@ -117,12 +117,34 @@ void flash_identification (flash_info_t * info)
 			(ATM_ID_BV1614A & FLASH_TYPEMASK)) {
 			info->flash_id |= ATM_ID_BV1614A & FLASH_TYPEMASK;
 			printf ("AT49BV1614A (16Mbit)\n");
-		}
-
 		} else {				/* AT49BV1614 Flash */
 			info->flash_id |= ATM_ID_BV1614 & FLASH_TYPEMASK;
 			printf ("AT49BV1614 (16Mbit)\n");
 		}
+
+	} else if ((device_code & FLASH_TYPEMASK) == (ATM_ID_BV6416 & FLASH_TYPEMASK)) {
+		info->flash_id |= ATM_ID_BV6416 & FLASH_TYPEMASK;
+		printf ("AT49BV6416 (64Mbit)\n");
+	}
+}
+
+ushort flash_number_sector(OrgDef *pOrgDef, unsigned int nb_blocks)
+{
+	int i, nb_sectors = 0;
+
+	for (i=0; i<nb_blocks; i++){
+		nb_sectors += pOrgDef[i].sector_number;
+	}
+
+	return nb_sectors;
+}
+
+void flash_unlock_sector(flash_info_t * info, unsigned int sector)
+{
+	volatile u16 *addr = (volatile u16 *) (info->start[sector]);
+
+	MEM_FLASH_ADDR1 = CMD_UNLOCK1;
+	*addr = CMD_SECTOR_UNLOCK;
 }


@@ -140,23 +162,29 @@ ulong flash_init (void)

 		flash_identification (&flash_info[i]);

-		flash_info[i].size = FLASH_BANK_SIZE;
-
 		if ((flash_info[i].flash_id & FLASH_TYPEMASK) ==
 			(ATM_ID_BV1614 & FLASH_TYPEMASK)) {
-			flash_info[i].sector_count = CFG_MAX_FLASH_SECT;
-			memset (flash_info[i].protect, 0, CFG_MAX_FLASH_SECT);

 			pOrgDef = OrgAT49BV16x4;
 			flash_nb_blocks = sizeof (OrgAT49BV16x4) / sizeof (OrgDef);
-		} else {			/* AT49BV1614A Flash */
-			flash_info[i].sector_count = CFG_MAX_FLASH_SECT - 1;
-			memset (flash_info[i].protect, 0, CFG_MAX_FLASH_SECT - 1);
+		} else if ((flash_info[i].flash_id & FLASH_TYPEMASK) ==
+			(ATM_ID_BV1614A & FLASH_TYPEMASK)){	/* AT49BV1614A Flash */

 			pOrgDef = OrgAT49BV16x4A;
 			flash_nb_blocks = sizeof (OrgAT49BV16x4A) / sizeof (OrgDef);
+		} else if ((flash_info[i].flash_id & FLASH_TYPEMASK) ==
+			(ATM_ID_BV6416 & FLASH_TYPEMASK)){	/* AT49BV6416 Flash */
+
+			pOrgDef = OrgAT49BV6416;
+			flash_nb_blocks = sizeof (OrgAT49BV6416) / sizeof (OrgDef);
+		} else {
+			flash_nb_blocks = 0;
+			pOrgDef = OrgAT49BV16x4;
 		}

+		flash_info[i].sector_count = flash_number_sector(pOrgDef, flash_nb_blocks);
+		memset (flash_info[i].protect, 0, flash_info[i].sector_count);
+
 		if (i == 0)
 			flashbase = PHYS_FLASH_1;
 		else
@@ -164,15 +192,26 @@ ulong flash_init (void)

 		sector = 0;
 		start_address = flashbase;
+		flash_info[i].size = 0;

 		for (j = 0; j < flash_nb_blocks; j++) {
 			for (k = 0; k < pOrgDef[j].sector_number; k++) {
 				flash_info[i].start[sector++] = start_address;
 				start_address += pOrgDef[j].sector_size;
+				flash_info[i].size += pOrgDef[j].sector_size;
 			}
 		}

 		size += flash_info[i].size;
+
+		if ((flash_info[i].flash_id & FLASH_TYPEMASK) ==
+			(ATM_ID_BV6416 & FLASH_TYPEMASK)){	/* AT49BV6416 Flash */
+
+			/* Unlock all sectors at reset */
+			for (j=0; j<flash_info[i].sector_count; j++){
+				flash_unlock_sector(&flash_info[i], j);
+			}
+		}
 	}

 	/* Protect binary boot image */
@@ -215,6 +254,9 @@ void flash_print_info (flash_info_t * info)
 	case (ATM_ID_BV1614A & FLASH_TYPEMASK):
 		printf ("AT49BV1614A (16Mbit)\n");
 		break;
+	case (ATM_ID_BV6416 & FLASH_TYPEMASK):
+		printf ("AT49BV6416 (64Mbit)\n");
+		break;
 	default:
 		printf ("Unknown Chip Type\n");
 		goto Done;
@@ -234,7 +276,7 @@ void flash_print_info (flash_info_t * info)
 	}
 	printf ("\n");

-  Done:
+Done:	;
 }

 /*-----------------------------------------------------------------------
--- a/board/at91rm9200dk/u-boot.lds
+++ b/board/at91rm9200dk/u-boot.lds
@@ -32,7 +32,7 @@ SECTIONS
 	. = ALIGN(4);
 	.text      :
 	{
-	  cpu/at91rm9200/start.o	(.text)
+	  cpu/arm920t/start.o	(.text)
 	  *(.text)
 	}

--- a/board/canmb/Makefile
+++ b/board/canmb/Makefile
@@ -0,0 +1,47 @@
+#
+# (C) Copyright 2005
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+include $(TOPDIR)/config.mk
+
+LIB	= lib$(BOARD).a
+
+OBJS	:= $(BOARD).o
+#../common/flash.o ../common/vpd.o ../common/am79c874.o
+
+$(LIB):	$(OBJS) $(SOBJS)
+	$(AR) crv $@ $(OBJS)
+
+clean:
+	rm -f $(SOBJS) $(OBJS)
+
+distclean:	clean
+	rm -f $(LIB) core *.bak .depend
+
+#########################################################################
+
+.depend:	Makefile $(SOBJS:.o=.S) $(OBJS:.o=.c)
+		$(CC) -M $(CPPFLAGS) $(SOBJS:.o=.S) $(OBJS:.o=.c) > $@
+
+-include .depend
+
+#########################################################################
--- a/board/canmb/canmb.c
+++ b/board/canmb/canmb.c
@@ -0,0 +1,251 @@
+/*
+ * (C) Copyright 2005
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * (C) Copyright 2004
+ * Mark Jonas, Freescale Semiconductor, mark.jonas@motorola.com.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <mpc5xxx.h>
+#include <pci.h>
+
+#if defined(CONFIG_MPC5200_DDR)
+#include "mt46v16m16-75.h"
+#else
+#include "mt48lc16m32s2-75.h"
+#endif
+
+#ifndef CFG_RAMBOOT
+static void sdram_start (int hi_addr)
+{
+	long hi_addr_bit = hi_addr ? 0x01000000 : 0;
+
+	/* unlock mode register */
+	*(vu_long *)MPC5XXX_SDRAM_CTRL = SDRAM_CONTROL | 0x80000000 | hi_addr_bit;
+	__asm__ volatile ("sync");
+
+	/* precharge all banks */
+	*(vu_long *)MPC5XXX_SDRAM_CTRL = SDRAM_CONTROL | 0x80000002 | hi_addr_bit;
+	__asm__ volatile ("sync");
+
+#if SDRAM_DDR
+	/* set mode register: extended mode */
+	*(vu_long *)MPC5XXX_SDRAM_MODE = SDRAM_EMODE;
+	__asm__ volatile ("sync");
+
+	/* set mode register: reset DLL */
+	*(vu_long *)MPC5XXX_SDRAM_MODE = SDRAM_MODE | 0x04000000;
+	__asm__ volatile ("sync");
+#endif
+
+	/* precharge all banks */
+	*(vu_long *)MPC5XXX_SDRAM_CTRL = SDRAM_CONTROL | 0x80000002 | hi_addr_bit;
+	__asm__ volatile ("sync");
+
+	/* auto refresh */
+	*(vu_long *)MPC5XXX_SDRAM_CTRL = SDRAM_CONTROL | 0x80000004 | hi_addr_bit;
+	__asm__ volatile ("sync");
+
+	/* set mode register */
+	*(vu_long *)MPC5XXX_SDRAM_MODE = SDRAM_MODE;
+	__asm__ volatile ("sync");
+
+	/* normal operation */
+	*(vu_long *)MPC5XXX_SDRAM_CTRL = SDRAM_CONTROL | hi_addr_bit;
+	__asm__ volatile ("sync");
+}
+#endif
+
+/*
+ * ATTENTION: Although partially referenced initdram does NOT make real use
+ *            use of CFG_SDRAM_BASE. The code does not work if CFG_SDRAM_BASE
+ *            is something else than 0x00000000.
+ */
+
+#if defined(CONFIG_MPC5200)
+long int initdram (int board_type)
+{
+	ulong dramsize = 0;
+	ulong dramsize2 = 0;
+#ifndef CFG_RAMBOOT
+	ulong test1, test2;
+
+	/* setup SDRAM chip selects */
+	*(vu_long *)MPC5XXX_SDRAM_CS0CFG = 0x0000001e;/* 2G at 0x0 */
+	*(vu_long *)MPC5XXX_SDRAM_CS1CFG = 0x80000000;/* disabled */
+	__asm__ volatile ("sync");
+
+	/* setup config registers */
+	*(vu_long *)MPC5XXX_SDRAM_CONFIG1 = SDRAM_CONFIG1;
+	*(vu_long *)MPC5XXX_SDRAM_CONFIG2 = SDRAM_CONFIG2;
+	__asm__ volatile ("sync");
+
+#if SDRAM_DDR
+	/* set tap delay */
+	*(vu_long *)MPC5XXX_CDM_PORCFG = SDRAM_TAPDELAY;
+	__asm__ volatile ("sync");
+#endif
+
+	/* find RAM size using SDRAM CS0 only */
+	sdram_start(0);
+	test1 = get_ram_size((ulong *)CFG_SDRAM_BASE, 0x80000000);
+	sdram_start(1);
+	test2 = get_ram_size((ulong *)CFG_SDRAM_BASE, 0x80000000);
+	if (test1 > test2) {
+		sdram_start(0);
+		dramsize = test1;
+	} else {
+		dramsize = test2;
+	}
+
+	/* memory smaller than 1MB is impossible */
+	if (dramsize < (1 << 20)) {
+		dramsize = 0;
+	}
+
+	/* set SDRAM CS0 size according to the amount of RAM found */
+	if (dramsize > 0) {
+		*(vu_long *)MPC5XXX_SDRAM_CS0CFG = 0x13 + __builtin_ffs(dramsize >> 20) - 1;
+	} else {
+		*(vu_long *)MPC5XXX_SDRAM_CS0CFG = 0; /* disabled */
+	}
+
+	/* let SDRAM CS1 start right after CS0 */
+	*(vu_long *)MPC5XXX_SDRAM_CS1CFG = dramsize + 0x0000001e;/* 2G */
+
+	/* find RAM size using SDRAM CS1 only */
+	if (!dramsize)
+		sdram_start(0);
+	test2 = test1 = get_ram_size((ulong *)(CFG_SDRAM_BASE + dramsize), 0x80000000);
+	if (!dramsize) {
+		sdram_start(1);
+		test2 = get_ram_size((ulong *)(CFG_SDRAM_BASE + dramsize), 0x80000000);
+	}
+	if (test1 > test2) {
+		sdram_start(0);
+		dramsize2 = test1;
+	} else {
+		dramsize2 = test2;
+	}
+
+	/* memory smaller than 1MB is impossible */
+	if (dramsize2 < (1 << 20)) {
+		dramsize2 = 0;
+	}
+
+	/* set SDRAM CS1 size according to the amount of RAM found */
+	if (dramsize2 > 0) {
+		*(vu_long *)MPC5XXX_SDRAM_CS1CFG = dramsize
+			| (0x13 + __builtin_ffs(dramsize2 >> 20) - 1);
+	} else {
+		*(vu_long *)MPC5XXX_SDRAM_CS1CFG = dramsize; /* disabled */
+	}
+
+#else /* CFG_RAMBOOT */
+
+	/* retrieve size of memory connected to SDRAM CS0 */
+	dramsize = *(vu_long *)MPC5XXX_SDRAM_CS0CFG & 0xFF;
+	if (dramsize >= 0x13) {
+		dramsize = (1 << (dramsize - 0x13)) << 20;
+	} else {
+		dramsize = 0;
+	}
+
+	/* retrieve size of memory connected to SDRAM CS1 */
+	dramsize2 = *(vu_long *)MPC5XXX_SDRAM_CS1CFG & 0xFF;
+	if (dramsize2 >= 0x13) {
+		dramsize2 = (1 << (dramsize2 - 0x13)) << 20;
+	} else {
+		dramsize2 = 0;
+	}
+
+#endif /* CFG_RAMBOOT */
+
+	return dramsize + dramsize2;
+}
+
+#elif defined(CONFIG_MGT5100)
+
+long int initdram (int board_type)
+{
+	ulong dramsize = 0;
+#ifndef CFG_RAMBOOT
+	ulong test1, test2;
+
+	/* setup and enable SDRAM chip selects */
+	*(vu_long *)MPC5XXX_SDRAM_START = 0x00000000;
+	*(vu_long *)MPC5XXX_SDRAM_STOP = 0x0000ffff;/* 2G */
+	*(vu_long *)MPC5XXX_ADDECR |= (1 << 22); /* Enable SDRAM */
+	__asm__ volatile ("sync");
+
+	/* setup config registers */
+	*(vu_long *)MPC5XXX_SDRAM_CONFIG1 = SDRAM_CONFIG1;
+	*(vu_long *)MPC5XXX_SDRAM_CONFIG2 = SDRAM_CONFIG2;
+
+	/* address select register */
+	*(vu_long *)MPC5XXX_SDRAM_XLBSEL = SDRAM_ADDRSEL;
+	__asm__ volatile ("sync");
+
+	/* find RAM size */
+	sdram_start(0);
+	test1 = get_ram_size((ulong *)CFG_SDRAM_BASE, 0x80000000);
+	sdram_start(1);
+	test2 = get_ram_size((ulong *)CFG_SDRAM_BASE, 0x80000000);
+	if (test1 > test2) {
+		sdram_start(0);
+		dramsize = test1;
+	} else {
+		dramsize = test2;
+	}
+
+	/* set SDRAM end address according to size */
+	*(vu_long *)MPC5XXX_SDRAM_STOP = ((dramsize - 1) >> 15);
+
+#else /* CFG_RAMBOOT */
+
+	/* Retrieve amount of SDRAM available */
+	dramsize = ((*(vu_long *)MPC5XXX_SDRAM_STOP + 1) << 15);
+
+#endif /* CFG_RAMBOOT */
+
+	return dramsize;
+}
+
+#else
+#error Neither CONFIG_MPC5200 or CONFIG_MGT5100 defined
+#endif
+
+int checkboard (void)
+{
+	puts ("Board: CANMB\n");
+	return 0;
+}
+
+int board_early_init_r (void)
+{
+	*(vu_long *)MPC5XXX_BOOTCS_CFG &= ~0x1; /* clear RO */
+	*(vu_long *)MPC5XXX_BOOTCS_START =
+	*(vu_long *)MPC5XXX_CS0_START = START_REG(CFG_FLASH_BASE);
+	*(vu_long *)MPC5XXX_BOOTCS_STOP =
+	*(vu_long *)MPC5XXX_CS0_STOP = STOP_REG(CFG_FLASH_BASE, CFG_FLASH_SIZE);
+	return 0;
+}
--- a/board/canmb/config.mk
+++ b/board/canmb/config.mk
@@ -0,0 +1,39 @@
+#
+# (C) Copyright 2005
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# (C) Copyright 2003
+# Reinhard Meyer, EMK Elektronik GmbH, r.meyer@emk-elektronik.de
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+#
+# CANMB board
+#
+# allowed and functional TEXT_BASE values:
+#
+#   0xfe000000		low boot at 0x00000100 (default board setting)
+#	0x00100000		RAM load and test
+#
+
+TEXT_BASE = 0xFE000000
+#TEXT_BASE = 0x00100000
+
+PLATFORM_CPPFLAGS += -DTEXT_BASE=$(TEXT_BASE) -I$(TOPDIR)/board
--- a/board/canmb/mt48lc16m32s2-75.h
+++ b/board/canmb/mt48lc16m32s2-75.h
@@ -0,0 +1,43 @@
+/*
+ * (C) Copyright 2004
+ * Mark Jonas, Freescale Semiconductor, mark.jonas@motorola.com.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#define SDRAM_DDR	0		/* is SDR */
+
+#if defined(CONFIG_MPC5200)
+/* Settings for XLB = 132 MHz */
+#define SDRAM_MODE	0x00CD0000
+#define SDRAM_CONTROL	0x504F0000
+#define SDRAM_CONFIG1	0xD2322800
+#define SDRAM_CONFIG2	0x8AD70000
+
+#elif defined(CONFIG_MGT5100)
+/* Settings for XLB = 66 MHz */
+#define SDRAM_MODE	0x008D0000
+#define SDRAM_CONTROL	0x504F0000
+#define SDRAM_CONFIG1	0xC2222600
+#define SDRAM_CONFIG2	0x88B70004
+#define SDRAM_ADDRSEL	0x02000000
+
+#else
+#error Neither CONFIG_MPC5200 or CONFIG_MGT5100 defined
+#endif
--- a/board/canmb/u-boot.lds
+++ b/board/canmb/u-boot.lds
@@ -0,0 +1,122 @@
+/*
+ * (C) Copyright 2005
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+OUTPUT_ARCH(powerpc)
+SEARCH_DIR(/lib); SEARCH_DIR(/usr/lib); SEARCH_DIR(/usr/local/lib); SEARCH_DIR(/usr/local/powerpc-any-elf/lib);
+/* Do we need any of these for elf?
+   __DYNAMIC = 0;    */
+SECTIONS
+{
+  /* Read-only sections, merged into text segment: */
+  . = + SIZEOF_HEADERS;
+  .interp : { *(.interp) }
+  .hash          : { *(.hash)		}
+  .dynsym        : { *(.dynsym)		}
+  .dynstr        : { *(.dynstr)		}
+  .rel.text      : { *(.rel.text)		}
+  .rela.text     : { *(.rela.text) 	}
+  .rel.data      : { *(.rel.data)		}
+  .rela.data     : { *(.rela.data) 	}
+  .rel.rodata    : { *(.rel.rodata) 	}
+  .rela.rodata   : { *(.rela.rodata) 	}
+  .rel.got       : { *(.rel.got)		}
+  .rela.got      : { *(.rela.got)		}
+  .rel.ctors     : { *(.rel.ctors)	}
+  .rela.ctors    : { *(.rela.ctors)	}
+  .rel.dtors     : { *(.rel.dtors)	}
+  .rela.dtors    : { *(.rela.dtors)	}
+  .rel.bss       : { *(.rel.bss)		}
+  .rela.bss      : { *(.rela.bss)		}
+  .rel.plt       : { *(.rel.plt)		}
+  .rela.plt      : { *(.rela.plt)		}
+  .init          : { *(.init)	}
+  .plt : { *(.plt) }
+  .text      :
+  {
+    cpu/mpc5xxx/start.o	(.text)
+    *(.text)
+    *(.fixup)
+    *(.got1)
+    . = ALIGN(16);
+    *(.rodata)
+    *(.rodata1)
+    *(.rodata.str1.4)
+  }
+  .fini      : { *(.fini)    } =0
+  .ctors     : { *(.ctors)   }
+  .dtors     : { *(.dtors)   }
+
+  /* Read-write section, merged into data segment: */
+  . = (. + 0x0FFF) & 0xFFFFF000;
+  _erotext = .;
+  PROVIDE (erotext = .);
+  .reloc   :
+  {
+    *(.got)
+    _GOT2_TABLE_ = .;
+    *(.got2)
+    _FIXUP_TABLE_ = .;
+    *(.fixup)
+  }
+  __got2_entries = (_FIXUP_TABLE_ - _GOT2_TABLE_) >> 2;
+  __fixup_entries = (. - _FIXUP_TABLE_) >> 2;
+
+  .data    :
+  {
+    *(.data)
+    *(.data1)
+    *(.sdata)
+    *(.sdata2)
+    *(.dynamic)
+    CONSTRUCTORS
+  }
+  _edata  =  .;
+  PROVIDE (edata = .);
+
+  __u_boot_cmd_start = .;
+  .u_boot_cmd : { *(.u_boot_cmd) }
+  __u_boot_cmd_end = .;
+
+
+  __start___ex_table = .;
+  __ex_table : { *(__ex_table) }
+  __stop___ex_table = .;
+
+  . = ALIGN(4096);
+  __init_begin = .;
+  .text.init : { *(.text.init) }
+  .data.init : { *(.data.init) }
+  . = ALIGN(4096);
+  __init_end = .;
+
+  __bss_start = .;
+  .bss       :
+  {
+   *(.sbss) *(.scommon)
+   *(.dynbss)
+   *(.bss)
+   *(COMMON)
+  }
+  _end = . ;
+  PROVIDE (end = .);
+}
--- a/board/cds/common/cadmus.c
+++ b/board/cds/common/cadmus.c
@@ -0,0 +1,95 @@
+/*
+ * Copyright 2004 Freescale Semiconductor.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+
+#include <common.h>
+
+
+/*
+ * CADMUS Board System Registers
+ */
+#ifndef CFG_CADMUS_BASE_REG
+#define CFG_CADMUS_BASE_REG	(CADMUS_BASE_ADDR + 0x4000)
+#endif
+
+typedef struct cadmus_reg {
+    u_char cm_ver;		/* Board version */
+    u_char cm_csr;		/* General control/status */
+    u_char cm_rst;		/* Reset control */
+    u_char cm_hsclk;		/* High speed clock */
+    u_char cm_hsxclk;		/* High speed clock extended */
+    u_char cm_led;		/* LED data */
+    u_char cm_pci;		/* PCI control/status */
+    u_char cm_dma;		/* DMA control */
+    u_char cm_reserved[248];	/* Total 256 bytes */
+} cadmus_reg_t;
+
+
+unsigned int
+get_board_version(void)
+{
+	volatile cadmus_reg_t *cadmus = (cadmus_reg_t *)CFG_CADMUS_BASE_REG;
+
+	return cadmus->cm_ver;
+}
+
+
+unsigned long
+get_clock_freq(void)
+{
+	volatile cadmus_reg_t *cadmus = (cadmus_reg_t *)CFG_CADMUS_BASE_REG;
+
+	uint pci1_speed = (cadmus->cm_pci >> 2) & 0x3; /* PSPEED in [4:5] */
+
+	if (pci1_speed == 0) {
+		return 33000000;
+	} else if (pci1_speed == 1) {
+		return 66000000;
+	} else {
+		/* Really, unknown. Be safe? */
+		return 33000000;
+	}
+}
+
+
+unsigned int
+get_pci_slot(void)
+{
+	volatile cadmus_reg_t *cadmus = (cadmus_reg_t *)CFG_CADMUS_BASE_REG;
+
+	/*
+	 * PCI slot in USER bits CSR[6:7] by convention.
+	 */
+	return ((cadmus->cm_csr >> 6) & 0x3) + 1;
+}
+
+
+unsigned int
+get_pci_dual(void)
+{
+	volatile cadmus_reg_t *cadmus = (cadmus_reg_t *)CFG_CADMUS_BASE_REG;
+
+	/*
+	 * PCI DUAL in CM_PCI[3]
+	 */
+	return cadmus->cm_pci & 0x10;
+}
--- a/board/cds/common/cadmus.h
+++ b/board/cds/common/cadmus.h
@@ -0,0 +1,54 @@
+/*
+ * Copyright 2004 Freescale Semiconductor.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#ifndef __CADMUS_H_
+#define __CADMUS_H_
+
+
+/*
+ * CADMUS Board System Register interface.
+ */
+
+/*
+ * Returns board version register.
+ */
+extern unsigned int get_board_version(void);
+
+/*
+ * Returns either 33000000 or 66000000 as the SYS_CLK_FREQ.
+ */
+extern unsigned long get_clock_freq(void);
+
+
+/*
+ * Returns 1 - 4, as found in the USER CSR[6:7] bits.
+ */
+extern unsigned int get_pci_slot(void);
+
+
+/*
+ * Returns PCI DUAL as found in CM_PCI[3].
+ */
+extern unsigned int get_pci_dual(void);
+
+
+#endif	/* __CADMUS_H_ */
--- a/board/cds/common/eeprom.c
+++ b/board/cds/common/eeprom.c
@@ -0,0 +1,60 @@
+/*
+ * Copyright 2004 Freescale Semiconductor.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+
+#include <common.h>
+#include <i2c.h>
+
+#include "eeprom.h"
+
+
+typedef struct {
+	char idee_pcbid[4];		/* "CCID" for CDC v1.X */
+	u8 idee_major;
+	u8 idee_minor;
+	char idee_serial[10];
+	char idee_errata[2];
+	char idee_date[8];		/* yyyymmdd */
+	/* The rest of the EEPROM space is reserved */
+} id_eeprom_t;
+
+
+unsigned int
+get_cpu_board_revision(void)
+{
+	uint major = 0;
+	uint minor = 0;
+
+	id_eeprom_t id_eeprom;
+
+	i2c_read(CFG_I2C_EEPROM_ADDR, 0, 2,
+		 (uchar *) &id_eeprom, sizeof(id_eeprom));
+
+	major = id_eeprom.idee_major;
+	minor = id_eeprom.idee_minor;
+
+	if (major == 0xff && minor == 0xff) {
+		major = minor = 0;
+	}
+
+	return MPC85XX_CPU_BOARD_REV(major,minor);
+}
--- a/board/cds/common/eeprom.h
+++ b/board/cds/common/eeprom.h
@@ -0,0 +1,50 @@
+/*
+ * Copyright 2004 Freescale Semiconductor.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#ifndef __EEPROM_H_
+#define __EEPROM_H_
+
+
+/*
+ * EEPROM Board System Register interface.
+ */
+
+
+/*
+ * CPU Board Revision
+ */
+#define MPC85XX_CPU_BOARD_REV(maj, min)	((((maj)&0xff) << 8) | ((min) & 0xff))
+#define MPC85XX_CPU_BOARD_MAJOR(rev)	(((rev) >> 8) & 0xff)
+#define MPC85XX_CPU_BOARD_MINOR(rev)	((rev) & 0xff)
+
+#define MPC85XX_CPU_BOARD_REV_UNKNOWN	MPC85XX_CPU_BOARD_REV(0,0)
+#define MPC85XX_CPU_BOARD_REV_1_0	MPC85XX_CPU_BOARD_REV(1,0)
+#define MPC85XX_CPU_BOARD_REV_1_1	MPC85XX_CPU_BOARD_REV(1,1)
+
+/*
+ * Returns CPU board revision register as a 16-bit value with
+ * the Major in the high byte, and Minor in the low byte.
+ */
+extern unsigned int get_cpu_board_revision(void);
+
+
+#endif	/* __CADMUS_H_ */
--- a/board/cds/mpc8541cds/Makefile
+++ b/board/cds/mpc8541cds/Makefile
@@ -0,0 +1,51 @@
+#
+# Copyright 2004 Freescale Semiconductor.
+# (C) Copyright 2001
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+include $(TOPDIR)/config.mk
+
+LIB	= lib$(BOARD).a
+
+OBJS	:= $(BOARD).o \
+	   ../common/cadmus.o \
+	   ../common/eeprom.o
+
+SOBJS	:= init.o
+
+$(LIB):	$(OBJS) $(SOBJS)
+	$(AR) crv $@ $(OBJS)
+
+clean:
+	rm -f $(OBJS) $(SOBJS)
+
+distclean:	clean
+	rm -f $(LIB) core *.bak .depend
+
+#########################################################################
+
+.depend:	Makefile $(SOBJS:.o=.S) $(OBJS:.o=.c)
+		$(CC) -M $(CPPFLAGS) $(SOBJS:.o=.S) $(OBJS:.o=.c) > $@
+
+-include .depend
+
+#########################################################################
--- a/board/cds/mpc8541cds/config.mk
+++ b/board/cds/mpc8541cds/config.mk
@@ -0,0 +1,30 @@
+#
+# Copyright 2004 Freescale Semiconductor.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+#
+# mpc8541cds board
+#
+TEXT_BASE = 0xfff80000
+
+PLATFORM_CPPFLAGS += -DCONFIG_E500=1
+PLATFORM_CPPFLAGS += -DCONFIG_MPC85xx=1
+PLATFORM_CPPFLAGS += -DCONFIG_MPC8541=1
--- a/board/cds/mpc8541cds/init.S
+++ b/board/cds/mpc8541cds/init.S
@@ -0,0 +1,255 @@
+/*
+ * Copyright 2004 Freescale Semiconductor.
+ * Copyright 2002,2003, Motorola Inc.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <ppc_asm.tmpl>
+#include <ppc_defs.h>
+#include <asm/cache.h>
+#include <asm/mmu.h>
+#include <config.h>
+#include <mpc85xx.h>
+
+
+/*
+ * TLB0 and TLB1 Entries
+ *
+ * Out of reset, TLB1's Entry 0 maps the highest 4K for CCSRBAR.
+ * However, CCSRBAR is then relocated to CFG_CCSRBAR right after
+ * these TLB entries are established.
+ *
+ * The TLB entries for DDR are dynamically setup in spd_sdram()
+ * and use TLB1 Entries 8 through 15 as needed according to the
+ * size of DDR memory.
+ *
+ * MAS0: tlbsel, esel, nv
+ * MAS1: valid, iprot, tid, ts, tsize
+ * MAS2: epn, sharen, x0, x1, w, i, m, g, e
+ * MAS3: rpn, u0-u3, ux, sx, uw, sw, ur, sr
+ */
+
+#define	entry_start \
+	mflr	r1 	;	\
+	bl	0f 	;
+
+#define	entry_end \
+0:	mflr	r0	;	\
+	mtlr	r1	;	\
+	blr		;
+
+
+	.section	.bootpg, "ax"
+	.globl	tlb1_entry
+tlb1_entry:
+	entry_start
+
+	/*
+	 * Number of TLB0 and TLB1 entries in the following table
+	 */
+	.long 13
+
+#if (CFG_CCSRBAR_DEFAULT != CFG_CCSRBAR)
+	/*
+	 * TLB0		4K	Non-cacheable, guarded
+	 * 0xff700000	4K	Initial CCSRBAR mapping
+	 *
+	 * This ends up at a TLB0 Index==0 entry, and must not collide
+	 * with other TLB0 Entries.
+	 */
+	.long TLB1_MAS0(0, 0, 0)
+	.long TLB1_MAS1(1, 0, 0, 0, 0)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,0,1,0,1,0,1)
+#else
+#error("Update the number of table entries in tlb1_entry")
+#endif
+
+	/*
+	 * TLB0		16K	Cacheable, non-guarded
+	 * 0xd001_0000	16K	Temporary Global data for initialization
+	 *
+	 * Use four 4K TLB0 entries.  These entries must be cacheable
+	 * as they provide the bootstrap memory before the memory
+	 * controler and real memory have been configured.
+	 *
+	 * These entries end up at TLB0 Indicies 0x10, 0x14, 0x18 and 0x1c,
+	 * and must not collide with other TLB0 entries.
+	 */
+	.long TLB1_MAS0(0, 0, 0)
+	.long TLB1_MAS1(1, 0, 0, 0, 0)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR),
+			0,0,0,0,0,0,0,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR),
+			0,0,0,0,0,1,0,1,0,1)
+
+	.long TLB1_MAS0(0, 0, 0)
+	.long TLB1_MAS1(1, 0, 0, 0, 0)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 4 * 1024),
+			0,0,0,0,0,0,0,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 4 * 1024),
+			0,0,0,0,0,1,0,1,0,1)
+
+	.long TLB1_MAS0(0, 0, 0)
+	.long TLB1_MAS1(1, 0, 0, 0, 0)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 8 * 1024),
+			0,0,0,0,0,0,0,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 8 * 1024),
+			0,0,0,0,0,1,0,1,0,1)
+
+	.long TLB1_MAS0(0, 0, 0)
+	.long TLB1_MAS1(1, 0, 0, 0, 0)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 12 * 1024),
+			0,0,0,0,0,0,0,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 12 * 1024),
+			0,0,0,0,0,1,0,1,0,1)
+
+
+	/*
+	 * TLB 0:	16M	Non-cacheable, guarded
+	 * 0xff000000	16M	FLASH
+	 * Out of reset this entry is only 4K.
+	 */
+	.long TLB1_MAS0(1, 0, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_16M)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_FLASH_BASE), 0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_FLASH_BASE), 0,0,0,0,0,1,0,1,0,1)
+
+	/*
+	 * TLB 1:	256M	Non-cacheable, guarded
+	 * 0x80000000	256M	PCI1 MEM First half
+	 */
+	.long TLB1_MAS0(1, 1, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_PCI1_MEM_BASE), 0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_PCI1_MEM_BASE), 0,0,0,0,0,1,0,1,0,1)
+
+	/*
+	 * TLB 2:	256M	Non-cacheable, guarded
+	 * 0x90000000	256M	PCI1 MEM Second half
+	 */
+	.long TLB1_MAS0(1, 2, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_PCI1_MEM_BASE + 0x10000000),
+			0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_PCI1_MEM_BASE + 0x10000000),
+			0,0,0,0,0,1,0,1,0,1)
+
+	/*
+	 * TLB 3:	256M	Non-cacheable, guarded
+	 * 0xa0000000	256M	PCI2 MEM First half
+	 */
+	.long TLB1_MAS0(1, 3, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_PCI2_MEM_BASE), 0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_PCI2_MEM_BASE), 0,0,0,0,0,1,0,1,0,1)
+
+	/*
+	 * TLB 4:	256M	Non-cacheable, guarded
+	 * 0xb0000000	256M	PCI2 MEM Second half
+	 */
+	.long TLB1_MAS0(1, 4, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_PCI2_MEM_BASE + 0x10000000),
+			0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_PCI2_MEM_BASE + 0x10000000),
+			0,0,0,0,0,1,0,1,0,1)
+
+	/*
+	 * TLB 5:	64M	Non-cacheable, guarded
+	 * 0xe000_0000	1M	CCSRBAR
+	 * 0xe200_0000	16M	PCI1 IO
+	 * 0xe300_0000	16M	PCI2 IO
+	 */
+	.long TLB1_MAS0(1, 5, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR), 0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR), 0,0,0,0,0,1,0,1,0,1)
+
+	/*
+	 * TLB 6:	64M	Cacheable, non-guarded
+	 * 0xf000_0000	64M	LBC SDRAM
+	 */
+	.long TLB1_MAS0(1, 6, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_LBC_SDRAM_BASE), 0,0,0,0,0,0,0,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_LBC_SDRAM_BASE), 0,0,0,0,0,1,0,1,0,1)
+
+	/*
+	 * TLB 7:	1M	Non-cacheable, guarded
+	 * 0xf8000000	1M	CADMUS registers
+	 */
+	.long TLB1_MAS0(1, 7, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_1M)
+	.long TLB1_MAS2(E500_TLB_EPN(CADMUS_BASE_ADDR), 0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CADMUS_BASE_ADDR), 0,0,0,0,0,1,0,1,0,1)
+
+	entry_end
+
+/*
+ * LAW(Local Access Window) configuration:
+ *
+ * 0x0000_0000     0x7fff_ffff     DDR                     2G
+ * 0x8000_0000     0x9fff_ffff     PCI1 MEM                512M
+ * 0xa000_0000     0xbfff_ffff     PCI2 MEM                512M
+ * 0xe000_0000     0xe000_ffff     CCSR                    1M
+ * 0xe200_0000     0xe2ff_ffff     PCI1 IO                 16M
+ * 0xe300_0000     0xe3ff_ffff     PCI2 IO                 16M
+ * 0xf000_0000     0xf7ff_ffff     SDRAM                   128M
+ * 0xf800_0000     0xf80f_ffff     NVRAM/CADMUS (*)        1M
+ * 0xff00_0000     0xff7f_ffff     FLASH (2nd bank)        8M
+ * 0xff80_0000     0xffff_ffff     FLASH (boot bank)       8M
+ *
+ * Notes:
+ *    CCSRBAR and L2-as-SRAM don't need a configured Local Access Window.
+ *    If flash is 8M at default position (last 8M), no LAW needed.
+ *
+ * The defines below are 1-off of the actual LAWAR0 usage.
+ * So LAWAR3 define uses the LAWAR4 register in the ECM.
+ */
+
+#define LAWBAR0 0
+#define LAWAR0  ((LAWAR_TRGT_IF_DDR | (LAWAR_SIZE & LAWAR_SIZE_128M)) & ~LAWAR_EN)
+
+#define LAWBAR1 ((CFG_PCI1_MEM_BASE>>12) & 0xfffff)
+#define LAWAR1 	(LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_512M))
+
+#define LAWBAR2 ((CFG_PCI2_MEM_BASE>>12) & 0xfffff)
+#define LAWAR2 	(LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_512M))
+
+#define LAWBAR3 ((CFG_PCI1_IO_BASE>>12) & 0xfffff)
+#define LAWAR3 	(LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_16M))
+
+#define LAWBAR4 ((CFG_PCI2_IO_BASE>>12) & 0xfffff)
+#define LAWAR4 	(LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_16M))
+
+/* LBC window - maps 256M 0xf0000000 -> 0xffffffff */
+#define LAWBAR5 ((CFG_LBC_SDRAM_BASE>>12) & 0xfffff)
+#define LAWAR5 	(LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_256M))
+
+	.section .bootpg, "ax"
+	.globl	law_entry
+
+law_entry:
+	entry_start
+	.long 6
+	.long LAWBAR0,LAWAR0,LAWBAR1,LAWAR1,LAWBAR2,LAWAR2,LAWBAR3,LAWAR3
+	.long LAWBAR4,LAWAR4,LAWBAR5,LAWAR5
+	entry_end
--- a/board/cds/mpc8541cds/mpc8541cds.c
+++ b/board/cds/mpc8541cds/mpc8541cds.c
@@ -0,0 +1,349 @@
+/*
+ * Copyright 2004 Freescale Semiconductor.
+ *
+ * (C) Copyright 2002 Scott McNutt <smcnutt@artesyncp.com>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <pci.h>
+#include <asm/processor.h>
+#include <asm/immap_85xx.h>
+#include <spd.h>
+
+#include "../common/cadmus.h"
+#include "../common/eeprom.h"
+
+#if defined(CONFIG_DDR_ECC)
+extern void ddr_enable_ecc(unsigned int dram_size);
+#endif
+
+extern long int spd_sdram(void);
+
+void local_bus_init(void);
+void sdram_init(void);
+
+int board_early_init_f (void)
+{
+	return 0;
+}
+
+int checkboard (void)
+{
+	volatile immap_t *immap = (immap_t *) CFG_CCSRBAR;
+	volatile ccsr_gur_t *gur = &immap->im_gur;
+
+	/* PCI slot in USER bits CSR[6:7] by convention. */
+	uint pci_slot = get_pci_slot ();
+
+	uint pci_dual = get_pci_dual ();	/* PCI DUAL in CM_PCI[3] */
+	uint pci1_32 = gur->pordevsr & 0x10000;	/* PORDEVSR[15] */
+	uint pci1_clk_sel = gur->porpllsr & 0x8000;	/* PORPLLSR[16] */
+	uint pci2_clk_sel = gur->porpllsr & 0x4000;	/* PORPLLSR[17] */
+
+	uint pci1_speed = get_clock_freq ();	/* PCI PSPEED in [4:5] */
+
+	uint cpu_board_rev = get_cpu_board_revision ();
+
+	printf ("Board: CDS Version 0x%02x, PCI Slot %d\n",
+		get_board_version (), pci_slot);
+
+	printf ("CPU Board Revision %d.%d (0x%04x)\n",
+		MPC85XX_CPU_BOARD_MAJOR (cpu_board_rev),
+		MPC85XX_CPU_BOARD_MINOR (cpu_board_rev), cpu_board_rev);
+
+	printf ("    PCI1: %d bit, %s MHz, %s\n",
+		(pci1_32) ? 32 : 64,
+		(pci1_speed == 33000000) ? "33" :
+		(pci1_speed == 66000000) ? "66" : "unknown",
+		pci1_clk_sel ? "sync" : "async");
+
+	if (pci_dual) {
+		printf ("    PCI2: 32 bit, 66 MHz, %s\n",
+			pci2_clk_sel ? "sync" : "async");
+	} else {
+		printf ("    PCI2: disabled\n");
+	}
+
+	/*
+	 * Initialize local bus.
+	 */
+	local_bus_init ();
+
+	return 0;
+}
+
+long int
+initdram(int board_type)
+{
+	long dram_size = 0;
+	volatile immap_t *immap = (immap_t *)CFG_IMMR;
+
+	puts("Initializing\n");
+
+#if defined(CONFIG_DDR_DLL)
+	{
+		/*
+		 * Work around to stabilize DDR DLL MSYNC_IN.
+		 * Errata DDR9 seems to have been fixed.
+		 * This is now the workaround for Errata DDR11:
+		 *    Override DLL = 1, Course Adj = 1, Tap Select = 0
+		 */
+
+		volatile ccsr_gur_t *gur= &immap->im_gur;
+
+		gur->ddrdllcr = 0x81000000;
+		asm("sync;isync;msync");
+		udelay(200);
+	}
+#endif
+	dram_size = spd_sdram();
+
+#if defined(CONFIG_DDR_ECC)
+	/*
+	 * Initialize and enable DDR ECC.
+	 */
+	ddr_enable_ecc(dram_size);
+#endif
+	/*
+	 * SDRAM Initialization
+	 */
+	sdram_init();
+
+	puts("    DDR: ");
+	return dram_size;
+}
+
+/*
+ * Initialize Local Bus
+ */
+void
+local_bus_init(void)
+{
+	volatile immap_t *immap = (immap_t *)CFG_IMMR;
+	volatile ccsr_gur_t *gur = &immap->im_gur;
+	volatile ccsr_lbc_t *lbc = &immap->im_lbc;
+
+	uint clkdiv;
+	uint lbc_hz;
+	sys_info_t sysinfo;
+	uint temp_lbcdll;
+
+	/*
+	 * Errata LBC11.
+	 * Fix Local Bus clock glitch when DLL is enabled.
+	 *
+	 * If localbus freq is < 66Mhz, DLL bypass mode must be used.
+	 * If localbus freq is > 133Mhz, DLL can be safely enabled.
+	 * Between 66 and 133, the DLL is enabled with an override workaround.
+	 */
+
+	get_sys_info(&sysinfo);
+	clkdiv = lbc->lcrr & 0x0f;
+	lbc_hz = sysinfo.freqSystemBus / 1000000 / clkdiv;
+
+	if (lbc_hz < 66) {
+		lbc->lcrr |= 0x80000000;	/* DLL Bypass */
+
+	} else if (lbc_hz >= 133) {
+		lbc->lcrr &= (~0x80000000);		/* DLL Enabled */
+
+	} else {
+		lbc->lcrr &= (~0x8000000);	/* DLL Enabled */
+		udelay(200);
+
+		/*
+		 * Sample LBC DLL ctrl reg, upshift it to set the
+		 * override bits.
+		 */
+		temp_lbcdll = gur->lbcdllcr;
+		gur->lbcdllcr = (((temp_lbcdll & 0xff) << 16) | 0x80000000);
+		asm("sync;isync;msync");
+	}
+}
+
+/*
+ * Initialize SDRAM memory on the Local Bus.
+ */
+void
+sdram_init(void)
+{
+#if defined(CFG_OR2_PRELIM) && defined(CFG_BR2_PRELIM)
+
+	uint idx;
+	volatile immap_t *immap = (immap_t *)CFG_IMMR;
+	volatile ccsr_lbc_t *lbc = &immap->im_lbc;
+	uint *sdram_addr = (uint *)CFG_LBC_SDRAM_BASE;
+	uint cpu_board_rev;
+	uint lsdmr_common;
+
+	puts("    SDRAM: ");
+
+	print_size (CFG_LBC_SDRAM_SIZE * 1024 * 1024, "\n");
+
+	/*
+	 * Setup SDRAM Base and Option Registers
+	 */
+	lbc->or2 = CFG_OR2_PRELIM;
+	asm("msync");
+
+	lbc->br2 = CFG_BR2_PRELIM;
+	asm("msync");
+
+	lbc->lbcr = CFG_LBC_LBCR;
+	asm("msync");
+
+
+	lbc->lsrt = CFG_LBC_LSRT;
+	lbc->mrtpr = CFG_LBC_MRTPR;
+	asm("msync");
+
+	/*
+	 * Determine which address lines to use baed on CPU board rev.
+	 */
+	cpu_board_rev = get_cpu_board_revision();
+	lsdmr_common = CFG_LBC_LSDMR_COMMON;
+	if (cpu_board_rev == MPC85XX_CPU_BOARD_REV_1_0) {
+		lsdmr_common |= CFG_LBC_LSDMR_BSMA1617;
+	} else if (cpu_board_rev == MPC85XX_CPU_BOARD_REV_1_1) {
+		lsdmr_common |= CFG_LBC_LSDMR_BSMA1516;
+	} else {
+		/*
+		 * Assume something unable to identify itself is
+		 * really old, and likely has lines 16/17 mapped.
+		 */
+		lsdmr_common |= CFG_LBC_LSDMR_BSMA1617;
+	}
+
+	/*
+	 * Issue PRECHARGE ALL command.
+	 */
+	lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_PCHALL;
+	asm("sync;msync");
+	*sdram_addr = 0xff;
+	ppcDcbf((unsigned long) sdram_addr);
+	udelay(100);
+
+	/*
+	 * Issue 8 AUTO REFRESH commands.
+	 */
+	for (idx = 0; idx < 8; idx++) {
+		lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_ARFRSH;
+		asm("sync;msync");
+		*sdram_addr = 0xff;
+		ppcDcbf((unsigned long) sdram_addr);
+		udelay(100);
+	}
+
+	/*
+	 * Issue 8 MODE-set command.
+	 */
+	lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_MRW;
+	asm("sync;msync");
+	*sdram_addr = 0xff;
+	ppcDcbf((unsigned long) sdram_addr);
+	udelay(100);
+
+	/*
+	 * Issue NORMAL OP command.
+	 */
+	lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_NORMAL;
+	asm("sync;msync");
+	*sdram_addr = 0xff;
+	ppcDcbf((unsigned long) sdram_addr);
+	udelay(200);    /* Overkill. Must wait > 200 bus cycles */
+
+#endif	/* enable SDRAM init */
+}
+
+#if defined(CFG_DRAM_TEST)
+int
+testdram(void)
+{
+	uint *pstart = (uint *) CFG_MEMTEST_START;
+	uint *pend = (uint *) CFG_MEMTEST_END;
+	uint *p;
+
+	printf("Testing DRAM from 0x%08x to 0x%08x\n",
+	       CFG_MEMTEST_START,
+	       CFG_MEMTEST_END);
+
+	printf("DRAM test phase 1:\n");
+	for (p = pstart; p < pend; p++)
+		*p = 0xaaaaaaaa;
+
+	for (p = pstart; p < pend; p++) {
+		if (*p != 0xaaaaaaaa) {
+			printf ("DRAM test fails at: %08x\n", (uint) p);
+			return 1;
+		}
+	}
+
+	printf("DRAM test phase 2:\n");
+	for (p = pstart; p < pend; p++)
+		*p = 0x55555555;
+
+	for (p = pstart; p < pend; p++) {
+		if (*p != 0x55555555) {
+			printf ("DRAM test fails at: %08x\n", (uint) p);
+			return 1;
+		}
+	}
+
+	printf("DRAM test passed.\n");
+	return 0;
+}
+#endif
+
+#if defined(CONFIG_PCI)
+
+/*
+ * Initialize PCI Devices, report devices found.
+ */
+
+#ifndef CONFIG_PCI_PNP
+static struct pci_config_table pci_mpc85xxcds_config_table[] = {
+    { PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID,
+      PCI_IDSEL_NUMBER, PCI_ANY_ID,
+      pci_cfgfunc_config_device, { PCI_ENET0_IOADDR,
+				   PCI_ENET0_MEMADDR,
+				   PCI_COMMAND_MEMORY | PCI_COMMAND_MASTER
+      } },
+    { }
+};
+#endif
+
+static struct pci_controller hose = {
+#ifndef CONFIG_PCI_PNP
+	config_table: pci_mpc85xxcds_config_table,
+#endif
+};
+
+#endif	/* CONFIG_PCI */
+
+void
+pci_init_board(void)
+{
+#ifdef CONFIG_PCI
+	extern void pci_mpc85xx_init(struct pci_controller *hose);
+
+	pci_mpc85xx_init(&hose);
+#endif
+}
--- a/board/cds/mpc8541cds/u-boot.lds
+++ b/board/cds/mpc8541cds/u-boot.lds
@@ -0,0 +1,147 @@
+/*
+ * Copyright 2004 Freescale Semiconductor.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+OUTPUT_ARCH(powerpc)
+SEARCH_DIR(/lib); SEARCH_DIR(/usr/lib); SEARCH_DIR(/usr/local/lib); SEARCH_DIR(/usr/local/powerpc-any-elf/lib);
+/* Do we need any of these for elf?
+   __DYNAMIC = 0;    */
+SECTIONS
+{
+  .resetvec 0xFFFFFFFC :
+  {
+    *(.resetvec)
+  } = 0xffff
+
+  .bootpg 0xFFFFF000 :
+  {
+    cpu/mpc85xx/start.o	(.bootpg)
+    board/cds/mpc8541cds/init.o (.bootpg)
+  } = 0xffff
+
+  /* Read-only sections, merged into text segment: */
+  . = + SIZEOF_HEADERS;
+  .interp : { *(.interp) }
+  .hash          : { *(.hash)		}
+  .dynsym        : { *(.dynsym)		}
+  .dynstr        : { *(.dynstr)		}
+  .rel.text      : { *(.rel.text)		}
+  .rela.text     : { *(.rela.text) 	}
+  .rel.data      : { *(.rel.data)		}
+  .rela.data     : { *(.rela.data) 	}
+  .rel.rodata    : { *(.rel.rodata) 	}
+  .rela.rodata   : { *(.rela.rodata) 	}
+  .rel.got       : { *(.rel.got)		}
+  .rela.got      : { *(.rela.got)		}
+  .rel.ctors     : { *(.rel.ctors)	}
+  .rela.ctors    : { *(.rela.ctors)	}
+  .rel.dtors     : { *(.rel.dtors)	}
+  .rela.dtors    : { *(.rela.dtors)	}
+  .rel.bss       : { *(.rel.bss)		}
+  .rela.bss      : { *(.rela.bss)		}
+  .rel.plt       : { *(.rel.plt)		}
+  .rela.plt      : { *(.rela.plt)		}
+  .init          : { *(.init)	}
+  .plt : { *(.plt) }
+  .text      :
+  {
+    cpu/mpc85xx/start.o	(.text)
+    board/cds/mpc8541cds/init.o (.text)
+    cpu/mpc85xx/traps.o (.text)
+    cpu/mpc85xx/interrupts.o (.text)
+    cpu/mpc85xx/cpu_init.o (.text)
+    cpu/mpc85xx/cpu.o (.text)
+    cpu/mpc85xx/tsec.o (.text)
+    cpu/mpc85xx/speed.o (.text)
+    cpu/mpc85xx/pci.o (.text)
+    common/dlmalloc.o (.text)
+    lib_generic/crc32.o (.text)
+    lib_ppc/extable.o (.text)
+    lib_generic/zlib.o (.text)
+    *(.text)
+    *(.fixup)
+    *(.got1)
+   }
+    _etext = .;
+    PROVIDE (etext = .);
+    .rodata    :
+   {
+    *(.rodata)
+    *(.rodata1)
+    *(.rodata.str1.4)
+  }
+  .fini      : { *(.fini)    } =0
+  .ctors     : { *(.ctors)   }
+  .dtors     : { *(.dtors)   }
+
+  /* Read-write section, merged into data segment: */
+  . = (. + 0x00FF) & 0xFFFFFF00;
+  _erotext = .;
+  PROVIDE (erotext = .);
+  .reloc   :
+  {
+    *(.got)
+    _GOT2_TABLE_ = .;
+    *(.got2)
+    _FIXUP_TABLE_ = .;
+    *(.fixup)
+  }
+  __got2_entries = (_FIXUP_TABLE_ - _GOT2_TABLE_) >> 2;
+  __fixup_entries = (. - _FIXUP_TABLE_) >> 2;
+
+  .data    :
+  {
+    *(.data)
+    *(.data1)
+    *(.sdata)
+    *(.sdata2)
+    *(.dynamic)
+    CONSTRUCTORS
+  }
+  _edata  =  .;
+  PROVIDE (edata = .);
+
+  __u_boot_cmd_start = .;
+  .u_boot_cmd : { *(.u_boot_cmd) }
+  __u_boot_cmd_end = .;
+
+  __start___ex_table = .;
+  __ex_table : { *(__ex_table) }
+  __stop___ex_table = .;
+
+  . = ALIGN(256);
+  __init_begin = .;
+  .text.init : { *(.text.init) }
+  .data.init : { *(.data.init) }
+  . = ALIGN(256);
+  __init_end = .;
+
+  __bss_start = .;
+  .bss       :
+  {
+   *(.sbss) *(.scommon)
+   *(.dynbss)
+   *(.bss)
+   *(COMMON)
+  }
+  _end = . ;
+  PROVIDE (end = .);
+}
--- a/board/cds/mpc8555cds/Makefile
+++ b/board/cds/mpc8555cds/Makefile
@@ -0,0 +1,51 @@
+#
+# Copyright 2004 Freescale Semiconductor.
+# (C) Copyright 2001
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+include $(TOPDIR)/config.mk
+
+LIB	= lib$(BOARD).a
+
+OBJS	:= $(BOARD).o \
+	   ../common/cadmus.o \
+	   ../common/eeprom.o
+
+SOBJS	:= init.o
+
+$(LIB):	$(OBJS) $(SOBJS)
+	$(AR) crv $@ $(OBJS)
+
+clean:
+	rm -f $(OBJS) $(SOBJS)
+
+distclean:	clean
+	rm -f $(LIB) core *.bak .depend
+
+#########################################################################
+
+.depend:	Makefile $(SOBJS:.o=.S) $(OBJS:.o=.c)
+		$(CC) -M $(CPPFLAGS) $(SOBJS:.o=.S) $(OBJS:.o=.c) > $@
+
+-include .depend
+
+#########################################################################
--- a/board/cds/mpc8555cds/config.mk
+++ b/board/cds/mpc8555cds/config.mk
@@ -0,0 +1,30 @@
+#
+# Copyright 2004 Freescale Semiconductor.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+#
+# mpc8555cds board
+#
+TEXT_BASE = 0xfff80000
+
+PLATFORM_CPPFLAGS += -DCONFIG_E500=1
+PLATFORM_CPPFLAGS += -DCONFIG_MPC85xx=1
+PLATFORM_CPPFLAGS += -DCONFIG_MPC8555=1
--- a/board/cds/mpc8555cds/init.S
+++ b/board/cds/mpc8555cds/init.S
@@ -0,0 +1,255 @@
+/*
+ * Copyright 2004 Freescale Semiconductor.
+ * Copyright 2002,2003, Motorola Inc.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <ppc_asm.tmpl>
+#include <ppc_defs.h>
+#include <asm/cache.h>
+#include <asm/mmu.h>
+#include <config.h>
+#include <mpc85xx.h>
+
+
+/*
+ * TLB0 and TLB1 Entries
+ *
+ * Out of reset, TLB1's Entry 0 maps the highest 4K for CCSRBAR.
+ * However, CCSRBAR is then relocated to CFG_CCSRBAR right after
+ * these TLB entries are established.
+ *
+ * The TLB entries for DDR are dynamically setup in spd_sdram()
+ * and use TLB1 Entries 8 through 15 as needed according to the
+ * size of DDR memory.
+ *
+ * MAS0: tlbsel, esel, nv
+ * MAS1: valid, iprot, tid, ts, tsize
+ * MAS2: epn, sharen, x0, x1, w, i, m, g, e
+ * MAS3: rpn, u0-u3, ux, sx, uw, sw, ur, sr
+ */
+
+#define	entry_start \
+	mflr	r1 	;	\
+	bl	0f 	;
+
+#define	entry_end \
+0:	mflr	r0	;	\
+	mtlr	r1	;	\
+	blr		;
+
+
+	.section	.bootpg, "ax"
+	.globl	tlb1_entry
+tlb1_entry:
+	entry_start
+
+	/*
+	 * Number of TLB0 and TLB1 entries in the following table
+	 */
+	.long 13
+
+#if (CFG_CCSRBAR_DEFAULT != CFG_CCSRBAR)
+	/*
+	 * TLB0		4K	Non-cacheable, guarded
+	 * 0xff700000	4K	Initial CCSRBAR mapping
+	 *
+	 * This ends up at a TLB0 Index==0 entry, and must not collide
+	 * with other TLB0 Entries.
+	 */
+	.long TLB1_MAS0(0, 0, 0)
+	.long TLB1_MAS1(1, 0, 0, 0, 0)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR_DEFAULT), 0,0,0,0,0,1,0,1,0,1)
+#else
+#error("Update the number of table entries in tlb1_entry")
+#endif
+
+	/*
+	 * TLB0		16K	Cacheable, non-guarded
+	 * 0xd001_0000	16K	Temporary Global data for initialization
+	 *
+	 * Use four 4K TLB0 entries.  These entries must be cacheable
+	 * as they provide the bootstrap memory before the memory
+	 * controler and real memory have been configured.
+	 *
+	 * These entries end up at TLB0 Indicies 0x10, 0x14, 0x18 and 0x1c,
+	 * and must not collide with other TLB0 entries.
+	 */
+	.long TLB1_MAS0(0, 0, 0)
+	.long TLB1_MAS1(1, 0, 0, 0, 0)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR),
+			0,0,0,0,0,0,0,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR),
+			0,0,0,0,0,1,0,1,0,1)
+
+	.long TLB1_MAS0(0, 0, 0)
+	.long TLB1_MAS1(1, 0, 0, 0, 0)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 4 * 1024),
+			0,0,0,0,0,0,0,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 4 * 1024),
+			0,0,0,0,0,1,0,1,0,1)
+
+	.long TLB1_MAS0(0, 0, 0)
+	.long TLB1_MAS1(1, 0, 0, 0, 0)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 8 * 1024),
+			0,0,0,0,0,0,0,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 8 * 1024),
+			0,0,0,0,0,1,0,1,0,1)
+
+	.long TLB1_MAS0(0, 0, 0)
+	.long TLB1_MAS1(1, 0, 0, 0, 0)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_INIT_RAM_ADDR + 12 * 1024),
+			0,0,0,0,0,0,0,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_INIT_RAM_ADDR + 12 * 1024),
+			0,0,0,0,0,1,0,1,0,1)
+
+
+	/*
+	 * TLB 0:	16M	Non-cacheable, guarded
+	 * 0xff000000	16M	FLASH
+	 * Out of reset this entry is only 4K.
+	 */
+	.long TLB1_MAS0(1, 0, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_16M)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_FLASH_BASE), 0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_FLASH_BASE), 0,0,0,0,0,1,0,1,0,1)
+
+	/*
+	 * TLB 1:	256M	Non-cacheable, guarded
+	 * 0x80000000	256M	PCI1 MEM First half
+	 */
+	.long TLB1_MAS0(1, 1, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_PCI1_MEM_BASE), 0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_PCI1_MEM_BASE), 0,0,0,0,0,1,0,1,0,1)
+
+	/*
+	 * TLB 2:	256M	Non-cacheable, guarded
+	 * 0x90000000	256M	PCI1 MEM Second half
+	 */
+	.long TLB1_MAS0(1, 2, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_PCI1_MEM_BASE + 0x10000000),
+			0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_PCI1_MEM_BASE + 0x10000000),
+			0,0,0,0,0,1,0,1,0,1)
+
+	/*
+	 * TLB 3:	256M	Non-cacheable, guarded
+	 * 0xa0000000	256M	PCI2 MEM First half
+	 */
+	.long TLB1_MAS0(1, 3, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_PCI2_MEM_BASE), 0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_PCI2_MEM_BASE), 0,0,0,0,0,1,0,1,0,1)
+
+	/*
+	 * TLB 4:	256M	Non-cacheable, guarded
+	 * 0xb0000000	256M	PCI2 MEM Second half
+	 */
+	.long TLB1_MAS0(1, 4, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_256M)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_PCI2_MEM_BASE + 0x10000000),
+			0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_PCI2_MEM_BASE + 0x10000000),
+			0,0,0,0,0,1,0,1,0,1)
+
+	/*
+	 * TLB 5:	64M	Non-cacheable, guarded
+	 * 0xe000_0000	1M	CCSRBAR
+	 * 0xe200_0000	16M	PCI1 IO
+	 * 0xe300_0000	16M	PCI2 IO
+	 */
+	.long TLB1_MAS0(1, 5, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_CCSRBAR), 0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_CCSRBAR), 0,0,0,0,0,1,0,1,0,1)
+
+	/*
+	 * TLB 6:	64M	Cacheable, non-guarded
+	 * 0xf000_0000	64M	LBC SDRAM
+	 */
+	.long TLB1_MAS0(1, 6, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_64M)
+	.long TLB1_MAS2(E500_TLB_EPN(CFG_LBC_SDRAM_BASE), 0,0,0,0,0,0,0,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CFG_LBC_SDRAM_BASE), 0,0,0,0,0,1,0,1,0,1)
+
+	/*
+	 * TLB 7:	1M	Non-cacheable, guarded
+	 * 0xf8000000	1M	CADMUS registers
+	 */
+	.long TLB1_MAS0(1, 7, 0)
+	.long TLB1_MAS1(1, 1, 0, 0, BOOKE_PAGESZ_1M)
+	.long TLB1_MAS2(E500_TLB_EPN(CADMUS_BASE_ADDR), 0,0,0,0,1,0,1,0)
+	.long TLB1_MAS3(E500_TLB_RPN(CADMUS_BASE_ADDR), 0,0,0,0,0,1,0,1,0,1)
+
+	entry_end
+
+/*
+ * LAW(Local Access Window) configuration:
+ *
+ * 0x0000_0000     0x7fff_ffff     DDR                     2G
+ * 0x8000_0000     0x9fff_ffff     PCI1 MEM                512M
+ * 0xa000_0000     0xbfff_ffff     PCI2 MEM                512M
+ * 0xe000_0000     0xe000_ffff     CCSR                    1M
+ * 0xe200_0000     0xe2ff_ffff     PCI1 IO                 16M
+ * 0xe300_0000     0xe3ff_ffff     PCI2 IO                 16M
+ * 0xf000_0000     0xf7ff_ffff     SDRAM                   128M
+ * 0xf800_0000     0xf80f_ffff     NVRAM/CADMUS (*)        1M
+ * 0xff00_0000     0xff7f_ffff     FLASH (2nd bank)        8M
+ * 0xff80_0000     0xffff_ffff     FLASH (boot bank)       8M
+ *
+ * Notes:
+ *    CCSRBAR and L2-as-SRAM don't need a configured Local Access Window.
+ *    If flash is 8M at default position (last 8M), no LAW needed.
+ *
+ * The defines below are 1-off of the actual LAWAR0 usage.
+ * So LAWAR3 define uses the LAWAR4 register in the ECM.
+ */
+
+#define LAWBAR0 0
+#define LAWAR0  ((LAWAR_TRGT_IF_DDR | (LAWAR_SIZE & LAWAR_SIZE_128M)) & ~LAWAR_EN)
+
+#define LAWBAR1 ((CFG_PCI1_MEM_BASE>>12) & 0xfffff)
+#define LAWAR1 	(LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_512M))
+
+#define LAWBAR2 ((CFG_PCI2_MEM_BASE>>12) & 0xfffff)
+#define LAWAR2 	(LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_512M))
+
+#define LAWBAR3 ((CFG_PCI1_IO_BASE>>12) & 0xfffff)
+#define LAWAR3 	(LAWAR_EN | LAWAR_TRGT_IF_PCI1 | (LAWAR_SIZE & LAWAR_SIZE_16M))
+
+#define LAWBAR4 ((CFG_PCI2_IO_BASE>>12) & 0xfffff)
+#define LAWAR4 	(LAWAR_EN | LAWAR_TRGT_IF_PCI2 | (LAWAR_SIZE & LAWAR_SIZE_16M))
+
+/* LBC window - maps 256M 0xf0000000 -> 0xffffffff */
+#define LAWBAR5 ((CFG_LBC_SDRAM_BASE>>12) & 0xfffff)
+#define LAWAR5 	(LAWAR_EN | LAWAR_TRGT_IF_LBC | (LAWAR_SIZE & LAWAR_SIZE_256M))
+
+	.section .bootpg, "ax"
+	.globl	law_entry
+
+law_entry:
+	entry_start
+	.long 6
+	.long LAWBAR0,LAWAR0,LAWBAR1,LAWAR1,LAWBAR2,LAWAR2,LAWBAR3,LAWAR3
+	.long LAWBAR4,LAWAR4,LAWBAR5,LAWAR5
+	entry_end
--- a/board/cds/mpc8555cds/mpc8555cds.c
+++ b/board/cds/mpc8555cds/mpc8555cds.c
@@ -0,0 +1,346 @@
+/*
+ * Copyright 2004 Freescale Semiconductor.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <pci.h>
+#include <asm/processor.h>
+#include <asm/immap_85xx.h>
+#include <spd.h>
+
+#include "../common/cadmus.h"
+#include "../common/eeprom.h"
+
+#if defined(CONFIG_DDR_ECC)
+extern void ddr_enable_ecc(unsigned int dram_size);
+#endif
+
+extern long int spd_sdram(void);
+
+void local_bus_init(void);
+void sdram_init(void);
+
+int board_early_init_f (void)
+{
+	return 0;
+}
+
+int checkboard (void)
+{
+	volatile immap_t *immap = (immap_t *) CFG_CCSRBAR;
+	volatile ccsr_gur_t *gur = &immap->im_gur;
+
+	/* PCI slot in USER bits CSR[6:7] by convention. */
+	uint pci_slot = get_pci_slot ();
+
+	uint pci_dual = get_pci_dual ();	/* PCI DUAL in CM_PCI[3] */
+	uint pci1_32 = gur->pordevsr & 0x10000;	/* PORDEVSR[15] */
+	uint pci1_clk_sel = gur->porpllsr & 0x8000;	/* PORPLLSR[16] */
+	uint pci2_clk_sel = gur->porpllsr & 0x4000;	/* PORPLLSR[17] */
+
+	uint pci1_speed = get_clock_freq ();	/* PCI PSPEED in [4:5] */
+
+	uint cpu_board_rev = get_cpu_board_revision ();
+
+	printf ("Board: CDS Version 0x%02x, PCI Slot %d\n",
+		get_board_version (), pci_slot);
+
+	printf ("CPU Board Revision %d.%d (0x%04x)\n",
+		MPC85XX_CPU_BOARD_MAJOR (cpu_board_rev),
+		MPC85XX_CPU_BOARD_MINOR (cpu_board_rev), cpu_board_rev);
+
+	printf ("    PCI1: %d bit, %s MHz, %s\n",
+		(pci1_32) ? 32 : 64,
+		(pci1_speed == 33000000) ? "33" :
+		(pci1_speed == 66000000) ? "66" : "unknown",
+		pci1_clk_sel ? "sync" : "async");
+
+	if (pci_dual) {
+		printf ("    PCI2: 32 bit, 66 MHz, %s\n",
+			pci2_clk_sel ? "sync" : "async");
+	} else {
+		printf ("    PCI2: disabled\n");
+	}
+
+	/*
+	 * Initialize local bus.
+	 */
+	local_bus_init ();
+
+	return 0;
+}
+
+long int
+initdram(int board_type)
+{
+	long dram_size = 0;
+	volatile immap_t *immap = (immap_t *)CFG_IMMR;
+
+	puts("Initializing\n");
+
+#if defined(CONFIG_DDR_DLL)
+	{
+		/*
+		 * Work around to stabilize DDR DLL MSYNC_IN.
+		 * Errata DDR9 seems to have been fixed.
+		 * This is now the workaround for Errata DDR11:
+		 *    Override DLL = 1, Course Adj = 1, Tap Select = 0
+		 */
+
+		volatile ccsr_gur_t *gur= &immap->im_gur;
+
+		gur->ddrdllcr = 0x81000000;
+		asm("sync;isync;msync");
+		udelay(200);
+	}
+#endif
+	dram_size = spd_sdram();
+
+#if defined(CONFIG_DDR_ECC)
+	/*
+	 * Initialize and enable DDR ECC.
+	 */
+	ddr_enable_ecc(dram_size);
+#endif
+	/*
+	 * SDRAM Initialization
+	 */
+	sdram_init();
+
+	puts("    DDR: ");
+	return dram_size;
+}
+
+/*
+ * Initialize Local Bus
+ */
+void
+local_bus_init(void)
+{
+	volatile immap_t *immap = (immap_t *)CFG_IMMR;
+	volatile ccsr_gur_t *gur = &immap->im_gur;
+	volatile ccsr_lbc_t *lbc = &immap->im_lbc;
+
+	uint clkdiv;
+	uint lbc_hz;
+	sys_info_t sysinfo;
+	uint temp_lbcdll;
+
+	/*
+	 * Errata LBC11.
+	 * Fix Local Bus clock glitch when DLL is enabled.
+	 *
+	 * If localbus freq is < 66Mhz, DLL bypass mode must be used.
+	 * If localbus freq is > 133Mhz, DLL can be safely enabled.
+	 * Between 66 and 133, the DLL is enabled with an override workaround.
+	 */
+
+	get_sys_info(&sysinfo);
+	clkdiv = lbc->lcrr & 0x0f;
+	lbc_hz = sysinfo.freqSystemBus / 1000000 / clkdiv;
+
+	if (lbc_hz < 66) {
+		lbc->lcrr |= 0x80000000;	/* DLL Bypass */
+
+	} else if (lbc_hz >= 133) {
+		lbc->lcrr &= (~0x80000000);		/* DLL Enabled */
+
+	} else {
+		lbc->lcrr &= (~0x8000000);	/* DLL Enabled */
+		udelay(200);
+
+		/*
+		 * Sample LBC DLL ctrl reg, upshift it to set the
+		 * override bits.
+		 */
+		temp_lbcdll = gur->lbcdllcr;
+		gur->lbcdllcr = (((temp_lbcdll & 0xff) << 16) | 0x80000000);
+		asm("sync;isync;msync");
+	}
+}
+
+/*
+ * Initialize SDRAM memory on the Local Bus.
+ */
+void
+sdram_init(void)
+{
+#if defined(CFG_OR2_PRELIM) && defined(CFG_BR2_PRELIM)
+
+	uint idx;
+	volatile immap_t *immap = (immap_t *)CFG_IMMR;
+	volatile ccsr_lbc_t *lbc = &immap->im_lbc;
+	uint *sdram_addr = (uint *)CFG_LBC_SDRAM_BASE;
+	uint cpu_board_rev;
+	uint lsdmr_common;
+
+	puts("    SDRAM: ");
+
+	print_size (CFG_LBC_SDRAM_SIZE * 1024 * 1024, "\n");
+
+	/*
+	 * Setup SDRAM Base and Option Registers
+	 */
+	lbc->or2 = CFG_OR2_PRELIM;
+	asm("msync");
+
+	lbc->br2 = CFG_BR2_PRELIM;
+	asm("msync");
+
+	lbc->lbcr = CFG_LBC_LBCR;
+	asm("msync");
+
+	lbc->lsrt = CFG_LBC_LSRT;
+	lbc->mrtpr = CFG_LBC_MRTPR;
+	asm("msync");
+
+	/*
+	 * Determine which address lines to use baed on CPU board rev.
+	 */
+	cpu_board_rev = get_cpu_board_revision();
+	lsdmr_common = CFG_LBC_LSDMR_COMMON;
+	if (cpu_board_rev == MPC85XX_CPU_BOARD_REV_1_0) {
+		lsdmr_common |= CFG_LBC_LSDMR_BSMA1617;
+	} else if (cpu_board_rev == MPC85XX_CPU_BOARD_REV_1_1) {
+		lsdmr_common |= CFG_LBC_LSDMR_BSMA1516;
+	} else {
+		/*
+		 * Assume something unable to identify itself is
+		 * really old, and likely has lines 16/17 mapped.
+		 */
+		lsdmr_common |= CFG_LBC_LSDMR_BSMA1617;
+	}
+
+	/*
+	 * Issue PRECHARGE ALL command.
+	 */
+	lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_PCHALL;
+	asm("sync;msync");
+	*sdram_addr = 0xff;
+	ppcDcbf((unsigned long) sdram_addr);
+	udelay(100);
+
+	/*
+	 * Issue 8 AUTO REFRESH commands.
+	 */
+	for (idx = 0; idx < 8; idx++) {
+		lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_ARFRSH;
+		asm("sync;msync");
+		*sdram_addr = 0xff;
+		ppcDcbf((unsigned long) sdram_addr);
+		udelay(100);
+	}
+
+	/*
+	 * Issue 8 MODE-set command.
+	 */
+	lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_MRW;
+	asm("sync;msync");
+	*sdram_addr = 0xff;
+	ppcDcbf((unsigned long) sdram_addr);
+	udelay(100);
+
+	/*
+	 * Issue NORMAL OP command.
+	 */
+	lbc->lsdmr = lsdmr_common | CFG_LBC_LSDMR_OP_NORMAL;
+	asm("sync;msync");
+	*sdram_addr = 0xff;
+	ppcDcbf((unsigned long) sdram_addr);
+	udelay(200);    /* Overkill. Must wait > 200 bus cycles */
+
+#endif	/* enable SDRAM init */
+}
+
+#if defined(CFG_DRAM_TEST)
+int
+testdram(void)
+{
+	uint *pstart = (uint *) CFG_MEMTEST_START;
+	uint *pend = (uint *) CFG_MEMTEST_END;
+	uint *p;
+
+	printf("Testing DRAM from 0x%08x to 0x%08x\n",
+	       CFG_MEMTEST_START,
+	       CFG_MEMTEST_END);
+
+	printf("DRAM test phase 1:\n");
+	for (p = pstart; p < pend; p++)
+		*p = 0xaaaaaaaa;
+
+	for (p = pstart; p < pend; p++) {
+		if (*p != 0xaaaaaaaa) {
+			printf ("DRAM test fails at: %08x\n", (uint) p);
+			return 1;
+		}
+	}
+
+	printf("DRAM test phase 2:\n");
+	for (p = pstart; p < pend; p++)
+		*p = 0x55555555;
+
+	for (p = pstart; p < pend; p++) {
+		if (*p != 0x55555555) {
+			printf ("DRAM test fails at: %08x\n", (uint) p);
+			return 1;
+		}
+	}
+
+	printf("DRAM test passed.\n");
+	return 0;
+}
+#endif
+
+#if defined(CONFIG_PCI)
+
+/*
+ * Initialize PCI Devices, report devices found.
+ */
+
+#ifndef CONFIG_PCI_PNP
+static struct pci_config_table pci_mpc85xxcds_config_table[] = {
+    { PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID,
+      PCI_IDSEL_NUMBER, PCI_ANY_ID,
+      pci_cfgfunc_config_device, { PCI_ENET0_IOADDR,
+				   PCI_ENET0_MEMADDR,
+				   PCI_COMMAND_MEMORY | PCI_COMMAND_MASTER
+      } },
+    { }
+};
+#endif
+
+static struct pci_controller hose = {
+#ifndef CONFIG_PCI_PNP
+	config_table: pci_mpc85xxcds_config_table,
+#endif
+};
+
+#endif	/* CONFIG_PCI */
+
+void
+pci_init_board(void)
+{
+#ifdef CONFIG_PCI
+	extern void pci_mpc85xx_init(struct pci_controller *hose);
+
+	pci_mpc85xx_init(&hose);
+#endif
+}
--- a/board/cds/mpc8555cds/u-boot.lds
+++ b/board/cds/mpc8555cds/u-boot.lds
@@ -0,0 +1,147 @@
+/*
+ * Copyright 2004 Freescale Semiconductor.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+OUTPUT_ARCH(powerpc)
+SEARCH_DIR(/lib); SEARCH_DIR(/usr/lib); SEARCH_DIR(/usr/local/lib); SEARCH_DIR(/usr/local/powerpc-any-elf/lib);
+/* Do we need any of these for elf?
+   __DYNAMIC = 0;    */
+SECTIONS
+{
+  .resetvec 0xFFFFFFFC :
+  {
+    *(.resetvec)
+  } = 0xffff
+
+  .bootpg 0xFFFFF000 :
+  {
+    cpu/mpc85xx/start.o	(.bootpg)
+    board/cds/mpc8555cds/init.o (.bootpg)
+  } = 0xffff
+
+  /* Read-only sections, merged into text segment: */
+  . = + SIZEOF_HEADERS;
+  .interp : { *(.interp) }
+  .hash          : { *(.hash)		}
+  .dynsym        : { *(.dynsym)		}
+  .dynstr        : { *(.dynstr)		}
+  .rel.text      : { *(.rel.text)		}
+  .rela.text     : { *(.rela.text) 	}
+  .rel.data      : { *(.rel.data)		}
+  .rela.data     : { *(.rela.data) 	}
+  .rel.rodata    : { *(.rel.rodata) 	}
+  .rela.rodata   : { *(.rela.rodata) 	}
+  .rel.got       : { *(.rel.got)		}
+  .rela.got      : { *(.rela.got)		}
+  .rel.ctors     : { *(.rel.ctors)	}
+  .rela.ctors    : { *(.rela.ctors)	}
+  .rel.dtors     : { *(.rel.dtors)	}
+  .rela.dtors    : { *(.rela.dtors)	}
+  .rel.bss       : { *(.rel.bss)		}
+  .rela.bss      : { *(.rela.bss)		}
+  .rel.plt       : { *(.rel.plt)		}
+  .rela.plt      : { *(.rela.plt)		}
+  .init          : { *(.init)	}
+  .plt : { *(.plt) }
+  .text      :
+  {
+    cpu/mpc85xx/start.o	(.text)
+    board/cds/mpc8555cds/init.o (.text)
+    cpu/mpc85xx/traps.o (.text)
+    cpu/mpc85xx/interrupts.o (.text)
+    cpu/mpc85xx/cpu_init.o (.text)
+    cpu/mpc85xx/cpu.o (.text)
+    cpu/mpc85xx/tsec.o (.text)
+    cpu/mpc85xx/speed.o (.text)
+    cpu/mpc85xx/pci.o (.text)
+    common/dlmalloc.o (.text)
+    lib_generic/crc32.o (.text)
+    lib_ppc/extable.o (.text)
+    lib_generic/zlib.o (.text)
+    *(.text)
+    *(.fixup)
+    *(.got1)
+   }
+    _etext = .;
+    PROVIDE (etext = .);
+    .rodata    :
+   {
+    *(.rodata)
+    *(.rodata1)
+    *(.rodata.str1.4)
+  }
+  .fini      : { *(.fini)    } =0
+  .ctors     : { *(.ctors)   }
+  .dtors     : { *(.dtors)   }
+
+  /* Read-write section, merged into data segment: */
+  . = (. + 0x00FF) & 0xFFFFFF00;
+  _erotext = .;
+  PROVIDE (erotext = .);
+  .reloc   :
+  {
+    *(.got)
+    _GOT2_TABLE_ = .;
+    *(.got2)
+    _FIXUP_TABLE_ = .;
+    *(.fixup)
+  }
+  __got2_entries = (_FIXUP_TABLE_ - _GOT2_TABLE_) >> 2;
+  __fixup_entries = (. - _FIXUP_TABLE_) >> 2;
+
+  .data    :
+  {
+    *(.data)
+    *(.data1)
+    *(.sdata)
+    *(.sdata2)
+    *(.dynamic)
+    CONSTRUCTORS
+  }
+  _edata  =  .;
+  PROVIDE (edata = .);
+
+  __u_boot_cmd_start = .;
+  .u_boot_cmd : { *(.u_boot_cmd) }
+  __u_boot_cmd_end = .;
+
+  __start___ex_table = .;
+  __ex_table : { *(__ex_table) }
+  __stop___ex_table = .;
+
+  . = ALIGN(256);
+  __init_begin = .;
+  .text.init : { *(.text.init) }
+  .data.init : { *(.data.init) }
+  . = ALIGN(256);
+  __init_end = .;
+
+  __bss_start = .;
+  .bss       :
+  {
+   *(.sbss) *(.scommon)
+   *(.dynbss)
+   *(.bss)
+   *(COMMON)
+  }
+  _end = . ;
+  PROVIDE (end = .);
+}
--- a/board/cerf250/Makefile
+++ b/board/cerf250/Makefile
@@ -0,0 +1,47 @@
+#
+# (C) Copyright 2000
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+include $(TOPDIR)/config.mk
+
+LIB	= lib$(BOARD).a
+
+OBJS	:= cerf250.o flash.o
+SOBJS	:= lowlevel_init.o
+
+$(LIB):	$(OBJS) $(SOBJS)
+	$(AR) crv $@ $(OBJS) $(SOBJS)
+
+clean:
+	rm -f $(SOBJS) $(OBJS)
+
+distclean:	clean
+	rm -f $(LIB) core *.bak .depend
+
+#########################################################################
+
+.depend:	Makefile $(SOBJS:.o=.S) $(OBJS:.o=.c)
+		$(CC) -M $(CPPFLAGS) $(SOBJS:.o=.S) $(OBJS:.o=.c) > $@
+
+-include .depend
+
+#########################################################################
--- a/board/cerf250/cerf250.c
+++ b/board/cerf250/cerf250.c
@@ -0,0 +1,75 @@
+/*
+ * (C) Copyright 2002
+ * Kyle Harris, Nexus Technologies, Inc. kharris@nexus-tech.net
+ *
+ * (C) Copyright 2002
+ * Sysgo Real-Time Solutions, GmbH <www.elinos.com>
+ * Marius Groeger <mgroeger@sysgo.de>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+
+/* ------------------------------------------------------------------------- */
+
+
+/*
+ * Miscelaneous platform dependent initialisations
+ */
+
+int board_init (void)
+{
+	DECLARE_GLOBAL_DATA_PTR;
+
+	/* memory and cpu-speed are setup before relocation */
+	/* so we do _nothing_ here */
+
+	/* arch number of cerf PXA Board */
+	gd->bd->bi_arch_number = MACH_TYPE_PXA_CERF;
+
+	/* adress of boot parameters */
+	gd->bd->bi_boot_params = 0xa0000100;
+
+	return 0;
+}
+
+int board_late_init(void)
+{
+	setenv("stdout", "serial");
+	setenv("stderr", "serial");
+	return 0;
+}
+
+
+int dram_init (void)
+{
+	DECLARE_GLOBAL_DATA_PTR;
+
+	gd->bd->bi_dram[0].start = PHYS_SDRAM_1;
+	gd->bd->bi_dram[0].size = PHYS_SDRAM_1_SIZE;
+	gd->bd->bi_dram[1].start = PHYS_SDRAM_2;
+	gd->bd->bi_dram[1].size = PHYS_SDRAM_2_SIZE;
+	gd->bd->bi_dram[2].start = PHYS_SDRAM_3;
+	gd->bd->bi_dram[2].size = PHYS_SDRAM_3_SIZE;
+	gd->bd->bi_dram[3].start = PHYS_SDRAM_4;
+	gd->bd->bi_dram[3].size = PHYS_SDRAM_4_SIZE;
+
+	return 0;
+}
--- a/board/cerf250/config.mk
+++ b/board/cerf250/config.mk
@@ -0,0 +1,5 @@
+#
+# Cerf board with PXA250 cpu
+#
+#
+TEXT_BASE = 0xa3080000
--- a/board/omap1510inn/flash.c
+++ b/board/omap1510inn/flash.c
@@ -27,12 +27,12 @@
 #include <common.h>
 #include <linux/byteorder/swab.h>

-#define PHYS_FLASH_SECT_SIZE    0x00020000	/* 256 KB sectors (x2) */
+
 flash_info_t flash_info[CFG_MAX_FLASH_BANKS];	/* info for FLASH chips    */

 /* Board support for 1 or 2 flash devices */
-#undef FLASH_PORT_WIDTH32
-#define FLASH_PORT_WIDTH16
+#define FLASH_PORT_WIDTH32
+#undef FLASH_PORT_WIDTH16

 #ifdef FLASH_PORT_WIDTH16
 #define FLASH_PORT_WIDTH		ushort
@@ -71,6 +71,10 @@ unsigned long flash_init (void)
 			flash_get_size ((FPW *) PHYS_FLASH_1, &flash_info[i]);
 			flash_get_offsets (PHYS_FLASH_1, &flash_info[i]);
 			break;
+		case 1:
+			flash_get_size ((FPW *) PHYS_FLASH_2, &flash_info[i]);
+			flash_get_offsets (PHYS_FLASH_2, &flash_info[i]);
+			break;
 		default:
 			panic ("configured too many flash banks!\n");
 			break;
@@ -87,8 +91,7 @@ unsigned long flash_init (void)

 	flash_protect ( FLAG_PROTECT_SET,
 			CFG_ENV_ADDR,
-			CFG_ENV_ADDR + CFG_ENV_SIZE - 1,
-			&flash_info[0]);
+			CFG_ENV_ADDR + CFG_ENV_SIZE - 1, &flash_info[0] );

 	return size;
 }
@@ -186,6 +189,7 @@ static ulong flash_get_size (FPW * addr, flash_info_t * info)

 	mb ();
 	value = addr[1];			/* device ID        */
+
 	switch (value) {

 	case (FPW) INTEL_ID_28F128J3A:
@@ -250,7 +254,7 @@ int flash_erase (flash_info_t * info, int s_first, int s_last)
 		printf ("\n");
 	}

-	/*start = get_timer (0); */
+	start = get_timer (0);
 	last = start;

 	/* Disable interrupts which might cause a timeout here */
@@ -281,8 +285,8 @@ int flash_erase (flash_info_t * info, int s_first, int s_last)
 				}
 			}

-			*addr = (FPW) 0x00500050;	/* clear status register cmd.   */
-			*addr = (FPW) 0x00FF00FF;	/* resest to read mode          */
+			*addr = 0x00500050;	/* clear status register cmd.   */
+			*addr = 0x00FF00FF;	/* resest to read mode          */

 			printf (" done\n");
 		}
@@ -392,7 +396,7 @@ static int write_data (flash_info_t * info, ulong dest, FPW data)

 	/* Check if Flash is (sufficiently) erased */
 	if ((*addr & data) != data) {
-		printf ("not erased at %08lx (%x)\n", (ulong) addr, *addr);
+		printf ("not erased at %08lx (%lx)\n", (ulong) addr, *addr);
 		return (2);
 	}
 	/* Disable interrupts which might cause a timeout here */
@@ -406,7 +410,6 @@ static int write_data (flash_info_t * info, ulong dest, FPW data)

 	/* wait while polling the status register */
 	while (((status = *addr) & (FPW) 0x00800080) != (FPW) 0x00800080) {
-
 		if (get_timer_masked () > CFG_FLASH_WRITE_TOUT) {
 			*addr = (FPW) 0x00FF00FF;	/* restore read mode */
 			return (1);
--- a/board/cerf250/lowlevel_init.S
+++ b/board/cerf250/lowlevel_init.S
@@ -0,0 +1,411 @@
+/*
+ * Most of this taken from Redboot hal_platform_setup.h with cleanup
+ *
+ * NOTE: I haven't clean this up considerably, just enough to get it
+ * running. See hal_platform_setup.h for the source. See
+ * board/cradle/lowlevel_init.S for another PXA250 setup that is
+ * much cleaner.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <config.h>
+#include <version.h>
+#include <asm/arch/pxa-regs.h>
+
+DRAM_SIZE:  .long   CFG_DRAM_SIZE
+
+/* wait for coprocessor write complete */
+   .macro CPWAIT reg
+   mrc  p15,0,\reg,c2,c0,0
+   mov  \reg,\reg
+   sub  pc,pc,#4
+   .endm
+
+
+/*
+ * 	Memory setup
+ */
+
+.globl lowlevel_init
+lowlevel_init:
+
+	/* Set up GPIO pins first ----------------------------------------- */
+
+	ldr		r0,	=GPSR0
+	ldr		r1,	=CFG_GPSR0_VAL
+	str		r1,	[r0]
+
+	ldr		r0,	=GPSR1
+	ldr		r1,	=CFG_GPSR1_VAL
+	str		r1,  [r0]
+
+	ldr		r0,	=GPSR2
+	ldr		r1,	=CFG_GPSR2_VAL
+	str		r1,	[r0]
+
+	ldr		r0,	=GPCR0
+	ldr		r1,	=CFG_GPCR0_VAL
+	str		r1,	[r0]
+
+	ldr		r0,	=GPCR1
+	ldr		r1,	=CFG_GPCR1_VAL
+	str		r1,	[r0]
+
+	ldr		r0,	=GPCR2
+	ldr		r1,	=CFG_GPCR2_VAL
+	str		r1,	[r0]
+
+	ldr		r0,	=GPDR0
+	ldr		r1,	=CFG_GPDR0_VAL
+	str		r1,	[r0]
+
+	ldr		r0,	=GPDR1
+	ldr		r1,	=CFG_GPDR1_VAL
+	str		r1,	[r0]
+
+	ldr		r0,	=GPDR2
+	ldr		r1,	=CFG_GPDR2_VAL
+	str		r1,	[r0]
+
+	ldr		r0,	=GAFR0_L
+	ldr		r1,	=CFG_GAFR0_L_VAL
+	str		r1,	[r0]
+
+	ldr		r0,	=GAFR0_U
+	ldr		r1,	=CFG_GAFR0_U_VAL
+	str		r1,	[r0]
+
+	ldr		r0,	=GAFR1_L
+	ldr		r1,	=CFG_GAFR1_L_VAL
+	str		r1,	[r0]
+
+	ldr		r0,	=GAFR1_U
+	ldr		r1,	=CFG_GAFR1_U_VAL
+	str		r1,	[r0]
+
+	ldr		r0,	=GAFR2_L
+	ldr		r1,	=CFG_GAFR2_L_VAL
+	str		r1,	[r0]
+
+	ldr		r0,	=GAFR2_U
+	ldr		r1,	=CFG_GAFR2_U_VAL
+	str		r1,	[r0]
+
+	ldr		r0,	=PSSR				/* enable GPIO pins */
+	ldr		r1,	=CFG_PSSR_VAL
+	str		r1,	[r0]
+
+	/* ---------------------------------------------------------------- */
+	/* Enable memory interface                                          */
+	/*                                                                  */
+	/* The sequence below is based on the recommended init steps        */
+	/* detailed in the Intel PXA250 Operating Systems Developers Guide, */
+	/* Chapter 10.                                                      */
+	/* ---------------------------------------------------------------- */
+
+	/* ---------------------------------------------------------------- */
+	/* Step 1: Wait for at least 200 microsedonds to allow internal     */
+	/*         clocks to settle. Only necessary after hard reset...     */
+	/*         FIXME: can be optimized later                            */
+	/* ---------------------------------------------------------------- */
+
+	ldr		r3,	=OSCR			/* reset the OS Timer Count to zero */
+	mov 	r2,	#0
+	str 	r2,	[r3]
+	ldr 	r4,	=0x300				/* really 0x2E1 is about 200usec,   */
+							/* so 0x300 should be plenty        */
+1:
+	ldr 	r2,	[r3]
+	cmp 	r4,	r2
+	bgt 	1b
+
+mem_init:
+
+	ldr  	r1,	=MEMC_BASE		/* get memory controller base addr. */
+
+	/* ---------------------------------------------------------------- */
+	/* Step 2a: Initialize Asynchronous static memory controller        */
+	/* ---------------------------------------------------------------- */
+
+	/* MSC registers: timing, bus width, mem type                       */
+
+	/* MSC0: nCS(0,1)                                                   */
+	ldr  	r2,	=CFG_MSC0_VAL
+	str  	r2,	[r1, #MSC0_OFFSET]
+	ldr  	r2,	[r1, #MSC0_OFFSET]	/* read back to ensure      */
+						/* that data latches        */
+	/* MSC1: nCS(2,3)                                                   */
+	ldr  	r2,	=CFG_MSC1_VAL
+	str  	r2,	[r1, #MSC1_OFFSET]
+	ldr  	r2,	[r1, #MSC1_OFFSET]
+
+	/* MSC2: nCS(4,5)                                                   */
+	ldr  	r2,	=CFG_MSC2_VAL
+	str  	r2,	[r1, #MSC2_OFFSET]
+	ldr  	r2,	[r1, #MSC2_OFFSET]
+
+	/* ---------------------------------------------------------------- */
+	/* Step 2b: Initialize Card Interface                               */
+	/* ---------------------------------------------------------------- */
+
+	/* MECR: Memory Expansion Card Register                             */
+	ldr  	r2,	=CFG_MECR_VAL
+	str  	r2,	[r1, #MECR_OFFSET]
+	ldr	 	r2,	[r1, #MECR_OFFSET]
+
+	/* MCMEM0: Card Interface slot 0 timing                             */
+	ldr  	r2,	=CFG_MCMEM0_VAL
+	str  	r2,	[r1, #MCMEM0_OFFSET]
+	ldr	 	r2,	[r1, #MCMEM0_OFFSET]
+
+	/* MCMEM1: Card Interface slot 1 timing                             */
+	ldr  	r2,	=CFG_MCMEM1_VAL
+	str  	r2,	[r1, #MCMEM1_OFFSET]
+	ldr	 	r2,	[r1, #MCMEM1_OFFSET]
+
+	/* MCATT0: Card Interface Attribute Space Timing, slot 0            */
+	ldr  	r2,	=CFG_MCATT0_VAL
+	str  	r2,	[r1, #MCATT0_OFFSET]
+	ldr	 	r2,	[r1, #MCATT0_OFFSET]
+
+	/* MCATT1: Card Interface Attribute Space Timing, slot 1            */
+	ldr  	r2, =CFG_MCATT1_VAL
+	str  	r2, [r1, #MCATT1_OFFSET]
+	ldr	 	r2,	[r1, #MCATT1_OFFSET]
+
+	/* MCIO0: Card Interface I/O Space Timing, slot 0                   */
+	ldr  	r2, =CFG_MCIO0_VAL
+	str  	r2, [r1, #MCIO0_OFFSET]
+	ldr	 	r2,	[r1, #MCIO0_OFFSET]
+
+	/* MCIO1: Card Interface I/O Space Timing, slot 1                   */
+	ldr  	r2, =CFG_MCIO1_VAL
+	str  	r2, [r1, #MCIO1_OFFSET]
+	ldr	 	r2,	[r1, #MCIO1_OFFSET]
+
+	/* ---------------------------------------------------------------- */
+	/* Step 2c: Write FLYCNFG  FIXME: what's that???                    */
+	/* ---------------------------------------------------------------- */
+
+
+	/* ---------------------------------------------------------------- */
+	/* Step 2d: Initialize Timing for Sync Memory (SDCLK0)              */
+	/* ---------------------------------------------------------------- */
+
+	/* Before accessing MDREFR we need a valid DRI field, so we set     */
+	/* this to power on defaults + DRI field, set SDRAM clocks free running */
+
+	ldr  	r3, =CFG_MDREFR_VAL
+	ldr  	r2, =0xFFF
+	and  	r3, r3,  r2
+
+	ldr	 	r0,	[r1, #MDREFR_OFFSET]
+	bic	 	r0, r0, r2
+	bic	 	r0, r0, #(MDREFR_K0FREE|MDREFR_K1FREE|MDREFR_K2FREE)
+	orr	 	r0, r0, r3
+
+	str		r0,	[r1, #MDREFR_OFFSET]	/* write back MDREFR        */
+
+
+	/* ---------------------------------------------------------------- */
+	/* Step 3: Initialize Synchronous Static Memory (Flash/Peripherals) */
+	/* ---------------------------------------------------------------- */
+
+	/* Initialize SXCNFG register. Assert the enable bits               */
+
+	/* Write SXMRS to cause an MRS command to all enabled banks of      */
+	/* synchronous static memory. Note that SXLCR need not be written   */
+	/* at this time.                                                    */
+
+	/* FIXME: we use async mode for now                                 */
+
+
+	/* ---------------------------------------------------------------- */
+	/* Step 4: Initialize SDRAM                                         */
+	/* ---------------------------------------------------------------- */
+
+	/* set MDREFR according to user define with exception of a few bits */
+
+	ldr     r4, =CFG_MDREFR_VAL
+	ldr		r2, =(MDREFR_K0RUN|MDREFR_K0DB2|MDREFR_K1RUN|MDREFR_K1DB2|\
+					MDREFR_K2RUN |MDREFR_K2DB2)
+	and		r4, r4, r2
+	bic		r0,	r0,	r2
+	orr		r0, r0, r4
+
+	str     r0, [r1, #MDREFR_OFFSET]    /* write back MDREFR        */
+	ldr     r0, [r1, #MDREFR_OFFSET]
+
+	/* Step 4b: de-assert MDREFR:SLFRSH.                                */
+
+	bic		r0, r0,	#(MDREFR_SLFRSH)
+	str     r0, [r1, #MDREFR_OFFSET]    /* write back MDREFR        */
+	ldr     r0, [r1, #MDREFR_OFFSET]
+
+
+	/* Step 4c: assert MDREFR:E1PIN and E0PIO as desired, set KXFREE  */
+
+	ldr     r4, =CFG_MDREFR_VAL
+	ldr		r2, =(MDREFR_E0PIN|MDREFR_E1PIN|MDREFR_K0FREE| \
+					MDREFR_K1FREE | MDREFR_K2FREE)
+	and		r4, r4, r2
+	orr		r0, r0, r4
+	str     r0, [r1, #MDREFR_OFFSET]    /* write back MDREFR        */
+	ldr     r0, [r1, #MDREFR_OFFSET]
+
+
+	/* Step 4d: write MDCNFG with MDCNFG:DEx deasserted (set to 0), to  */
+	/*          configure but not enable each SDRAM partition pair.     */
+
+	ldr		r4,	=CFG_MDCNFG_VAL
+	bic		r4,	r4,	#(MDCNFG_DE0|MDCNFG_DE1)
+	bic		r4, r4,	#(MDCNFG_DE2|MDCNFG_DE3)
+	str     r4, [r1, #MDCNFG_OFFSET]	/* write back MDCNFG        */
+	ldr     r4, [r1, #MDCNFG_OFFSET]
+
+
+	/* Step 4e: Wait for the clock to the SDRAMs to stabilize,          */
+	/*          100..200 <20>sec.                                          */
+
+	ldr 	r3, =OSCR			/* reset the OS Timer Count to zero */
+	mov 	r2, #0
+	str 	r2, [r3]
+	ldr 	r4, =0x300			/* really 0x2E1 is about 200usec,   */
+						/* so 0x300 should be plenty        */
+1:
+	ldr 	r2, [r3]
+	cmp 	r4, r2
+	bgt 	1b
+
+
+	/* Step 4f: Trigger a number (usually 8) refresh cycles by          */
+	/*          attempting non-burst read or write accesses to disabled */
+	/*          SDRAM, as commonly specified in the power up sequence   */
+	/*          documented in SDRAM data sheets. The address(es) used   */
+	/*          for this purpose must not be cacheable.                 */
+
+	ldr		r3,	=CFG_DRAM_BASE
+.rept 8
+	str		r2,	[r3]
+.endr
+
+	/* Step 4g: Write MDCNFG with enable bits asserted                  */
+	/*          (MDCNFG:DEx set to 1).                                  */
+
+	ldr     r3, [r1, #MDCNFG_OFFSET]
+	orr	r3,	r3,	#(MDCNFG_DE0|MDCNFG_DE1)
+	str     r3, [r1, #MDCNFG_OFFSET]
+
+	/* Step 4h: Write MDMRS.                                            */
+
+	ldr     r2, =CFG_MDMRS_VAL
+	str     r2, [r1, #MDMRS_OFFSET]
+
+
+	/* We are finished with Intel's memory controller initialisation    */
+
+
+	/* ---------------------------------------------------------------- */
+	/* Disable (mask) all interrupts at interrupt controller            */
+	/* ---------------------------------------------------------------- */
+
+initirqs:
+
+	mov     r1, #0		/* clear int. level register (IRQ, not FIQ) */
+	ldr     r2, =ICLR
+	str     r1, [r2]
+
+	ldr     r2, =ICMR	/* mask all interrupts at the controller    */
+	str     r1, [r2]
+
+
+	/* ---------------------------------------------------------------- */
+	/* Clock initialisation                                             */
+	/* ---------------------------------------------------------------- */
+
+initclks:
+
+	/* Disable the peripheral clocks, and set the core clock frequency  */
+
+	/* Turn Off ALL on-chip peripheral clocks for re-configuration      */
+	/* Note: See label 'ENABLECLKS' for the re-enabling                 */
+	ldr     r1, =CKEN
+	mov     r2, #0
+	str     r2, [r1]
+
+
+	/* default value in case no valid rotary switch setting is found    */
+	ldr     r2, =(CCCR_L27|CCCR_M2|CCCR_N10)  /* DEFAULT: {200/200/100} */
+
+	/* ... and write the core clock config register                     */
+	ldr     r1, =CCCR
+	str     r2, [r1]
+
+#ifdef RTC
+	/* enable the 32Khz oscillator for RTC and PowerManager             */
+
+	ldr     r1, =OSCC
+	mov     r2, #OSCC_OON
+	str     r2, [r1]
+
+	/* NOTE:  spin here until OSCC.OOK get set, meaning the PLL         */
+	/* has settled.                                                     */
+60:
+	ldr     r2, [r1]
+	ands    r2, r2, #1
+	beq     60b
+#endif
+
+	/* ---------------------------------------------------------------- */
+	/*                                                                  */
+	/* ---------------------------------------------------------------- */
+
+	/* Save SDRAM size */
+    ldr     r1, =DRAM_SIZE
+	str   	r8, [r1]
+
+	/* Interrupt init: Mask all interrupts                              */
+    ldr		r0,	=ICMR /* enable no sources */
+	mov 	r1,	#0
+    str 	r1,	[r0]
+
+	/* FIXME */
+
+#define NODEBUG
+#ifdef NODEBUG
+	/*Disable software and data breakpoints */
+	mov		r0,#0
+	mcr		p15,0,r0,c14,c8,0  /* ibcr0 */
+	mcr		p15,0,r0,c14,c9,0  /* ibcr1 */
+	mcr		p15,0,r0,c14,c4,0  /* dbcon */
+
+	/*Enable all debug functionality */
+	mov		r0,#0x80000000
+	mcr		p14,0,r0,c10,c0,0  /* dcsr */
+
+#endif
+
+	/* ---------------------------------------------------------------- */
+	/* End lowlevel_init                                                     */
+	/* ---------------------------------------------------------------- */
+
+endlowlevel_init:
+
+    mov     pc,	lr
--- a/board/cerf250/u-boot.lds
+++ b/board/cerf250/u-boot.lds
@@ -0,0 +1,55 @@
+/*
+ * (C) Copyright 2000
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+OUTPUT_FORMAT("elf32-littlearm", "elf32-littlearm", "elf32-littlearm")
+OUTPUT_ARCH(arm)
+ENTRY(_start)
+SECTIONS
+{
+	. = 0x00000000;
+
+	. = ALIGN(4);
+	.text      :
+	{
+	  cpu/pxa/start.o	(.text)
+	  *(.text)
+	}
+
+	. = ALIGN(4);
+	.rodata : { *(.rodata) }
+
+	. = ALIGN(4);
+	.data : { *(.data) }
+
+	. = ALIGN(4);
+	.got : { *(.got) }
+
+	__u_boot_cmd_start = .;
+	.u_boot_cmd : { *(.u_boot_cmd) }
+	__u_boot_cmd_end = .;
+
+	. = ALIGN(4);
+	__bss_start = .;
+	.bss : { *(.bss) }
+	_end = .;
+}
--- a/board/cm4008/Makefile
+++ b/board/cm4008/Makefile
@@ -0,0 +1,46 @@
+#
+# (C) Copyright 2000, 2002
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+include $(TOPDIR)/config.mk
+
+LIB	= lib$(BOARD).a
+
+OBJS	:= cm4008.o flash.o
+
+$(LIB):	$(OBJS) $(SOBJS)
+	$(AR) crv $@ $^
+
+clean:
+	rm -f $(SOBJS) $(OBJS)
+
+distclean:	clean
+	rm -f $(LIB) core *.bak .depend
+
+#########################################################################
+
+.depend:	Makefile $(SOBJS:.o=.S) $(OBJS:.o=.c)
+		$(CC) -M $(CPPFLAGS) $(SOBJS:.o=.S) $(OBJS:.o=.c) > $@
+
+-include .depend
+
+#########################################################################
--- a/board/cm4008/cm4008.c
+++ b/board/cm4008/cm4008.c
@@ -0,0 +1,101 @@
+/*
+ * (C) Copyright 2005
+ * Greg Ungerer, OpenGear Inc, <greg.ungerer@opengear.com>
+ *
+ * (C) Copyright 2002
+ * Kyle Harris, Nexus Technologies, Inc. kharris@nexus-tech.net
+ *
+ * (C) Copyright 2002
+ * Sysgo Real-Time Solutions, GmbH <www.elinos.com>
+ * Marius Groeger <mgroeger@sysgo.de>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <asm/arch/platform.h>
+
+/* ------------------------------------------------------------------------- */
+
+#define	ks8695_read(a)	  *((volatile unsigned int *) (KS8695_IO_BASE+(a)))
+#define	ks8695_write(a,b) *((volatile unsigned int *) (KS8695_IO_BASE+(a))) = (b)
+
+/* ------------------------------------------------------------------------- */
+
+
+/*
+ * Miscelaneous platform dependent initialisations
+ */
+int env_flash_cmdline (void)
+{
+	unsigned char *sp = (unsigned char *) 0x0201c020;
+	unsigned char *ep;
+	int len;
+
+	/* Check if "erase" push button is depressed */
+	if ((ks8695_read(KS8695_GPIO_DATA) & 0x8) == 0) {
+		printf("### Entering network recovery mode...\n");
+		setenv("bootargs", "console=ttyAM0,115200 mem=16M initrd=0x400000,6M root=/dev/ram0");
+		setenv("bootcmd", "bootp 0x400000; gofsk 0x400000");
+		setenv("bootdelay", "2");
+		return 0;
+	}
+
+	/* Check for flash based kernel boot args to use as default */
+	for (ep = sp, len = 0; ((len < 1024) && (*ep != 0)); ep++, len++)
+		;
+
+	if ((len > 0) && (len <1024))
+		setenv("bootargs", sp);
+
+	return 0;
+}
+
+int board_late_init (void)
+{
+	return 0;
+}
+
+
+int board_init (void)
+{
+	DECLARE_GLOBAL_DATA_PTR;
+
+	/* arch number of CM4008 */
+	gd->bd->bi_arch_number = 624;
+
+	/* adress of boot parameters */
+	gd->bd->bi_boot_params = 0x00000100;
+
+	/* power down all but port 0 on the switch */
+	ks8695_write(KS8695_SWITCH_LPPM12, 0x00000005);
+	ks8695_write(KS8695_SWITCH_LPPM34, 0x00050005);
+
+	return 0;
+}
+
+int dram_init (void)
+{
+	DECLARE_GLOBAL_DATA_PTR;
+
+	gd->bd->bi_dram[0].start = PHYS_SDRAM_1;
+	gd->bd->bi_dram[0].size  = PHYS_SDRAM_1_SIZE;
+
+	return (0);
+}
--- a/board/cm4008/config.mk
+++ b/board/cm4008/config.mk
@@ -0,0 +1 @@
+TEXT_BASE = 0x00f00000
--- a/board/cm4008/flash.c
+++ b/board/cm4008/flash.c
@@ -0,0 +1,409 @@
+/*
+ * (C) Copyright 2005
+ * Greg Ungerer, OpenGear Inc, greg.ungerer@opengear.com
+ *
+ * (C) Copyright 2001
+ * Kyle Harris, Nexus Technologies, Inc. kharris@nexus-tech.net
+ *
+ * (C) Copyright 2001
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <linux/byteorder/swab.h>
+
+
+flash_info_t flash_info[CFG_MAX_FLASH_BANKS];	/* info for FLASH chips */
+
+#define mb() __asm__ __volatile__ ("" : : : "memory")
+
+/*-----------------------------------------------------------------------
+ * Functions
+ */
+static ulong flash_get_size (unsigned char * addr, flash_info_t * info);
+static int write_data (flash_info_t * info, ulong dest, unsigned char data);
+static void flash_get_offsets (ulong base, flash_info_t * info);
+void inline spin_wheel (void);
+
+/*-----------------------------------------------------------------------
+ */
+
+unsigned long flash_init (void)
+{
+	int i;
+	ulong size = 0;
+
+	for (i = 0; i < CFG_MAX_FLASH_BANKS; i++) {
+		switch (i) {
+		case 0:
+			flash_get_size ((unsigned char *) PHYS_FLASH_1, &flash_info[i]);
+			flash_get_offsets (PHYS_FLASH_1, &flash_info[i]);
+			break;
+		case 1:
+			/* ignore for now */
+			flash_info[i].flash_id = FLASH_UNKNOWN;
+			break;
+		default:
+			panic ("configured too many flash banks!\n");
+			break;
+		}
+		size += flash_info[i].size;
+	}
+
+	/* Protect monitor and environment sectors
+	 */
+	flash_protect (FLAG_PROTECT_SET,
+		       CFG_FLASH_BASE,
+		       CFG_FLASH_BASE + _bss_start - _armboot_start,
+		       &flash_info[0]);
+
+	return size;
+}
+
+/*-----------------------------------------------------------------------
+ */
+static void flash_get_offsets (ulong base, flash_info_t * info)
+{
+	int i;
+
+	if (info->flash_id == FLASH_UNKNOWN)
+		return;
+
+	if ((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_INTEL) {
+		for (i = 0; i < info->sector_count; i++) {
+			info->start[i] = base + (i * PHYS_FLASH_SECT_SIZE);
+			info->protect[i] = 0;
+		}
+	}
+}
+
+/*-----------------------------------------------------------------------
+ */
+void flash_print_info (flash_info_t * info)
+{
+	int i;
+
+	if (info->flash_id == FLASH_UNKNOWN) {
+		printf ("missing or unknown FLASH type\n");
+		return;
+	}
+
+	switch (info->flash_id & FLASH_VENDMASK) {
+	case FLASH_MAN_INTEL:
+		printf ("INTEL ");
+		break;
+	default:
+		printf ("Unknown Vendor ");
+		break;
+	}
+
+	switch (info->flash_id & FLASH_TYPEMASK) {
+	case FLASH_28F128J3A:
+		printf ("28F128J3A\n");
+		break;
+	default:
+		printf ("Unknown Chip Type\n");
+		break;
+	}
+
+	printf ("  Size: %ld MB in %d Sectors\n",
+		info->size >> 20, info->sector_count);
+
+	printf ("  Sector Start Addresses:");
+	for (i = 0; i < info->sector_count; ++i) {
+		if ((i % 5) == 0)
+			printf ("\n   ");
+		printf (" %08lX%s",
+			info->start[i], info->protect[i] ? " (RO)" : "     ");
+	}
+	printf ("\n");
+	return;
+}
+
+/*
+ * The following code cannot be run from FLASH!
+ */
+static ulong flash_get_size (unsigned char * addr, flash_info_t * info)
+{
+	volatile unsigned char value;
+
+	/* Write auto select command: read Manufacturer ID */
+	addr[0x5555] = 0xAA;
+	addr[0x2AAA] = 0x55;
+	addr[0x5555] = 0x90;
+
+	mb ();
+	value = addr[0];
+
+	switch (value) {
+
+	case (unsigned char)INTEL_MANUFACT:
+		info->flash_id = FLASH_MAN_INTEL;
+		break;
+
+	default:
+		info->flash_id = FLASH_UNKNOWN;
+		info->sector_count = 0;
+		info->size = 0;
+		addr[0] = 0xFF;	/* restore read mode */
+		return (0);	/* no or unknown flash  */
+	}
+
+	mb ();
+	value = addr[2];	/* device ID            */
+
+	switch (value) {
+
+	case (unsigned char)INTEL_ID_28F640J3A:
+		info->flash_id += FLASH_28F640J3A;
+		info->sector_count = 64;
+		info->size = 0x00800000;
+		break;		/* => 8 MB     */
+
+	case (unsigned char)INTEL_ID_28F128J3A:
+		info->flash_id += FLASH_28F128J3A;
+		info->sector_count = 128;
+		info->size = 0x01000000;
+		break;		/* => 16 MB     */
+
+	default:
+		info->flash_id = FLASH_UNKNOWN;
+		break;
+	}
+
+	if (info->sector_count > CFG_MAX_FLASH_SECT) {
+		printf ("** ERROR: sector count %d > max (%d) **\n",
+			info->sector_count, CFG_MAX_FLASH_SECT);
+		info->sector_count = CFG_MAX_FLASH_SECT;
+	}
+
+	addr[0] = 0xFF;	/* restore read mode */
+
+	return (info->size);
+}
+
+
+/*-----------------------------------------------------------------------
+ */
+
+int flash_erase (flash_info_t * info, int s_first, int s_last)
+{
+	int flag, prot, sect;
+	ulong type;
+	int rcode = 0;
+
+	if ((s_first < 0) || (s_first > s_last)) {
+		if (info->flash_id == FLASH_UNKNOWN) {
+			printf ("- missing\n");
+		} else {
+			printf ("- no sectors to erase\n");
+		}
+		return 1;
+	}
+
+	type = (info->flash_id & FLASH_VENDMASK);
+	if ((type != FLASH_MAN_INTEL)) {
+		printf ("Can't erase unknown flash type %08lx - aborted\n",
+			info->flash_id);
+		return 1;
+	}
+
+	prot = 0;
+	for (sect = s_first; sect <= s_last; ++sect) {
+		if (info->protect[sect]) {
+			prot++;
+		}
+	}
+
+	if (prot)
+		printf ("- Warning: %d protected sectors will not be erased!\n", prot);
+	else
+		printf ("\n");
+
+	/* Disable interrupts which might cause a timeout here */
+	flag = disable_interrupts ();
+
+	/* Start erase on unprotected sectors */
+	for (sect = s_first; sect <= s_last; sect++) {
+		if (info->protect[sect] == 0) {	/* not protected */
+			volatile unsigned char *addr;
+			unsigned char status;
+
+			printf ("Erasing sector %2d ... ", sect);
+
+			/* arm simple, non interrupt dependent timer */
+			reset_timer_masked ();
+
+			addr = (volatile unsigned char *) (info->start[sect]);
+			*addr = 0x50;	/* clear status register */
+			*addr = 0x20;	/* erase setup */
+			*addr = 0xD0;	/* erase confirm */
+
+			while (((status = *addr) & 0x80) != 0x80) {
+				if (get_timer_masked () >
+				    CFG_FLASH_ERASE_TOUT) {
+					printf ("Timeout\n");
+					*addr = 0xB0;	/* suspend erase */
+					*addr = 0xFF;	/* reset to read mode */
+					rcode = 1;
+					break;
+				}
+			}
+
+			*addr = 0x50;	/* clear status register cmd */
+			*addr = 0xFF;	/* resest to read mode */
+
+			printf (" done\n");
+		}
+	}
+	return rcode;
+}
+
+/*-----------------------------------------------------------------------
+ * Copy memory to flash, returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ * 4 - Flash not identified
+ */
+
+int write_buff (flash_info_t * info, uchar * src, ulong addr, ulong cnt)
+{
+	ulong cp, wp;
+	unsigned char data;
+	int count, i, l, rc, port_width;
+
+	if (info->flash_id == FLASH_UNKNOWN)
+		return 4;
+
+	wp = addr;
+	port_width = 1;
+
+	/*
+	 * handle unaligned start bytes
+	 */
+	if ((l = addr - wp) != 0) {
+		data = 0;
+		for (i = 0, cp = wp; i < l; ++i, ++cp) {
+			data = (data << 8) | (*(uchar *) cp);
+		}
+		for (; i < port_width && cnt > 0; ++i) {
+			data = (data << 8) | *src++;
+			--cnt;
+			++cp;
+		}
+		for (; cnt == 0 && i < port_width; ++i, ++cp) {
+			data = (data << 8) | (*(uchar *) cp);
+		}
+
+		if ((rc = write_data (info, wp, data)) != 0) {
+			return (rc);
+		}
+		wp += port_width;
+	}
+
+	/*
+	 * handle word aligned part
+	 */
+	count = 0;
+	while (cnt >= port_width) {
+		data = 0;
+		for (i = 0; i < port_width; ++i) {
+			data = (data << 8) | *src++;
+		}
+		if ((rc = write_data (info, wp, data)) != 0) {
+			return (rc);
+		}
+		wp += port_width;
+		cnt -= port_width;
+		if (count++ > 0x800) {
+			spin_wheel ();
+			count = 0;
+		}
+	}
+
+	if (cnt == 0) {
+		return (0);
+	}
+
+	/*
+	 * handle unaligned tail bytes
+	 */
+	data = 0;
+	for (i = 0, cp = wp; i < port_width && cnt > 0; ++i, ++cp) {
+		data = (data << 8) | *src++;
+		--cnt;
+	}
+	for (; i < port_width; ++i, ++cp) {
+		data = (data << 8) | (*(uchar *) cp);
+	}
+
+	return (write_data (info, wp, data));
+}
+
+/*-----------------------------------------------------------------------
+ * Write a word or halfword to Flash, returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ */
+static int write_data (flash_info_t * info, ulong dest, unsigned char data)
+{
+	volatile unsigned char *addr = (volatile unsigned char *) dest;
+	ulong status;
+	int flag;
+
+	/* Check if Flash is (sufficiently) erased */
+	if ((*addr & data) != data) {
+		printf ("not erased at %08lx (%lx)\n", (ulong) addr,
+			(ulong) * addr);
+		return (2);
+	}
+	/* Disable interrupts which might cause a timeout here */
+	flag = disable_interrupts ();
+
+	*addr = 0x40;	/* write setup */
+	*addr = data;
+
+	/* arm simple, non interrupt dependent timer */
+	reset_timer_masked ();
+
+	/* wait while polling the status register */
+	while (((status = *addr) & 0x80) != 0x80) {
+		if (get_timer_masked () > CFG_FLASH_WRITE_TOUT) {
+			*addr = 0xFF;	/* restore read mode */
+			return (1);
+		}
+	}
+
+	*addr = 0xFF;	/* restore read mode */
+
+	return (0);
+}
+
+void inline spin_wheel (void)
+{
+	static int p = 0;
+	static char w[] = "\\/-";
+
+	printf ("\010%c", w[p]);
+	(++p == 3) ? (p = 0) : 0;
+}
--- a/board/cm4008/u-boot.lds
+++ b/board/cm4008/u-boot.lds
@@ -0,0 +1,55 @@
+/*
+ * (C) Copyright 2000
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+OUTPUT_FORMAT("elf32-littlearm", "elf32-littlearm", "elf32-littlearm")
+OUTPUT_ARCH(arm)
+ENTRY(_start)
+SECTIONS
+{
+	. = 0x00000000;
+
+	. = ALIGN(4);
+	.text      :
+	{
+	  cpu/arm920t/start.o	(.text)
+	  *(.text)
+	}
+
+	. = ALIGN(4);
+	.rodata : { *(.rodata) }
+
+	. = ALIGN(4);
+	.data : { *(.data) }
+
+	. = ALIGN(4);
+	.got : { *(.got) }
+
+	__u_boot_cmd_start = .;
+	.u_boot_cmd : { *(.u_boot_cmd) }
+	__u_boot_cmd_end = .;
+
+	. = ALIGN(4);
+	__bss_start = .;
+	.bss : { *(.bss) }
+	_end = .;
+}
--- a/board/cm41xx/Makefile
+++ b/board/cm41xx/Makefile
@@ -0,0 +1,46 @@
+#
+# (C) Copyright 2000, 2002
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+include $(TOPDIR)/config.mk
+
+LIB	= lib$(BOARD).a
+
+OBJS	:= cm41xx.o flash.o
+
+$(LIB):	$(OBJS) $(SOBJS)
+	$(AR) crv $@ $^
+
+clean:
+	rm -f $(SOBJS) $(OBJS)
+
+distclean:	clean
+	rm -f $(LIB) core *.bak .depend
+
+#########################################################################
+
+.depend:	Makefile $(SOBJS:.o=.S) $(OBJS:.o=.c)
+		$(CC) -M $(CPPFLAGS) $(SOBJS:.o=.S) $(OBJS:.o=.c) > $@
+
+-include .depend
+
+#########################################################################
--- a/board/cm41xx/cm41xx.c
+++ b/board/cm41xx/cm41xx.c
@@ -0,0 +1,101 @@
+/*
+ * (C) Copyright 2005
+ * Greg Ungerer, OpenGear Inc, <greg.ungerer@opengear.com>
+ *
+ * (C) Copyright 2002
+ * Kyle Harris, Nexus Technologies, Inc. kharris@nexus-tech.net
+ *
+ * (C) Copyright 2002
+ * Sysgo Real-Time Solutions, GmbH <www.elinos.com>
+ * Marius Groeger <mgroeger@sysgo.de>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <asm/arch/platform.h>
+
+/* ------------------------------------------------------------------------- */
+
+#define	ks8695_read(a)	  *((volatile unsigned int *) (KS8695_IO_BASE+(a)))
+#define	ks8695_write(a,b) *((volatile unsigned int *) (KS8695_IO_BASE+(a))) = (b)
+
+/* ------------------------------------------------------------------------- */
+
+
+/*
+ * Miscelaneous platform dependent initialisations
+ */
+int env_flash_cmdline (void)
+{
+	unsigned char *sp = (unsigned char *) 0x0201c020;
+	unsigned char *ep;
+	int len;
+
+	/* Check if "erase" push button is depressed */
+	if ((ks8695_read(KS8695_GPIO_DATA) & 0x8) == 0) {
+		printf("### Entering network recovery mode...\n");
+		setenv("bootargs", "console=ttyAM0,115200 mem=32M initrd=0x400000,8M root=/dev/ram0");
+		setenv("bootcmd", "bootp 0x400000; gofsk 0x400000");
+		setenv("bootdelay", "2");
+		return 0;
+	}
+
+	/* Check for flash based kernel boot args to use as default */
+	for (ep = sp, len = 0; ((len < 1024) && (*ep != 0)); ep++, len++)
+		;
+
+	if ((len > 0) && (len <1024))
+		setenv("bootargs", sp);
+
+	return 0;
+}
+
+int board_late_init (void)
+{
+	return 0;
+}
+
+
+int board_init (void)
+{
+	DECLARE_GLOBAL_DATA_PTR;
+
+	/* arch number of CM41xx */
+	gd->bd->bi_arch_number = 672;
+
+	/* adress of boot parameters */
+	gd->bd->bi_boot_params = 0x00000100;
+
+	/* power down all but port 0 on the switch */
+	ks8695_write(KS8695_SWITCH_LPPM12, 0x00000005);
+	ks8695_write(KS8695_SWITCH_LPPM34, 0x00050005);
+
+	return 0;
+}
+
+int dram_init (void)
+{
+	DECLARE_GLOBAL_DATA_PTR;
+
+	gd->bd->bi_dram[0].start = PHYS_SDRAM_1;
+	gd->bd->bi_dram[0].size  = PHYS_SDRAM_1_SIZE;
+
+	return (0);
+}
--- a/board/cm41xx/config.mk
+++ b/board/cm41xx/config.mk
@@ -0,0 +1 @@
+TEXT_BASE = 0x00f00000
--- a/board/cm41xx/flash.c
+++ b/board/cm41xx/flash.c
@@ -0,0 +1,409 @@
+/*
+ * (C) Copyright 2005
+ * Greg Ungerer, OpenGear Inc, greg.ungerer@opengear.com
+ *
+ * (C) Copyright 2001
+ * Kyle Harris, Nexus Technologies, Inc. kharris@nexus-tech.net
+ *
+ * (C) Copyright 2001
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <linux/byteorder/swab.h>
+
+
+flash_info_t flash_info[CFG_MAX_FLASH_BANKS];	/* info for FLASH chips */
+
+#define mb() __asm__ __volatile__ ("" : : : "memory")
+
+/*-----------------------------------------------------------------------
+ * Functions
+ */
+static ulong flash_get_size (unsigned char * addr, flash_info_t * info);
+static int write_data (flash_info_t * info, ulong dest, unsigned char data);
+static void flash_get_offsets (ulong base, flash_info_t * info);
+void inline spin_wheel (void);
+
+/*-----------------------------------------------------------------------
+ */
+
+unsigned long flash_init (void)
+{
+	int i;
+	ulong size = 0;
+
+	for (i = 0; i < CFG_MAX_FLASH_BANKS; i++) {
+		switch (i) {
+		case 0:
+			flash_get_size ((unsigned char *) PHYS_FLASH_1, &flash_info[i]);
+			flash_get_offsets (PHYS_FLASH_1, &flash_info[i]);
+			break;
+		case 1:
+			/* ignore for now */
+			flash_info[i].flash_id = FLASH_UNKNOWN;
+			break;
+		default:
+			panic ("configured too many flash banks!\n");
+			break;
+		}
+		size += flash_info[i].size;
+	}
+
+	/* Protect monitor and environment sectors
+	 */
+	flash_protect (FLAG_PROTECT_SET,
+		       CFG_FLASH_BASE,
+		       CFG_FLASH_BASE + _bss_start - _armboot_start,
+		       &flash_info[0]);
+
+	return size;
+}
+
+/*-----------------------------------------------------------------------
+ */
+static void flash_get_offsets (ulong base, flash_info_t * info)
+{
+	int i;
+
+	if (info->flash_id == FLASH_UNKNOWN)
+		return;
+
+	if ((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_INTEL) {
+		for (i = 0; i < info->sector_count; i++) {
+			info->start[i] = base + (i * PHYS_FLASH_SECT_SIZE);
+			info->protect[i] = 0;
+		}
+	}
+}
+
+/*-----------------------------------------------------------------------
+ */
+void flash_print_info (flash_info_t * info)
+{
+	int i;
+
+	if (info->flash_id == FLASH_UNKNOWN) {
+		printf ("missing or unknown FLASH type\n");
+		return;
+	}
+
+	switch (info->flash_id & FLASH_VENDMASK) {
+	case FLASH_MAN_INTEL:
+		printf ("INTEL ");
+		break;
+	default:
+		printf ("Unknown Vendor ");
+		break;
+	}
+
+	switch (info->flash_id & FLASH_TYPEMASK) {
+	case FLASH_28F128J3A:
+		printf ("28F128J3A\n");
+		break;
+	default:
+		printf ("Unknown Chip Type\n");
+		break;
+	}
+
+	printf ("  Size: %ld MB in %d Sectors\n",
+		info->size >> 20, info->sector_count);
+
+	printf ("  Sector Start Addresses:");
+	for (i = 0; i < info->sector_count; ++i) {
+		if ((i % 5) == 0)
+			printf ("\n   ");
+		printf (" %08lX%s",
+			info->start[i], info->protect[i] ? " (RO)" : "     ");
+	}
+	printf ("\n");
+	return;
+}
+
+/*
+ * The following code cannot be run from FLASH!
+ */
+static ulong flash_get_size (unsigned char * addr, flash_info_t * info)
+{
+	volatile unsigned char value;
+
+	/* Write auto select command: read Manufacturer ID */
+	addr[0x5555] = 0xAA;
+	addr[0x2AAA] = 0x55;
+	addr[0x5555] = 0x90;
+
+	mb ();
+	value = addr[0];
+
+	switch (value) {
+
+	case (unsigned char)INTEL_MANUFACT:
+		info->flash_id = FLASH_MAN_INTEL;
+		break;
+
+	default:
+		info->flash_id = FLASH_UNKNOWN;
+		info->sector_count = 0;
+		info->size = 0;
+		addr[0] = 0xFF;	/* restore read mode */
+		return (0);	/* no or unknown flash  */
+	}
+
+	mb ();
+	value = addr[2];	/* device ID            */
+
+	switch (value) {
+
+	case (unsigned char)INTEL_ID_28F640J3A:
+		info->flash_id += FLASH_28F640J3A;
+		info->sector_count = 64;
+		info->size = 0x00800000;
+		break;		/* => 8 MB     */
+
+	case (unsigned char)INTEL_ID_28F128J3A:
+		info->flash_id += FLASH_28F128J3A;
+		info->sector_count = 128;
+		info->size = 0x01000000;
+		break;		/* => 16 MB     */
+
+	default:
+		info->flash_id = FLASH_UNKNOWN;
+		break;
+	}
+
+	if (info->sector_count > CFG_MAX_FLASH_SECT) {
+		printf ("** ERROR: sector count %d > max (%d) **\n",
+			info->sector_count, CFG_MAX_FLASH_SECT);
+		info->sector_count = CFG_MAX_FLASH_SECT;
+	}
+
+	addr[0] = 0xFF;	/* restore read mode */
+
+	return (info->size);
+}
+
+
+/*-----------------------------------------------------------------------
+ */
+
+int flash_erase (flash_info_t * info, int s_first, int s_last)
+{
+	int flag, prot, sect;
+	ulong type;
+	int rcode = 0;
+
+	if ((s_first < 0) || (s_first > s_last)) {
+		if (info->flash_id == FLASH_UNKNOWN) {
+			printf ("- missing\n");
+		} else {
+			printf ("- no sectors to erase\n");
+		}
+		return 1;
+	}
+
+	type = (info->flash_id & FLASH_VENDMASK);
+	if ((type != FLASH_MAN_INTEL)) {
+		printf ("Can't erase unknown flash type %08lx - aborted\n",
+			info->flash_id);
+		return 1;
+	}
+
+	prot = 0;
+	for (sect = s_first; sect <= s_last; ++sect) {
+		if (info->protect[sect]) {
+			prot++;
+		}
+	}
+
+	if (prot)
+		printf ("- Warning: %d protected sectors will not be erased!\n", prot);
+	else
+		printf ("\n");
+
+	/* Disable interrupts which might cause a timeout here */
+	flag = disable_interrupts ();
+
+	/* Start erase on unprotected sectors */
+	for (sect = s_first; sect <= s_last; sect++) {
+		if (info->protect[sect] == 0) {	/* not protected */
+			volatile unsigned char *addr;
+			unsigned char status;
+
+			printf ("Erasing sector %2d ... ", sect);
+
+			/* arm simple, non interrupt dependent timer */
+			reset_timer_masked ();
+
+			addr = (volatile unsigned char *) (info->start[sect]);
+			*addr = 0x50;	/* clear status register */
+			*addr = 0x20;	/* erase setup */
+			*addr = 0xD0;	/* erase confirm */
+
+			while (((status = *addr) & 0x80) != 0x80) {
+				if (get_timer_masked () >
+				    CFG_FLASH_ERASE_TOUT) {
+					printf ("Timeout\n");
+					*addr = 0xB0;	/* suspend erase */
+					*addr = 0xFF;	/* reset to read mode */
+					rcode = 1;
+					break;
+				}
+			}
+
+			*addr = 0x50;	/* clear status register cmd */
+			*addr = 0xFF;	/* resest to read mode */
+
+			printf (" done\n");
+		}
+	}
+	return rcode;
+}
+
+/*-----------------------------------------------------------------------
+ * Copy memory to flash, returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ * 4 - Flash not identified
+ */
+
+int write_buff (flash_info_t * info, uchar * src, ulong addr, ulong cnt)
+{
+	ulong cp, wp;
+	unsigned char data;
+	int count, i, l, rc, port_width;
+
+	if (info->flash_id == FLASH_UNKNOWN)
+		return 4;
+
+	wp = addr;
+	port_width = 1;
+
+	/*
+	 * handle unaligned start bytes
+	 */
+	if ((l = addr - wp) != 0) {
+		data = 0;
+		for (i = 0, cp = wp; i < l; ++i, ++cp) {
+			data = (data << 8) | (*(uchar *) cp);
+		}
+		for (; i < port_width && cnt > 0; ++i) {
+			data = (data << 8) | *src++;
+			--cnt;
+			++cp;
+		}
+		for (; cnt == 0 && i < port_width; ++i, ++cp) {
+			data = (data << 8) | (*(uchar *) cp);
+		}
+
+		if ((rc = write_data (info, wp, data)) != 0) {
+			return (rc);
+		}
+		wp += port_width;
+	}
+
+	/*
+	 * handle word aligned part
+	 */
+	count = 0;
+	while (cnt >= port_width) {
+		data = 0;
+		for (i = 0; i < port_width; ++i) {
+			data = (data << 8) | *src++;
+		}
+		if ((rc = write_data (info, wp, data)) != 0) {
+			return (rc);
+		}
+		wp += port_width;
+		cnt -= port_width;
+		if (count++ > 0x800) {
+			spin_wheel ();
+			count = 0;
+		}
+	}
+
+	if (cnt == 0) {
+		return (0);
+	}
+
+	/*
+	 * handle unaligned tail bytes
+	 */
+	data = 0;
+	for (i = 0, cp = wp; i < port_width && cnt > 0; ++i, ++cp) {
+		data = (data << 8) | *src++;
+		--cnt;
+	}
+	for (; i < port_width; ++i, ++cp) {
+		data = (data << 8) | (*(uchar *) cp);
+	}
+
+	return (write_data (info, wp, data));
+}
+
+/*-----------------------------------------------------------------------
+ * Write a word or halfword to Flash, returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ */
+static int write_data (flash_info_t * info, ulong dest, unsigned char data)
+{
+	volatile unsigned char *addr = (volatile unsigned char *) dest;
+	ulong status;
+	int flag;
+
+	/* Check if Flash is (sufficiently) erased */
+	if ((*addr & data) != data) {
+		printf ("not erased at %08lx (%lx)\n", (ulong) addr,
+			(ulong) * addr);
+		return (2);
+	}
+	/* Disable interrupts which might cause a timeout here */
+	flag = disable_interrupts ();
+
+	*addr = 0x40;	/* write setup */
+	*addr = data;
+
+	/* arm simple, non interrupt dependent timer */
+	reset_timer_masked ();
+
+	/* wait while polling the status register */
+	while (((status = *addr) & 0x80) != 0x80) {
+		if (get_timer_masked () > CFG_FLASH_WRITE_TOUT) {
+			*addr = 0xFF;	/* restore read mode */
+			return (1);
+		}
+	}
+
+	*addr = 0xFF;	/* restore read mode */
+
+	return (0);
+}
+
+void inline spin_wheel (void)
+{
+	static int p = 0;
+	static char w[] = "\\/-";
+
+	printf ("\010%c", w[p]);
+	(++p == 3) ? (p = 0) : 0;
+}
--- a/board/cm41xx/u-boot.lds
+++ b/board/cm41xx/u-boot.lds
@@ -0,0 +1,55 @@
+/*
+ * (C) Copyright 2000
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+OUTPUT_FORMAT("elf32-littlearm", "elf32-littlearm", "elf32-littlearm")
+OUTPUT_ARCH(arm)
+ENTRY(_start)
+SECTIONS
+{
+	. = 0x00000000;
+
+	. = ALIGN(4);
+	.text      :
+	{
+	  cpu/arm920t/start.o	(.text)
+	  *(.text)
+	}
+
+	. = ALIGN(4);
+	.rodata : { *(.rodata) }
+
+	. = ALIGN(4);
+	.data : { *(.data) }
+
+	. = ALIGN(4);
+	.got : { *(.got) }
+
+	__u_boot_cmd_start = .;
+	.u_boot_cmd : { *(.u_boot_cmd) }
+	__u_boot_cmd_end = .;
+
+	. = ALIGN(4);
+	__bss_start = .;
+	.bss : { *(.bss) }
+	_end = .;
+}
--- a/board/cmc_pu2/Makefile
+++ b/board/cmc_pu2/Makefile
@@ -0,0 +1,46 @@
+#
+# (C) Copyright 2003
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+include $(TOPDIR)/config.mk
+
+LIB	= lib$(BOARD).a
+
+OBJS	:= cmc_pu2.o at45.o dm9161.o flash.o
+
+$(LIB):	$(OBJS) $(SOBJS)
+	$(AR) crv $@ $(OBJS) $(SOBJS)
+
+clean:
+	rm -f $(SOBJS) $(OBJS)
+
+distclean:	clean
+	rm -f $(LIB) core *.bak .depend
+
+#########################################################################
+
+.depend:	Makefile $(SOBJS:.o=.S) $(OBJS:.o=.c)
+		$(CC) -M $(CPPFLAGS) $(SOBJS:.o=.S) $(OBJS:.o=.c) > $@
+
+-include .depend
+
+#########################################################################
--- a/board/cmc_pu2/at45.c
+++ b/board/cmc_pu2/at45.c
@@ -0,0 +1,621 @@
+/* Driver for ATMEL DataFlash support
+ * Author : Hamid Ikdoumi (Atmel)
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ *
+ */
+
+#include <config.h>
+#include <common.h>
+#include <asm/hardware.h>
+
+#ifdef CONFIG_HAS_DATAFLASH
+#include <dataflash.h>
+
+#define AT91C_SPI_CLK	10000000	/* Max Value = 10MHz to be compliant to
+the Continuous Array Read function */
+
+/* AC Characteristics */
+/* DLYBS = tCSS = 250ns min and DLYBCT = tCSH = 250ns */
+#define DATAFLASH_TCSS	(0xC << 16)
+#define DATAFLASH_TCHS	(0x1 << 24)
+
+#define AT91C_TIMEOUT_WRDY			200000
+#define AT91C_SPI_PCS0_SERIAL_DATAFLASH		0xE     /* Chip Select 0 : NPCS0 %1110 */
+#define AT91C_SPI_PCS3_DATAFLASH_CARD		0x7     /* Chip Select 3 : NPCS3 %0111 */
+
+void AT91F_SpiInit(void) {
+
+/*-------------------------------------------------------------------*/
+/*	SPI DataFlash Init								*/
+/*-------------------------------------------------------------------*/
+	/* Configure PIOs */
+	AT91C_BASE_PIOA->PIO_ASR = AT91C_PA3_NPCS0 | AT91C_PA4_NPCS1 | AT91C_PA1_MOSI | AT91C_PA5_NPCS2 |
+				   AT91C_PA6_NPCS3 | AT91C_PA0_MISO | AT91C_PA2_SPCK;
+	AT91C_BASE_PIOA->PIO_PDR = AT91C_PA3_NPCS0 | AT91C_PA4_NPCS1 | AT91C_PA1_MOSI | AT91C_PA5_NPCS2 |
+				   AT91C_PA6_NPCS3 | AT91C_PA0_MISO | AT91C_PA2_SPCK;
+	/* Enable CLock */
+	AT91C_BASE_PMC->PMC_PCER = 1 << AT91C_ID_SPI;
+
+	/* Reset the SPI */
+	AT91C_BASE_SPI->SPI_CR = AT91C_SPI_SWRST;
+
+	/* Configure SPI in Master Mode with No CS selected !!! */
+	AT91C_BASE_SPI->SPI_MR = AT91C_SPI_MSTR | AT91C_SPI_MODFDIS | AT91C_SPI_PCS;
+
+	/* Configure CS0 and CS3 */
+	*(AT91C_SPI_CSR + 0) = AT91C_SPI_CPOL | (AT91C_SPI_DLYBS & DATAFLASH_TCSS) | (AT91C_SPI_DLYBCT &
+	DATAFLASH_TCHS) | ((AT91C_MASTER_CLOCK / (2*AT91C_SPI_CLK)) << 8);
+
+	*(AT91C_SPI_CSR + 3) = AT91C_SPI_CPOL | (AT91C_SPI_DLYBS & DATAFLASH_TCSS) | (AT91C_SPI_DLYBCT &
+	DATAFLASH_TCHS) | ((AT91C_MASTER_CLOCK / (2*AT91C_SPI_CLK)) << 8);
+
+}
+
+void AT91F_SpiEnable(int cs) {
+	switch(cs) {
+	case 0:	/* Configure SPI CS0 for Serial DataFlash AT45DBxx */
+		AT91C_BASE_SPI->SPI_MR &= 0xFFF0FFFF;
+		AT91C_BASE_SPI->SPI_MR |= ((AT91C_SPI_PCS0_SERIAL_DATAFLASH<<16) & AT91C_SPI_PCS);
+		break;
+	case 3:	/* Configure SPI CS3 for Serial DataFlash Card */
+		/* Set up PIO SDC_TYPE to switch on DataFlash Card and not MMC/SDCard */
+		AT91C_BASE_PIOB->PIO_PER = AT91C_PIO_PB7;	/* Set in PIO mode */
+		AT91C_BASE_PIOB->PIO_OER = AT91C_PIO_PB7;	/* Configure in output */
+		/* Clear Output */
+		AT91C_BASE_PIOB->PIO_CODR = AT91C_PIO_PB7;
+		/* Configure PCS */
+		AT91C_BASE_SPI->SPI_MR &= 0xFFF0FFFF;
+		AT91C_BASE_SPI->SPI_MR |= ((AT91C_SPI_PCS3_DATAFLASH_CARD<<16) & AT91C_SPI_PCS);
+		break;
+	}
+
+	/* SPI_Enable */
+	AT91C_BASE_SPI->SPI_CR = AT91C_SPI_SPIEN;
+}
+
+/*----------------------------------------------------------------------------*/
+/* \fn    AT91F_SpiWrite						      */
+/* \brief Set the PDC registers for a transfert				      */
+/*----------------------------------------------------------------------------*/
+unsigned int AT91F_SpiWrite ( AT91PS_DataflashDesc pDesc )
+{
+	unsigned int timeout;
+
+	pDesc->state = BUSY;
+
+	AT91C_BASE_SPI->SPI_PTCR = AT91C_PDC_TXTDIS + AT91C_PDC_RXTDIS;
+
+	/* Initialize the Transmit and Receive Pointer */
+	AT91C_BASE_SPI->SPI_RPR = (unsigned int)pDesc->rx_cmd_pt ;
+	AT91C_BASE_SPI->SPI_TPR = (unsigned int)pDesc->tx_cmd_pt ;
+
+	/* Intialize the Transmit and Receive Counters */
+	AT91C_BASE_SPI->SPI_RCR = pDesc->rx_cmd_size;
+	AT91C_BASE_SPI->SPI_TCR = pDesc->tx_cmd_size;
+
+	if ( pDesc->tx_data_size != 0 ) {
+		/* Initialize the Next Transmit and Next Receive Pointer */
+		AT91C_BASE_SPI->SPI_RNPR = (unsigned int)pDesc->rx_data_pt ;
+		AT91C_BASE_SPI->SPI_TNPR = (unsigned int)pDesc->tx_data_pt ;
+
+		/* Intialize the Next Transmit and Next Receive Counters */
+		AT91C_BASE_SPI->SPI_RNCR = pDesc->rx_data_size ;
+		AT91C_BASE_SPI->SPI_TNCR = pDesc->tx_data_size ;
+	}
+
+	/* arm simple, non interrupt dependent timer */
+	reset_timer_masked();
+	timeout = 0;
+
+	AT91C_BASE_SPI->SPI_PTCR = AT91C_PDC_TXTEN + AT91C_PDC_RXTEN;
+	while(!(AT91C_BASE_SPI->SPI_SR & AT91C_SPI_RXBUFF) && ((timeout = get_timer_masked() ) < CFG_SPI_WRITE_TOUT));
+	AT91C_BASE_SPI->SPI_PTCR = AT91C_PDC_TXTDIS + AT91C_PDC_RXTDIS;
+	pDesc->state = IDLE;
+
+	if (timeout >= CFG_SPI_WRITE_TOUT){
+		printf("Error Timeout\n\r");
+		return DATAFLASH_ERROR;
+	}
+
+	return DATAFLASH_OK;
+}
+
+
+/*----------------------------------------------------------------------*/
+/* \fn    AT91F_DataFlashSendCommand					*/
+/* \brief Generic function to send a command to the dataflash		*/
+/*----------------------------------------------------------------------*/
+AT91S_DataFlashStatus AT91F_DataFlashSendCommand(
+	AT91PS_DataFlash pDataFlash,
+	unsigned char OpCode,
+	unsigned int CmdSize,
+	unsigned int DataflashAddress)
+{
+    unsigned int adr;
+
+	if ( (pDataFlash->pDataFlashDesc->state) != IDLE)
+		return DATAFLASH_BUSY;
+
+	/* process the address to obtain page address and byte address */
+	adr = ((DataflashAddress / (pDataFlash->pDevice->pages_size)) << pDataFlash->pDevice->page_offset) + (DataflashAddress % (pDataFlash->pDevice->pages_size));
+
+	/* fill the  command  buffer */
+	pDataFlash->pDataFlashDesc->command[0] = OpCode;
+	if (pDataFlash->pDevice->pages_number >= 16384) {
+		pDataFlash->pDataFlashDesc->command[1] = (unsigned char)((adr & 0x0F000000) >> 24);
+		pDataFlash->pDataFlashDesc->command[2] = (unsigned char)((adr & 0x00FF0000) >> 16);
+		pDataFlash->pDataFlashDesc->command[3] = (unsigned char)((adr & 0x0000FF00) >> 8);
+		pDataFlash->pDataFlashDesc->command[4] = (unsigned char)(adr & 0x000000FF);
+	} else {
+		pDataFlash->pDataFlashDesc->command[1] = (unsigned char)((adr & 0x00FF0000) >> 16);
+		pDataFlash->pDataFlashDesc->command[2] = (unsigned char)((adr & 0x0000FF00) >> 8);
+		pDataFlash->pDataFlashDesc->command[3] = (unsigned char)(adr & 0x000000FF) ;
+		pDataFlash->pDataFlashDesc->command[4] = 0;
+	}
+	pDataFlash->pDataFlashDesc->command[5] = 0;
+	pDataFlash->pDataFlashDesc->command[6] = 0;
+	pDataFlash->pDataFlashDesc->command[7] = 0;
+
+	/* Initialize the SpiData structure for the spi write fuction */
+	pDataFlash->pDataFlashDesc->tx_cmd_pt   =  pDataFlash->pDataFlashDesc->command ;
+	pDataFlash->pDataFlashDesc->tx_cmd_size =  CmdSize ;
+	pDataFlash->pDataFlashDesc->rx_cmd_pt   =  pDataFlash->pDataFlashDesc->command ;
+	pDataFlash->pDataFlashDesc->rx_cmd_size =  CmdSize ;
+
+	/* send the command and read the data */
+	return AT91F_SpiWrite (pDataFlash->pDataFlashDesc);
+}
+
+
+/*----------------------------------------------------------------------*/
+/* \fn    AT91F_DataFlashGetStatus					*/
+/* \brief Read the status register of the dataflash			*/
+/*----------------------------------------------------------------------*/
+AT91S_DataFlashStatus AT91F_DataFlashGetStatus(AT91PS_DataflashDesc pDesc)
+{
+	AT91S_DataFlashStatus status;
+
+	/* if a transfert is in progress ==> return 0 */
+	if( (pDesc->state) != IDLE)
+		return DATAFLASH_BUSY;
+
+	/* first send the read status command (D7H) */
+	pDesc->command[0] = DB_STATUS;
+	pDesc->command[1] = 0;
+
+	pDesc->DataFlash_state  = GET_STATUS;
+	pDesc->tx_data_size 	= 0 ;	/* Transmit the command and receive response */
+	pDesc->tx_cmd_pt 		= pDesc->command ;
+	pDesc->rx_cmd_pt 		= pDesc->command ;
+	pDesc->rx_cmd_size 		= 2 ;
+	pDesc->tx_cmd_size 		= 2 ;
+	status = AT91F_SpiWrite (pDesc);
+
+	pDesc->DataFlash_state = *( (unsigned char *) (pDesc->rx_cmd_pt) +1);
+
+	return status;
+}
+
+
+/*----------------------------------------------------------------------*/
+/* \fn    AT91F_DataFlashWaitReady					*/
+/* \brief wait for dataflash ready (bit7 of the status register == 1)	*/
+/*----------------------------------------------------------------------*/
+AT91S_DataFlashStatus AT91F_DataFlashWaitReady(AT91PS_DataflashDesc pDataFlashDesc, unsigned int timeout)
+{
+	pDataFlashDesc->DataFlash_state = IDLE;
+
+	do {
+		AT91F_DataFlashGetStatus(pDataFlashDesc);
+		timeout--;
+	} while( ((pDataFlashDesc->DataFlash_state & 0x80) != 0x80) && (timeout > 0) );
+
+	if((pDataFlashDesc->DataFlash_state & 0x80) != 0x80)
+		return DATAFLASH_ERROR;
+
+	return DATAFLASH_OK;
+}
+
+
+/*------------------------------------------------------------------------------*/
+/* Function Name       : AT91F_DataFlashContinuousRead 				*/
+/* Object              : Continuous stream Read 				*/
+/* Input Parameters    : DataFlash Service					*/
+/*						: <src> = dataflash address	*/
+/*                     : <*dataBuffer> = data buffer pointer			*/
+/*                     : <sizeToRead> = data buffer size			*/
+/* Return value		: State of the dataflash				*/
+/*------------------------------------------------------------------------------*/
+AT91S_DataFlashStatus AT91F_DataFlashContinuousRead (
+	AT91PS_DataFlash pDataFlash,
+	int src,
+	unsigned char *dataBuffer,
+	int sizeToRead )
+{
+	AT91S_DataFlashStatus status;
+	/* Test the size to read in the device */
+	if ( (src + sizeToRead) > (pDataFlash->pDevice->pages_size * (pDataFlash->pDevice->pages_number)))
+		return DATAFLASH_MEMORY_OVERFLOW;
+
+	pDataFlash->pDataFlashDesc->rx_data_pt = dataBuffer;
+	pDataFlash->pDataFlashDesc->rx_data_size = sizeToRead;
+	pDataFlash->pDataFlashDesc->tx_data_pt = dataBuffer;
+	pDataFlash->pDataFlashDesc->tx_data_size = sizeToRead;
+
+	status = AT91F_DataFlashSendCommand (pDataFlash, DB_CONTINUOUS_ARRAY_READ, 8, src);
+	/* Send the command to the dataflash */
+	return(status);
+}
+
+
+/*------------------------------------------------------------------------------*/
+/* Function Name       : AT91F_DataFlashPagePgmBuf				*/
+/* Object              : Main memory page program through buffer 1 or buffer 2	*/
+/* Input Parameters    : DataFlash Service					*/
+/*						: <*src> = Source buffer	*/
+/*                     : <dest> = dataflash destination address			*/
+/*                     : <SizeToWrite> = data buffer size			*/
+/* Return value		: State of the dataflash				*/
+/*------------------------------------------------------------------------------*/
+AT91S_DataFlashStatus AT91F_DataFlashPagePgmBuf(
+	AT91PS_DataFlash pDataFlash,
+	unsigned char *src,
+	unsigned int dest,
+	unsigned int SizeToWrite)
+{
+	int cmdsize;
+	pDataFlash->pDataFlashDesc->tx_data_pt = src ;
+	pDataFlash->pDataFlashDesc->tx_data_size = SizeToWrite ;
+	pDataFlash->pDataFlashDesc->rx_data_pt = src;
+	pDataFlash->pDataFlashDesc->rx_data_size = SizeToWrite;
+
+	cmdsize = 4;
+	/* Send the command to the dataflash */
+	if (pDataFlash->pDevice->pages_number >= 16384)
+		cmdsize = 5;
+	return(AT91F_DataFlashSendCommand (pDataFlash, DB_PAGE_PGM_BUF1, cmdsize, dest));
+}
+
+
+/*------------------------------------------------------------------------------*/
+/* Function Name       : AT91F_MainMemoryToBufferTransfert			*/
+/* Object              : Read a page in the SRAM Buffer 1 or 2			*/
+/* Input Parameters    : DataFlash Service					*/
+/*                     : Page concerned						*/
+/*                     : 							*/
+/* Return value		: State of the dataflash				*/
+/*------------------------------------------------------------------------------*/
+AT91S_DataFlashStatus AT91F_MainMemoryToBufferTransfert(
+	AT91PS_DataFlash pDataFlash,
+	unsigned char BufferCommand,
+	unsigned int page)
+{
+	int cmdsize;
+	/* Test if the buffer command is legal */
+	if ((BufferCommand != DB_PAGE_2_BUF1_TRF) && (BufferCommand != DB_PAGE_2_BUF2_TRF))
+		return DATAFLASH_BAD_COMMAND;
+
+	/* no data to transmit or receive */
+	pDataFlash->pDataFlashDesc->tx_data_size = 0;
+	cmdsize = 4;
+	if (pDataFlash->pDevice->pages_number >= 16384)
+		cmdsize = 5;
+	return(AT91F_DataFlashSendCommand (pDataFlash, BufferCommand, cmdsize, page*pDataFlash->pDevice->pages_size));
+}
+
+
+/*----------------------------------------------------------------------------- */
+/* Function Name       : AT91F_DataFlashWriteBuffer				*/
+/* Object              : Write data to the internal sram buffer 1 or 2		*/
+/* Input Parameters    : DataFlash Service					*/
+/*			: <BufferCommand> = command to write buffer1 or buffer2	*/
+/*                     : <*dataBuffer> = data buffer to write			*/
+/*                     : <bufferAddress> = address in the internal buffer	*/
+/*                     : <SizeToWrite> = data buffer size			*/
+/* Return value		: State of the dataflash				*/
+/*------------------------------------------------------------------------------*/
+AT91S_DataFlashStatus AT91F_DataFlashWriteBuffer (
+	AT91PS_DataFlash pDataFlash,
+	unsigned char BufferCommand,
+	unsigned char *dataBuffer,
+	unsigned int bufferAddress,
+	int SizeToWrite )
+{
+	int cmdsize;
+	/* Test if the buffer command is legal */
+	if ((BufferCommand != DB_BUF1_WRITE) && (BufferCommand != DB_BUF2_WRITE))
+		return DATAFLASH_BAD_COMMAND;
+
+	/* buffer address must be lower than page size */
+	if (bufferAddress > pDataFlash->pDevice->pages_size)
+		return DATAFLASH_BAD_ADDRESS;
+
+	if ( (pDataFlash->pDataFlashDesc->state)  != IDLE)
+		return DATAFLASH_BUSY;
+
+	/* Send first Write Command */
+	pDataFlash->pDataFlashDesc->command[0] = BufferCommand;
+	pDataFlash->pDataFlashDesc->command[1] = 0;
+	if (pDataFlash->pDevice->pages_number >= 16384) {
+	    	pDataFlash->pDataFlashDesc->command[2] = 0;
+	    	pDataFlash->pDataFlashDesc->command[3] = (unsigned char)(((unsigned int)(bufferAddress &  pDataFlash->pDevice->byte_mask)) >> 8) ;
+	    	pDataFlash->pDataFlashDesc->command[4] = (unsigned char)((unsigned int)bufferAddress  & 0x00FF) ;
+		cmdsize = 5;
+	} else {
+	    	pDataFlash->pDataFlashDesc->command[2] = (unsigned char)(((unsigned int)(bufferAddress &  pDataFlash->pDevice->byte_mask)) >> 8) ;
+	    	pDataFlash->pDataFlashDesc->command[3] = (unsigned char)((unsigned int)bufferAddress  & 0x00FF) ;
+	    	pDataFlash->pDataFlashDesc->command[4] = 0;
+		cmdsize = 4;
+	}
+
+	pDataFlash->pDataFlashDesc->tx_cmd_pt 	 = pDataFlash->pDataFlashDesc->command ;
+	pDataFlash->pDataFlashDesc->tx_cmd_size = cmdsize ;
+	pDataFlash->pDataFlashDesc->rx_cmd_pt 	 = pDataFlash->pDataFlashDesc->command ;
+	pDataFlash->pDataFlashDesc->rx_cmd_size = cmdsize ;
+
+	pDataFlash->pDataFlashDesc->rx_data_pt 	= dataBuffer ;
+	pDataFlash->pDataFlashDesc->tx_data_pt 	= dataBuffer ;
+	pDataFlash->pDataFlashDesc->rx_data_size 	= SizeToWrite ;
+	pDataFlash->pDataFlashDesc->tx_data_size 	= SizeToWrite ;
+
+	return AT91F_SpiWrite(pDataFlash->pDataFlashDesc);
+}
+
+/*------------------------------------------------------------------------------*/
+/* Function Name       : AT91F_PageErase                                        */
+/* Object              : Erase a page 						*/
+/* Input Parameters    : DataFlash Service					*/
+/*                     : Page concerned						*/
+/*                     : 							*/
+/* Return value		: State of the dataflash				*/
+/*------------------------------------------------------------------------------*/
+AT91S_DataFlashStatus AT91F_PageErase(
+	AT91PS_DataFlash pDataFlash,
+	unsigned int page)
+{
+	int cmdsize;
+	/* Test if the buffer command is legal */
+	/* no data to transmit or receive */
+    	pDataFlash->pDataFlashDesc->tx_data_size = 0;
+
+	cmdsize = 4;
+	if (pDataFlash->pDevice->pages_number >= 16384)
+		cmdsize = 5;
+	return(AT91F_DataFlashSendCommand (pDataFlash, DB_PAGE_ERASE, cmdsize, page*pDataFlash->pDevice->pages_size));
+}
+
+
+/*------------------------------------------------------------------------------*/
+/* Function Name       : AT91F_BlockErase                                       */
+/* Object              : Erase a Block 						*/
+/* Input Parameters    : DataFlash Service					*/
+/*                     : Page concerned						*/
+/*                     : 							*/
+/* Return value		: State of the dataflash				*/
+/*------------------------------------------------------------------------------*/
+AT91S_DataFlashStatus AT91F_BlockErase(
+	AT91PS_DataFlash pDataFlash,
+	unsigned int block)
+{
+	int cmdsize;
+	/* Test if the buffer command is legal */
+	/* no data to transmit or receive */
+    	pDataFlash->pDataFlashDesc->tx_data_size = 0;
+	cmdsize = 4;
+	if (pDataFlash->pDevice->pages_number >= 16384)
+		cmdsize = 5;
+	return(AT91F_DataFlashSendCommand (pDataFlash, DB_BLOCK_ERASE,cmdsize, block*8*pDataFlash->pDevice->pages_size));
+}
+
+/*------------------------------------------------------------------------------*/
+/* Function Name       : AT91F_WriteBufferToMain				*/
+/* Object              : Write buffer to the main memory			*/
+/* Input Parameters    : DataFlash Service					*/
+/*		: <BufferCommand> = command to send to buffer1 or buffer2	*/
+/*                     : <dest> = main memory address				*/
+/* Return value		: State of the dataflash				*/
+/*------------------------------------------------------------------------------*/
+AT91S_DataFlashStatus AT91F_WriteBufferToMain (
+	AT91PS_DataFlash pDataFlash,
+	unsigned char BufferCommand,
+	unsigned int dest )
+{
+	int cmdsize;
+	/* Test if the buffer command is correct */
+	if ((BufferCommand != DB_BUF1_PAGE_PGM) &&
+	    (BufferCommand != DB_BUF1_PAGE_ERASE_PGM) &&
+	    (BufferCommand != DB_BUF2_PAGE_PGM) &&
+	    (BufferCommand != DB_BUF2_PAGE_ERASE_PGM) )
+		return DATAFLASH_BAD_COMMAND;
+
+	/* no data to transmit or receive */
+	pDataFlash->pDataFlashDesc->tx_data_size = 0;
+
+	cmdsize = 4;
+	if (pDataFlash->pDevice->pages_number >= 16384)
+		cmdsize = 5;
+	/* Send the command to the dataflash */
+	return(AT91F_DataFlashSendCommand (pDataFlash, BufferCommand, cmdsize, dest));
+}
+
+
+/*------------------------------------------------------------------------------*/
+/* Function Name       : AT91F_PartialPageWrite					*/
+/* Object              : Erase partielly a page					*/
+/* Input Parameters    : <page> = page number					*/
+/*			: <AdrInpage> = adr to begin the fading			*/
+/*                     : <length> = Number of bytes to erase			*/
+/*------------------------------------------------------------------------------*/
+AT91S_DataFlashStatus AT91F_PartialPageWrite (
+	AT91PS_DataFlash pDataFlash,
+	unsigned char *src,
+	unsigned int dest,
+	unsigned int size)
+{
+	unsigned int page;
+	unsigned int AdrInPage;
+
+	page = dest / (pDataFlash->pDevice->pages_size);
+	AdrInPage = dest % (pDataFlash->pDevice->pages_size);
+
+	/* Read the contents of the page in the Sram Buffer */
+	AT91F_MainMemoryToBufferTransfert(pDataFlash, DB_PAGE_2_BUF1_TRF, page);
+	AT91F_DataFlashWaitReady(pDataFlash->pDataFlashDesc, AT91C_TIMEOUT_WRDY);
+	/*Update the SRAM buffer */
+	AT91F_DataFlashWriteBuffer(pDataFlash, DB_BUF1_WRITE, src, AdrInPage, size);
+
+	AT91F_DataFlashWaitReady(pDataFlash->pDataFlashDesc, AT91C_TIMEOUT_WRDY);
+
+	/* Erase page if a 128 Mbits device */
+	if (pDataFlash->pDevice->pages_number >= 16384) {
+		AT91F_PageErase(pDataFlash, page);
+		/* Rewrite the modified Sram Buffer in the main memory */
+		AT91F_DataFlashWaitReady(pDataFlash->pDataFlashDesc, AT91C_TIMEOUT_WRDY);
+	}
+
+	/* Rewrite the modified Sram Buffer in the main memory */
+	return(AT91F_WriteBufferToMain(pDataFlash, DB_BUF1_PAGE_ERASE_PGM, (page*pDataFlash->pDevice->pages_size)));
+}
+
+
+/*------------------------------------------------------------------------------*/
+/* Function Name       : AT91F_DataFlashWrite					*/
+/* Object              :							*/
+/* Input Parameters    : <*src> = Source buffer					*/
+/*                     : <dest> = dataflash adress				*/
+/*                     : <size> = data buffer size				*/
+/*------------------------------------------------------------------------------*/
+AT91S_DataFlashStatus AT91F_DataFlashWrite(
+	AT91PS_DataFlash pDataFlash,
+	unsigned char *src,
+	int dest,
+	int size )
+{
+	unsigned int length;
+	unsigned int page;
+	unsigned int status;
+
+	AT91F_SpiEnable(pDataFlash->pDevice->cs);
+
+	if ( (dest + size) > (pDataFlash->pDevice->pages_size * (pDataFlash->pDevice->pages_number)))
+		return DATAFLASH_MEMORY_OVERFLOW;
+
+	/* If destination does not fit a page start address */
+	if ((dest % ((unsigned int)(pDataFlash->pDevice->pages_size)))  != 0 ) {
+		length = pDataFlash->pDevice->pages_size - (dest % ((unsigned int)(pDataFlash->pDevice->pages_size)));
+
+		if (size < length)
+			length = size;
+
+		if(!AT91F_PartialPageWrite(pDataFlash,src, dest, length))
+			return DATAFLASH_ERROR;
+
+		AT91F_DataFlashWaitReady(pDataFlash->pDataFlashDesc, AT91C_TIMEOUT_WRDY);
+
+		/* Update size, source and destination pointers */
+		size -= length;
+		dest += length;
+		src += length;
+	}
+
+	while (( size - pDataFlash->pDevice->pages_size ) >= 0 ) {
+		/* program dataflash page */
+		page = (unsigned int)dest / (pDataFlash->pDevice->pages_size);
+
+		status = AT91F_DataFlashWriteBuffer(pDataFlash, DB_BUF1_WRITE, src, 0, pDataFlash->pDevice->pages_size);
+		AT91F_DataFlashWaitReady(pDataFlash->pDataFlashDesc, AT91C_TIMEOUT_WRDY);
+
+		status = AT91F_PageErase(pDataFlash, page);
+		AT91F_DataFlashWaitReady(pDataFlash->pDataFlashDesc, AT91C_TIMEOUT_WRDY);
+		if (!status)
+			return DATAFLASH_ERROR;
+
+		status = AT91F_WriteBufferToMain (pDataFlash, DB_BUF1_PAGE_PGM, dest);
+		if(!status)
+			return DATAFLASH_ERROR;
+
+		AT91F_DataFlashWaitReady(pDataFlash->pDataFlashDesc, AT91C_TIMEOUT_WRDY);
+
+		/* Update size, source and destination pointers */
+		size -= pDataFlash->pDevice->pages_size ;
+		dest += pDataFlash->pDevice->pages_size ;
+		src  += pDataFlash->pDevice->pages_size ;
+	}
+
+	/* If still some bytes to read */
+	if ( size > 0 ) {
+		/* program dataflash page */
+		if(!AT91F_PartialPageWrite(pDataFlash, src, dest, size) )
+			return DATAFLASH_ERROR;
+
+		AT91F_DataFlashWaitReady(pDataFlash->pDataFlashDesc, AT91C_TIMEOUT_WRDY);
+	}
+	return DATAFLASH_OK;
+}
+
+
+/*------------------------------------------------------------------------------*/
+/* Function Name       : AT91F_DataFlashRead 					*/
+/* Object              : Read a block in dataflash				*/
+/* Input Parameters    : 							*/
+/* Return value		: 							*/
+/*------------------------------------------------------------------------------*/
+int AT91F_DataFlashRead(
+	AT91PS_DataFlash pDataFlash,
+	unsigned long addr,
+	unsigned long size,
+	char *buffer)
+{
+	unsigned long SizeToRead;
+
+	AT91F_SpiEnable(pDataFlash->pDevice->cs);
+
+	if(AT91F_DataFlashWaitReady(pDataFlash->pDataFlashDesc, AT91C_TIMEOUT_WRDY) != DATAFLASH_OK)
+		return -1;
+
+	while (size) {
+		SizeToRead = (size < 0x8000)? size:0x8000;
+
+		if (AT91F_DataFlashWaitReady(pDataFlash->pDataFlashDesc, AT91C_TIMEOUT_WRDY) != DATAFLASH_OK)
+			return -1;
+
+		if (AT91F_DataFlashContinuousRead (pDataFlash, addr, buffer, SizeToRead) != DATAFLASH_OK)
+			return -1;
+
+		size -= SizeToRead;
+		addr += SizeToRead;
+		buffer += SizeToRead;
+	}
+
+	return DATAFLASH_OK;
+}
+
+
+/*------------------------------------------------------------------------------*/
+/* Function Name       : AT91F_DataflashProbe 					*/
+/* Object              : 							*/
+/* Input Parameters    : 							*/
+/* Return value	       : Dataflash status register				*/
+/*------------------------------------------------------------------------------*/
+int AT91F_DataflashProbe(int cs, AT91PS_DataflashDesc pDesc)
+{
+	AT91F_SpiEnable(cs);
+	AT91F_DataFlashGetStatus(pDesc);
+	return((pDesc->command[1] == 0xFF)? 0: pDesc->command[1] & 0x3C);
+}
+
+#endif
--- a/board/cmc_pu2/cmc_pu2.c
+++ b/board/cmc_pu2/cmc_pu2.c
@@ -0,0 +1,141 @@
+/*
+ * (C) Copyright 2002
+ * Sysgo Real-Time Solutions, GmbH <www.elinos.com>
+ * Marius Groeger <mgroeger@sysgo.de>
+ *
+ * Modified for CMC_PU2 (removed Smart Media support) by Gary Jennejohn
+ * (2004) garyj@denx.de
+ *
+ * Modified for CMC_BASIC by Martin Krause (2005), TQ-Systems GmbH
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <asm/mach-types.h>
+#include <asm/arch/AT91RM9200.h>
+
+/* ------------------------------------------------------------------------- */
+/*
+ * Miscelaneous platform dependent initialisations
+ */
+#define CMC_BASIC	1
+#define CMC_PU2		2
+
+int hw_detect (void);
+
+int board_init (void)
+{
+	DECLARE_GLOBAL_DATA_PTR;
+	AT91PS_PIO piob = AT91C_BASE_PIOB;
+	AT91PS_PIO pioc = AT91C_BASE_PIOC;
+
+	/* Enable Ctrlc */
+	console_init_f ();
+
+	/* Correct IRDA resistor problem */
+	/* Set PA23_TXD in Output */
+	/* (AT91PS_PIO) AT91C_BASE_PIOA->PIO_OER = AT91C_PA23_TXD2; */
+
+	/* memory and cpu-speed are setup before relocation */
+	/* so we do _nothing_ here */
+
+	/* PIOB and PIOC clock enabling */
+	*AT91C_PMC_PCER = 1 << AT91C_ID_PIOB;
+	*AT91C_PMC_PCER = 1 << AT91C_ID_PIOC;
+
+	/*
+	 * configure PC0-PC3 as input without pull ups, so RS485 driver enable
+	 * (CMC-PU2) and digital outputs (CMC-BASIC) are deactivated.
+	 */
+	pioc->PIO_ODR = AT91C_PIO_PC0 | AT91C_PIO_PC1 |
+			AT91C_PIO_PC2 | AT91C_PIO_PC3;
+	pioc->PIO_PPUDR = AT91C_PIO_PC0 | AT91C_PIO_PC1 |
+			AT91C_PIO_PC2 | AT91C_PIO_PC3;
+	pioc->PIO_PER = AT91C_PIO_PC0 | AT91C_PIO_PC1 |
+	        	AT91C_PIO_PC2 | AT91C_PIO_PC3;
+
+	/*
+	 * On CMC-PU2 board configure PB3-PB6 to input without pull ups to
+	 * clear the duo LEDs (the external pull downs assure a proper
+	 * signal). On CMC-BASIC set PB3-PB6 to output and drive it
+	 * high, to configure current meassurement on AINx.
+	 */
+	if (hw_detect() & CMC_PU2) {
+		piob->PIO_ODR = AT91C_PIO_PB3 | AT91C_PIO_PB4 |
+				AT91C_PIO_PB5 | AT91C_PIO_PB6;
+	}
+	else if (hw_detect() & CMC_BASIC) {
+		piob->PIO_SODR = AT91C_PIO_PB3 | AT91C_PIO_PB4 |
+				AT91C_PIO_PB5 | AT91C_PIO_PB6;
+		piob->PIO_OER = AT91C_PIO_PB3 | AT91C_PIO_PB4 |
+				AT91C_PIO_PB5 | AT91C_PIO_PB6;
+	}
+	piob->PIO_PPUDR = AT91C_PIO_PB3 | AT91C_PIO_PB4 |
+			AT91C_PIO_PB5 | AT91C_PIO_PB6;
+	piob->PIO_PER = AT91C_PIO_PB3 | AT91C_PIO_PB4 |
+			AT91C_PIO_PB5 | AT91C_PIO_PB6;
+
+	/*
+	 * arch number of CMC_PU2-Board. MACH_TYPE_CMC_PU2 is not supported in
+	 * the linuxarm kernel, yet.
+	 */
+	/* gd->bd->bi_arch_number = MACH_TYPE_CMC_PU2; */
+	gd->bd->bi_arch_number = 251;
+	/* adress of boot parameters */
+	gd->bd->bi_boot_params = PHYS_SDRAM + 0x100;
+
+	return 0;
+}
+
+int dram_init (void)
+{
+	DECLARE_GLOBAL_DATA_PTR;
+
+	gd->bd->bi_dram[0].start = PHYS_SDRAM;
+	gd->bd->bi_dram[0].size = PHYS_SDRAM_SIZE;
+	return 0;
+}
+
+int checkboard (void)
+{
+	if (hw_detect() & CMC_PU2)
+		puts ("Board: CMC-PU2 (Rittal GmbH)\n");
+	else if (hw_detect() & CMC_BASIC)
+		puts ("Board: CMC-BASIC (Rittal GmbH)\n");
+	else
+		puts ("Board: unknown\n");
+	return 0;
+}
+
+int hw_detect (void)
+{
+	AT91PS_PIO pio = AT91C_BASE_PIOB;
+
+	/* PIOB clock enabling */
+	*AT91C_PMC_PCER = 1 << AT91C_ID_PIOB;
+
+	/* configure PB12 as input without pull up */
+	pio->PIO_ODR = AT91C_PIO_PB12;
+	pio->PIO_PPUDR = AT91C_PIO_PB12;
+	pio->PIO_PER = AT91C_PIO_PB12;
+
+	/* read board identification pin */
+	return ((pio->PIO_PDSR & AT91C_PIO_PB12) ? CMC_PU2 : CMC_BASIC);
+}
--- a/board/cmc_pu2/config.mk
+++ b/board/cmc_pu2/config.mk
@@ -0,0 +1,3 @@
+TEXT_BASE = 0x20F00000
+## For testing: load at 0x20100000 and "go" at 0x201000A4
+#TEXT_BASE = 0x20100000
--- a/board/cmc_pu2/dm9161.c
+++ b/board/cmc_pu2/dm9161.c
@@ -0,0 +1,243 @@
+/*
+ * (C) Copyright 2003
+ * Author : Hamid Ikdoumi (Atmel)
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <at91rm9200_net.h>
+#include <net.h>
+#include <dm9161.h>
+
+#ifdef CONFIG_DRIVER_ETHER
+
+#if (CONFIG_COMMANDS & CFG_CMD_NET)
+
+/*
+ * Name:
+ *	dm9161_IsPhyConnected
+ * Description:
+ *	Reads the 2 PHY ID registers
+ * Arguments:
+ *	p_mac - pointer to AT91S_EMAC struct
+ * Return value:
+ *	TRUE - if id read successfully
+ *	FALSE- if error
+ */
+static unsigned int dm9161_IsPhyConnected (AT91PS_EMAC p_mac)
+{
+	unsigned short Id1, Id2;
+
+	at91rm9200_EmacEnableMDIO (p_mac);
+	at91rm9200_EmacReadPhy (p_mac, DM9161_PHYID1, &Id1);
+	at91rm9200_EmacReadPhy (p_mac, DM9161_PHYID2, &Id2);
+	at91rm9200_EmacDisableMDIO (p_mac);
+
+	if ((Id1 == (DM9161_PHYID1_OUI >> 6)) &&
+		((Id2 >> 10) == (DM9161_PHYID1_OUI & DM9161_LSB_MASK)))
+		return TRUE;
+
+	return FALSE;
+}
+
+/*
+ * Name:
+ *	dm9161_GetLinkSpeed
+ * Description:
+ *	Link parallel detection status of MAC is checked and set in the
+ *	MAC configuration registers
+ * Arguments:
+ *	p_mac - pointer to MAC
+ * Return value:
+ *	TRUE - if link status set succesfully
+ *	FALSE - if link status not set
+ */
+static UCHAR dm9161_GetLinkSpeed (AT91PS_EMAC p_mac)
+{
+	unsigned short stat1, stat2;
+
+	if (!at91rm9200_EmacReadPhy (p_mac, DM9161_BMSR, &stat1))
+		return FALSE;
+
+	if (!(stat1 & DM9161_LINK_STATUS))	/* link status up? */
+		return FALSE;
+
+	if (!at91rm9200_EmacReadPhy (p_mac, DM9161_DSCSR, &stat2))
+		return FALSE;
+
+	if ((stat1 & DM9161_100BASE_TX_FD) && (stat2 & DM9161_100FDX)) {
+		/*set Emac for 100BaseTX and Full Duplex  */
+		p_mac->EMAC_CFG |= AT91C_EMAC_SPD | AT91C_EMAC_FD;
+		return TRUE;
+	}
+
+	if ((stat1 & DM9161_10BASE_T_FD) && (stat2 & DM9161_10FDX)) {
+		/*set MII for 10BaseT and Full Duplex  */
+		p_mac->EMAC_CFG = (p_mac->EMAC_CFG &
+				~(AT91C_EMAC_SPD | AT91C_EMAC_FD))
+				| AT91C_EMAC_FD;
+		return TRUE;
+	}
+
+	if ((stat1 & DM9161_100BASE_T4_HD) && (stat2 & DM9161_100HDX)) {
+		/*set MII for 100BaseTX and Half Duplex  */
+		p_mac->EMAC_CFG = (p_mac->EMAC_CFG &
+				~(AT91C_EMAC_SPD | AT91C_EMAC_FD))
+				| AT91C_EMAC_SPD;
+		return TRUE;
+	}
+
+	if ((stat1 & DM9161_10BASE_T_HD) && (stat2 & DM9161_10HDX)) {
+		/*set MII for 10BaseT and Half Duplex  */
+		p_mac->EMAC_CFG &= ~(AT91C_EMAC_SPD | AT91C_EMAC_FD);
+		return TRUE;
+	}
+	return FALSE;
+}
+
+
+/*
+ * Name:
+ *	dm9161_InitPhy
+ * Description:
+ *	MAC starts checking its link by using parallel detection and
+ *	Autonegotiation and the same is set in the MAC configuration registers
+ * Arguments:
+ *	p_mac - pointer to struct AT91S_EMAC
+ * Return value:
+ *	TRUE - if link status set succesfully
+ *	FALSE - if link status not set
+ */
+static UCHAR dm9161_InitPhy (AT91PS_EMAC p_mac)
+{
+	UCHAR ret = TRUE;
+	unsigned short IntValue;
+
+	at91rm9200_EmacEnableMDIO (p_mac);
+
+	if (!dm9161_GetLinkSpeed (p_mac)) {
+		/* Try another time */
+		ret = dm9161_GetLinkSpeed (p_mac);
+	}
+
+	/* Disable PHY Interrupts */
+	at91rm9200_EmacReadPhy (p_mac, DM9161_MDINTR, &IntValue);
+	/* clear FDX, SPD, Link, INTR masks */
+	IntValue &= ~(DM9161_FDX_MASK | DM9161_SPD_MASK |
+		      DM9161_LINK_MASK | DM9161_INTR_MASK);
+	at91rm9200_EmacWritePhy (p_mac, DM9161_MDINTR, &IntValue);
+	at91rm9200_EmacDisableMDIO (p_mac);
+
+	return (ret);
+}
+
+
+/*
+ * Name:
+ *	dm9161_AutoNegotiate
+ * Description:
+ *	MAC Autonegotiates with the partner status of same is set in the
+ *	MAC configuration registers
+ * Arguments:
+ *	dev - pointer to struct net_device
+ * Return value:
+ *	TRUE - if link status set successfully
+ *	FALSE - if link status not set
+ */
+static UCHAR dm9161_AutoNegotiate (AT91PS_EMAC p_mac, int *status)
+{
+	unsigned short value;
+	unsigned short PhyAnar;
+	unsigned short PhyAnalpar;
+
+	/* Set dm9161 control register */
+	if (!at91rm9200_EmacReadPhy (p_mac, DM9161_BMCR, &value))
+		return FALSE;
+	value &= ~DM9161_AUTONEG;	/* remove autonegotiation enable */
+	value |= DM9161_ISOLATE;	/* Electrically isolate PHY */
+	if (!at91rm9200_EmacWritePhy (p_mac, DM9161_BMCR, &value))
+		return FALSE;
+
+	/* Set the Auto_negotiation Advertisement Register */
+	/* MII advertising for Next page, 100BaseTxFD and HD, 10BaseTFD and HD, IEEE 802.3 */
+	PhyAnar = DM9161_NP | DM9161_TX_FDX | DM9161_TX_HDX |
+		  DM9161_10_FDX | DM9161_10_HDX | DM9161_AN_IEEE_802_3;
+	if (!at91rm9200_EmacWritePhy (p_mac, DM9161_ANAR, &PhyAnar))
+		return FALSE;
+
+	/* Read the Control Register     */
+	if (!at91rm9200_EmacReadPhy (p_mac, DM9161_BMCR, &value))
+		return FALSE;
+
+	value |= DM9161_SPEED_SELECT | DM9161_AUTONEG | DM9161_DUPLEX_MODE;
+	if (!at91rm9200_EmacWritePhy (p_mac, DM9161_BMCR, &value))
+		return FALSE;
+	/* Restart Auto_negotiation  */
+	value |= DM9161_RESTART_AUTONEG;
+	if (!at91rm9200_EmacWritePhy (p_mac, DM9161_BMCR, &value))
+		return FALSE;
+
+	/*check AutoNegotiate complete */
+	udelay (10000);
+	at91rm9200_EmacReadPhy (p_mac, DM9161_BMSR, &value);
+	if (!(value & DM9161_AUTONEG_COMP))
+		return FALSE;
+
+	/* Get the AutoNeg Link partner base page */
+	if (!at91rm9200_EmacReadPhy (p_mac, DM9161_ANLPAR, &PhyAnalpar))
+		return FALSE;
+
+	if ((PhyAnar & DM9161_TX_FDX) && (PhyAnalpar & DM9161_TX_FDX)) {
+		/*set MII for 100BaseTX and Full Duplex  */
+		p_mac->EMAC_CFG |= AT91C_EMAC_SPD | AT91C_EMAC_FD;
+		return TRUE;
+	}
+
+	if ((PhyAnar & DM9161_10_FDX) && (PhyAnalpar & DM9161_10_FDX)) {
+		/*set MII for 10BaseT and Full Duplex  */
+		p_mac->EMAC_CFG = (p_mac->EMAC_CFG &
+				~(AT91C_EMAC_SPD | AT91C_EMAC_FD))
+				| AT91C_EMAC_FD;
+		return TRUE;
+	}
+	return FALSE;
+}
+
+
+/*
+ * Name:
+ *	at91rm92000_GetPhyInterface
+ * Description:
+ *	Initialise the interface functions to the PHY
+ * Arguments:
+ *	None
+ * Return value:
+ *	None
+ */
+void at91rm92000_GetPhyInterface(AT91PS_PhyOps p_phyops)
+{
+	p_phyops->Init = dm9161_InitPhy;
+	p_phyops->IsPhyConnected = dm9161_IsPhyConnected;
+	p_phyops->GetLinkSpeed = dm9161_GetLinkSpeed;
+	p_phyops->AutoNegotiate = dm9161_AutoNegotiate;
+}
+
+#endif	/* CONFIG_COMMANDS & CFG_CMD_NET */
+
+#endif	/* CONFIG_DRIVER_ETHER */
--- a/board/cmc_pu2/flash.c
+++ b/board/cmc_pu2/flash.c
@@ -0,0 +1,468 @@
+/*
+ * (C) Copyright 2003-2004
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * (C) Copyright 2004
+ * Martin Krause, TQ-Systems GmbH, martin.krause@tqs.de
+ *
+ * Modified for the CMC PU2 by (C) Copyright 2004 Gary Jennejohn
+ * garyj@denx.de
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+
+#ifndef	CFG_ENV_ADDR
+#define CFG_ENV_ADDR	(CFG_FLASH_BASE + CFG_ENV_OFFSET)
+#endif
+
+flash_info_t	flash_info[CFG_MAX_FLASH_BANKS]; /* info for FLASH chips */
+
+#define FLASH_CYCLE1	0x0555
+#define FLASH_CYCLE2	0x02AA
+
+/*-----------------------------------------------------------------------
+ * Functions
+ */
+static ulong flash_get_size(vu_short *addr, flash_info_t *info);
+static void flash_reset(flash_info_t *info);
+static int write_word_amd(flash_info_t *info, vu_short *dest, ushort data);
+static flash_info_t *flash_get_info(ulong base);
+
+/*-----------------------------------------------------------------------
+ * flash_init()
+ *
+ * sets up flash_info and returns size of FLASH (bytes)
+ */
+unsigned long flash_init (void)
+{
+	unsigned long size = 0;
+	ulong flashbase = CFG_FLASH_BASE;
+
+	/* Init: no FLASHes known */
+	memset(&flash_info[0], 0, sizeof(flash_info_t));
+
+	flash_info[0].size = flash_get_size((vu_short *)flashbase, &flash_info[0]);
+
+	size = flash_info[0].size;
+
+#if CFG_MONITOR_BASE >= CFG_FLASH_BASE
+	/* monitor protection ON by default */
+	flash_protect(FLAG_PROTECT_SET,
+		      CFG_MONITOR_BASE,
+		      CFG_MONITOR_BASE+monitor_flash_len-1,
+		      flash_get_info(CFG_MONITOR_BASE));
+#endif
+
+#ifdef	CFG_ENV_IS_IN_FLASH
+	/* ENV protection ON by default */
+	flash_protect(FLAG_PROTECT_SET,
+		      CFG_ENV_ADDR,
+		      CFG_ENV_ADDR+CFG_ENV_SIZE-1,
+		      flash_get_info(CFG_ENV_ADDR));
+#endif
+
+	return size ? size : 1;
+}
+
+/*-----------------------------------------------------------------------
+ */
+static void flash_reset(flash_info_t *info)
+{
+	vu_short *base = (vu_short *)(info->start[0]);
+
+	/* Put FLASH back in read mode */
+	if ((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_INTEL)
+		*base = 0x00FF;	/* Intel Read Mode */
+	else if ((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_AMD)
+		*base = 0x00F0;	/* AMD Read Mode */
+}
+
+/*-----------------------------------------------------------------------
+ */
+
+static flash_info_t *flash_get_info(ulong base)
+{
+	int i;
+	flash_info_t * info;
+
+	info = NULL;
+	for (i = 0; i < CFG_MAX_FLASH_BANKS; i ++) {
+		info = & flash_info[i];
+		if (info->size && info->start[0] <= base &&
+		    base <= info->start[0] + info->size - 1)
+			break;
+	}
+
+	return i == CFG_MAX_FLASH_BANKS ? 0 : info;
+}
+
+/*-----------------------------------------------------------------------
+ */
+
+void flash_print_info (flash_info_t *info)
+{
+	int i;
+
+	if (info->flash_id == FLASH_UNKNOWN) {
+		printf ("missing or unknown FLASH type\n");
+		return;
+	}
+
+	switch (info->flash_id & FLASH_VENDMASK) {
+	case FLASH_MAN_AMD:	printf ("AMD ");		break;
+	case FLASH_MAN_BM:	printf ("BRIGHT MICRO ");	break;
+	case FLASH_MAN_FUJ:	printf ("FUJITSU ");		break;
+	case FLASH_MAN_SST:	printf ("SST ");		break;
+	case FLASH_MAN_STM:	printf ("STM ");		break;
+	case FLASH_MAN_INTEL:	printf ("INTEL ");		break;
+	default:		printf ("Unknown Vendor ");	break;
+	}
+
+	switch (info->flash_id & FLASH_TYPEMASK) {
+	case FLASH_S29GL064M:
+		printf ("S29GL064M-R6 (64Mbit, uniform sector size)\n");
+		break;
+	default:
+		printf ("Unknown Chip Type\n");
+		break;
+	}
+
+	printf ("  Size: %ld MB in %d Sectors\n",
+		info->size >> 20,
+		info->sector_count);
+
+	printf ("  Sector Start Addresses:");
+
+	for (i=0; i<info->sector_count; ++i) {
+		if ((i % 5) == 0) {
+			printf ("\n   ");
+		}
+		printf (" %08lX%s",
+			info->start[i],
+			info->protect[i] ? " (RO)" : "     ");
+	}
+	printf ("\n");
+	return;
+}
+
+/*-----------------------------------------------------------------------
+ */
+
+/*
+ * The following code cannot be run from FLASH!
+ */
+
+ulong flash_get_size (vu_short *addr, flash_info_t *info)
+{
+	int i;
+	ushort value;
+	ulong base = (ulong)addr;
+
+	/* Write auto select command sequence */
+	addr[FLASH_CYCLE1] = 0x00AA;	/* for AMD, Intel ignores this */
+	addr[FLASH_CYCLE2] = 0x0055;	/* for AMD, Intel ignores this */
+	addr[FLASH_CYCLE1] = 0x0090;	/* selects Intel or AMD */
+
+	/* read Manufacturer ID */
+	udelay(100);
+	value = addr[0];
+	debug ("Manufacturer ID: %04X\n", value);
+
+	switch (value) {
+
+	case (AMD_MANUFACT & 0xFFFF):
+		debug ("Manufacturer: AMD (Spansion)\n");
+		info->flash_id = FLASH_MAN_AMD;
+		break;
+
+	case (INTEL_MANUFACT & 0xFFFF):
+		debug ("Manufacturer: Intel (not supported yet)\n");
+		info->flash_id = FLASH_MAN_INTEL;
+		break;
+
+	default:
+		printf ("Unknown Manufacturer ID: %04X\n", value);
+		info->flash_id = FLASH_UNKNOWN;
+		info->sector_count = 0;
+		info->size = 0;
+		goto out;
+	}
+
+	value = addr[1];
+	debug ("Device ID: %04X\n", value);
+
+	switch (addr[1]) {
+
+	case (AMD_ID_MIRROR & 0xFFFF):
+		debug ("Mirror Bit flash: addr[14] = %08X  addr[15] = %08X\n",
+			addr[14], addr[15]);
+
+		switch(addr[14]) {
+		case (AMD_ID_GL064M_2 & 0xFFFF):
+			if (addr[15] != (AMD_ID_GL064M_3 & 0xffff)) {
+				printf ("Chip: S29GLxxxM -> unknown\n");
+				info->flash_id = FLASH_UNKNOWN;
+				info->sector_count = 0;
+				info->size = 0;
+			} else {
+				debug ("Chip: S29GL064M-R6\n");
+				info->flash_id += FLASH_S29GL064M;
+				info->sector_count = 128;
+				info->size = 0x00800000;
+				for (i = 0; i < info->sector_count; i++) {
+					info->start[i] = base;
+					base += 0x10000;
+				}
+			}
+			break;	/* => 16 MB	*/
+		default:
+			printf ("Chip: *** unknown ***\n");
+			info->flash_id = FLASH_UNKNOWN;
+			info->sector_count = 0;
+			info->size = 0;
+			break;
+		}
+		break;
+
+	default:
+		printf ("Unknown Device ID: %04X\n", value);
+		info->flash_id = FLASH_UNKNOWN;
+		info->sector_count = 0;
+		info->size = 0;
+		break;
+	}
+
+out:
+	/* Put FLASH back in read mode */
+	flash_reset(info);
+
+	return (info->size);
+}
+
+/*-----------------------------------------------------------------------
+ */
+
+int	flash_erase (flash_info_t *info, int s_first, int s_last)
+{
+	vu_short *addr = (vu_short *)(info->start[0]);
+	int flag, prot, sect, ssect, l_sect;
+	ulong now, last;
+
+	debug ("flash_erase: first: %d last: %d\n", s_first, s_last);
+
+	if ((s_first < 0) || (s_first > s_last)) {
+		if (info->flash_id == FLASH_UNKNOWN) {
+			printf ("- missing\n");
+		} else {
+			printf ("- no sectors to erase\n");
+		}
+		return 1;
+	}
+
+	if ((info->flash_id == FLASH_UNKNOWN) ||
+	    (info->flash_id > FLASH_AMD_COMP)) {
+		printf ("Can't erase unknown flash type %08lx - aborted\n",
+			info->flash_id);
+		return 1;
+	}
+
+	prot = 0;
+	for (sect=s_first; sect<=s_last; ++sect) {
+		if (info->protect[sect]) {
+			prot++;
+		}
+	}
+
+	if (prot) {
+		printf ("- Warning: %d protected sectors will not be erased!\n",
+			prot);
+	} else {
+		printf ("\n");
+	}
+
+	/* Disable interrupts which might cause a timeout here */
+	flag = disable_interrupts();
+
+	/*
+	 * Start erase on unprotected sectors.
+	 * Since the flash can erase multiple sectors with one command
+	 * we take advantage of that by doing the erase in chunks of
+	 * 3 sectors.
+	 */
+	for (sect = s_first; sect <= s_last; ) {
+		l_sect = -1;
+
+		addr[FLASH_CYCLE1] = 0x00AA;
+		addr[FLASH_CYCLE2] = 0x0055;
+		addr[FLASH_CYCLE1] = 0x0080;
+		addr[FLASH_CYCLE1] = 0x00AA;
+		addr[FLASH_CYCLE2] = 0x0055;
+
+		/* do the erase in chunks of at most 3 sectors */
+		for (ssect = 0; ssect < 3; ssect++) {
+			if ((sect + ssect) > s_last)
+				break;
+			if (info->protect[sect + ssect] == 0) {	/* not protected */
+				addr = (vu_short *)(info->start[sect + ssect]);
+				addr[0] = 0x0030;
+				l_sect = sect + ssect;
+			}
+		}
+		/* wait at least 80us - let's wait 1 ms */
+		udelay (1000);
+
+		/*
+		 * We wait for the last triggered sector
+		 */
+		if (l_sect < 0)
+			goto DONE;
+
+		reset_timer_masked ();
+		last  = 0;
+		addr = (vu_short *)(info->start[l_sect]);
+		while ((addr[0] & 0x0080) != 0x0080) {
+			if ((now = get_timer_masked ()) > CFG_FLASH_ERASE_TOUT) {
+				printf ("Timeout\n");
+				return 1;
+			}
+			/* show that we're waiting */
+			if ((now - last) > 1000) {	/* every second */
+				putc ('.');
+				last = now;
+			}
+		}
+		addr = (vu_short *)info->start[0];
+		addr[0] = 0x00F0;	/* reset bank */
+		sect += ssect;
+	}
+
+	/* re-enable interrupts if necessary */
+	if (flag)
+		enable_interrupts();
+
+DONE:
+	/* reset to read mode */
+	addr = (vu_short *)info->start[0];
+	addr[0] = 0x00F0;	/* reset bank */
+
+	printf (" done\n");
+	return 0;
+}
+
+/*-----------------------------------------------------------------------
+ * Copy memory to flash, returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ */
+
+int write_buff (flash_info_t *info, uchar *src, ulong addr, ulong cnt)
+{
+	ulong wp, data;
+	int rc;
+
+	if (addr & 1) {
+		printf ("unaligned destination not supported\n");
+		return ERR_ALIGN;
+	};
+
+	if ((int) src & 1) {
+		printf ("unaligned source not supported\n");
+		return ERR_ALIGN;
+	};
+
+	wp = addr;
+
+	while (cnt >= 2) {
+		data = *((vu_short *)src);
+		if ((rc = write_word_amd(info, (vu_short *)wp, data)) != 0) {
+printf ("write_buff 1: write_word_amd() rc=%d\n", rc);
+			return (rc);
+		}
+		src += 2;
+		wp += 2;
+		cnt -= 2;
+	}
+
+	if (cnt == 0) {
+		return (ERR_OK);
+	}
+
+	if (cnt == 1) {
+		data = (*((volatile u8 *) src)) | (*((volatile u8 *) (wp + 1)) << 8);
+		if ((rc = write_word_amd(info, (vu_short *)wp, data)) != 0) {
+printf ("write_buff 1: write_word_amd() rc=%d\n", rc);
+			return (rc);
+		}
+		src += 1;
+		wp += 1;
+		cnt -= 1;
+	}
+
+	return ERR_OK;
+}
+
+/*-----------------------------------------------------------------------
+ * Write a word to Flash for AMD FLASH
+ * A word is 16 or 32 bits, whichever the bus width of the flash bank
+ * (not an individual chip) is.
+ *
+ * returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ */
+static int write_word_amd (flash_info_t *info, vu_short *dest, ushort data)
+{
+	int flag;
+	vu_short *base;		/* first address in flash bank	*/
+
+	/* Check if Flash is (sufficiently) erased */
+	if ((*dest & data) != data) {
+		return (2);
+	}
+
+	base = (vu_short *)(info->start[0]);
+
+	/* Disable interrupts which might cause a timeout here */
+	flag = disable_interrupts();
+
+	base[FLASH_CYCLE1] = 0x00AA;	/* unlock */
+	base[FLASH_CYCLE2] = 0x0055;	/* unlock */
+	base[FLASH_CYCLE1] = 0x00A0;	/* selects program mode */
+
+	*dest = data;		/* start programming the data	*/
+
+	/* re-enable interrupts if necessary */
+	if (flag)
+		enable_interrupts();
+
+	reset_timer_masked ();
+
+	/* data polling for D7 */
+	while ((*dest & 0x0080) != (data & 0x0080)) {
+		if (get_timer_masked () > CFG_FLASH_WRITE_TOUT) {
+			*dest = 0x00F0;	/* reset bank */
+			return (1);
+		}
+	}
+	return (0);
+}
--- a/board/cmc_pu2/u-boot.lds
+++ b/board/cmc_pu2/u-boot.lds
@@ -0,0 +1,56 @@
+/*
+ * (C) Copyright 2002
+ * Gary Jennejohn, DENX Software Engineering, <gj@denx.de>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+OUTPUT_FORMAT("elf32-littlearm", "elf32-littlearm", "elf32-littlearm")
+/*OUTPUT_FORMAT("elf32-arm", "elf32-arm", "elf32-arm")*/
+OUTPUT_ARCH(arm)
+ENTRY(_start)
+SECTIONS
+{
+	. = 0x00000000;
+
+	. = ALIGN(4);
+	.text      :
+	{
+	  cpu/arm920t/start.o	(.text)
+	  *(.text)
+	}
+
+	. = ALIGN(4);
+	.rodata : { *(.rodata) }
+
+	. = ALIGN(4);
+	.data : { *(.data) }
+
+	. = ALIGN(4);
+	.got : { *(.got) }
+
+	__u_boot_cmd_start = .;
+	.u_boot_cmd : { *(.u_boot_cmd) }
+	__u_boot_cmd_end = .;
+
+	. = ALIGN(4);
+	__bss_start = .;
+	.bss : { *(.bss) }
+	_end = .;
+}
--- a/board/cobra5272/Makefile
+++ b/board/cobra5272/Makefile
--- a/board/cobra5272/bdm/cobra5272_uboot.gdb
+++ b/board/cobra5272/bdm/cobra5272_uboot.gdb
@@ -0,0 +1,169 @@
+#
+# GDB Init script for the Coldfire 5272 processor.
+#
+# The main purpose of this script is to configure the 
+# DRAM controller so code can be loaded.
+#
+# This file was changed to suite the senTec COBRA5272 board.
+# 
+
+define addresses
+
+set $mbar  = 0x10000001
+set $scr   = $mbar - 1 + 0x004
+set $spr   = $mbar - 1 + 0x006
+set $pmr   = $mbar - 1 + 0x008
+set $apmr  = $mbar - 1 + 0x00e
+set $dir   = $mbar - 1 + 0x010
+set $icr1  = $mbar - 1 + 0x020
+set $icr2  = $mbar - 1 + 0x024
+set $icr3  = $mbar - 1 + 0x028
+set $icr4  = $mbar - 1 + 0x02c
+set $isr   = $mbar - 1 + 0x030
+set $pitr  = $mbar - 1 + 0x034
+set $piwr  = $mbar - 1 + 0x038
+set $pivr  = $mbar - 1 + 0x03f
+set $csbr0 = $mbar - 1 + 0x040
+set $csor0 = $mbar - 1 + 0x044
+set $csbr1 = $mbar - 1 + 0x048
+set $csor1 = $mbar - 1 + 0x04c
+set $csbr2 = $mbar - 1 + 0x050
+set $csor2 = $mbar - 1 + 0x054
+set $csbr3 = $mbar - 1 + 0x058
+set $csor3 = $mbar - 1 + 0x05c
+set $csbr4 = $mbar - 1 + 0x060
+set $csor4 = $mbar - 1 + 0x064
+set $csbr5 = $mbar - 1 + 0x068
+set $csor5 = $mbar - 1 + 0x06c
+set $csbr6 = $mbar - 1 + 0x070
+set $csor6 = $mbar - 1 + 0x074
+set $csbr7 = $mbar - 1 + 0x078
+set $csor7 = $mbar - 1 + 0x07c
+set $pacnt = $mbar - 1 + 0x080
+set $paddr = $mbar - 1 + 0x084
+set $padat = $mbar - 1 + 0x086
+set $pbcnt = $mbar - 1 + 0x088
+set $pbddr = $mbar - 1 + 0x08c
+set $pbdat = $mbar - 1 + 0x08e
+set $pcddr = $mbar - 1 + 0x094
+set $pcdat = $mbar - 1 + 0x096
+set $pdcnt = $mbar - 1 + 0x098
+set $sdcr  = $mbar - 1 + 0x180
+set $sdtr  = $mbar - 1 + 0x184
+set $wrrr  = $mbar - 1 + 0x280
+set $wirr  = $mbar - 1 + 0x283
+set $wcr   = $mbar - 1 + 0x288
+set $wer   = $mbar - 1 + 0x28c
+
+end
+
+
+#
+# Setup system configuration
+#
+define setup-sys
+set *((unsigned short *) $scr) = 0x0003
+set *((unsigned short *) $spr) = 0xffff
+set *((unsigned char *) $pivr) = 0x4f
+end
+
+
+#
+# Setup Chip Selects (as per Motorola M5272C3 board)
+#
+define setup-cs
+
+# CS0 -- FLASH
+set *((unsigned long *) $csbr0) = 0xffe00201
+set *((unsigned long *) $csor0) = 0xffe00014
+
+# CS1 -- external bus test
+set *((unsigned long *) $csbr1) = 0x0
+set *((unsigned long *) $csor1) = 0x0
+
+# CS2 -- Optional FSRAM
+set *((unsigned long *) $csbr2) = 0x30000001
+set *((unsigned long *) $csor2) = 0xfff80000
+
+# CS3 -- not used
+set *((unsigned long *) $csbr3) = 0x0
+set *((unsigned long *) $csor3) = 0x0
+
+# CS4 --  not used
+set *((unsigned long *) $csbr4) = 0x0
+set *((unsigned long *) $csor4) = 0x0
+
+# CS5 -- PLI socket0
+set *((unsigned long *) $csbr5) = 0x0
+set *((unsigned long *) $csor5) = 0x0
+
+# CS6 -- PLI socket1
+set *((unsigned long *) $csbr6) = 0x0
+set *((unsigned long *) $csor6) = 0x0
+
+# CS7 -- SDRAM
+set *((unsigned long *) $csbr7) = 0x00000701
+set *((unsigned long *) $csor7) = 0xff00007c
+
+end
+
+
+#
+# Setup the DRAM controller.
+#
+
+define setup-dram
+set *((unsigned long *) $sdtr) = 0x0000f539
+set *((unsigned long *) $sdcr) = 0x00004211
+
+# Dummy write to start SDRAM
+set *((unsigned long *) 0) = 0
+end
+
+
+#
+# Setup for GPIO pins
+#
+define setup-ppio
+
+# PORT A -- the LED's
+set *((unsigned long *) $pacnt) = 0x00000000
+# lower 8 bits for output:
+set *((unsigned short *) $paddr) = 0xff
+# LED's off:
+set *((unsigned short *) $padat) = 0xff
+
+# PORT B
+set *((unsigned long *) $pbcnt) = 0x55554155
+set *((unsigned short *) $pbddr) = 0x0000
+set *((unsigned short *) $pbdat) = 0x17ea
+
+# PORT C
+#set *((unsigned short *) $pcddr) = 0x0000
+#set *((unsigned short *) $pcdat) = 0x1898
+
+# PORT D
+set *((unsigned long *) $pdcnt) = 0x00000000
+
+end
+
+
+#
+#	Added for uClinux-coldfire target...
+#
+target bdm /dev/bdm
+
+addresses
+setup-sys
+setup-cs
+setup-dram
+setup-ppio
+set print pretty
+set print asm-demangle
+display/i $pc
+
+
+#
+load u-boot
+set $pc=0x20000
+c
--- a/board/cobra5272/bdm/gdbinit.reset
+++ b/board/cobra5272/bdm/gdbinit.reset
@@ -0,0 +1,2 @@
+target bdm /dev/bdmcf0
+q
--- a/board/cobra5272/bdm/load-cobra_uboot
+++ b/board/cobra5272/bdm/load-cobra_uboot
@@ -0,0 +1,2 @@
+m68k-bdm-elf-gdb -n -x board/cobra5272/bdm/cobra5272_uboot.gdb u-boot
+
--- a/board/cobra5272/bdm/reset
+++ b/board/cobra5272/bdm/reset
@@ -0,0 +1,2 @@
+m68k-bdm-elf-gdb -n -x bdm/gdbinit.reset
+
--- a/board/cobra5272/cobra5272.c
+++ b/board/cobra5272/cobra5272.c
@@ -0,0 +1,55 @@
+/*
+ * (C) Copyright 2000-2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <asm/m5272.h>
+#include <asm/immap_5272.h>
+
+
+int checkboard (void)
+{
+	puts ("Board: ");
+	puts ("senTec COBRA5272 Board\n");
+	return 0;
+};
+
+long int initdram (int board_type)
+{
+	volatile sdramctrl_t *sdp = (sdramctrl_t *) (CFG_MBAR + MCFSIM_SDCR);
+
+	sdp->sdram_sdtr = 0xf539;
+	sdp->sdram_sdcr = 0x4211;
+
+	/* Dummy write to start SDRAM */
+	*((volatile unsigned long *) 0) = 0;
+
+	return CFG_SDRAM_SIZE * 1024 * 1024;
+};
+
+int testdram (void)
+{
+	/* TODO: XXX XXX XXX */
+	printf ("DRAM test not implemented!\n");
+
+	return (0);
+}
--- a/board/cobra5272/config.mk
+++ b/board/cobra5272/config.mk
@@ -0,0 +1,25 @@
+#
+# (C) Copyright 2000-2003
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+# Coldfire contribution by Bernhard Kuhn <bkuhn@metrowerks.com>
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+TEXT_BASE = 0xffe00000
--- a/board/cobra5272/flash.c
+++ b/board/cobra5272/flash.c
@@ -0,0 +1,378 @@
+/*
+ * (C) Copyright 2000-2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+
+#define PHYS_FLASH_1 CFG_FLASH_BASE
+#define FLASH_BANK_SIZE 0x200000
+
+flash_info_t flash_info[CFG_MAX_FLASH_BANKS];
+
+void flash_print_info (flash_info_t * info)
+{
+	int i;
+
+	switch (info->flash_id & FLASH_VENDMASK) {
+	case (AMD_MANUFACT & FLASH_VENDMASK):
+		printf ("AMD: ");
+		break;
+	default:
+		printf ("Unknown Vendor ");
+		break;
+	}
+
+	switch (info->flash_id & FLASH_TYPEMASK) {
+	case (AMD_ID_PL160CB & FLASH_TYPEMASK):
+		printf ("AM29PL160CB (16Mbit)\n");
+		break;
+	default:
+		printf ("Unknown Chip Type\n");
+		goto Done;
+		break;
+	}
+
+	printf ("  Size: %ld MB in %d Sectors\n",
+		info->size >> 20, info->sector_count);
+
+	printf ("  Sector Start Addresses:");
+	for (i = 0; i < info->sector_count; i++) {
+		if ((i % 5) == 0) {
+			printf ("\n   ");
+		}
+		printf (" %08lX%s", info->start[i],
+			info->protect[i] ? " (RO)" : "     ");
+	}
+	printf ("\n");
+
+Done:
+}
+
+
+unsigned long flash_init (void)
+{
+	int i, j;
+	ulong size = 0;
+
+	for (i = 0; i < CFG_MAX_FLASH_BANKS; i++) {
+		ulong flashbase = 0;
+
+		flash_info[i].flash_id =
+			(AMD_MANUFACT & FLASH_VENDMASK) |
+			(AMD_ID_PL160CB & FLASH_TYPEMASK);
+		flash_info[i].size = FLASH_BANK_SIZE;
+		flash_info[i].sector_count = CFG_MAX_FLASH_SECT;
+		memset (flash_info[i].protect, 0, CFG_MAX_FLASH_SECT);
+		if (i == 0)
+			flashbase = PHYS_FLASH_1;
+		else
+			panic ("configured to many flash banks!\n");
+
+		for (j = 0; j < flash_info[i].sector_count; j++) {
+			if (j == 0) {
+				/* 1st is 16 KiB */
+				flash_info[i].start[j] = flashbase;
+			}
+			if ((j >= 1) && (j <= 2)) {
+				/* 2nd and 3rd are 8 KiB */
+				flash_info[i].start[j] =
+					flashbase + 0x4000 + 0x2000 * (j - 1);
+			}
+			if (j == 3) {
+				/* 4th is 224 KiB */
+				flash_info[i].start[j] = flashbase + 0x8000;
+			}
+			if ((j >= 4) && (j <= 10)) {
+				/* rest is 256 KiB */
+				flash_info[i].start[j] =
+					flashbase + 0x40000 + 0x40000 * (j -
+									 4);
+			}
+		}
+		size += flash_info[i].size;
+	}
+
+	flash_protect (FLAG_PROTECT_SET,
+		       CFG_FLASH_BASE,
+		       CFG_FLASH_BASE + 0x3ffff, &flash_info[0]);
+
+	return size;
+}
+
+
+#define CMD_READ_ARRAY		0x00F0
+#define CMD_UNLOCK1		0x00AA
+#define CMD_UNLOCK2		0x0055
+#define CMD_ERASE_SETUP		0x0080
+#define CMD_ERASE_CONFIRM	0x0030
+#define CMD_PROGRAM		0x00A0
+#define CMD_UNLOCK_BYPASS	0x0020
+
+#define MEM_FLASH_ADDR1		(*(volatile u16 *)(CFG_FLASH_BASE + (0x00000555<<1)))
+#define MEM_FLASH_ADDR2		(*(volatile u16 *)(CFG_FLASH_BASE + (0x000002AA<<1)))
+
+#define BIT_ERASE_DONE		0x0080
+#define BIT_RDY_MASK		0x0080
+#define BIT_PROGRAM_ERROR	0x0020
+#define BIT_TIMEOUT		0x80000000	/* our flag */
+
+#define READY 1
+#define ERR   2
+#define TMO   4
+
+
+int flash_erase (flash_info_t * info, int s_first, int s_last)
+{
+	ulong result;
+	int iflag, cflag, prot, sect;
+	int rc = ERR_OK;
+	int chip1;
+
+	/* first look for protection bits */
+
+	if (info->flash_id == FLASH_UNKNOWN)
+		return ERR_UNKNOWN_FLASH_TYPE;
+
+	if ((s_first < 0) || (s_first > s_last)) {
+		return ERR_INVAL;
+	}
+
+	if ((info->flash_id & FLASH_VENDMASK) !=
+	    (AMD_MANUFACT & FLASH_VENDMASK)) {
+		return ERR_UNKNOWN_FLASH_VENDOR;
+	}
+
+	prot = 0;
+	for (sect = s_first; sect <= s_last; ++sect) {
+		if (info->protect[sect]) {
+			prot++;
+		}
+	}
+	if (prot)
+		return ERR_PROTECTED;
+
+	/*
+	 * Disable interrupts which might cause a timeout
+	 * here. Remember that our exception vectors are
+	 * at address 0 in the flash, and we don't want a
+	 * (ticker) exception to happen while the flash
+	 * chip is in programming mode.
+	 */
+
+	cflag = icache_status ();
+	icache_disable ();
+	iflag = disable_interrupts ();
+
+	printf ("\n");
+
+	/* Start erase on unprotected sectors */
+	for (sect = s_first; sect <= s_last && !ctrlc (); sect++) {
+		printf ("Erasing sector %2d ... ", sect);
+
+		/* arm simple, non interrupt dependent timer */
+		set_timer (0);
+
+		if (info->protect[sect] == 0) {	/* not protected */
+			volatile u16 *addr =
+				(volatile u16 *) (info->start[sect]);
+
+			MEM_FLASH_ADDR1 = CMD_UNLOCK1;
+			MEM_FLASH_ADDR2 = CMD_UNLOCK2;
+			MEM_FLASH_ADDR1 = CMD_ERASE_SETUP;
+
+			MEM_FLASH_ADDR1 = CMD_UNLOCK1;
+			MEM_FLASH_ADDR2 = CMD_UNLOCK2;
+			*addr = CMD_ERASE_CONFIRM;
+
+			/* wait until flash is ready */
+			chip1 = 0;
+
+			do {
+				result = *addr;
+
+				/* check timeout */
+				if (get_timer (0) > CFG_FLASH_ERASE_TOUT) {
+					MEM_FLASH_ADDR1 = CMD_READ_ARRAY;
+					chip1 = TMO;
+					break;
+				}
+
+				if (!chip1
+				    && (result & 0xFFFF) & BIT_ERASE_DONE)
+					chip1 = READY;
+
+			} while (!chip1);
+
+			MEM_FLASH_ADDR1 = CMD_READ_ARRAY;
+
+			if (chip1 == ERR) {
+				rc = ERR_PROG_ERROR;
+				goto outahere;
+			}
+			if (chip1 == TMO) {
+				rc = ERR_TIMOUT;
+				goto outahere;
+			}
+
+			printf ("ok.\n");
+		} else {	/* it was protected */
+
+			printf ("protected!\n");
+		}
+	}
+
+	if (ctrlc ())
+		printf ("User Interrupt!\n");
+
+      outahere:
+	/* allow flash to settle - wait 10 ms */
+	udelay (10000);
+
+	if (iflag)
+		enable_interrupts ();
+
+	if (cflag)
+		icache_enable ();
+
+	return rc;
+}
+
+
+volatile static int write_word (flash_info_t * info, ulong dest, ulong data)
+{
+	volatile u16 *addr = (volatile u16 *) dest;
+	ulong result;
+	int rc = ERR_OK;
+	int cflag, iflag;
+	int chip1;
+
+	/*
+	 * Check if Flash is (sufficiently) erased
+	 */
+	result = *addr;
+	if ((result & data) != data)
+		return ERR_NOT_ERASED;
+
+
+	/*
+	 * Disable interrupts which might cause a timeout
+	 * here. Remember that our exception vectors are
+	 * at address 0 in the flash, and we don't want a
+	 * (ticker) exception to happen while the flash
+	 * chip is in programming mode.
+	 */
+
+	cflag = icache_status ();
+	icache_disable ();
+	iflag = disable_interrupts ();
+
+	MEM_FLASH_ADDR1 = CMD_UNLOCK1;
+	MEM_FLASH_ADDR2 = CMD_UNLOCK2;
+	MEM_FLASH_ADDR1 = CMD_PROGRAM;
+	*addr = data;
+
+	/* arm simple, non interrupt dependent timer */
+	set_timer (0);
+
+	/* wait until flash is ready */
+	chip1 = 0;
+	do {
+		result = *addr;
+
+		/* check timeout */
+		if (get_timer (0) > CFG_FLASH_ERASE_TOUT) {
+			chip1 = ERR | TMO;
+			break;
+		}
+		if (!chip1 && ((result & 0x80) == (data & 0x80)))
+			chip1 = READY;
+
+	} while (!chip1);
+
+	*addr = CMD_READ_ARRAY;
+
+	if (chip1 == ERR || *addr != data)
+		rc = ERR_PROG_ERROR;
+
+	if (iflag)
+		enable_interrupts ();
+
+	if (cflag)
+		icache_enable ();
+
+	return rc;
+}
+
+
+int write_buff (flash_info_t * info, uchar * src, ulong addr, ulong cnt)
+{
+	ulong wp, data;
+	int rc;
+
+	if (addr & 1) {
+		printf ("unaligned destination not supported\n");
+		return ERR_ALIGN;
+	}
+
+#if 0
+	if (cnt & 1) {
+		printf ("odd transfer sizes not supported\n");
+		return ERR_ALIGN;
+	}
+#endif
+
+	wp = addr;
+
+	if (addr & 1) {
+		data = (*((volatile u8 *) addr) << 8) | *((volatile u8 *)
+							  src);
+		if ((rc = write_word (info, wp - 1, data)) != 0) {
+			return (rc);
+		}
+		src += 1;
+		wp += 1;
+		cnt -= 1;
+	}
+
+	while (cnt >= 2) {
+		data = *((volatile u16 *) src);
+		if ((rc = write_word (info, wp, data)) != 0) {
+			return (rc);
+		}
+		src += 2;
+		wp += 2;
+		cnt -= 2;
+	}
+
+	if (cnt == 1) {
+		data = (*((volatile u8 *) src) << 8) |
+			*((volatile u8 *) (wp + 1));
+		if ((rc = write_word (info, wp, data)) != 0) {
+			return (rc);
+		}
+		src += 1;
+		wp += 1;
+		cnt -= 1;
+	}
+
+	return ERR_OK;
+}
--- a/board/cobra5272/u-boot.lds
+++ b/board/cobra5272/u-boot.lds
@@ -0,0 +1,142 @@
+/*
+ * (C) Copyright 2000
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+OUTPUT_ARCH(m68k)
+SEARCH_DIR(/lib); SEARCH_DIR(/usr/lib); SEARCH_DIR(/usr/local/lib);
+/* Do we need any of these for elf?
+   __DYNAMIC = 0;    */
+SECTIONS
+{
+  /* Read-only sections, merged into text segment: */
+  . = + SIZEOF_HEADERS;
+  .interp : { *(.interp) }
+  .hash          : { *(.hash)		}
+  .dynsym        : { *(.dynsym)		}
+  .dynstr        : { *(.dynstr)		}
+  .rel.text      : { *(.rel.text)		}
+  .rela.text     : { *(.rela.text) 	}
+  .rel.data      : { *(.rel.data)		}
+  .rela.data     : { *(.rela.data) 	}
+  .rel.rodata    : { *(.rel.rodata) 	}
+  .rela.rodata   : { *(.rela.rodata) 	}
+  .rel.got       : { *(.rel.got)		}
+  .rela.got      : { *(.rela.got)		}
+  .rel.ctors     : { *(.rel.ctors)	}
+  .rela.ctors    : { *(.rela.ctors)	}
+  .rel.dtors     : { *(.rel.dtors)	}
+  .rela.dtors    : { *(.rela.dtors)	}
+  .rel.bss       : { *(.rel.bss)		}
+  .rela.bss      : { *(.rela.bss)		}
+  .rel.plt       : { *(.rel.plt)		}
+  .rela.plt      : { *(.rela.plt)		}
+  .init          : { *(.init)	}
+  .plt : { *(.plt) }
+  .text      :
+  {
+    /* WARNING - the following is hand-optimized to fit within	*/
+    /* the sector layout of our flash chips!	XXX FIXME XXX	*/
+    cpu/mcf52x2/start.o		(.text)
+    cpu/mcf52x2/cpu_init.o	(.text)
+    lib_m68k/traps.o		(.text)
+    cpu/mcf52x2/interrupts.o	(.text)
+    common/dlmalloc.o		(.text)
+    lib_generic/zlib.o		(.text)
+
+    . = DEFINED(env_offset) ? env_offset : .;
+    common/environment.o	(.text)
+
+    *(.text)
+    *(.fixup)
+    *(.got1)
+  }
+  _etext = .;
+  PROVIDE (etext = .);
+  .rodata    :
+  {
+    *(.rodata)
+    *(.rodata1)
+  }
+  .fini      : { *(.fini)    } =0
+  .ctors     : { *(.ctors)   }
+  .dtors     : { *(.dtors)   }
+
+  /* Read-write section, merged into data segment: */
+  . = (. + 0x00FF) & 0xFFFFFF00;
+  _erotext = .;
+  PROVIDE (erotext = .);
+
+  .reloc   :
+  {
+    __got_start = .;
+    *(.got)
+    __got_end = .;
+    _GOT2_TABLE_ = .;
+    *(.got2)
+    _FIXUP_TABLE_ = .;
+    *(.fixup)
+  }
+  __got2_entries = (_FIXUP_TABLE_ - _GOT2_TABLE_) >>2;
+  __fixup_entries = (. - _FIXUP_TABLE_)>>2;
+
+  .data    :
+  {
+    *(.data)
+    *(.data1)
+    *(.sdata)
+    *(.sdata2)
+    *(.dynamic)
+    CONSTRUCTORS
+  }
+  _edata  =  .;
+  PROVIDE (edata = .);
+
+  __u_boot_cmd_start = .;
+  .u_boot_cmd : { *(.u_boot_cmd) }
+  __u_boot_cmd_end = .;
+
+
+  __start___ex_table = .;
+  __ex_table : { *(__ex_table) }
+  __stop___ex_table = .;
+
+  . = ALIGN(256);
+  __init_begin = .;
+  .text.init : { *(.text.init) }
+  .data.init : { *(.data.init) }
+  . = ALIGN(256);
+  __init_end = .;
+
+  __bss_start = .;
+  .bss       :
+  {
+   _sbss = .;
+   *(.sbss) *(.scommon)
+   *(.dynbss)
+   *(.bss)
+   *(COMMON)
+   . = ALIGN(4);
+   _ebss = .;
+  }
+  _end = . ;
+  PROVIDE (end = .);
+}
--- a/board/cogent/mb.h
+++ b/board/cogent/mb.h
@@ -54,7 +54,7 @@
 * i.e. they are 8 bytes apart. For big endian addressing, the 8 bit register
 * will be at byte 7 (the address + 7). For little endian addressing, the
 * register will be at byte 0 (the address + 0). To learn the endianess
- * we must include <asm/byteorder.h>
+ * we must include <endian.h>
 *
 * Take the CMA102 and CMA111 motherboards as examples...
 *
@@ -230,16 +230,20 @@

 #ifndef __ASSEMBLY__

-#include <asm/byteorder.h>
+#ifdef USE_HOSTCC
+#include <endian.h>		/* avoid using private kernel header files */
+#else
+#include <asm/byteorder.h>	/* use U-Boot provided headers */
+#endif

 /* a single CMA10x motherboard i/o register */
 typedef
    struct {
-#if defined(__LITTLE_ENDIAN)
+#if __BYTE_ORDER == __LITTLE_ENDIAN
 	unsigned char value;
 #endif
 	unsigned char filler[7];
-#if defined(__BIG_ENDIAN)
+#if __BYTE_ORDER == __BIG_ENDIAN
 	unsigned char value;
 #endif
    }
@@ -357,7 +361,7 @@ cma_mb_dipsw;
 /* V360EPC PCI Bridge */
 typedef
    struct {
-#if defined(__LITTLE_ENDIAN)
+#if __BYTE_ORDER == __LITTLE_ENDIAN
 	unsigned short v3_pci_vendor;		/* 0x00 */
 	unsigned short v3_pci_device;
 	unsigned short v3_pci_cmd;		/* 0x04 */
@@ -436,7 +440,7 @@ typedef
 	unsigned long  reserved8:24;
 	unsigned long  reserved9[7];		/* 0xe4 */
 #endif
-#if defined(__BIG_ENDIAN)
+#if __BYTE_ORDER == __BIG_ENDIAN
 	unsigned short v3_pci_device;		/* 0x00 */
 	unsigned short v3_pci_vendor;
 	unsigned short v3_pci_stat;		/* 0x04 */
--- a/board/cpc45/Makefile
+++ b/board/cpc45/Makefile
@@ -25,7 +25,7 @@ include $(TOPDIR)/config.mk

 LIB	= lib$(BOARD).a

-OBJS	= $(BOARD).o flash.o plx9030.o
+OBJS	= $(BOARD).o flash.o plx9030.o pd67290.o

 $(LIB):	.depend $(OBJS)
 	$(AR) crv $@ $(OBJS)
--- a/board/cpc45/cpc45.c
+++ b/board/cpc45/cpc45.c
@@ -24,10 +24,13 @@
 #include <common.h>
 #include <mpc824x.h>
 #include <asm/processor.h>
+#include <asm/io.h>
 #include <pci.h>
+#include <i2c.h>

 int sysControlDisplay(int digit, uchar ascii_code);
 extern void Plx9030Init(void);
+extern void SPD67290Init(void);

 	/* We have to clear the initial data area here. Couldn't have done it
 	 * earlier because DRAM had not been initialized.
@@ -49,7 +52,7 @@ int checkboard(void)
 	ulong busfreq  = get_bus_freq(0);
 	char  buf[32];

-	printf("CPC45 ");
+	puts ("CPC45  ");
 /*
 	printf("Revision %d ", revision);
 */
@@ -60,44 +63,136 @@ int checkboard(void)

 long int initdram (int board_type)
 {
-	long size;
-	long new_bank0_end;
-	long mear1;
-	long emear1;
+	int m, row, col, bank, i, ref;
+	unsigned long start, end;
+	uint32_t mccr1, mccr2;
+	uint32_t mear1 = 0, emear1 = 0, msar1 = 0, emsar1 = 0;
+	uint32_t mear2 = 0, emear2 = 0, msar2 = 0, emsar2 = 0;
+	uint8_t mber = 0;
+	unsigned int tmp;

-	size = get_ram_size(CFG_SDRAM_BASE, CFG_MAX_RAM_SIZE);
+	i2c_init(CFG_I2C_SPEED, CFG_I2C_SLAVE);

-	new_bank0_end = size - 1;
-	mear1 = mpc824x_mpc107_getreg(MEAR1);
-	emear1 = mpc824x_mpc107_getreg(EMEAR1);
-	mear1 = (mear1  & 0xFFFFFF00) |
-		((new_bank0_end & MICR_ADDR_MASK) >> MICR_ADDR_SHIFT);
-	emear1 = (emear1 & 0xFFFFFF00) |
-		((new_bank0_end & MICR_ADDR_MASK) >> MICR_EADDR_SHIFT);
-	mpc824x_mpc107_setreg(MEAR1, mear1);
-	mpc824x_mpc107_setreg(EMEAR1, emear1);
+	if (i2c_reg_read (0x50, 2) != 0x04)
+		return 0;	/* Memory type */

-	return (size);
+	m = i2c_reg_read (0x50, 5);	/* # of physical banks */
+	row = i2c_reg_read (0x50, 3);	/* # of rows */
+	col = i2c_reg_read (0x50, 4);	/* # of columns */
+	bank = i2c_reg_read (0x50, 17);	/* # of logical banks */
+	ref  = i2c_reg_read (0x50, 12);	/* refresh rate / type */
+
+	CONFIG_READ_WORD(MCCR1, mccr1);
+	mccr1 &= 0xffff0000;
+
+	CONFIG_READ_WORD(MCCR2, mccr2);
+	mccr2 &= 0xffff0000;
+
+	start = CFG_SDRAM_BASE;
+	end = start + (1 << (col + row + 3) ) * bank - 1;
+
+	for (i = 0; i < m; i++) {
+		mccr1 |= ((row == 13)? 2 : (bank == 4)? 0 : 3) << i * 2;
+		if (i < 4) {
+			msar1  |= ((start >> 20) & 0xff) << i * 8;
+			emsar1 |= ((start >> 28) & 0xff) << i * 8;
+			mear1  |= ((end >> 20) & 0xff) << i * 8;
+			emear1 |= ((end >> 28) & 0xff) << i * 8;
+		} else {
+			msar2  |= ((start >> 20) & 0xff) << (i-4) * 8;
+			emsar2 |= ((start >> 28) & 0xff) << (i-4) * 8;
+			mear2  |= ((end >> 20) & 0xff) << (i-4) * 8;
+			emear2 |= ((end >> 28) & 0xff) << (i-4) * 8;
 		}
+		mber |= 1 << i;
+		start += (1 << (col + row + 3) ) * bank;
+		end += (1 << (col + row + 3) ) * bank;
+	}
+	for (; i < 8; i++) {
+		if (i < 4) {
+			msar1  |= 0xff << i * 8;
+			emsar1 |= 0x30 << i * 8;
+			mear1  |= 0xff << i * 8;
+			emear1 |= 0x30 << i * 8;
+		} else {
+			msar2  |= 0xff << (i-4) * 8;
+			emsar2 |= 0x30 << (i-4) * 8;
+			mear2  |= 0xff << (i-4) * 8;
+			emear2 |= 0x30 << (i-4) * 8;
+		}
+	}
+
+	switch(ref) {
+		case 0x00:
+		case 0x80:
+			tmp = get_bus_freq(0) / 1000000 * 15625 / 1000 - 22;
+			break;
+		case 0x01:
+		case 0x81:
+			tmp = get_bus_freq(0) / 1000000 * 3900 / 1000 - 22;
+			break;
+		case 0x02:
+		case 0x82:
+			tmp = get_bus_freq(0) / 1000000 * 7800 / 1000 - 22;
+			break;
+		case 0x03:
+		case 0x83:
+			tmp = get_bus_freq(0) / 1000000 * 31300 / 1000 - 22;
+			break;
+		case 0x04:
+		case 0x84:
+			tmp = get_bus_freq(0) / 1000000 * 62500 / 1000 - 22;
+			break;
+		case 0x05:
+		case 0x85:
+			tmp = get_bus_freq(0) / 1000000 * 125000 / 1000 - 22;
+			break;
+		default:
+			tmp = 0x512;
+			break;
+	}
+
+	CONFIG_WRITE_WORD(MCCR1, mccr1);
+	CONFIG_WRITE_WORD(MCCR2, tmp << MCCR2_REFINT_SHIFT);
+	CONFIG_WRITE_WORD(MSAR1, msar1);
+	CONFIG_WRITE_WORD(EMSAR1, emsar1);
+	CONFIG_WRITE_WORD(MEAR1, mear1);
+	CONFIG_WRITE_WORD(EMEAR1, emear1);
+	CONFIG_WRITE_WORD(MSAR2, msar2);
+	CONFIG_WRITE_WORD(EMSAR2, emsar2);
+	CONFIG_WRITE_WORD(MEAR2, mear2);
+	CONFIG_WRITE_WORD(EMEAR2, emear2);
+	CONFIG_WRITE_BYTE(MBER, mber);
+
+	return (1 << (col + row + 3) ) * bank * m;
+}
+

 /*
 * Initialize PCI Devices, report devices found.
 */
-#ifndef CONFIG_PCI_PNP

-static struct pci_config_table pci_sandpoint_config_table[] = {
-	{ PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, 0x0f, PCI_ANY_ID,
+static struct pci_config_table pci_cpc45_config_table[] = {
+#ifndef CONFIG_PCI_PNP
+	{ PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, 0x0F, PCI_ANY_ID,
 	  pci_cfgfunc_config_device, { PCI_ENET0_IOADDR,
 				       PCI_ENET0_MEMADDR,
 				       PCI_COMMAND_MEMORY | PCI_COMMAND_MASTER }},
+	{ PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, 0x0D, PCI_ANY_ID,
+	  pci_cfgfunc_config_device, { PCI_PLX9030_IOADDR,
+				       PCI_PLX9030_MEMADDR,
+				       PCI_COMMAND_MEMORY | PCI_COMMAND_MASTER }},
+	{ PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, PCI_ANY_ID, 0x0E, PCI_ANY_ID,
+	  pci_cfgfunc_config_device, { PCMCIA_IO_BASE,
+				       PCMCIA_IO_BASE,
+				       PCI_COMMAND_MEMORY | PCI_COMMAND_IO }},
+#endif /*CONFIG_PCI_PNP*/
 	{ }
 };
-#endif
-

 struct pci_controller hose = {
 #ifndef CONFIG_PCI_PNP
-	config_table: pci_sandpoint_config_table,
+	config_table: pci_cpc45_config_table,
 #endif
 };

@@ -108,6 +203,9 @@ void pci_init_board(void)
 	/* init PCI_to_LOCAL Bus BRIDGE */
 	Plx9030Init();

+	/* Clear Display */
+	DISP_CWORD = 0x0;
+
 	sysControlDisplay(0,' ');
 	sysControlDisplay(1,'C');
 	sysControlDisplay(2,'P');
@@ -130,9 +228,7 @@ void pci_init_board(void)
 * RETURNS: NA
 */

-int sysControlDisplay
-    (
-    int digit, 			/* number of digit 0..7 */
+int sysControlDisplay (int digit,	/* number of digit 0..7 */
 		       uchar ascii_code	/* ASCII code */
 		      )
 {
@@ -143,3 +239,37 @@ int sysControlDisplay

 	return (0);
 }
+
+#if (CONFIG_COMMANDS & CFG_CMD_PCMCIA)
+
+#ifdef CFG_PCMCIA_MEM_ADDR
+volatile unsigned char *pcmcia_mem = (unsigned char*)CFG_PCMCIA_MEM_ADDR;
+#endif
+
+int pcmcia_init(void)
+{
+	u_int rc;
+
+	debug ("Enable PCMCIA " PCMCIA_SLOT_MSG "\n");
+
+	rc = i82365_init();
+
+	return rc;
+}
+
+#endif	/* CFG_CMD_PCMCIA */
+
+# ifdef CONFIG_IDE_LED
+void ide_led (uchar led, uchar status)
+{
+	u_char  val;
+	/* We have one PCMCIA slot and use LED H4 for the IDE Interface */
+	val = readb(BCSR_BASE + 0x04);
+	if (status) {				/* led on */
+		val |= B_CTRL_LED0;
+	} else {
+		val &= ~B_CTRL_LED0;
+	}
+	writeb(val, BCSR_BASE + 0x04);
+}
+# endif
--- a/Show More
+++ b/Show More
				`@@ -0,0 +1,2 @@`
				`m68k-bdm-elf-gdb -n -x board/cobra5272/bdm/cobra5272_uboot.gdb u-boot`